jupyter
This commit is contained in:
parent
814aa2bd4c
commit
9c862c21bc
128
C/parser.c
128
C/parser.c
@ -1,19 +1,19 @@
|
|||||||
/*************************************************************************
|
/*************************************************************************
|
||||||
* *
|
* *
|
||||||
* YAP Prolog *
|
* YAP Prolog *
|
||||||
* *
|
* *
|
||||||
* Yap Prolog was developed at NCCUP - Universidade do Porto *
|
* Yap Prolog was developed at NCCUP - Universidade do Porto *
|
||||||
* *
|
* *
|
||||||
* Copyright L.Damas, V.S.Costa and Universidade do Porto 1985-1997 *
|
* Copyright L.Damas, V.S.Costa and Universidade do Porto 1985-1997 *
|
||||||
* *
|
* *
|
||||||
**************************************************************************
|
**************************************************************************
|
||||||
* *
|
* *
|
||||||
* File: parser.c *
|
* File: parser.c *
|
||||||
* Last rev: *
|
* Last rev: *
|
||||||
* mods: *
|
* mods: *
|
||||||
* comments: Prolog's parser *
|
* comments: Prolog's parser *
|
||||||
* *
|
* *
|
||||||
*************************************************************************/
|
*************************************************************************/
|
||||||
#ifdef SCCS
|
#ifdef SCCS
|
||||||
static char SccsId[] = "%W% %G%";
|
static char SccsId[] = "%W% %G%";
|
||||||
#endif
|
#endif
|
||||||
@ -135,10 +135,10 @@ dot with single quotes.
|
|||||||
*/
|
*/
|
||||||
|
|
||||||
#include "Yap.h"
|
#include "Yap.h"
|
||||||
|
#include "YapEval.h"
|
||||||
#include "YapHeap.h"
|
#include "YapHeap.h"
|
||||||
#include "YapText.h"
|
#include "YapText.h"
|
||||||
#include "Yatom.h"
|
#include "Yatom.h"
|
||||||
#include "YapEval.h"
|
|
||||||
#include "yapio.h"
|
#include "yapio.h"
|
||||||
/* stuff we want to use in standard YAP code */
|
/* stuff we want to use in standard YAP code */
|
||||||
#include "iopreds.h"
|
#include "iopreds.h"
|
||||||
@ -157,7 +157,9 @@ dot with single quotes.
|
|||||||
|
|
||||||
/* weak backtraking mechanism based on long_jump */
|
/* weak backtraking mechanism based on long_jump */
|
||||||
|
|
||||||
typedef struct jmp_buff_struct { sigjmp_buf JmpBuff; } JMPBUFF;
|
typedef struct jmp_buff_struct {
|
||||||
|
sigjmp_buf JmpBuff;
|
||||||
|
} JMPBUFF;
|
||||||
|
|
||||||
static void GNextToken(CACHE_TYPE1);
|
static void GNextToken(CACHE_TYPE1);
|
||||||
static void checkfor(Term, JMPBUFF *, encoding_t CACHE_TYPE);
|
static void checkfor(Term, JMPBUFF *, encoding_t CACHE_TYPE);
|
||||||
@ -165,19 +167,20 @@ static Term ParseArgs(Atom, Term, JMPBUFF *, Term, encoding_t, Term CACHE_TYPE);
|
|||||||
static Term ParseList(JMPBUFF *, encoding_t, Term CACHE_TYPE);
|
static Term ParseList(JMPBUFF *, encoding_t, Term CACHE_TYPE);
|
||||||
static Term ParseTerm(int, JMPBUFF *, encoding_t, Term CACHE_TYPE);
|
static Term ParseTerm(int, JMPBUFF *, encoding_t, Term CACHE_TYPE);
|
||||||
|
|
||||||
extern Term Yap_tokRep(void* tokptr);
|
extern Term Yap_tokRep(void *tokptr);
|
||||||
extern const char * Yap_tokText(void *tokptr);
|
extern const char *Yap_tokText(void *tokptr);
|
||||||
|
|
||||||
static void syntax_msg(const char *msg, ...) {
|
static void syntax_msg(const char *msg, ...) {
|
||||||
CACHE_REGS
|
CACHE_REGS
|
||||||
va_list ap;
|
va_list ap;
|
||||||
if (!LOCAL_ErrorMessage ||
|
if (!LOCAL_ErrorMessage ||
|
||||||
(LOCAL_Error_TYPE == SYNTAX_ERROR &&
|
(LOCAL_Error_TYPE == SYNTAX_ERROR &&
|
||||||
LOCAL_ActiveError->prologParserLine < LOCAL_tokptr->TokPos)) {
|
LOCAL_tokptr->TokPos < LOCAL_ActiveError->prologParserPos )) {
|
||||||
if (!LOCAL_ErrorMessage) {
|
if (!LOCAL_ErrorMessage) {
|
||||||
LOCAL_ErrorMessage = malloc(1024 + 1);
|
LOCAL_ErrorMessage = malloc(MAX_ERROR_MSG_SIZE + 1);
|
||||||
}
|
}
|
||||||
LOCAL_ActiveError->prologParserLine = LOCAL_tokptr->TokPos;
|
LOCAL_ActiveError->prologParserLine = LOCAL_tokptr->TokLine;
|
||||||
|
LOCAL_ActiveError->prologParserPos = LOCAL_tokptr->TokPos;
|
||||||
va_start(ap, msg);
|
va_start(ap, msg);
|
||||||
vsnprintf(LOCAL_ErrorMessage, MAX_ERROR_MSG_SIZE, msg, ap);
|
vsnprintf(LOCAL_ErrorMessage, MAX_ERROR_MSG_SIZE, msg, ap);
|
||||||
va_end(ap);
|
va_end(ap);
|
||||||
@ -226,7 +229,7 @@ static void syntax_msg(const char *msg, ...) {
|
|||||||
#define FAIL siglongjmp(FailBuff->JmpBuff, 1)
|
#define FAIL siglongjmp(FailBuff->JmpBuff, 1)
|
||||||
|
|
||||||
VarEntry *Yap_LookupVar(const char *var) /* lookup variable in variables table
|
VarEntry *Yap_LookupVar(const char *var) /* lookup variable in variables table
|
||||||
* */
|
* */
|
||||||
{
|
{
|
||||||
CACHE_REGS
|
CACHE_REGS
|
||||||
VarEntry *p;
|
VarEntry *p;
|
||||||
@ -364,7 +367,7 @@ static Term Variables(VarEntry *p, Term l USES_REGS) {
|
|||||||
|
|
||||||
Term Yap_Variables(VarEntry *p, Term l) {
|
Term Yap_Variables(VarEntry *p, Term l) {
|
||||||
CACHE_REGS
|
CACHE_REGS
|
||||||
l = Variables(LOCAL_AnonVarTable, l PASS_REGS);
|
l = Variables(LOCAL_AnonVarTable, l PASS_REGS);
|
||||||
return Variables(p, l PASS_REGS);
|
return Variables(p, l PASS_REGS);
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -468,7 +471,7 @@ inline static void checkfor(Term c, JMPBUFF *FailBuff,
|
|||||||
strncpy(s, Yap_tokText(LOCAL_tokptr), 1023);
|
strncpy(s, Yap_tokText(LOCAL_tokptr), 1023);
|
||||||
syntax_msg("line %d: expected to find "
|
syntax_msg("line %d: expected to find "
|
||||||
"\'%c....................................\', found %s",
|
"\'%c....................................\', found %s",
|
||||||
LOCAL_tokptr->TokPos, c, s);
|
LOCAL_tokptr->TokLine, c, s);
|
||||||
FAIL;
|
FAIL;
|
||||||
}
|
}
|
||||||
NextToken;
|
NextToken;
|
||||||
@ -549,12 +552,12 @@ static Term ParseArgs(Atom a, Term close, JMPBUFF *FailBuff, Term arg1,
|
|||||||
|
|
||||||
func = Yap_MkFunctor(a, 1);
|
func = Yap_MkFunctor(a, 1);
|
||||||
if (func == NULL) {
|
if (func == NULL) {
|
||||||
syntax_msg("line %d: Heap Overflow", LOCAL_tokptr->TokPos);
|
syntax_msg("line %d: Heap Overflow", LOCAL_tokptr->TokLine);
|
||||||
FAIL;
|
FAIL;
|
||||||
}
|
}
|
||||||
t = Yap_MkApplTerm(func, nargs, p);
|
t = Yap_MkApplTerm(func, nargs, p);
|
||||||
if (HR > ASP - 4096) {
|
if (HR > ASP - 4096) {
|
||||||
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokPos);
|
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokLine);
|
||||||
return TermNil;
|
return TermNil;
|
||||||
}
|
}
|
||||||
NextToken;
|
NextToken;
|
||||||
@ -564,7 +567,7 @@ static Term ParseArgs(Atom a, Term close, JMPBUFF *FailBuff, Term arg1,
|
|||||||
while (1) {
|
while (1) {
|
||||||
Term *tp = (Term *)ParserAuxSp;
|
Term *tp = (Term *)ParserAuxSp;
|
||||||
if (ParserAuxSp + 1 > LOCAL_TrailTop) {
|
if (ParserAuxSp + 1 > LOCAL_TrailTop) {
|
||||||
syntax_msg("line %d: Trail Overflow", LOCAL_tokptr->TokPos);
|
syntax_msg("line %d: Trail Overflow", LOCAL_tokptr->TokLine);
|
||||||
FAIL;
|
FAIL;
|
||||||
}
|
}
|
||||||
*tp++ = Unsigned(ParseTerm(999, FailBuff, enc, cmod PASS_REGS));
|
*tp++ = Unsigned(ParseTerm(999, FailBuff, enc, cmod PASS_REGS));
|
||||||
@ -582,12 +585,12 @@ static Term ParseArgs(Atom a, Term close, JMPBUFF *FailBuff, Term arg1,
|
|||||||
* order
|
* order
|
||||||
*/
|
*/
|
||||||
if (HR > ASP - (nargs + 1)) {
|
if (HR > ASP - (nargs + 1)) {
|
||||||
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokPos);
|
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokLine);
|
||||||
FAIL;
|
FAIL;
|
||||||
}
|
}
|
||||||
func = Yap_MkFunctor(a, nargs);
|
func = Yap_MkFunctor(a, nargs);
|
||||||
if (func == NULL) {
|
if (func == NULL) {
|
||||||
syntax_msg("line %d: Heap Overflow", LOCAL_tokptr->TokPos);
|
syntax_msg("line %d: Heap Overflow", LOCAL_tokptr->TokLine);
|
||||||
FAIL;
|
FAIL;
|
||||||
}
|
}
|
||||||
#ifdef SFUNC
|
#ifdef SFUNC
|
||||||
@ -602,7 +605,7 @@ static Term ParseArgs(Atom a, Term close, JMPBUFF *FailBuff, Term arg1,
|
|||||||
t = Yap_MkApplTerm(func, nargs, p);
|
t = Yap_MkApplTerm(func, nargs, p);
|
||||||
#endif
|
#endif
|
||||||
if (HR > ASP - 4096) {
|
if (HR > ASP - 4096) {
|
||||||
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokPos);
|
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokLine);
|
||||||
return TermNil;
|
return TermNil;
|
||||||
}
|
}
|
||||||
/* check for possible overflow against local stack */
|
/* check for possible overflow against local stack */
|
||||||
@ -611,8 +614,8 @@ static Term ParseArgs(Atom a, Term close, JMPBUFF *FailBuff, Term arg1,
|
|||||||
}
|
}
|
||||||
|
|
||||||
static Term MakeAccessor(Term t, Functor f USES_REGS) {
|
static Term MakeAccessor(Term t, Functor f USES_REGS) {
|
||||||
UInt arity = ArityOfFunctor(FunctorOfTerm(t));
|
UInt arity = ArityOfFunctor(FunctorOfTerm(t));
|
||||||
int i;
|
int i;
|
||||||
Term tf[2], tl = TermNil;
|
Term tf[2], tl = TermNil;
|
||||||
|
|
||||||
tf[1] = ArgOfTerm(1, t);
|
tf[1] = ArgOfTerm(1, t);
|
||||||
@ -638,7 +641,7 @@ loop:
|
|||||||
/* check for possible overflow against local stack */
|
/* check for possible overflow against local stack */
|
||||||
if (HR > ASP - 4096) {
|
if (HR > ASP - 4096) {
|
||||||
to_store[1] = TermNil;
|
to_store[1] = TermNil;
|
||||||
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokPos);
|
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokLine);
|
||||||
FAIL;
|
FAIL;
|
||||||
} else {
|
} else {
|
||||||
to_store[1] = AbsPair(HR);
|
to_store[1] = AbsPair(HR);
|
||||||
@ -653,7 +656,7 @@ loop:
|
|||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
syntax_msg("line %d: looking for symbol ',','|' got symbol '%s'",
|
syntax_msg("line %d: looking for symbol ',','|' got symbol '%s'",
|
||||||
LOCAL_tokptr->TokPos, Yap_tokText(LOCAL_tokptr));
|
LOCAL_tokptr->TokLine, Yap_tokText(LOCAL_tokptr));
|
||||||
FAIL;
|
FAIL;
|
||||||
}
|
}
|
||||||
return (o);
|
return (o);
|
||||||
@ -725,13 +728,13 @@ static Term ParseTerm(int prio, JMPBUFF *FailBuff, encoding_t enc,
|
|||||||
TRY(
|
TRY(
|
||||||
/* build appl on the heap */
|
/* build appl on the heap */
|
||||||
func = Yap_MkFunctor(AtomOfTerm(t), 1); if (func == NULL) {
|
func = Yap_MkFunctor(AtomOfTerm(t), 1); if (func == NULL) {
|
||||||
syntax_msg("line %d: Heap Overflow", LOCAL_tokptr->TokPos);
|
syntax_msg("line %d: Heap Overflow", LOCAL_tokptr->TokLine);
|
||||||
FAIL;
|
FAIL;
|
||||||
} t = ParseTerm(oprprio, FailBuff, enc, cmod PASS_REGS);
|
} t = ParseTerm(oprprio, FailBuff, enc, cmod PASS_REGS);
|
||||||
t = Yap_MkApplTerm(func, 1, &t);
|
t = Yap_MkApplTerm(func, 1, &t);
|
||||||
/* check for possible overflow against local stack */
|
/* check for possible overflow against local stack */
|
||||||
if (HR > ASP - 4096) {
|
if (HR > ASP - 4096) {
|
||||||
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokPos);
|
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokLine);
|
||||||
FAIL;
|
FAIL;
|
||||||
} curprio = opprio;
|
} curprio = opprio;
|
||||||
, break;)
|
, break;)
|
||||||
@ -762,7 +765,7 @@ static Term ParseTerm(int prio, JMPBUFF *FailBuff, encoding_t enc,
|
|||||||
break;
|
break;
|
||||||
|
|
||||||
case Error_tok:
|
case Error_tok:
|
||||||
syntax_msg("line %d: found ill-formed \"%s\"", LOCAL_tokptr->TokPos,
|
syntax_msg("line %d: found ill-formed \"%s\"", LOCAL_tokptr->TokLine,
|
||||||
Yap_tokText(LOCAL_tokptr));
|
Yap_tokText(LOCAL_tokptr));
|
||||||
FAIL;
|
FAIL;
|
||||||
|
|
||||||
@ -798,14 +801,14 @@ static Term ParseTerm(int prio, JMPBUFF *FailBuff, encoding_t enc,
|
|||||||
t = Yap_MkApplTerm(FunctorBraces, 1, &t);
|
t = Yap_MkApplTerm(FunctorBraces, 1, &t);
|
||||||
/* check for possible overflow against local stack */
|
/* check for possible overflow against local stack */
|
||||||
if (HR > ASP - 4096) {
|
if (HR > ASP - 4096) {
|
||||||
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokPos);
|
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokLine);
|
||||||
FAIL;
|
FAIL;
|
||||||
}
|
}
|
||||||
checkfor(TermEndCurlyBracket, FailBuff, enc PASS_REGS);
|
checkfor(TermEndCurlyBracket, FailBuff, enc PASS_REGS);
|
||||||
break;
|
break;
|
||||||
default:
|
default:
|
||||||
syntax_msg("line %d: unexpected ponctuation signal %s",
|
syntax_msg("line %d: unexpected ponctuation signal %s",
|
||||||
LOCAL_tokptr->TokPos, Yap_tokRep(LOCAL_tokptr));
|
LOCAL_tokptr->TokLine, Yap_tokRep(LOCAL_tokptr));
|
||||||
FAIL;
|
FAIL;
|
||||||
}
|
}
|
||||||
break;
|
break;
|
||||||
@ -896,7 +899,7 @@ static Term ParseTerm(int prio, JMPBUFF *FailBuff, encoding_t enc,
|
|||||||
NextToken;
|
NextToken;
|
||||||
break;
|
break;
|
||||||
default:
|
default:
|
||||||
syntax_msg("line %d: expected operator, got \'%s\'", LOCAL_tokptr->TokPos,
|
syntax_msg("line %d: expected operator, got \'%s\'", LOCAL_tokptr->TokLine,
|
||||||
Yap_tokText(LOCAL_tokptr));
|
Yap_tokText(LOCAL_tokptr));
|
||||||
FAIL;
|
FAIL;
|
||||||
}
|
}
|
||||||
@ -912,9 +915,8 @@ static Term ParseTerm(int prio, JMPBUFF *FailBuff, encoding_t enc,
|
|||||||
/* try parsing as infix operator */
|
/* try parsing as infix operator */
|
||||||
Volatile int oldprio = curprio;
|
Volatile int oldprio = curprio;
|
||||||
TRY3(
|
TRY3(
|
||||||
func = Yap_MkFunctor(save_opinfo, 2);
|
func = Yap_MkFunctor(save_opinfo, 2); if (func == NULL) {
|
||||||
if (func == NULL) {
|
syntax_msg("line %d: Heap Overflow", LOCAL_tokptr->TokLine);
|
||||||
syntax_msg("line %d: Heap Overflow", LOCAL_tokptr->TokPos);
|
|
||||||
FAIL;
|
FAIL;
|
||||||
} NextToken;
|
} NextToken;
|
||||||
{
|
{
|
||||||
@ -924,7 +926,7 @@ static Term ParseTerm(int prio, JMPBUFF *FailBuff, encoding_t enc,
|
|||||||
t = Yap_MkApplTerm(func, 2, args);
|
t = Yap_MkApplTerm(func, 2, args);
|
||||||
/* check for possible overflow against local stack */
|
/* check for possible overflow against local stack */
|
||||||
if (HR > ASP - 4096) {
|
if (HR > ASP - 4096) {
|
||||||
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokPos);
|
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokLine);
|
||||||
FAIL;
|
FAIL;
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
@ -937,13 +939,13 @@ static Term ParseTerm(int prio, JMPBUFF *FailBuff, encoding_t enc,
|
|||||||
/* parse as posfix operator */
|
/* parse as posfix operator */
|
||||||
Functor func = Yap_MkFunctor(AtomOfTerm(LOCAL_tokptr->TokInfo), 1);
|
Functor func = Yap_MkFunctor(AtomOfTerm(LOCAL_tokptr->TokInfo), 1);
|
||||||
if (func == NULL) {
|
if (func == NULL) {
|
||||||
syntax_msg("line %d: Heap Overflow", LOCAL_tokptr->TokPos);
|
syntax_msg("line %d: Heap Overflow", LOCAL_tokptr->TokLine);
|
||||||
FAIL;
|
FAIL;
|
||||||
}
|
}
|
||||||
t = Yap_MkApplTerm(func, 1, &t);
|
t = Yap_MkApplTerm(func, 1, &t);
|
||||||
/* check for possible overflow against local stack */
|
/* check for possible overflow against local stack */
|
||||||
if (HR > ASP - 4096) {
|
if (HR > ASP - 4096) {
|
||||||
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokPos);
|
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokLine);
|
||||||
FAIL;
|
FAIL;
|
||||||
}
|
}
|
||||||
curprio = opprio;
|
curprio = opprio;
|
||||||
@ -953,7 +955,8 @@ static Term ParseTerm(int prio, JMPBUFF *FailBuff, encoding_t enc,
|
|||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
if (LOCAL_tokptr->Tok == Ord(Ponctuation_tok)) {
|
if (LOCAL_tokptr->Tok == Ord(Ponctuation_tok)) {
|
||||||
if (LOCAL_tokptr->TokInfo == TermComma && prio >= 1000 && curprio <= 999) {
|
if (LOCAL_tokptr->TokInfo == TermComma && prio >= 1000 &&
|
||||||
|
curprio <= 999) {
|
||||||
Volatile Term args[2];
|
Volatile Term args[2];
|
||||||
NextToken;
|
NextToken;
|
||||||
args[0] = t;
|
args[0] = t;
|
||||||
@ -961,7 +964,7 @@ static Term ParseTerm(int prio, JMPBUFF *FailBuff, encoding_t enc,
|
|||||||
t = Yap_MkApplTerm(FunctorComma, 2, args);
|
t = Yap_MkApplTerm(FunctorComma, 2, args);
|
||||||
/* check for possible overflow against local stack */
|
/* check for possible overflow against local stack */
|
||||||
if (HR > ASP - 4096) {
|
if (HR > ASP - 4096) {
|
||||||
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokPos);
|
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokLine);
|
||||||
FAIL;
|
FAIL;
|
||||||
}
|
}
|
||||||
curprio = 1000;
|
curprio = 1000;
|
||||||
@ -977,7 +980,7 @@ static Term ParseTerm(int prio, JMPBUFF *FailBuff, encoding_t enc,
|
|||||||
t = Yap_MkApplTerm(FunctorVBar, 2, args);
|
t = Yap_MkApplTerm(FunctorVBar, 2, args);
|
||||||
/* check for possible overflow against local stack */
|
/* check for possible overflow against local stack */
|
||||||
if (HR > ASP - 4096) {
|
if (HR > ASP - 4096) {
|
||||||
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokPos);
|
syntax_msg("line %d: Stack Overflow", LOCAL_tokptr->TokLine);
|
||||||
FAIL;
|
FAIL;
|
||||||
}
|
}
|
||||||
curprio = opprio;
|
curprio = opprio;
|
||||||
@ -1000,18 +1003,17 @@ static Term ParseTerm(int prio, JMPBUFF *FailBuff, encoding_t enc,
|
|||||||
curprio = opprio;
|
curprio = opprio;
|
||||||
continue;
|
continue;
|
||||||
} else if (LOCAL_tokptr->TokInfo == TermBeginCurlyBracket &&
|
} else if (LOCAL_tokptr->TokInfo == TermBeginCurlyBracket &&
|
||||||
IsPosfixOp(AtomBraces, &opprio, &oplprio,
|
IsPosfixOp(AtomBraces, &opprio, &oplprio, cmod PASS_REGS) &&
|
||||||
cmod PASS_REGS) &&
|
|
||||||
opprio <= prio && oplprio >= curprio) {
|
opprio <= prio && oplprio >= curprio) {
|
||||||
t = ParseArgs(AtomBraces, TermEndCurlyBracket, FailBuff, t,
|
t = ParseArgs(AtomBraces, TermEndCurlyBracket, FailBuff, t, enc,
|
||||||
enc, cmod PASS_REGS);
|
cmod PASS_REGS);
|
||||||
t = MakeAccessor(t, FunctorBraces PASS_REGS);
|
t = MakeAccessor(t, FunctorBraces PASS_REGS);
|
||||||
curprio = opprio;
|
curprio = opprio;
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
if (LOCAL_tokptr->Tok <= Ord(String_tok)) {
|
if (LOCAL_tokptr->Tok <= Ord(String_tok)) {
|
||||||
syntax_msg("line %d: expected operator, got \'%s\'", LOCAL_tokptr->TokPos,
|
syntax_msg("line %d: expected operator, got \'%s\'", LOCAL_tokptr->TokLine,
|
||||||
Yap_tokText(LOCAL_tokptr));
|
Yap_tokText(LOCAL_tokptr));
|
||||||
FAIL;
|
FAIL;
|
||||||
}
|
}
|
||||||
@ -1022,8 +1024,8 @@ static Term ParseTerm(int prio, JMPBUFF *FailBuff, encoding_t enc,
|
|||||||
|
|
||||||
Term Yap_Parse(UInt prio, encoding_t enc, Term cmod) {
|
Term Yap_Parse(UInt prio, encoding_t enc, Term cmod) {
|
||||||
CACHE_REGS
|
CACHE_REGS
|
||||||
// ensure that if we throw an exception
|
// ensure that if we throw an exception
|
||||||
// t will be 0.
|
// t will be 0.
|
||||||
Volatile Term t = 0;
|
Volatile Term t = 0;
|
||||||
JMPBUFF FailBuff;
|
JMPBUFF FailBuff;
|
||||||
yhandle_t sls = Yap_StartSlots();
|
yhandle_t sls = Yap_StartSlots();
|
||||||
@ -1046,12 +1048,12 @@ Term Yap_Parse(UInt prio, encoding_t enc, Term cmod) {
|
|||||||
Yap_CloseSlots(sls);
|
Yap_CloseSlots(sls);
|
||||||
}
|
}
|
||||||
if (LOCAL_tokptr != NULL && LOCAL_tokptr->Tok != Ord(eot_tok)) {
|
if (LOCAL_tokptr != NULL && LOCAL_tokptr->Tok != Ord(eot_tok)) {
|
||||||
LOCAL_Error_TYPE = SYNTAX_ERROR;
|
LOCAL_Error_TYPE = SYNTAX_ERROR;
|
||||||
if (LOCAL_tokptr->TokNext) {
|
if (LOCAL_tokptr->TokNext) {
|
||||||
LOCAL_ErrorMessage = "operator misssing . ";
|
LOCAL_ErrorMessage = "bracket or operator expected.";
|
||||||
} else {
|
} else {
|
||||||
LOCAL_ErrorMessage = "term does not end on . ";
|
LOCAL_ErrorMessage = "term must end with . or EOF.";
|
||||||
}
|
}
|
||||||
t = 0;
|
t = 0;
|
||||||
}
|
}
|
||||||
if (t != 0 && LOCAL_Error_TYPE == SYNTAX_ERROR) {
|
if (t != 0 && LOCAL_Error_TYPE == SYNTAX_ERROR) {
|
||||||
|
25
C/scanner.c
25
C/scanner.c
@ -688,8 +688,7 @@ static int send_error_message(char s[]) {
|
|||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
static wchar_t read_quoted_char(int *scan_nextp,
|
static wchar_t read_quoted_char(int *scan_nextp, struct stream_desc *st) {
|
||||||
struct stream_desc *st) {
|
|
||||||
int ch;
|
int ch;
|
||||||
|
|
||||||
/* escape sequence */
|
/* escape sequence */
|
||||||
@ -1123,7 +1122,8 @@ Term Yap_scan_num(StreamDesc *inp, bool error_on) {
|
|||||||
;
|
;
|
||||||
#endif
|
#endif
|
||||||
TokEntry *tokptr = (TokEntry *)AllocScannerMemory(sizeof(TokEntry));
|
TokEntry *tokptr = (TokEntry *)AllocScannerMemory(sizeof(TokEntry));
|
||||||
tokptr->TokPos = GetCurInpPos(inp);
|
tokptr->TokLine = GetCurInpLine(inp);
|
||||||
|
tokptr->TokPos = GetCurInpPos(inp);
|
||||||
if (ch == '-') {
|
if (ch == '-') {
|
||||||
sign = -1;
|
sign = -1;
|
||||||
ch = getchr(inp);
|
ch = getchr(inp);
|
||||||
@ -1324,8 +1324,8 @@ TokEntry *Yap_tokenizer(struct stream_desc *st, bool store_comments,
|
|||||||
LOCAL_AnonVarTable = NULL;
|
LOCAL_AnonVarTable = NULL;
|
||||||
l = NULL;
|
l = NULL;
|
||||||
p = NULL; /* Just to make lint happy */
|
p = NULL; /* Just to make lint happy */
|
||||||
__android_log_print(ANDROID_LOG_INFO, "YAPDroid", "i %d", st-GLOBAL_Stream);
|
__android_log_print(ANDROID_LOG_INFO, "YAPDroid", "i %d", st - GLOBAL_Stream);
|
||||||
ch = getchr(st);
|
ch = getchr(st);
|
||||||
while (chtype(ch) == BS) {
|
while (chtype(ch) == BS) {
|
||||||
ch = getchr(st);
|
ch = getchr(st);
|
||||||
}
|
}
|
||||||
@ -1353,7 +1353,8 @@ TokEntry *Yap_tokenizer(struct stream_desc *st, bool store_comments,
|
|||||||
while (chtype(ch) == BS) {
|
while (chtype(ch) == BS) {
|
||||||
ch = getchr(st);
|
ch = getchr(st);
|
||||||
}
|
}
|
||||||
t->TokPos = GetCurInpPos(st);
|
t->TokPos = GetCurInpPos(st);
|
||||||
|
t->TokLine = GetCurInpLine(st);
|
||||||
|
|
||||||
switch (chtype(ch)) {
|
switch (chtype(ch)) {
|
||||||
|
|
||||||
@ -1472,7 +1473,8 @@ TokEntry *Yap_tokenizer(struct stream_desc *st, bool store_comments,
|
|||||||
if (cherr) {
|
if (cherr) {
|
||||||
TokEntry *e;
|
TokEntry *e;
|
||||||
t->Tok = Number_tok;
|
t->Tok = Number_tok;
|
||||||
t->TokPos = GetCurInpPos(st);
|
t->TokPos = GetCurInpPos(st);
|
||||||
|
t->TokLine = GetCurInpLine(st);
|
||||||
e = (TokEntry *)AllocScannerMemory(sizeof(TokEntry));
|
e = (TokEntry *)AllocScannerMemory(sizeof(TokEntry));
|
||||||
if (e == NULL) {
|
if (e == NULL) {
|
||||||
return TrailSpaceError(p, l);
|
return TrailSpaceError(p, l);
|
||||||
@ -1498,7 +1500,8 @@ TokEntry *Yap_tokenizer(struct stream_desc *st, bool store_comments,
|
|||||||
|
|
||||||
t->Tok = Ord(Var_tok);
|
t->Tok = Ord(Var_tok);
|
||||||
t->TokInfo = (Term)Yap_LookupVar("E");
|
t->TokInfo = (Term)Yap_LookupVar("E");
|
||||||
t->TokPos = GetCurInpPos(st);
|
t->TokPos = GetCurInpPos(st);
|
||||||
|
t->TokLine = GetCurInpLine(st);
|
||||||
e2 = (TokEntry *)AllocScannerMemory(sizeof(TokEntry));
|
e2 = (TokEntry *)AllocScannerMemory(sizeof(TokEntry));
|
||||||
if (e2 == NULL) {
|
if (e2 == NULL) {
|
||||||
return TrailSpaceError(p, l);
|
return TrailSpaceError(p, l);
|
||||||
@ -1531,7 +1534,8 @@ TokEntry *Yap_tokenizer(struct stream_desc *st, bool store_comments,
|
|||||||
if (ch == '(')
|
if (ch == '(')
|
||||||
solo_flag = FALSE;
|
solo_flag = FALSE;
|
||||||
t->TokInfo = MkAtomTerm(AtomE);
|
t->TokInfo = MkAtomTerm(AtomE);
|
||||||
t->TokPos = GetCurInpPos(st);
|
t->TokLine = GetCurInpLine(st);
|
||||||
|
t->TokPos = GetCurInpPos(st);
|
||||||
e2 = (TokEntry *)AllocScannerMemory(sizeof(TokEntry));
|
e2 = (TokEntry *)AllocScannerMemory(sizeof(TokEntry));
|
||||||
if (e2 == NULL) {
|
if (e2 == NULL) {
|
||||||
return TrailSpaceError(p, l);
|
return TrailSpaceError(p, l);
|
||||||
@ -1967,7 +1971,8 @@ TokEntry *Yap_tokenizer(struct stream_desc *st, bool store_comments,
|
|||||||
p->TokNext = e;
|
p->TokNext = e;
|
||||||
e->Tok = Error_tok;
|
e->Tok = Error_tok;
|
||||||
e->TokInfo = MkAtomTerm(Yap_LookupAtom(LOCAL_ErrorMessage));
|
e->TokInfo = MkAtomTerm(Yap_LookupAtom(LOCAL_ErrorMessage));
|
||||||
e->TokPos = GetCurInpPos(st);
|
e->TokPos = GetCurInpPos(st);
|
||||||
|
e->TokLine = GetCurInpLine(st);
|
||||||
e->TokNext = NULL;
|
e->TokNext = NULL;
|
||||||
LOCAL_ErrorMessage = NULL;
|
LOCAL_ErrorMessage = NULL;
|
||||||
p = e;
|
p = e;
|
||||||
|
@ -330,12 +330,10 @@ static const char *find_directory(YAP_init_args *iap, const char *paths[],
|
|||||||
int j = 0;
|
int j = 0;
|
||||||
while ((p = names[j++])) {
|
while ((p = names[j++])) {
|
||||||
char *io = o + s;
|
char *io = o + s;
|
||||||
printf("%s -> %s\n", inp, o);
|
|
||||||
if ((no = location(iap, p, io)) && io[0] != '\0' && Yap_Exists(o))
|
if ((no = location(iap, p, io)) && io[0] != '\0' && Yap_Exists(o))
|
||||||
return pop_output_text_stack(lvl, realpath(o, full));
|
return pop_output_text_stack(lvl, realpath(o, full));
|
||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
printf("-> %s\n", o);
|
|
||||||
return pop_output_text_stack(lvl, o);
|
return pop_output_text_stack(lvl, o);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -413,32 +413,36 @@ endif ()
|
|||||||
|
|
||||||
# rpath stuff, hopefully it works
|
# rpath stuff, hopefully it works
|
||||||
# use, i.e. don't skip the full RPATH for the build tree
|
# use, i.e. don't skip the full RPATH for the build tree
|
||||||
#SET(CMAKE_SKIP_BUILD_RPATH FALSE)
|
#SET(CMAKE_SKIP_BUILD_RPATH TRUE)
|
||||||
|
|
||||||
|
|
||||||
# when building, don't use the install RPATH already
|
# when building, don't use the install RPATH already
|
||||||
# (but later on when installing)
|
## (but later on when installing)
|
||||||
#SET(CMAKE_BUILD_WITH_INSTALL_RPATH TRUE)
|
#SET(CMAKE_BUILD_WITH_INSTALL_RPATH FALSE)
|
||||||
|
#
|
||||||
# SET(CMAKE_INSTALL_FULL_RPATH ${CMAKE_TOP_BINARY_DIR})
|
## SET(CMAKE_INSTALL_FULL_RPATH ${CMAKE_TOP_BINARY_DIR})
|
||||||
|
#
|
||||||
# add the automatically determined parts of the RPATH
|
## add the automatically determined parts of the RPATH
|
||||||
# which point to directories outside the build tree to the install RPATH
|
## which point to directories outside the build tree to the install RPATH
|
||||||
SET(CMAKE_INSTALL_RPATH_USE_LINK_PATH TRUE)
|
#SET(CMAKE_INSTALL_RPATH_USE_LINK_PATH FAlSE)
|
||||||
|
#
|
||||||
|
#
|
||||||
# the RPATH to be used when installing, but only if it's not a system directory
|
## the RPATH to be used when installing, but only if it's not a system directory
|
||||||
LIST(FIND CMAKE_PLATFORM_IMPLICIT_LINK_DIRECTORIES "${libdir}" isSystemDir)
|
#LIST(FIND CMAKE_PLATFORM_IMPLICIT_LINK_DIRECTORIES "${libdir}" isSystemDir)
|
||||||
IF("${isSystemDir}" STREQUAL "-1")
|
# IF("${isSystemDir}" STREQUAL "-1")
|
||||||
SET(CMAKE_INSTALL_RPATH ${libdir})
|
# SET(CMAKE_INSTALL_RPATH ${libdir})
|
||||||
ENDIF("${isSystemDir}" STREQUAL "-1")
|
#ENDIF("${isSystemDir}" STREQUAL "-1")
|
||||||
|
#
|
||||||
IF(NOT WIN32 AND NOT APPLE)
|
IF(NOT WIN32 AND NOT APPLE)
|
||||||
LIST(APPEND CMAKE_INSTALL_RPATH \\$ORIGIN/../lib/Yap)
|
LIST(APPEND CMAKE_INSTALL_RPATH \\$ORIGIN/../lib/Yap)
|
||||||
LIST(APPEND CMAKE_INSTALL_RPATH ${CMAKE_INSTALL_FULL_LIBDIR})
|
LIST(APPEND CMAKE_INSTALL_RPATH ${CMAKE_INSTALL_FULL_LIBDIR})
|
||||||
LIST(APPEND CMAKE_INSTALL_RPATH \\$ORIGIN/../lib)
|
LIST(APPEND CMAKE_INSTALL_RPATH \\$ORIGIN/../lib)
|
||||||
LIST(APPEND CMAKE_INSTALL_RPATH \\$ORIGIN/../../../lib)
|
LIST(APPEND CMAKE_INSTALL_RPATH \\$ORIGIN/../../../lib)
|
||||||
|
ELSE()
|
||||||
|
LIST(APPEND CMAKE_INSTALL_RPATH @loader_path/../lib/Yap)
|
||||||
|
LIST(APPEND CMAKE_INSTALL_RPATH ${CMAKE_INSTALL_FULL_LIBDIR})
|
||||||
|
LIST(APPEND CMAKE_INSTALL_RPATH @loader_path/../lib)
|
||||||
|
LIST(APPEND CMAKE_INSTALL_RPATH @loader_path/../../../lib)
|
||||||
ENDIF()
|
ENDIF()
|
||||||
|
|
||||||
# Model Specific
|
# Model Specific
|
||||||
|
@ -1031,6 +1031,8 @@ Term YAPEngine::top_level(std::string s) {
|
|||||||
ARG1 = YAP_ReadBuffer(s.data(), &tp);
|
ARG1 = YAP_ReadBuffer(s.data(), &tp);
|
||||||
ARG2 = tp;
|
ARG2 = tp;
|
||||||
ARG3 = MkVarTerm();
|
ARG3 = MkVarTerm();
|
||||||
|
if (ARG1 == 0)
|
||||||
|
YAPError(SYNTAX_ERROR);
|
||||||
YAPPredicate p = YAPPredicate(YAP_TopGoal());
|
YAPPredicate p = YAPPredicate(YAP_TopGoal());
|
||||||
YAPQuery *Q = new YAPQuery(p, 0);
|
YAPQuery *Q = new YAPQuery(p, 0);
|
||||||
Term ts[2];
|
Term ts[2];
|
||||||
|
@ -13,7 +13,7 @@ typedef enum TokenKinds {
|
|||||||
typedef struct TOKEN {
|
typedef struct TOKEN {
|
||||||
enum TokenKinds Tok;
|
enum TokenKinds Tok;
|
||||||
Term TokInfo;
|
Term TokInfo;
|
||||||
int TokPos;
|
intptr_t TokPos, TokLine;
|
||||||
struct TOKEN *TokNext;
|
struct TOKEN *TokNext;
|
||||||
} TokEntry;
|
} TokEntry;
|
||||||
|
|
||||||
|
@ -382,9 +382,14 @@ function. */
|
|||||||
#cmakedefine HAVE_FFSL ${HAVE_FFSL}
|
#cmakedefine HAVE_FFSL ${HAVE_FFSL}
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
/* Define to 1 if you have the `ffsll' function. */
|
/* Define to 1 if you have the `ftell' function. */
|
||||||
#ifndef HAVE_FFSLL
|
#ifndef HAVE_FTELL
|
||||||
#cmakedefine HAVE_FFSLL ${HAVE_FFSLL}
|
#cmakedefine HAVE_FTELL ${HAVE_FTELL}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `ftello' function. */
|
||||||
|
#ifndef HAVE_FTELLO
|
||||||
|
#cmakedefine HAVE_FTELLO ${HAVE_FTELLO}
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
/* Define to 1 if you have the `fgetpos' function. */
|
/* Define to 1 if you have the `fgetpos' function. */
|
||||||
|
@ -33,7 +33,6 @@
|
|||||||
|
|
||||||
#include <encoding.h>
|
#include <encoding.h>
|
||||||
|
|
||||||
|
|
||||||
typedef struct {
|
typedef struct {
|
||||||
dev_t st_dev; /* ID of device containing file */
|
dev_t st_dev; /* ID of device containing file */
|
||||||
mode_t st_mode; /* Mode of file (see below) */
|
mode_t st_mode; /* Mode of file (see below) */
|
||||||
@ -50,13 +49,12 @@ typedef struct {
|
|||||||
#endif
|
#endif
|
||||||
} vfs_stat;
|
} vfs_stat;
|
||||||
|
|
||||||
|
|
||||||
typedef enum vfs_flags {
|
typedef enum vfs_flags {
|
||||||
VFS_CAN_WRITE = 0x1, /// we can write to files in this space
|
VFS_CAN_WRITE = 0x1, /// we can write to files in this space
|
||||||
VFS_CAN_EXEC = 0x2, /// we can execute files in this space
|
VFS_CAN_EXEC = 0x2, /// we can execute files in this space
|
||||||
VFS_CAN_SEEK = 0x4, /// we can seek within files in this space
|
VFS_CAN_SEEK = 0x4, /// we can seek within files in this space
|
||||||
VFS_HAS_PREFIX = 0x8, /// has a prefix that identifies a file in this space
|
VFS_HAS_PREFIX = 0x8, /// has a prefix that identifies a file in this space
|
||||||
VFS_HAS_SUFFIX = 0x10, /// has a suffix that describes the file.
|
VFS_HAS_SUFFIX = 0x10, /// has a suffix that describes the file.
|
||||||
VFS_HAS_FUNCTION = 0x20 /// has a suffix that describes the file.
|
VFS_HAS_FUNCTION = 0x20 /// has a suffix that describes the file.
|
||||||
} vfs_flags_t;
|
} vfs_flags_t;
|
||||||
|
|
||||||
@ -80,27 +78,32 @@ typedef struct vfs {
|
|||||||
const char *suffix;
|
const char *suffix;
|
||||||
bool (*chDir)(struct vfs *me, const char *s);
|
bool (*chDir)(struct vfs *me, const char *s);
|
||||||
/** operations */
|
/** operations */
|
||||||
void *(*open)(struct vfs *,int sno, const char *fname, const char *io_mode); /// open an object
|
void *(*open)(struct vfs *, int sno, const char *fname,
|
||||||
|
const char *io_mode); /// open an object
|
||||||
/// in this space, usual w,r,a,b flags plus B (store in a buffer)
|
/// in this space, usual w,r,a,b flags plus B (store in a buffer)
|
||||||
bool (*close)(int sno); /// close the object
|
bool (*close)(int sno); /// close the object
|
||||||
int (*get_char)(int sno); /// get an octet to the stream
|
int (*get_char)(int sno); /// get an octet from the stream
|
||||||
|
int (*peek_char)(int sno); /// unget an octet from the stream
|
||||||
int (*put_char)(int sno, int ch); /// output an octet to the stream
|
int (*put_char)(int sno, int ch); /// output an octet to the stream
|
||||||
void (*flush)(int sno); /// flush a stream
|
void (*flush)(int sno); /// flush a stream
|
||||||
int64_t (*seek)(int sno, int64_t offset,
|
int64_t (*seek)(int sno, int64_t offset,
|
||||||
int whence); /// jump around the stream
|
int whence); /// jump around the stream
|
||||||
void *(*opendir)(struct vfs *,const char *s); /// open a directory object, if one exists
|
void *(*opendir)(struct vfs *,
|
||||||
const char *(*nextdir)(void *d); /// walk to the next entry in a directory object
|
const char *s); /// open a directory object, if one exists
|
||||||
|
const char *(*nextdir)(
|
||||||
|
void *d); /// walk to the next entry in a directory object
|
||||||
bool (*closedir)(void *d);
|
bool (*closedir)(void *d);
|
||||||
; /// close access a directory object
|
; /// close access a directory object
|
||||||
bool (*stat)(struct vfs *,const char *s,
|
bool (*stat)(struct vfs *, const char *s,
|
||||||
vfs_stat *); /// obtain size, age, permissions of a file.
|
vfs_stat *); /// obtain size, age, permissions of a file.
|
||||||
bool (*isdir)(struct vfs *,const char *s); /// verify whether is directory.
|
bool (*isdir)(struct vfs *, const char *s); /// verify whether is directory.
|
||||||
bool (*exists)(struct vfs *, const char *s); /// verify whether a file exists.
|
bool (*exists)(struct vfs *, const char *s); /// verify whether a file exists.
|
||||||
bool (*chdir)(struct vfs *,const char *s); /// set working directory (may be virtual).
|
bool (*chdir)(struct vfs *,
|
||||||
encoding_t enc; /// default file encoded.
|
const char *s); /// set working directory (may be virtual).
|
||||||
|
encoding_t enc; /// default file encoded.
|
||||||
YAP_Term (*parsers)(int sno); // a set of parsers that can read the
|
YAP_Term (*parsers)(int sno); // a set of parsers that can read the
|
||||||
// stream and generate a YAP_Term
|
// stream and generate a YAP_Term
|
||||||
int (*writers)(int ch, int sno );
|
int (*writers)(int ch, int sno);
|
||||||
/// convert a YAP_Term into this space
|
/// convert a YAP_Term into this space
|
||||||
const char *virtual_cwd;
|
const char *virtual_cwd;
|
||||||
/** VFS dep
|
/** VFS dep
|
||||||
@ -113,7 +116,8 @@ extern VFS_t *GLOBAL_VFS;
|
|||||||
|
|
||||||
extern void init_android_stream(void);
|
extern void init_android_stream(void);
|
||||||
|
|
||||||
extern void Yap_InitStdStream(int sno, unsigned int flags, FILE *file, VFS_t *vfsp);
|
extern void Yap_InitStdStream(int sno, unsigned int flags, FILE *file,
|
||||||
|
VFS_t *vfsp);
|
||||||
|
|
||||||
static inline VFS_t *vfs_owner(const char *fname) {
|
static inline VFS_t *vfs_owner(const char *fname) {
|
||||||
VFS_t *me = GLOBAL_VFS;
|
VFS_t *me = GLOBAL_VFS;
|
||||||
@ -124,12 +128,13 @@ static inline VFS_t *vfs_owner(const char *fname) {
|
|||||||
bool p = true;
|
bool p = true;
|
||||||
if ((me->vflags & VFS_HAS_PREFIX) && p) {
|
if ((me->vflags & VFS_HAS_PREFIX) && p) {
|
||||||
const char *r = fname, *s = me->prefix;
|
const char *r = fname, *s = me->prefix;
|
||||||
while (*s && p) p = *s++ == *r++;
|
while (*s && p)
|
||||||
if (p && r > fname+1)
|
p = *s++ == *r++;
|
||||||
return me;
|
if (p && r > fname + 1)
|
||||||
|
return me;
|
||||||
}
|
}
|
||||||
if (me->vflags & VFS_HAS_SUFFIX && (sz = strlen(me->suffix)) && (d = (sz0 - sz)) >= 0 &&
|
if (me->vflags & VFS_HAS_SUFFIX && (sz = strlen(me->suffix)) &&
|
||||||
strcmp(fname + d, me->suffix) == 0) {
|
(d = (sz0 - sz)) >= 0 && strcmp(fname + d, me->suffix) == 0) {
|
||||||
return me;
|
return me;
|
||||||
}
|
}
|
||||||
me = me->next;
|
me = me->next;
|
||||||
|
@ -1,17 +1,16 @@
|
|||||||
/*************************************************************************
|
/*************************************************************************
|
||||||
* *
|
* *
|
||||||
* YAP Prolog %W% %G% *
|
* YAP Prolog %W% %G% *
|
||||||
* Yap Prolog was developed at NCCUP - Universidade do Porto *
|
* Yap Prolog was developed at NCCUP - Universidade do Porto *
|
||||||
* *
|
* *
|
||||||
* Copyright L.Damas, V.S.Costa and Universidade do Porto 1985-1997 *
|
* Copyright L.Damas, V.S.Costa and Universidade do Porto 1985-1997 *
|
||||||
* *
|
* *
|
||||||
**************************************************************************
|
**************************************************************************
|
||||||
* *
|
* *
|
||||||
* File: YapError.h *
|
* File: YapError.h * mods:
|
||||||
* mods: *
|
** comments: error header file for YAP *
|
||||||
* comments: error header file for YAP *
|
* version: $Id: Yap.h,v 1.38 2008-06-18 10:02:27 vsc Exp $ *
|
||||||
* version: $Id: Yap.h,v 1.38 2008-06-18 10:02:27 vsc Exp $ *
|
*************************************************************************/
|
||||||
*************************************************************************/
|
|
||||||
|
|
||||||
#ifndef YAP_ERROR_H
|
#ifndef YAP_ERROR_H
|
||||||
#define YAP_ERROR_H 1
|
#define YAP_ERROR_H 1
|
||||||
@ -42,21 +41,20 @@ struct yami *Yap_Error__(const char *file, const char *function, int lineno,
|
|||||||
yap_error_number err, YAP_Term wheret, ...);
|
yap_error_number err, YAP_Term wheret, ...);
|
||||||
|
|
||||||
void Yap_ThrowError__(const char *file, const char *function, int lineno,
|
void Yap_ThrowError__(const char *file, const char *function, int lineno,
|
||||||
yap_error_number err, YAP_Term wheret, ...)
|
yap_error_number err, YAP_Term wheret, ...)
|
||||||
#ifndef MSC_VER
|
#ifndef MSC_VER
|
||||||
__attribute__ ((noreturn))
|
__attribute__((noreturn))
|
||||||
#endif
|
#endif
|
||||||
;
|
;
|
||||||
|
|
||||||
|
|
||||||
#define Yap_NilError(id, ...) \
|
#define Yap_NilError(id, ...) \
|
||||||
Yap_Error__(__FILE__, __FUNCTION__, __LINE__, id, TermNil, __VA_ARGS__)
|
Yap_Error__(__FILE__, __FUNCTION__, __LINE__, id, TermNil, __VA_ARGS__)
|
||||||
|
|
||||||
#define Yap_Error(id, inp, ...) \
|
#define Yap_Error(id, inp, ...) \
|
||||||
Yap_Error__(__FILE__, __FUNCTION__, __LINE__, id, inp, __VA_ARGS__)
|
Yap_Error__(__FILE__, __FUNCTION__, __LINE__, id, inp, __VA_ARGS__)
|
||||||
|
|
||||||
#define Yap_ThrowError(id, inp, ...) \
|
#define Yap_ThrowError(id, inp, ...) \
|
||||||
Yap_ThrowError__(__FILE__, __FUNCTION__, __LINE__, id, inp, __VA_ARGS__)
|
Yap_ThrowError__(__FILE__, __FUNCTION__, __LINE__, id, inp, __VA_ARGS__)
|
||||||
|
|
||||||
#ifdef YAP_TERM_H
|
#ifdef YAP_TERM_H
|
||||||
/**
|
/**
|
||||||
@ -183,10 +181,10 @@ INLINE_ONLY extern inline Term Yap_ensure_atom__(const char *fu, const char *fi,
|
|||||||
uintptr_t prologPredLine;
|
uintptr_t prologPredLine;
|
||||||
uintptr_t prologPredFirstLine;
|
uintptr_t prologPredFirstLine;
|
||||||
uintptr_t prologPredLastLine;
|
uintptr_t prologPredLastLine;
|
||||||
const char * prologPredName;
|
const char *prologPredName;
|
||||||
uintptr_t prologPredArity;
|
uintptr_t prologPredArity;
|
||||||
const char * prologPredModule;
|
const char *prologPredModule;
|
||||||
const char * prologPredFile;
|
const char *prologPredFile;
|
||||||
void *errorGoal;
|
void *errorGoal;
|
||||||
struct error_prolog_source *errorParent;
|
struct error_prolog_source *errorParent;
|
||||||
} yap_error_prolog_source_t;
|
} yap_error_prolog_source_t;
|
||||||
@ -195,8 +193,8 @@ INLINE_ONLY extern inline Term Yap_ensure_atom__(const char *fu, const char *fi,
|
|||||||
typedef struct s_yap_error_descriptor {
|
typedef struct s_yap_error_descriptor {
|
||||||
enum yap_error_status status;
|
enum yap_error_status status;
|
||||||
yap_error_class_number errorClass;
|
yap_error_class_number errorClass;
|
||||||
const char * errorAsText;
|
const char *errorAsText;
|
||||||
const char * classAsText;
|
const char *classAsText;
|
||||||
yap_error_number errorNo;
|
yap_error_number errorNo;
|
||||||
intptr_t errorLine;
|
intptr_t errorLine;
|
||||||
const char *errorFunction;
|
const char *errorFunction;
|
||||||
@ -206,15 +204,16 @@ INLINE_ONLY extern inline Term Yap_ensure_atom__(const char *fu, const char *fi,
|
|||||||
uintptr_t prologPredLine;
|
uintptr_t prologPredLine;
|
||||||
uintptr_t prologPredFirstLine;
|
uintptr_t prologPredFirstLine;
|
||||||
uintptr_t prologPredLastLine;
|
uintptr_t prologPredLastLine;
|
||||||
const char * prologPredName;
|
const char *prologPredName;
|
||||||
uintptr_t prologPredArity;
|
uintptr_t prologPredArity;
|
||||||
const char * prologPredModule;
|
const char *prologPredModule;
|
||||||
const char * prologPredFile;
|
const char *prologPredFile;
|
||||||
|
uintptr_t prologParserPos;
|
||||||
uintptr_t prologParserLine;
|
uintptr_t prologParserLine;
|
||||||
uintptr_t prologParserFirstLine;
|
uintptr_t prologParserFirstLine;
|
||||||
uintptr_t prologParserLastLine;
|
uintptr_t prologParserLastLine;
|
||||||
const char * prologParserName;
|
const char *prologParserText;
|
||||||
const char * prologParserFile;
|
const char *prologParserFile;
|
||||||
bool prologConsulting;
|
bool prologConsulting;
|
||||||
void *errorTerm;
|
void *errorTerm;
|
||||||
uintptr_t rawErrorTerm, rawExtraErrorTerm;
|
uintptr_t rawErrorTerm, rawExtraErrorTerm;
|
||||||
|
@ -65,6 +65,16 @@ typedef struct yap_io_position {
|
|||||||
intptr_t reserved[2]; /* future extensions */
|
intptr_t reserved[2]; /* future extensions */
|
||||||
} yapIOPOS;
|
} yapIOPOS;
|
||||||
|
|
||||||
|
typedef struct yapchlookahead {
|
||||||
|
intptr_t charcount; /* character position in file */
|
||||||
|
intptr_t linecount; /* lineno in file */
|
||||||
|
intptr_t linepos; /* position in line */
|
||||||
|
intptr_t ch; /* future extensions */
|
||||||
|
struct yapchlookahead *next;
|
||||||
|
} yapStreamLookahead;
|
||||||
|
|
||||||
|
extern int PopCode(int sno);
|
||||||
|
|
||||||
#ifndef _PL_STREAM_H
|
#ifndef _PL_STREAM_H
|
||||||
typedef struct {
|
typedef struct {
|
||||||
YAP_Atom file; /* current source file */
|
YAP_Atom file; /* current source file */
|
||||||
@ -244,6 +254,7 @@ typedef struct stream_desc {
|
|||||||
int); /* function the stream uses for parser. It may be different
|
int); /* function the stream uses for parser. It may be different
|
||||||
from above if the ISO character conversion is on */
|
from above if the ISO character conversion is on */
|
||||||
encoding_t encoding; /** current encoding for stream */
|
encoding_t encoding; /** current encoding for stream */
|
||||||
|
struct yapchlookahead *recbs; /// support arbitrary depth peek
|
||||||
} StreamDesc;
|
} StreamDesc;
|
||||||
|
|
||||||
#endif
|
#endif
|
||||||
|
@ -222,6 +222,8 @@ X_API int PL_get_nchars(term_t l, size_t *lengthp, char **s, unsigned flags) {
|
|||||||
if (s) {
|
if (s) {
|
||||||
size_t len = strlen(out.val.c);
|
size_t len = strlen(out.val.c);
|
||||||
if (flags & (BUF_DISCARDABLE | BUF_RING)) {
|
if (flags & (BUF_DISCARDABLE | BUF_RING)) {
|
||||||
|
strncpy(LOCAL_FileNameBuf, out.val.c, YAP_FILENAME_MAX);
|
||||||
|
*s = LOCAL_FileNameBuf;
|
||||||
pop_text_stack(lvl);
|
pop_text_stack(lvl);
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
@ -707,10 +709,12 @@ X_API int PL_get_functor(term_t ts, functor_t *f) {
|
|||||||
*f = t;
|
*f = t;
|
||||||
} else if (IsPairTerm(t)) {
|
} else if (IsPairTerm(t)) {
|
||||||
*f = FunctorToSWIFunctor(FunctorDot);
|
*f = FunctorToSWIFunctor(FunctorDot);
|
||||||
} else {
|
} else if (IsApplTerm(t) && !IsExtensionFunctor(FunctorOfTerm(t))) {
|
||||||
*f = FunctorToSWIFunctor(FunctorOfTerm(t));
|
*f = FunctorToSWIFunctor(FunctorOfTerm(t));
|
||||||
|
} else {
|
||||||
|
return false;
|
||||||
}
|
}
|
||||||
return 1;
|
return true;
|
||||||
}
|
}
|
||||||
|
|
||||||
/** @brief *f is assigned the floating point number of term ts, or the
|
/** @brief *f is assigned the floating point number of term ts, or the
|
||||||
|
@ -3,9 +3,9 @@
|
|||||||
|
|
||||||
(function(mod) {
|
(function(mod) {
|
||||||
if (typeof exports == "object" && typeof module == "object") // CommonJS
|
if (typeof exports == "object" && typeof module == "object") // CommonJS
|
||||||
mod(require("../../lib/codemirror"));
|
mod(require("codemirror/lib/codemirror"));
|
||||||
else if (typeof define == "function" && define.amd) // AMD
|
else if (typeof define == "function" && define.amd) // AMD
|
||||||
define([ "../../lib/codemirror" ], mod);
|
define([ "codemirror/lib/codemirror" ], mod);
|
||||||
else // Plain browser env
|
else // Plain browser env
|
||||||
mod(CodeMirror);
|
mod(CodeMirror);
|
||||||
})(function(CodeMirror) {
|
})(function(CodeMirror) {
|
||||||
@ -205,7 +205,7 @@ CodeMirror.defineMode("prolog", function(cm_config, parserConfig) {
|
|||||||
});
|
});
|
||||||
delete state.tagName;
|
delete state.tagName;
|
||||||
delete state.tagColumn;
|
delete state.tagColumn;
|
||||||
return ret("dict_open", null);
|
return ret("dict_open", "bracket");
|
||||||
}
|
}
|
||||||
|
|
||||||
if (ch == "/" && stream.eat("*"))
|
if (ch == "/" && stream.eat("*"))
|
||||||
@ -225,7 +225,7 @@ CodeMirror.defineMode("prolog", function(cm_config, parserConfig) {
|
|||||||
break;
|
break;
|
||||||
case "]":
|
case "]":
|
||||||
state.nesting.pop();
|
state.nesting.pop();
|
||||||
return ret("list_close", null);
|
return ret("list_close", "bracket");
|
||||||
case "}": {
|
case "}": {
|
||||||
var nest = nesting(state);
|
var nest = nesting(state);
|
||||||
var type = (nest && nest.tag) ? "dict_close" : "brace_term_close";
|
var type = (nest && nest.tag) ? "dict_close" : "brace_term_close";
|
||||||
@ -251,30 +251,30 @@ CodeMirror.defineMode("prolog", function(cm_config, parserConfig) {
|
|||||||
closeColumn : stream.column(),
|
closeColumn : stream.column(),
|
||||||
alignment : stream.column() + 2
|
alignment : stream.column() + 2
|
||||||
});
|
});
|
||||||
return ret("list_open", null);
|
return ret("list_open", "bracket");
|
||||||
break;
|
break;
|
||||||
case "{":
|
case "{":
|
||||||
if (config.quasiQuotations && stream.eat("|")) {
|
if (config.quasiQuotations && stream.eat("|")) {
|
||||||
state.nesting.push(
|
state.nesting.push(
|
||||||
{type : "quasi-quotation", alignment : stream.column() + 1});
|
{type : "quasi-quotation", alignment : stream.column() + 1});
|
||||||
return ret("qq_open", "qq_open");
|
return ret("qq_open", "bracket");
|
||||||
} else {
|
} else {
|
||||||
state.nesting.push({
|
state.nesting.push({
|
||||||
type : "curly",
|
type : "curly",
|
||||||
closeColumn : stream.column(),
|
closeColumn : stream.column(),
|
||||||
alignment : stream.column() + 2
|
alignment : stream.column() + 2
|
||||||
});
|
});
|
||||||
return ret("brace_term_open", null);
|
return ret("brace_term_open", "bracket");
|
||||||
}
|
}
|
||||||
break;
|
break;
|
||||||
case "|":
|
case "|":
|
||||||
if (config.quasiQuotations) {
|
if (config.quasiQuotations) {
|
||||||
if (stream.eat("|")) {
|
if (stream.eat("|")) {
|
||||||
state.tokenize = plTokenQuasiQuotation;
|
state.tokenize = plTokenQuasiQuotation;
|
||||||
return ret("qq_sep", "qq_sep");
|
return ret("qq_sep", "bracket");
|
||||||
} else if (stream.eat("}")) {
|
} else if (stream.eat("}")) {
|
||||||
state.nesting.pop();
|
state.nesting.pop();
|
||||||
return ret("qq_close", "qq_close");
|
return ret("qq_close", "bracket");
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
if (isControl(state))
|
if (isControl(state))
|
||||||
@ -304,7 +304,7 @@ CodeMirror.defineMode("prolog", function(cm_config, parserConfig) {
|
|||||||
if (!readEsc(stream))
|
if (!readEsc(stream))
|
||||||
return ret("error", "error");
|
return ret("error", "error");
|
||||||
}
|
}
|
||||||
return ret("code", "code");
|
return ret("code", "number");
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -325,37 +325,41 @@ CodeMirror.defineMode("prolog", function(cm_config, parserConfig) {
|
|||||||
return ret("fullstop", "error", atom);
|
return ret("fullstop", "error", atom);
|
||||||
} else {
|
} else {
|
||||||
}
|
}
|
||||||
return ret("fullstop", "fullstop", atom);
|
return ret("fullstop", null, atom);
|
||||||
} else if (isNeck.test(atom)) {
|
} else if (isNeck.test(atom)) {
|
||||||
return ret("neck", "neck", atom);
|
return ret("neck", "property", atom);
|
||||||
} else if (isControl(state) && isControlOp.test(atom)) {
|
} else if (isControl(state) && isControlOp.test(atom)) {
|
||||||
state.goalStart = true;
|
state.goalStart = true;
|
||||||
return ret("symbol", "operator", atom);
|
return ret("symbol", "meta", atom);
|
||||||
} else
|
} else
|
||||||
return ret("symbol", "operator", atom);
|
return ret("symbol", "meta", atom);
|
||||||
}
|
}
|
||||||
|
|
||||||
stream.eatWhile(/[\w_]/);
|
stream.eatWhile(/[\w_]/);
|
||||||
var word = stream.current();
|
var word = stream.current(), extra = "";
|
||||||
if (stream.peek() == "{" && config.dicts) {
|
if (stream.peek() == "{" && config.dicts) {
|
||||||
state.tagName = word; /* tmp state extension */
|
state.tagName = word; /* tmp state extension */
|
||||||
state.tagColumn = stream.column();
|
state.tagColumn = stream.column();
|
||||||
return ret("tag", "tag", word);
|
return ret("tag", "tag", word);
|
||||||
} else if (ch == "_") {
|
} else if (ch == "_") {
|
||||||
if (word.length == 1) {
|
if (word.length == 1) {
|
||||||
return ret("var", "anon", word);
|
return ret("var", "variable-3", word);
|
||||||
} else {
|
} else {
|
||||||
var sec = word.charAt(1);
|
var sec = word.charAt(1);
|
||||||
if (sec == sec.toUpperCase())
|
if (sec == sec.toUpperCase())
|
||||||
return ret("var", "var-2", word);
|
return ret("var", "variable-3", word);
|
||||||
}
|
}
|
||||||
return ret("var", "var", word);
|
return ret("var", "variable-3", word);
|
||||||
} else if (ch == ch.toUpperCase()) {
|
} else if (ch == ch.toUpperCase()) {
|
||||||
return ret("var", "var", word);
|
return ret("var", "Variable-2", word);
|
||||||
} else if (stream.peek() == "(") {
|
} else if (stream.peek() == "(") {
|
||||||
state.functorName = word; /* tmp state extension */
|
state.functorName = word; /* tmp state extension */
|
||||||
state.functorColumn = stream.column();
|
state.functorColumn = stream.column();
|
||||||
return ret("functor", "functor", word);
|
return ret("functor", "atom", word);
|
||||||
|
} else if ((extra = stream.eat(/\/\/?\d+/))) {
|
||||||
|
state.functorName = word; /* tmp state extension */
|
||||||
|
state.functorColumn = stream.column();
|
||||||
|
return ret("functor", "atom", word);
|
||||||
} else
|
} else
|
||||||
return ret("atom", "atom", word);
|
return ret("atom", "atom", word);
|
||||||
}
|
}
|
||||||
@ -367,7 +371,7 @@ CodeMirror.defineMode("prolog", function(cm_config, parserConfig) {
|
|||||||
if (stream.peek() == "(") { /* 'quoted functor'() */
|
if (stream.peek() == "(") { /* 'quoted functor'() */
|
||||||
var word = stream.current();
|
var word = stream.current();
|
||||||
state.functorName = word; /* tmp state extension */
|
state.functorName = word; /* tmp state extension */
|
||||||
return ret("functor", "functor", word);
|
return ret("functor", "atom", word);
|
||||||
}
|
}
|
||||||
if (stream.peek() == "{" && config.dicts) { /* 'quoted tag'{} */
|
if (stream.peek() == "{" && config.dicts) { /* 'quoted tag'{} */
|
||||||
var word = stream.current();
|
var word = stream.current();
|
||||||
@ -389,7 +393,7 @@ CodeMirror.defineMode("prolog", function(cm_config, parserConfig) {
|
|||||||
}
|
}
|
||||||
maybeEnd = (ch == "|");
|
maybeEnd = (ch == "|");
|
||||||
}
|
}
|
||||||
return ret("qq_content", "qq_content");
|
return ret("qq_content", "string");
|
||||||
}
|
}
|
||||||
|
|
||||||
function plTokenComment(stream, state) {
|
function plTokenComment(stream, state) {
|
||||||
@ -574,7 +578,7 @@ CodeMirror.defineMode("prolog", function(cm_config, parserConfig) {
|
|||||||
"atom" : "atom",
|
"atom" : "atom",
|
||||||
"qatom" : "atom",
|
"qatom" : "atom",
|
||||||
"bqstring" : "string",
|
"bqstring" : "string",
|
||||||
"symbol" : "atom",
|
"symbol" : "keyword",
|
||||||
"functor" : "keyword",
|
"functor" : "keyword",
|
||||||
"tag" : "tag",
|
"tag" : "tag",
|
||||||
"number" : "number",
|
"number" : "number",
|
||||||
@ -1192,15 +1196,14 @@ CodeMirror.defineMode("prolog", function(cm_config, parserConfig) {
|
|||||||
|
|
||||||
if (builtins[state.curToken] == "prolog")
|
if (builtins[state.curToken] == "prolog")
|
||||||
return "builtin";
|
return "builtin";
|
||||||
if (ops[state.curToken])
|
//if (ops[state.curToken])
|
||||||
return "operator";
|
// return "operator";
|
||||||
|
|
||||||
if (typeof(parserConfig.enrich) == "function")
|
//if (typeof(parserConfig.enrich) == "function")
|
||||||
style = parserConfig.enrich(stream, state, type, content, style);
|
// style = parserConfig.enrich(stream, state, type, content, style);
|
||||||
|
|
||||||
return style;
|
return style;
|
||||||
|
|
||||||
return translType[type];
|
|
||||||
},
|
},
|
||||||
|
|
||||||
indent : function(state, textAfter) {
|
indent : function(state, textAfter) {
|
||||||
@ -1211,7 +1214,7 @@ CodeMirror.defineMode("prolog", function(cm_config, parserConfig) {
|
|||||||
if ((nest = nesting(state))) {
|
if ((nest = nesting(state))) {
|
||||||
if (nest.closeColumn && !state.commaAtEOL)
|
if (nest.closeColumn && !state.commaAtEOL)
|
||||||
return nest.closeColumn;
|
return nest.closeColumn;
|
||||||
return nest.alignment;
|
y return nest.alignment;
|
||||||
}
|
}
|
||||||
if (!state.inBody)
|
if (!state.inBody)
|
||||||
return 0;
|
return 0;
|
1399
misc/editors/yap.js
1399
misc/editors/yap.js
File diff suppressed because it is too large
Load Diff
@ -13,7 +13,7 @@
|
|||||||
#cmakedefine HAVE_READLINE_READLINE_H ${HAVE_READLINE_READLINE_H}
|
#cmakedefine HAVE_READLINE_READLINE_H ${HAVE_READLINE_READLINE_H}
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
#if defined(FOUND_READLINE)
|
#if defined(HAVE_READLINE_READLINE_H) && defined(HAVE_LIBREADLINE)
|
||||||
#define USE_READLINE 1
|
#define USE_READLINE 1
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
|
142
os/charsio.c
142
os/charsio.c
@ -93,126 +93,68 @@ INLINE_ONLY inline EXTERN Int CharOfAtom(Atom at) {
|
|||||||
return val;
|
return val;
|
||||||
}
|
}
|
||||||
|
|
||||||
Int Yap_peek(int sno) {
|
int PopCode(int sno) {
|
||||||
CACHE_REGS
|
|
||||||
Int ocharcount, olinecount, olinepos;
|
|
||||||
StreamDesc *s;
|
StreamDesc *s;
|
||||||
int32_t ch;
|
Int ch;
|
||||||
|
struct yapchlookahead *p;
|
||||||
s = GLOBAL_Stream + sno;
|
s = GLOBAL_Stream + sno;
|
||||||
#if USE_READLINE
|
if (!s->recbs) {
|
||||||
if (s->status & Readline_Stream_f && trueGlobalPrologFlag(READLINE_FLAG)) {
|
return EOF;
|
||||||
ch = Yap_ReadlinePeekChar(sno);
|
|
||||||
if (ch == EOFCHAR) {
|
|
||||||
s->stream_getc = EOFPeek;
|
|
||||||
s->stream_wgetc = EOFWPeek;
|
|
||||||
s->status |= Push_Eof_Stream_f;
|
|
||||||
}
|
|
||||||
return ch;
|
|
||||||
}
|
}
|
||||||
#endif
|
p = s->recbs;
|
||||||
#if !HAVE_FMEMOPEN
|
ch = p->ch;
|
||||||
if (s->status & InMemory_Stream_f) {
|
s->recbs = s->recbs->next;
|
||||||
return Yap_MemPeekc(sno);
|
free(p);
|
||||||
}
|
if (!s->recbs)
|
||||||
#endif
|
Yap_DefaultStreamOps(s);
|
||||||
/* buffer the character */
|
|
||||||
if (s->encoding == Yap_SystemEncoding() && 0) {
|
|
||||||
ch = fgetwc(s->file);
|
|
||||||
ungetwc(ch, s->file);
|
|
||||||
return ch;
|
|
||||||
} else {
|
|
||||||
ocharcount = s->charcount;
|
|
||||||
olinecount = s->linecount;
|
|
||||||
olinepos = s->linepos;
|
|
||||||
ch = s->stream_wgetc(sno);
|
|
||||||
if (ch == EOFCHAR) {
|
|
||||||
s->stream_getc = EOFPeek;
|
|
||||||
s->stream_wgetc = EOFWPeek;
|
|
||||||
s->status |= Push_Eof_Stream_f;
|
|
||||||
return ch;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
if (s->encoding == ENC_OCTET || s->encoding == ENC_ISO_LATIN1 ||
|
|
||||||
s->encoding == ENC_ISO_ASCII) {
|
|
||||||
ungetc(ch, s->file);
|
|
||||||
} else if (s->encoding == ENC_ISO_UTF8) {
|
|
||||||
unsigned char cs[8];
|
|
||||||
size_t n = put_utf8(cs, ch);
|
|
||||||
while (n--) {
|
|
||||||
ungetc(cs[n], s->file);
|
|
||||||
}
|
|
||||||
} else if (s->encoding == ENC_UTF16_BE) {
|
|
||||||
/* do the ungetc as if a write .. */
|
|
||||||
// computations
|
|
||||||
if (ch < 0x10000) {
|
|
||||||
ungetc(ch % 256, s->file);
|
|
||||||
ungetc(ch / 256, s->file);
|
|
||||||
} else {
|
|
||||||
uint16_t lead = LEAD_OFFSET + (ch >> 10);
|
|
||||||
uint16_t trail = 0xDC00 + (ch & 0x3FF);
|
|
||||||
|
|
||||||
ungetc(lead % 256, s->file);
|
|
||||||
ungetc(lead / 256, s->file);
|
|
||||||
ungetc(trail % 256, s->file);
|
|
||||||
ungetc(trail / 256, s->file);
|
|
||||||
}
|
|
||||||
} else if (s->encoding == ENC_UTF16_LE) {
|
|
||||||
if (ch < 0x10000) {
|
|
||||||
ungetc(ch / 256, s->file);
|
|
||||||
ungetc(ch % 256, s->file);
|
|
||||||
} else {
|
|
||||||
uint16_t lead = LEAD_OFFSET + (ch >> 10);
|
|
||||||
uint16_t trail = 0xDC00 + (ch & 0x3FF);
|
|
||||||
|
|
||||||
ungetc(trail / 256, s->file);
|
|
||||||
ungetc(trail % 256, s->file);
|
|
||||||
ungetc(lead / 256, s->file);
|
|
||||||
ungetc(lead % 256, s->file);
|
|
||||||
}
|
|
||||||
} else if (s->encoding == ENC_ISO_UTF32_LE) {
|
|
||||||
ungetc((ch >> 24) & 0xff, s->file);
|
|
||||||
ungetc((ch >> 16) & 0xff, s->file);
|
|
||||||
ungetc((ch >> 8) & 0xff, s->file);
|
|
||||||
ungetc(ch & 0xff, s->file);
|
|
||||||
} else if (s->encoding == ENC_ISO_UTF32_BE) {
|
|
||||||
ungetc(ch & 0xff, s->file);
|
|
||||||
ungetc((ch >> 8) & 0xff, s->file);
|
|
||||||
ungetc((ch >> 16) & 0xff, s->file);
|
|
||||||
ungetc((ch >> 24) & 0xff, s->file);
|
|
||||||
} else if (s->encoding == ENC_UCS2_BE) {
|
|
||||||
/* do the ungetc as if a write .. */
|
|
||||||
// computations
|
|
||||||
ungetc(ch % 256, s->file);
|
|
||||||
ungetc(ch / 256, s->file);
|
|
||||||
} else if (s->encoding == ENC_UCS2_LE) {
|
|
||||||
ungetc(ch / 256, s->file);
|
|
||||||
ungetc(ch % 256, s->file);
|
|
||||||
}
|
|
||||||
s->charcount = ocharcount;
|
|
||||||
s->linecount = olinecount;
|
|
||||||
s->linepos = olinepos;
|
|
||||||
return ch;
|
return ch;
|
||||||
}
|
}
|
||||||
|
|
||||||
static Int dopeek_byte(int sno) {
|
static int peekCode(int sno, bool wide) {
|
||||||
Int ocharcount, olinecount, olinepos;
|
Int ocharcount, olinecount, olinepos;
|
||||||
StreamDesc *s;
|
StreamDesc *s;
|
||||||
Int ch;
|
Int ch;
|
||||||
|
struct yapchlookahead *recb = malloc(sizeof(struct yapchlookahead)), *r;
|
||||||
|
recb->next = NULL;
|
||||||
s = GLOBAL_Stream + sno;
|
s = GLOBAL_Stream + sno;
|
||||||
ocharcount = s->charcount;
|
ocharcount = s->charcount;
|
||||||
olinecount = s->linecount;
|
olinecount = s->linecount;
|
||||||
olinepos = s->linepos;
|
olinepos = s->linepos;
|
||||||
ch = GLOBAL_Stream[sno].stream_getc(sno);
|
if (wide)
|
||||||
|
recb->ch = ch = GLOBAL_Stream[sno].stream_wgetc(sno);
|
||||||
|
else
|
||||||
|
recb->ch = ch = GLOBAL_Stream[sno].stream_getc(sno);
|
||||||
|
if (ch == EOFCHAR) {
|
||||||
|
s->stream_getc = EOFPeek;
|
||||||
|
s->stream_wgetc = EOFWPeek;
|
||||||
|
s->status |= Push_Eof_Stream_f;
|
||||||
|
return ch;
|
||||||
|
}
|
||||||
|
recb->charcount = s->charcount;
|
||||||
|
recb->linecount = s->linecount;
|
||||||
|
recb->linepos = s->linepos;
|
||||||
s->charcount = ocharcount;
|
s->charcount = ocharcount;
|
||||||
s->linecount = olinecount;
|
s->linecount = olinecount;
|
||||||
s->linepos = olinepos;
|
s->linepos = olinepos;
|
||||||
|
if (s->recbs) {
|
||||||
|
r = s->recbs;
|
||||||
|
while (r->next) {
|
||||||
|
r = r->next;
|
||||||
|
}
|
||||||
|
r->next = recb;
|
||||||
|
} else {
|
||||||
|
s->recbs = recb;
|
||||||
|
}
|
||||||
/* buffer the character */
|
/* buffer the character */
|
||||||
ungetc(ch, s->file);
|
GLOBAL_Stream[sno].stream_getc = PopCode;
|
||||||
|
GLOBAL_Stream[sno].stream_wgetc = PopCode;
|
||||||
return ch;
|
return ch;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
Int Yap_peek(int sno) { return peekCode(sno, true); }
|
||||||
|
|
||||||
|
static Int dopeek_byte(int sno) { return peekCode(sno, false); }
|
||||||
|
|
||||||
bool store_code(int ch, Term t USES_REGS) {
|
bool store_code(int ch, Term t USES_REGS) {
|
||||||
Term t2 = Deref(t);
|
Term t2 = Deref(t);
|
||||||
bool rc = Yap_unify_constant(t2, MkIntegerTerm(ch));
|
bool rc = Yap_unify_constant(t2, MkIntegerTerm(ch));
|
||||||
|
@ -108,6 +108,7 @@ bool fill_pads(int sno, int sno0, int total, format_info *fg USES_REGS)
|
|||||||
GLOBAL_Stream[sno].linecount = 1;
|
GLOBAL_Stream[sno].linecount = 1;
|
||||||
GLOBAL_Stream[sno].linepos += nchars;
|
GLOBAL_Stream[sno].linepos += nchars;
|
||||||
GLOBAL_Stream[sno].charcount = 0;
|
GLOBAL_Stream[sno].charcount = 0;
|
||||||
|
GLOBAL_Stream[sno].recbs = NULL;
|
||||||
fg->phys_start = 0;
|
fg->phys_start = 0;
|
||||||
fg->lstart = GLOBAL_Stream[sno].linepos;
|
fg->lstart = GLOBAL_Stream[sno].linepos;
|
||||||
fg->gapi = 0;
|
fg->gapi = 0;
|
||||||
@ -122,6 +123,7 @@ bool Yap_set_stream_to_buf(StreamDesc *st, const char *buf,
|
|||||||
st->file = f = fmemopen((char *)buf, nchars, "r");
|
st->file = f = fmemopen((char *)buf, nchars, "r");
|
||||||
st->status = Input_Stream_f | Seekable_Stream_f | InMemory_Stream_f;
|
st->status = Input_Stream_f | Seekable_Stream_f | InMemory_Stream_f;
|
||||||
st->vfs = NULL;
|
st->vfs = NULL;
|
||||||
|
st->recbs = NULL;
|
||||||
st->encoding = LOCAL_encoding;
|
st->encoding = LOCAL_encoding;
|
||||||
Yap_DefaultStreamOps(st);
|
Yap_DefaultStreamOps(st);
|
||||||
st->linecount = 0;
|
st->linecount = 0;
|
||||||
@ -194,7 +196,7 @@ int Yap_open_buf_write_stream(encoding_t enc, memBufSource src) {
|
|||||||
st->linecount = 1;
|
st->linecount = 1;
|
||||||
st->encoding = enc;
|
st->encoding = enc;
|
||||||
st->vfs = NULL;
|
st->vfs = NULL;
|
||||||
Yap_DefaultStreamOps(st);
|
st->recbs = NULL;
|
||||||
#if HAVE_OPEN_MEMSTREAM
|
#if HAVE_OPEN_MEMSTREAM
|
||||||
st->file = open_memstream(&st->nbuf, &st->nsize);
|
st->file = open_memstream(&st->nbuf, &st->nsize);
|
||||||
// setbuf(st->file, NULL);
|
// setbuf(st->file, NULL);
|
||||||
@ -205,6 +207,7 @@ int Yap_open_buf_write_stream(encoding_t enc, memBufSource src) {
|
|||||||
return -1;
|
return -1;
|
||||||
}
|
}
|
||||||
#endif
|
#endif
|
||||||
|
Yap_DefaultStreamOps(st);
|
||||||
UNLOCK(st->streamlock);
|
UNLOCK(st->streamlock);
|
||||||
return sno;
|
return sno;
|
||||||
}
|
}
|
||||||
|
@ -189,7 +189,7 @@ fmemseek(void *cookie, fpos_t pos, int whence)
|
|||||||
return (fpos_t) offset;
|
return (fpos_t) offset;
|
||||||
}
|
}
|
||||||
|
|
||||||
/* Reclaim resources used by stream described by COOKIE. */
|
/* Reclaim resources used by stream described by COOKIE. */
|
||||||
static int
|
static int
|
||||||
fmemclose(void *cookie)
|
fmemclose(void *cookie)
|
||||||
{
|
{
|
||||||
|
2610
os/iopreds.c
2610
os/iopreds.c
File diff suppressed because it is too large
Load Diff
@ -91,10 +91,15 @@ extern void Yap_InitStdStreams(void);
|
|||||||
extern Term Yap_StreamPosition(int);
|
extern Term Yap_StreamPosition(int);
|
||||||
extern void Yap_CloseStream(int sno);
|
extern void Yap_CloseStream(int sno);
|
||||||
|
|
||||||
static inline Int GetCurInpPos(StreamDesc *inp_stream) {
|
static inline Int GetCurInpLine(StreamDesc *inp_stream) {
|
||||||
return (inp_stream->linecount);
|
return (inp_stream->linecount);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
static inline Int GetCurInpPos(StreamDesc *inp_stream) {
|
||||||
|
return (inp_stream->charcount);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
#define PlIOError(type, culprit, ...) \
|
#define PlIOError(type, culprit, ...) \
|
||||||
PlIOError__(__FILE__, __FUNCTION__, __LINE__, type, culprit, __VA_ARGS__)
|
PlIOError__(__FILE__, __FUNCTION__, __LINE__, type, culprit, __VA_ARGS__)
|
||||||
|
|
||||||
|
53
os/mem.c
53
os/mem.c
@ -1,19 +1,19 @@
|
|||||||
/*************************************************************************
|
/*************************************************************************
|
||||||
* *
|
* *
|
||||||
* YAP Prolog *
|
* YAP Prolog *
|
||||||
* *
|
* *
|
||||||
* Yap Prolog was developed at NCCUP - Universidade do Porto *
|
* Yap Prolog was developed at NCCUP - Universidade do Porto *
|
||||||
* *
|
* *
|
||||||
* Copyright L.Damas, V.S.Costa and Universidade do Porto 1985-1997 *
|
* Copyright L.Damas, V.S.Costa and Universidade do Porto 1985-1997 *
|
||||||
* *
|
* *
|
||||||
**************************************************************************
|
**************************************************************************
|
||||||
* *
|
* *
|
||||||
* File: mem.c *
|
* File: mem.c *
|
||||||
* Last rev: 5/2/88 *
|
* Last rev: 5/2/88 *
|
||||||
* mods: *
|
* mods: *
|
||||||
* comments: Input/Output C implemented predicates *
|
* comments: Input/Output C implemented predicates *
|
||||||
* *
|
* *
|
||||||
*************************************************************************/
|
*************************************************************************/
|
||||||
#ifdef SCCS
|
#ifdef SCCS
|
||||||
static char SccsId[] = "%W% %G%";
|
static char SccsId[] = "%W% %G%";
|
||||||
#endif
|
#endif
|
||||||
@ -24,10 +24,10 @@ static char SccsId[] = "%W% %G%";
|
|||||||
*/
|
*/
|
||||||
|
|
||||||
#include "sysbits.h"
|
#include "sysbits.h"
|
||||||
#include "YapStreams.h"
|
|
||||||
|
|
||||||
#if !HAVE_FMEMOPEN || !defined(HAVE_FMEMOPEN)
|
#if !HAVE_FMEMOPEN || !defined(HAVE_FMEMOPEN)
|
||||||
|
|
||||||
|
#include "YapStreams.h"
|
||||||
|
|
||||||
#include "format.h"
|
#include "format.h"
|
||||||
|
|
||||||
@ -48,6 +48,8 @@ int format_synch(int sno, int sno0, format_info *fg) {
|
|||||||
GLOBAL_Stream[sno].linecount = 1;
|
GLOBAL_Stream[sno].linecount = 1;
|
||||||
GLOBAL_Stream[sno].linepos = 0;
|
GLOBAL_Stream[sno].linepos = 0;
|
||||||
GLOBAL_Stream[sno].charcount = 0;
|
GLOBAL_Stream[sno].charcount = 0;
|
||||||
|
GLOBAL_Stream[sno].recbs = NULL;
|
||||||
|
GLOBAL_Stream[sno].vfs = NULL;
|
||||||
fg->lstart = 0;
|
fg->lstart = 0;
|
||||||
fg->phys_start = 0;
|
fg->phys_start = 0;
|
||||||
fg->gapi = 0;
|
fg->gapi = 0;
|
||||||
@ -55,7 +57,7 @@ int format_synch(int sno, int sno0, format_info *fg) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// uses directly the buffer in the memory stream.
|
// uses directly the buffer in the memory stream.
|
||||||
bool fill_pads(int sno, int sno0, int total, format_info *fg USES_REGS) {
|
bool fill_pads(int sno, int sno0, int total, format_info *fg USES_REGS) {
|
||||||
int nfillers, fill_space, lfill_space, nchars;
|
int nfillers, fill_space, lfill_space, nchars;
|
||||||
int (*f_putc)(int, int);
|
int (*f_putc)(int, int);
|
||||||
const char *buf;
|
const char *buf;
|
||||||
@ -103,6 +105,9 @@ int format_synch(int sno, int sno0, format_info *fg) {
|
|||||||
GLOBAL_Stream[sno].linecount = 1;
|
GLOBAL_Stream[sno].linecount = 1;
|
||||||
GLOBAL_Stream[sno].linepos += nchars;
|
GLOBAL_Stream[sno].linepos += nchars;
|
||||||
GLOBAL_Stream[sno].charcount = 0;
|
GLOBAL_Stream[sno].charcount = 0;
|
||||||
|
GLOBAL_Stream[sno].recbs = NULL;
|
||||||
|
GLOBAL_Stream[sno].vfs = NULL;
|
||||||
|
GLOBAL_Stream[sno].file = NULL;
|
||||||
fg->phys_start = 0;
|
fg->phys_start = 0;
|
||||||
fg->lstart = GLOBAL_Stream[sno].linepos;
|
fg->lstart = GLOBAL_Stream[sno].linepos;
|
||||||
fg->gapi = 0;
|
fg->gapi = 0;
|
||||||
@ -180,7 +185,8 @@ static int MemPutc(int sno, int ch) {
|
|||||||
return ((int)ch);
|
return ((int)ch);
|
||||||
}
|
}
|
||||||
|
|
||||||
bool Yap_set_stream_to_buf(StreamDesc *st, const char *buf, size_t nchars USES_REGS) {
|
bool Yap_set_stream_to_buf(StreamDesc *st, const char *buf,
|
||||||
|
size_t nchars USES_REGS) {
|
||||||
FILE *f;
|
FILE *f;
|
||||||
stream_flags_t flags;
|
stream_flags_t flags;
|
||||||
|
|
||||||
@ -189,14 +195,14 @@ bool Yap_set_stream_to_buf(StreamDesc *st, const char *buf, size_t nchars USES_R
|
|||||||
st->vfs = NULL;
|
st->vfs = NULL;
|
||||||
Yap_initStream(st - GLOBAL_Stream, f, NULL, TermNil, LOCAL_encoding, flags,
|
Yap_initStream(st - GLOBAL_Stream, f, NULL, TermNil, LOCAL_encoding, flags,
|
||||||
AtomRead, NULL);
|
AtomRead, NULL);
|
||||||
// like any file stream.
|
// like any file stream.
|
||||||
/* currently these streams are not seekable */
|
/* currently these streams are not seekable */
|
||||||
st->status = Input_Stream_f | InMemory_Stream_f;
|
st->status = Input_Stream_f | InMemory_Stream_f;
|
||||||
st->u.mem_string.pos = 0;
|
st->u.mem_string.pos = 0;
|
||||||
st->u.mem_string.buf = (char *)buf;
|
st->u.mem_string.buf = (char *)buf;
|
||||||
st->u.mem_string.max_size = nchars;
|
st->u.mem_string.max_size = nchars;
|
||||||
st->u.mem_string.error_handler = NULL;
|
st->u.mem_string.error_handler = NULL;
|
||||||
// st->u.mem_string.src = src; check new assets coode
|
// st->u.mem_string.src = src; check new assets coode
|
||||||
Yap_DefaultStreamOps(st);
|
Yap_DefaultStreamOps(st);
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
@ -223,7 +229,7 @@ int Yap_open_buf_read_stream(const char *buf, size_t nchars, encoding_t *encp,
|
|||||||
flags = Input_Stream_f | InMemory_Stream_f;
|
flags = Input_Stream_f | InMemory_Stream_f;
|
||||||
st->vfs = NULL;
|
st->vfs = NULL;
|
||||||
Yap_initStream(sno, f, NULL, TermNil, encoding, flags, AtomRead, NULL);
|
Yap_initStream(sno, f, NULL, TermNil, encoding, flags, AtomRead, NULL);
|
||||||
// like any file stream.
|
// like any file stream.
|
||||||
/* currently these streams are not seekable */
|
/* currently these streams are not seekable */
|
||||||
st->status = Input_Stream_f | InMemory_Stream_f;
|
st->status = Input_Stream_f | InMemory_Stream_f;
|
||||||
st->u.mem_string.pos = 0;
|
st->u.mem_string.pos = 0;
|
||||||
@ -272,7 +278,9 @@ int Yap_open_buf_write_stream(encoding_t enc, memBufSource src) {
|
|||||||
st->charcount = 0;
|
st->charcount = 0;
|
||||||
st->linecount = 1;
|
st->linecount = 1;
|
||||||
st->encoding = enc;
|
st->encoding = enc;
|
||||||
|
st->recbs = NULL;
|
||||||
st->vfs = NULL;
|
st->vfs = NULL;
|
||||||
|
st->file = NULL;
|
||||||
Yap_DefaultStreamOps(st);
|
Yap_DefaultStreamOps(st);
|
||||||
st->nbuf = st->u.mem_string.buf = malloc(PLGETC_BUF_SIZE);
|
st->nbuf = st->u.mem_string.buf = malloc(PLGETC_BUF_SIZE);
|
||||||
st->u.mem_string.src = MEM_BUF_MALLOC;
|
st->u.mem_string.src = MEM_BUF_MALLOC;
|
||||||
@ -357,7 +365,8 @@ restart:
|
|||||||
void Yap_MemOps(StreamDesc *st) {
|
void Yap_MemOps(StreamDesc *st) {
|
||||||
st->stream_putc = MemPutc;
|
st->stream_putc = MemPutc;
|
||||||
|
|
||||||
st->stream_getc = MemGetc;}
|
st->stream_getc = MemGetc;
|
||||||
|
}
|
||||||
|
|
||||||
bool Yap_CloseMemoryStream(int sno) {
|
bool Yap_CloseMemoryStream(int sno) {
|
||||||
if ((GLOBAL_Stream[sno].status & Output_Stream_f)) {
|
if ((GLOBAL_Stream[sno].status & Output_Stream_f)) {
|
||||||
|
484
os/readterm.c
484
os/readterm.c
@ -95,7 +95,7 @@ static char SccsId[] = "%W% %G%";
|
|||||||
#define SYSTEM_STAT stat
|
#define SYSTEM_STAT stat
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
static Term syntax_error(TokEntry *errtok, int sno, Term cmod);
|
static Term syntax_error(TokEntry *errtok, int sno, Term cmod, Int start);
|
||||||
|
|
||||||
static void clean_vars(VarEntry *p) {
|
static void clean_vars(VarEntry *p) {
|
||||||
if (p == NULL)
|
if (p == NULL)
|
||||||
@ -315,55 +315,80 @@ static Int scan_to_list(USES_REGS1) {
|
|||||||
* Implicit arguments:
|
* Implicit arguments:
|
||||||
* +
|
* +
|
||||||
*/
|
*/
|
||||||
static Term syntax_error(TokEntry *errtok, int sno, Term cmod) {
|
static Term syntax_error(TokEntry *errtok, int sno, Term cmod, Int newpos) {
|
||||||
CACHE_REGS
|
CACHE_REGS
|
||||||
Term startline, errline, endline;
|
Term startline, errline, endline;
|
||||||
Term tf[3];
|
Term tf[4];
|
||||||
Term tm;
|
Term tm;
|
||||||
Term *tailp = tf + 2;
|
Term *tailp = tf + 3;
|
||||||
CELL *Hi = HR;
|
CELL *Hi = HR;
|
||||||
TokEntry *tok = LOCAL_tokptr;
|
TokEntry *tok = LOCAL_tokptr;
|
||||||
Int cline = tok->TokPos;
|
Int cline = tok->TokLine;
|
||||||
|
Int startpos = tok->TokPos;
|
||||||
|
errtok = LOCAL_toktide;
|
||||||
|
Int errpos = errtok->TokPos;
|
||||||
|
UInt diff = 0;
|
||||||
startline = MkIntegerTerm(cline);
|
startline = MkIntegerTerm(cline);
|
||||||
endline = MkIntegerTerm(cline);
|
endline = MkIntegerTerm(cline);
|
||||||
if (errtok != LOCAL_toktide) {
|
|
||||||
errtok = LOCAL_toktide;
|
|
||||||
}
|
|
||||||
LOCAL_Error_TYPE = YAP_NO_ERROR;
|
LOCAL_Error_TYPE = YAP_NO_ERROR;
|
||||||
errline = MkIntegerTerm(errtok->TokPos);
|
errline = MkIntegerTerm(errtok->TokLine);
|
||||||
if (LOCAL_ErrorMessage)
|
if (LOCAL_ErrorMessage)
|
||||||
tm = MkStringTerm(LOCAL_ErrorMessage);
|
tm = MkStringTerm(LOCAL_ErrorMessage);
|
||||||
else
|
else {
|
||||||
tm = MkStringTerm("syntax error");
|
tm = MkStringTerm("syntax error");
|
||||||
while (tok) {
|
}
|
||||||
|
if (errpos && newpos >= 0) {
|
||||||
|
char o[128 + 1];
|
||||||
|
diff = errpos - startpos;
|
||||||
|
if (diff > 128) {
|
||||||
|
diff = 128;
|
||||||
|
startpos = errpos - diff;
|
||||||
|
}
|
||||||
|
#if HAVE_FTELLO
|
||||||
|
Int curpos = ftello(GLOBAL_Stream[sno].file);
|
||||||
|
fseeko(GLOBAL_Stream[sno].file, startpos, SEEK_SET);
|
||||||
|
#else
|
||||||
|
Int curpos = ftell(GLOBAL_Stream[sno].file);
|
||||||
|
fseek(GLOBAL_Stream[sno].file, startpos, SEEK_SET);
|
||||||
|
#endif
|
||||||
|
fread(o, diff, 1, GLOBAL_Stream[sno].file);
|
||||||
|
#if HAVE_FTELLO
|
||||||
|
fseeko(GLOBAL_Stream[sno].file, curpos, SEEK_SET);
|
||||||
|
#else
|
||||||
|
fseek(GLOBAL_Stream[sno].file, curpos, SEEK_SET);
|
||||||
|
#endif
|
||||||
|
o[diff] = '\0';
|
||||||
|
tf[3] = MkStringTerm(o);
|
||||||
|
} else {
|
||||||
|
while (tok) {
|
||||||
|
|
||||||
if (HR > ASP - 1024) {
|
if (HR > ASP - 1024) {
|
||||||
errline = MkIntegerTerm(0);
|
errline = MkIntegerTerm(0);
|
||||||
endline = MkIntegerTerm(0);
|
endline = MkIntegerTerm(0);
|
||||||
/* for some reason moving this earlier confuses gcc on solaris */
|
/* for some reason moving this earlier confuses gcc on solaris */
|
||||||
HR = Hi;
|
HR = Hi;
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
if (tok->TokPos != cline) {
|
if (tok->TokLine != cline) {
|
||||||
*tailp = MkPairTerm(TermNewLine, TermNil);
|
*tailp = MkPairTerm(TermNewLine, TermNil);
|
||||||
tailp = RepPair(*tailp) + 1;
|
tailp = RepPair(*tailp) + 1;
|
||||||
cline = tok->TokPos;
|
cline = tok->TokLine;
|
||||||
}
|
}
|
||||||
if (tok == errtok && tok->Tok != Error_tok) {
|
if (tok == errtok && tok->Tok != Error_tok) {
|
||||||
*tailp = MkPairTerm(MkAtomTerm(AtomError), TermNil);
|
*tailp = MkPairTerm(MkAtomTerm(AtomError), TermNil);
|
||||||
|
tailp = RepPair(*tailp) + 1;
|
||||||
|
}
|
||||||
|
Term rep = Yap_tokRep(tok);
|
||||||
|
if (tok->TokNext) {
|
||||||
|
tok = tok->TokNext;
|
||||||
|
} else {
|
||||||
|
endline = MkIntegerTerm(tok->TokLine);
|
||||||
|
tok = NULL;
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
*tailp = MkPairTerm(rep, TermNil);
|
||||||
tailp = RepPair(*tailp) + 1;
|
tailp = RepPair(*tailp) + 1;
|
||||||
}
|
}
|
||||||
Term rep = Yap_tokRep(tok);
|
|
||||||
if (tok->TokNext) {
|
|
||||||
tok = tok->TokNext;
|
|
||||||
} else {
|
|
||||||
endline = MkIntegerTerm(tok->TokPos);
|
|
||||||
tok = NULL;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
*tailp = MkPairTerm(rep, TermNil);
|
|
||||||
tailp = RepPair(*tailp) + 1;
|
|
||||||
}
|
}
|
||||||
{
|
{
|
||||||
Term t[3];
|
Term t[3];
|
||||||
@ -376,9 +401,10 @@ static Term syntax_error(TokEntry *errtok, int sno, Term cmod) {
|
|||||||
/*2 msg */
|
/*2 msg */
|
||||||
/* 1: file */
|
/* 1: file */
|
||||||
tf[1] = Yap_StreamUserName(sno);
|
tf[1] = Yap_StreamUserName(sno);
|
||||||
|
tf[2] = MkIntegerTerm(LOCAL_ActiveError->prologParserPos);
|
||||||
clean_vars(LOCAL_VarTable);
|
clean_vars(LOCAL_VarTable);
|
||||||
clean_vars(LOCAL_AnonVarTable);
|
clean_vars(LOCAL_AnonVarTable);
|
||||||
Term terr = Yap_MkApplTerm(FunctorInfo3, 3, tf);
|
Term terr = Yap_MkApplTerm(FunctorInfo4, 4, tf);
|
||||||
Term tn[2];
|
Term tn[2];
|
||||||
tn[0] = Yap_MkApplTerm(FunctorShortSyntaxError, 1, &tm);
|
tn[0] = Yap_MkApplTerm(FunctorShortSyntaxError, 1, &tm);
|
||||||
tn[1] = terr;
|
tn[1] = terr;
|
||||||
@ -386,14 +412,14 @@ static Term syntax_error(TokEntry *errtok, int sno, Term cmod) {
|
|||||||
#if DEBUG
|
#if DEBUG
|
||||||
if (Yap_ExecutionMode == YAP_BOOT_MODE) {
|
if (Yap_ExecutionMode == YAP_BOOT_MODE) {
|
||||||
fprintf(stderr, "SYNTAX ERROR while booting: ");
|
fprintf(stderr, "SYNTAX ERROR while booting: ");
|
||||||
Yap_DebugPlWriteln(terr);
|
fe
|
||||||
}
|
}
|
||||||
#endif
|
#endif
|
||||||
return terr;
|
return terr;
|
||||||
}
|
}
|
||||||
|
|
||||||
Term Yap_syntax_error(TokEntry *errtok, int sno) {
|
Term Yap_syntax_error(TokEntry *errtok, int sno) {
|
||||||
return syntax_error(errtok, sno, CurrentModule);
|
return syntax_error(errtok, sno, CurrentModule, -1);
|
||||||
}
|
}
|
||||||
|
|
||||||
typedef struct FEnv {
|
typedef struct FEnv {
|
||||||
@ -417,9 +443,6 @@ typedef struct renv {
|
|||||||
bool ce, sw;
|
bool ce, sw;
|
||||||
Term sy;
|
Term sy;
|
||||||
UInt cpos;
|
UInt cpos;
|
||||||
#if HAVE_FGETPOS
|
|
||||||
fpos_t rpos;
|
|
||||||
#endif
|
|
||||||
int prio;
|
int prio;
|
||||||
int ungetc_oldc;
|
int ungetc_oldc;
|
||||||
int had_ungetc;
|
int had_ungetc;
|
||||||
@ -500,11 +523,7 @@ static xarg *setReadEnv(Term opts, FEnv *fe, struct renv *re, int inp_stream) {
|
|||||||
}
|
}
|
||||||
re->seekable = (GLOBAL_Stream[inp_stream].status & Seekable_Stream_f) != 0;
|
re->seekable = (GLOBAL_Stream[inp_stream].status & Seekable_Stream_f) != 0;
|
||||||
if (re->seekable) {
|
if (re->seekable) {
|
||||||
#if HAVE_FGETPOS
|
|
||||||
fgetpos(GLOBAL_Stream[inp_stream].file, &re->rpos);
|
|
||||||
#else
|
|
||||||
re->cpos = GLOBAL_Stream[inp_stream].charcount;
|
re->cpos = GLOBAL_Stream[inp_stream].charcount;
|
||||||
#endif
|
|
||||||
}
|
}
|
||||||
if (args[READ_PRIORITY].used) {
|
if (args[READ_PRIORITY].used) {
|
||||||
re->prio = IntegerOfTerm(args[READ_PRIORITY].tvalue);
|
re->prio = IntegerOfTerm(args[READ_PRIORITY].tvalue);
|
||||||
@ -890,8 +909,8 @@ static parser_state_t scanError(REnv *re, FEnv *fe, int inp_stream) {
|
|||||||
if (GLOBAL_Stream[inp_stream].status & InMemory_Stream_f) {
|
if (GLOBAL_Stream[inp_stream].status & InMemory_Stream_f) {
|
||||||
GLOBAL_Stream[inp_stream].u.mem_string.pos = re->cpos;
|
GLOBAL_Stream[inp_stream].u.mem_string.pos = re->cpos;
|
||||||
} else if (GLOBAL_Stream[inp_stream].status) {
|
} else if (GLOBAL_Stream[inp_stream].status) {
|
||||||
#if HAVE_FGETPOS
|
#if HAVE_FTELLO
|
||||||
fsetpos(GLOBAL_Stream[inp_stream].file, &re->rpos);
|
fseeko(GLOBAL_Stream[inp_stream].file, re->cpos, 0L);
|
||||||
#else
|
#else
|
||||||
fseek(GLOBAL_Stream[inp_stream].file, re->cpos, 0L);
|
fseek(GLOBAL_Stream[inp_stream].file, re->cpos, 0L);
|
||||||
#endif
|
#endif
|
||||||
@ -912,7 +931,11 @@ static parser_state_t parseError(REnv *re, FEnv *fe, int inp_stream) {
|
|||||||
LOCAL_Error_TYPE = YAP_NO_ERROR;
|
LOCAL_Error_TYPE = YAP_NO_ERROR;
|
||||||
return YAP_PARSING_FINISHED;
|
return YAP_PARSING_FINISHED;
|
||||||
} else {
|
} else {
|
||||||
Term t = syntax_error(fe->toklast, inp_stream, fe->cmod);
|
if (re->seekable) {
|
||||||
|
re->cpos = GLOBAL_Stream[inp_stream].charcount;
|
||||||
|
}
|
||||||
|
|
||||||
|
Term t = syntax_error(fe->toklast, inp_stream, fe->cmod, re->cpos);
|
||||||
if (ParserErrorStyle == TermError) {
|
if (ParserErrorStyle == TermError) {
|
||||||
LOCAL_ActiveError->errorTerm = Yap_StoreTermInDB(t, 4);
|
LOCAL_ActiveError->errorTerm = Yap_StoreTermInDB(t, 4);
|
||||||
LOCAL_Error_TYPE = SYNTAX_ERROR;
|
LOCAL_Error_TYPE = SYNTAX_ERROR;
|
||||||
@ -1059,8 +1082,7 @@ typedef enum read_clause_enum_choices {
|
|||||||
static const param_t read_clause_defs[] = {READ_CLAUSE_DEFS()};
|
static const param_t read_clause_defs[] = {READ_CLAUSE_DEFS()};
|
||||||
#undef PAR
|
#undef PAR
|
||||||
|
|
||||||
static xarg *setClauseReadEnv(Term opts, FEnv *fe, struct renv *re,
|
static xarg *setClauseReadEnv(Term opts, FEnv *fe, struct renv *re, int sno) {
|
||||||
int sno) {
|
|
||||||
CACHE_REGS
|
CACHE_REGS
|
||||||
|
|
||||||
xarg *args = Yap_ArgListToVector(opts, read_clause_defs, READ_CLAUSE_END);
|
xarg *args = Yap_ArgListToVector(opts, read_clause_defs, READ_CLAUSE_END);
|
||||||
@ -1120,11 +1142,7 @@ static xarg *setClauseReadEnv(Term opts, FEnv *fe, struct renv *re,
|
|||||||
fe->ce = Yap_CharacterEscapes(fe->cmod);
|
fe->ce = Yap_CharacterEscapes(fe->cmod);
|
||||||
re->seekable = (GLOBAL_Stream[sno].status & Seekable_Stream_f) != 0;
|
re->seekable = (GLOBAL_Stream[sno].status & Seekable_Stream_f) != 0;
|
||||||
if (re->seekable) {
|
if (re->seekable) {
|
||||||
#if HAVE_FGETPOS
|
|
||||||
fgetpos(GLOBAL_Stream[sno].file, &re->rpos);
|
|
||||||
#else
|
|
||||||
re->cpos = GLOBAL_Stream[sno].charcount;
|
re->cpos = GLOBAL_Stream[sno].charcount;
|
||||||
#endif
|
|
||||||
}
|
}
|
||||||
re->prio = LOCAL_default_priority;
|
re->prio = LOCAL_default_priority;
|
||||||
return args;
|
return args;
|
||||||
@ -1354,202 +1372,200 @@ Term Yap_BufferToTerm(const unsigned char *s, Term opts) {
|
|||||||
Term rval;
|
Term rval;
|
||||||
int sno;
|
int sno;
|
||||||
encoding_t l = ENC_ISO_UTF8;
|
encoding_t l = ENC_ISO_UTF8;
|
||||||
sno = Yap_open_buf_read_stream((char *)s, strlen((const char*)s), &l, MEM_BUF_USER);
|
sno = Yap_open_buf_read_stream((char *)s, strlen((const char *)s), &l,
|
||||||
|
MEM_BUF_USER);
|
||||||
|
|
||||||
rval = Yap_read_term(sno, opts, false);
|
rval = Yap_read_term(sno, opts, false);
|
||||||
Yap_CloseStream(sno);
|
Yap_CloseStream(sno);
|
||||||
return rval;
|
return rval;
|
||||||
}
|
}
|
||||||
|
|
||||||
X_API Term Yap_BufferToTermWithPrioBindings(const unsigned char *s, size_t len,
|
X_API Term Yap_BufferToTermWithPrioBindings(const unsigned char *s, size_t len,
|
||||||
Term opts, int prio,
|
Term opts, int prio,
|
||||||
Term bindings) {
|
Term bindings) {
|
||||||
CACHE_REGS
|
CACHE_REGS
|
||||||
Term ctl;
|
Term ctl;
|
||||||
|
|
||||||
ctl = opts;
|
ctl = opts;
|
||||||
if (bindings) {
|
if (bindings) {
|
||||||
ctl = add_names(bindings, TermNil);
|
ctl = add_names(bindings, TermNil);
|
||||||
}
|
}
|
||||||
if (prio != 1200) {
|
if (prio != 1200) {
|
||||||
ctl = add_priority(bindings, ctl);
|
ctl = add_priority(bindings, ctl);
|
||||||
}
|
}
|
||||||
return Yap_BufferToTerm(s, ctl);
|
return Yap_BufferToTerm(s, ctl);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* @pred read_term_from_atom( +Atom , -T , +Options )
|
* @pred read_term_from_atom( +Atom , -T , +Options )
|
||||||
*
|
*
|
||||||
* read a term _T_ stored in constant _Atom_ according to _Options_
|
* read a term _T_ stored in constant _Atom_ according to _Options_
|
||||||
*
|
*
|
||||||
* @param _Atom_ the source _Atom_
|
* @param _Atom_ the source _Atom_
|
||||||
* @param _T_ the output term _T_, may be any term
|
* @param _T_ the output term _T_, may be any term
|
||||||
* @param _Options_ read_term/3 options.
|
* @param _Options_ read_term/3 options.
|
||||||
*
|
*
|
||||||
* @notes Originally from SWI-Prolog, in YAP only works with internalised
|
* @notes Originally from SWI-Prolog, in YAP only works with internalised
|
||||||
*atoms
|
*atoms
|
||||||
* Check read_term_from_atomic/3 for the general version. Also, the built-in
|
* Check read_term_from_atomic/3 for the general version. Also, the built-in
|
||||||
*is
|
*is
|
||||||
*supposed to
|
*supposed to
|
||||||
* use YAP's internal encoding, so please avoid the encoding/1 option.
|
* use YAP's internal encoding, so please avoid the encoding/1 option.
|
||||||
*/
|
*/
|
||||||
static Int read_term_from_atom(USES_REGS1) {
|
static Int read_term_from_atom(USES_REGS1) {
|
||||||
Term t1 = Deref(ARG1);
|
Term t1 = Deref(ARG1);
|
||||||
Atom at;
|
Atom at;
|
||||||
const unsigned char *s;
|
const unsigned char *s;
|
||||||
|
|
||||||
if (IsVarTerm(t1)) {
|
if (IsVarTerm(t1)) {
|
||||||
Yap_Error(INSTANTIATION_ERROR, t1, "style_check/1");
|
Yap_Error(INSTANTIATION_ERROR, t1, "style_check/1");
|
||||||
return false;
|
return false;
|
||||||
} else if (!IsAtomTerm(t1)) {
|
} else if (!IsAtomTerm(t1)) {
|
||||||
Yap_Error(TYPE_ERROR_ATOM, t1, "style_check/1");
|
Yap_Error(TYPE_ERROR_ATOM, t1, "style_check/1");
|
||||||
return false;
|
return false;
|
||||||
} else {
|
} else {
|
||||||
at = AtomOfTerm(t1);
|
at = AtomOfTerm(t1);
|
||||||
s = at->UStrOfAE;
|
s = at->UStrOfAE;
|
||||||
}
|
}
|
||||||
Term ctl = add_output(ARG2, ARG3);
|
Term ctl = add_output(ARG2, ARG3);
|
||||||
|
|
||||||
return Yap_BufferToTerm(s, ctl);
|
return Yap_BufferToTerm(s, ctl);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* @pred read_term_from_atomic( +Atomic , - T , +Options )
|
* @pred read_term_from_atomic( +Atomic , - T , +Options )
|
||||||
*
|
*
|
||||||
* read a term _T_ stored in text _Atomic_ according to _Options_
|
* read a term _T_ stored in text _Atomic_ according to _Options_
|
||||||
*
|
*
|
||||||
* @param _Atomic_ the source may be an atom, string, list of codes, or list
|
* @param _Atomic_ the source may be an atom, string, list of codes, or list
|
||||||
*of
|
*of
|
||||||
*chars.
|
*chars.
|
||||||
* @param _T_ the output term _T_, may be any term
|
* @param _T_ the output term _T_, may be any term
|
||||||
* @param _Options_ read_term/3 options.
|
* @param _Options_ read_term/3 options.
|
||||||
*
|
*
|
||||||
* @notes Idea originally from SWI-Prolog, but in YAP we separate atomic and
|
* @notes Idea originally from SWI-Prolog, but in YAP we separate atomic and
|
||||||
*atom.
|
*atom.
|
||||||
* Encoding is fixed in atoms and strings.
|
* Encoding is fixed in atoms and strings.
|
||||||
*/
|
*/
|
||||||
static Int read_term_from_atomic(USES_REGS1) {
|
static Int read_term_from_atomic(USES_REGS1) {
|
||||||
Term t1 = Deref(ARG1);
|
Term t1 = Deref(ARG1);
|
||||||
const unsigned char *s;
|
const unsigned char *s;
|
||||||
|
|
||||||
if (IsVarTerm(t1)) {
|
if (IsVarTerm(t1)) {
|
||||||
Yap_Error(INSTANTIATION_ERROR, t1, "read_term_from_atomic/3");
|
Yap_Error(INSTANTIATION_ERROR, t1, "read_term_from_atomic/3");
|
||||||
return (FALSE);
|
return (FALSE);
|
||||||
} else if (!IsAtomicTerm(t1)) {
|
} else if (!IsAtomicTerm(t1)) {
|
||||||
Yap_Error(TYPE_ERROR_ATOMIC, t1, "read_term_from_atomic/3");
|
Yap_Error(TYPE_ERROR_ATOMIC, t1, "read_term_from_atomic/3");
|
||||||
return (FALSE);
|
return (FALSE);
|
||||||
} else {
|
} else {
|
||||||
Term t = Yap_AtomicToString(t1 PASS_REGS);
|
Term t = Yap_AtomicToString(t1 PASS_REGS);
|
||||||
s = UStringOfTerm(t);
|
s = UStringOfTerm(t);
|
||||||
}
|
}
|
||||||
Term ctl = add_output(ARG2, ARG3);
|
Term ctl = add_output(ARG2, ARG3);
|
||||||
|
|
||||||
return Yap_BufferToTerm(s, ctl);
|
return Yap_BufferToTerm(s, ctl);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* @pred read_term_from_string( +String , - T , + Options )
|
* @pred read_term_from_string( +String , - T , + Options )
|
||||||
*
|
*
|
||||||
* read a term _T_ stored in constant _String_ according to _Options_
|
* read a term _T_ stored in constant _String_ according to _Options_
|
||||||
*
|
*
|
||||||
* @param _String_ the source _String_
|
* @param _String_ the source _String_
|
||||||
* @param _T_ the output term _T_, may be any term
|
* @param _T_ the output term _T_, may be any term
|
||||||
* @param _Options_ read_term/3 options.
|
* @param _Options_ read_term/3 options.
|
||||||
*
|
*
|
||||||
* @notes Idea from SWI-Prolog, in YAP only works with strings
|
* @notes Idea from SWI-Prolog, in YAP only works with strings
|
||||||
* Check read_term_from_atomic/3 for the general version.
|
* Check read_term_from_atomic/3 for the general version.
|
||||||
*/
|
*/
|
||||||
static Int read_term_from_string(USES_REGS1) {
|
static Int read_term_from_string(USES_REGS1) {
|
||||||
Term t1 = Deref(ARG1), rc;
|
Term t1 = Deref(ARG1), rc;
|
||||||
const unsigned char *s;
|
const unsigned char *s;
|
||||||
size_t len;
|
size_t len;
|
||||||
if (IsVarTerm(t1)) {
|
if (IsVarTerm(t1)) {
|
||||||
Yap_Error(INSTANTIATION_ERROR, t1, "read_term_from_string/3");
|
Yap_Error(INSTANTIATION_ERROR, t1, "read_term_from_string/3");
|
||||||
return (FALSE);
|
return (FALSE);
|
||||||
} else if (!IsStringTerm(t1)) {
|
} else if (!IsStringTerm(t1)) {
|
||||||
Yap_Error(TYPE_ERROR_STRING, t1, "read_term_from_string/3");
|
Yap_Error(TYPE_ERROR_STRING, t1, "read_term_from_string/3");
|
||||||
return (FALSE);
|
return (FALSE);
|
||||||
} else {
|
} else {
|
||||||
s = UStringOfTerm(t1);
|
s = UStringOfTerm(t1);
|
||||||
len = strlen_utf8(s);
|
len = strlen_utf8(s);
|
||||||
}
|
}
|
||||||
char *ss = (char *)s;
|
char *ss = (char *)s;
|
||||||
encoding_t enc = ENC_ISO_UTF8;
|
encoding_t enc = ENC_ISO_UTF8;
|
||||||
int sno = Yap_open_buf_read_stream(ss, len, &enc, MEM_BUF_USER);
|
int sno = Yap_open_buf_read_stream(ss, len, &enc, MEM_BUF_USER);
|
||||||
rc = Yap_read_term(sno, Deref(ARG3), 3);
|
rc = Yap_read_term(sno, Deref(ARG3), 3);
|
||||||
Yap_CloseStream(sno);
|
Yap_CloseStream(sno);
|
||||||
if (!rc)
|
if (!rc)
|
||||||
return false;
|
return false;
|
||||||
return Yap_unify(rc, ARG2);
|
return Yap_unify(rc, ARG2);
|
||||||
}
|
}
|
||||||
|
|
||||||
static Int atomic_to_term(USES_REGS1) {
|
static Int atomic_to_term(USES_REGS1) {
|
||||||
Term t1 = Deref(ARG1);
|
Term t1 = Deref(ARG1);
|
||||||
if (IsVarTerm(t1)) {
|
if (IsVarTerm(t1)) {
|
||||||
Yap_Error(INSTANTIATION_ERROR, t1, "read_term_from_string/3");
|
Yap_Error(INSTANTIATION_ERROR, t1, "read_term_from_string/3");
|
||||||
return (FALSE);
|
return (FALSE);
|
||||||
} else if (!IsAtomicTerm(t1)) {
|
} else if (!IsAtomicTerm(t1)) {
|
||||||
Yap_Error(TYPE_ERROR_ATOMIC, t1, "read_term_from_atomic/3");
|
Yap_Error(TYPE_ERROR_ATOMIC, t1, "read_term_from_atomic/3");
|
||||||
return (FALSE);
|
return (FALSE);
|
||||||
} else {
|
} else {
|
||||||
Term t = Yap_AtomicToString(t1 PASS_REGS);
|
Term t = Yap_AtomicToString(t1 PASS_REGS);
|
||||||
const unsigned char *us = UStringOfTerm(t);
|
const unsigned char *us = UStringOfTerm(t);
|
||||||
return Yap_BufferToTerm(us,
|
return Yap_BufferToTerm(us, add_output(ARG2, add_names(ARG3, TermNil)));
|
||||||
add_output(ARG2, add_names(ARG3, TermNil)));
|
}
|
||||||
}
|
}
|
||||||
}
|
|
||||||
|
|
||||||
static Int atom_to_term(USES_REGS1) {
|
static Int atom_to_term(USES_REGS1) {
|
||||||
Term t1 = Deref(ARG1);
|
Term t1 = Deref(ARG1);
|
||||||
if (IsVarTerm(t1)) {
|
if (IsVarTerm(t1)) {
|
||||||
Yap_Error(INSTANTIATION_ERROR, t1, "read_term_from_string/3");
|
Yap_Error(INSTANTIATION_ERROR, t1, "read_term_from_string/3");
|
||||||
return (FALSE);
|
return (FALSE);
|
||||||
} else if (!IsAtomTerm(t1)) {
|
} else if (!IsAtomTerm(t1)) {
|
||||||
Yap_Error(TYPE_ERROR_ATOM, t1, "read_term_from_atomic/3");
|
Yap_Error(TYPE_ERROR_ATOM, t1, "read_term_from_atomic/3");
|
||||||
return (FALSE);
|
return (FALSE);
|
||||||
} else {
|
} else {
|
||||||
Term t = Yap_AtomicToString(t1 PASS_REGS);
|
Term t = Yap_AtomicToString(t1 PASS_REGS);
|
||||||
const unsigned char *us = UStringOfTerm(t);
|
const unsigned char *us = UStringOfTerm(t);
|
||||||
return Yap_BufferToTerm(us,
|
return Yap_BufferToTerm(us, add_output(ARG2, add_names(ARG3, TermNil)));
|
||||||
add_output(ARG2, add_names(ARG3, TermNil)));
|
}
|
||||||
}
|
}
|
||||||
}
|
|
||||||
|
|
||||||
static Int string_to_term(USES_REGS1) {
|
static Int string_to_term(USES_REGS1) {
|
||||||
Term t1 = Deref(ARG1);
|
Term t1 = Deref(ARG1);
|
||||||
|
|
||||||
if (IsVarTerm(t1)) {
|
if (IsVarTerm(t1)) {
|
||||||
Yap_Error(INSTANTIATION_ERROR, t1, "read_term_from_string/3");
|
Yap_Error(INSTANTIATION_ERROR, t1, "read_term_from_string/3");
|
||||||
return (FALSE);
|
return (FALSE);
|
||||||
} else if (!IsStringTerm(t1)) {
|
} else if (!IsStringTerm(t1)) {
|
||||||
Yap_Error(TYPE_ERROR_STRING, t1, "read_term_from_string/3");
|
Yap_Error(TYPE_ERROR_STRING, t1, "read_term_from_string/3");
|
||||||
return (FALSE);
|
return (FALSE);
|
||||||
} else {
|
} else {
|
||||||
const unsigned char *us = UStringOfTerm(t1);
|
const unsigned char *us = UStringOfTerm(t1);
|
||||||
return Yap_BufferToTerm(us,
|
return Yap_BufferToTerm(us, add_output(ARG2, add_names(ARG3, TermNil)));
|
||||||
add_output(ARG2, add_names(ARG3, TermNil)));
|
}
|
||||||
}
|
}
|
||||||
}
|
|
||||||
|
|
||||||
void Yap_InitReadTPreds(void) {
|
void Yap_InitReadTPreds(void) {
|
||||||
Yap_InitCPred("read_term", 2, read_term2, SyncPredFlag);
|
Yap_InitCPred("read_term", 2, read_term2, SyncPredFlag);
|
||||||
Yap_InitCPred("read_term", 3, read_term, SyncPredFlag);
|
Yap_InitCPred("read_term", 3, read_term, SyncPredFlag);
|
||||||
|
|
||||||
Yap_InitCPred("scan_to_list", 2, scan_to_list, SyncPredFlag);
|
Yap_InitCPred("scan_to_list", 2, scan_to_list, SyncPredFlag);
|
||||||
Yap_InitCPred("read", 1, read1, SyncPredFlag);
|
Yap_InitCPred("read", 1, read1, SyncPredFlag);
|
||||||
Yap_InitCPred("read", 2, read2, SyncPredFlag);
|
Yap_InitCPred("read", 2, read2, SyncPredFlag);
|
||||||
Yap_InitCPred("read_clause", 2, read_clause2, SyncPredFlag);
|
Yap_InitCPred("read_clause", 2, read_clause2, SyncPredFlag);
|
||||||
Yap_InitCPred("read_clause", 3, read_clause, 0);
|
Yap_InitCPred("read_clause", 3, read_clause, 0);
|
||||||
Yap_InitCPred("read_term_from_atom", 3, read_term_from_atom, 0);
|
Yap_InitCPred("read_term_from_atom", 3, read_term_from_atom, 0);
|
||||||
Yap_InitCPred("read_term_from_atomic", 3, read_term_from_atomic, 0);
|
Yap_InitCPred("read_term_from_atomic", 3, read_term_from_atomic, 0);
|
||||||
Yap_InitCPred("read_term_from_string", 3, read_term_from_string, 0);
|
Yap_InitCPred("read_term_from_string", 3, read_term_from_string, 0);
|
||||||
Yap_InitCPred("atom_to_term", 3, atom_to_term, 0);
|
Yap_InitCPred("atom_to_term", 3, atom_to_term, 0);
|
||||||
Yap_InitCPred("atomic_to_term", 3, atomic_to_term, 0);
|
Yap_InitCPred("atomic_to_term", 3, atomic_to_term, 0);
|
||||||
Yap_InitCPred("string_to_term", 3, string_to_term, 0);
|
Yap_InitCPred("string_to_term", 3, string_to_term, 0);
|
||||||
|
|
||||||
Yap_InitCPred("fileerrors", 0, fileerrors, SyncPredFlag);
|
Yap_InitCPred("fileerrors", 0, fileerrors, SyncPredFlag);
|
||||||
Yap_InitCPred("nofileeleerrors", 0, nofileerrors, SyncPredFlag);
|
Yap_InitCPred("nofileeleerrors", 0, nofileerrors, SyncPredFlag);
|
||||||
Yap_InitCPred("source_location", 2, source_location, SyncPredFlag);
|
Yap_InitCPred("source_location", 2, source_location, SyncPredFlag);
|
||||||
Yap_InitCPred("$style_checker", 1, style_checker,
|
Yap_InitCPred("$style_checker", 1, style_checker,
|
||||||
SyncPredFlag | HiddenPredFlag);
|
SyncPredFlag | HiddenPredFlag);
|
||||||
}
|
}
|
||||||
|
10
os/sockets.c
10
os/sockets.c
@ -38,7 +38,7 @@ static char SccsId[] = "%W% %G%";
|
|||||||
#if HAVE_IO_H
|
#if HAVE_IO_H
|
||||||
/* Windows */
|
/* Windows */
|
||||||
#include <io.h>
|
#include <io.h>
|
||||||
#endif
|
#endif
|
||||||
#if HAVE_SOCKET
|
#if HAVE_SOCKET
|
||||||
#include <winsock2.h>
|
#include <winsock2.h>
|
||||||
#endif
|
#endif
|
||||||
@ -84,7 +84,7 @@ Yap_socketStream( StreamDesc *s )
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/*
|
/*
|
||||||
sockets cannot use standard FILE *, we have to go through fds, and in the
|
sockets cannot use standard FILE *, we have to go through fds, and in the
|
||||||
case of VC++, we have to use the receive routines...
|
case of VC++, we have to use the receive routines...
|
||||||
*/
|
*/
|
||||||
@ -108,7 +108,7 @@ SocketGetc(int sno)
|
|||||||
ch = c;
|
ch = c;
|
||||||
} else {
|
} else {
|
||||||
#if HAVE_STRERROR
|
#if HAVE_STRERROR
|
||||||
Yap_Error(SYSTEM_ERROR_INTERNAL, TermNil,
|
Yap_Error(SYSTEM_ERROR_INTERNAL, TermNil,
|
||||||
"( socket_getc: %s)", strerror(errno));
|
"( socket_getc: %s)", strerror(errno));
|
||||||
#else
|
#else
|
||||||
Yap_Error(SYSTEM_ERROR_INTERNAL, TermNil,
|
Yap_Error(SYSTEM_ERROR_INTERNAL, TermNil,
|
||||||
@ -211,7 +211,7 @@ SocketPutc (int sno, int ch)
|
|||||||
Yap_Error(PERMISSION_ERROR_INPUT_STREAM, TermNil, "error writing stream socket: %s", strerror(errno));
|
Yap_Error(PERMISSION_ERROR_INPUT_STREAM, TermNil, "error writing stream socket: %s", strerror(errno));
|
||||||
#else
|
#else
|
||||||
Yap_Error(PERMISSION_ERROR_INPUT_STREAM, TermNil, "error writing stream socket");
|
Yap_Error(PERMISSION_ERROR_INPUT_STREAM, TermNil, "error writing stream socket");
|
||||||
#endif
|
#endif
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -256,6 +256,8 @@ Yap_InitSocketStream(int fd, socket_info flags, socket_domain domain) {
|
|||||||
st->charcount = 0;
|
st->charcount = 0;
|
||||||
st->linecount = 1;
|
st->linecount = 1;
|
||||||
st->linepos = 0;
|
st->linepos = 0;
|
||||||
|
st->vfs = NULL;
|
||||||
|
st->recbs = NULL;
|
||||||
st->stream_putc = SocketPutc;
|
st->stream_putc = SocketPutc;
|
||||||
st->stream_getc = SocketGetc;
|
st->stream_getc = SocketGetc;
|
||||||
Yap_DefaultStreamOps( st );
|
Yap_DefaultStreamOps( st );
|
||||||
|
@ -701,7 +701,29 @@ wint_t = c_uint
|
|||||||
# } __value; /* Value so far. */
|
# } __value; /* Value so far. */
|
||||||
#} __mbstate_t;
|
#} __mbstate_t;
|
||||||
|
|
||||||
class _mbstate_t_value(Union):
|
class lK_mbstate_t_value(Union):
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
_fields_ = [("__wch",wint_t),
|
_fields_ = [("__wch",wint_t),
|
||||||
("__wchb",c_char*4)]
|
("__wchb",c_char*4)]
|
||||||
|
|
||||||
|
@ -698,68 +698,66 @@ static PyObject *structseq_repr(PyObject *iobj) {
|
|||||||
}
|
}
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
static bool
|
static bool legal_symbol(const char *s) {
|
||||||
legal_symbol( const char *s)
|
int ch;
|
||||||
{
|
while (((ch = *s++) != '\0')) {
|
||||||
int ch;
|
if (isalnum(ch) || ch == '_')
|
||||||
while(((ch = *s++) != '\0')) {
|
continue;
|
||||||
if (isalnum(ch) || ch == '_')
|
return false;
|
||||||
continue;
|
}
|
||||||
return false;
|
return true;
|
||||||
}
|
|
||||||
return true;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
PyObject *term_to_nametuple(const char *s, arity_t arity, PyObject *tuple) {
|
PyObject *term_to_nametuple(const char *s, arity_t arity, PyObject *tuple) {
|
||||||
PyObject *o, *d = NULL;
|
PyObject *o, *d = NULL;
|
||||||
if (legal_symbol(s)) {
|
if (legal_symbol(s)) {
|
||||||
PyTypeObject *typp;
|
PyTypeObject *typp;
|
||||||
PyObject *key = PyUnicode_FromString(s);
|
PyObject *key = PyUnicode_FromString(s);
|
||||||
if (Py_f2p && (d = PyList_GetItem(Py_f2p, arity)) &&
|
if (Py_f2p && (d = PyList_GetItem(Py_f2p, arity)) &&
|
||||||
PyDict_Contains(d, key)) {
|
PyDict_Contains(d, key)) {
|
||||||
typp = (PyTypeObject *) PyDict_GetItem(d, key);
|
typp = (PyTypeObject *)PyDict_GetItem(d, key);
|
||||||
Py_INCREF(typp);
|
|
||||||
} else {
|
|
||||||
typp = calloc(sizeof(PyTypeObject), 1);
|
|
||||||
PyStructSequence_Desc *desc = calloc(sizeof(PyStructSequence_Desc), 1);
|
|
||||||
desc->name = PyMem_Malloc(strlen(s) + 1);
|
|
||||||
strcpy(desc->name, s);
|
|
||||||
desc->doc = "YAPTerm";
|
|
||||||
desc->fields = pnull;
|
|
||||||
desc->n_in_sequence = arity;
|
|
||||||
if (PyStructSequence_InitType2(typp, desc) < 0)
|
|
||||||
return NULL;
|
|
||||||
// typp->tp_flags &= ~Py_TPFLAGS_HEAPTYPE;
|
|
||||||
// typp->tp_flags &= ~Py_TPFLAGS_HAVE_GC;
|
|
||||||
// typp->tp_str = structseq_str;
|
|
||||||
typp->tp_repr = structseq_repr;
|
|
||||||
// typp = PyStructSequence_NewType(desc);
|
|
||||||
// don't do this: we cannot add a type as an atribute.
|
|
||||||
// PyModule_AddGObject(py_Main, s, (PyObject *)typp);
|
|
||||||
if (d && !PyDict_Contains(d, key))
|
|
||||||
PyDict_SetItem(d, key, (PyObject *) typp);
|
|
||||||
Py_DECREF(key);
|
|
||||||
Py_INCREF(typp);
|
|
||||||
}
|
|
||||||
o = PyStructSequence_New(typp);
|
|
||||||
Py_INCREF(typp);
|
Py_INCREF(typp);
|
||||||
arity_t i;
|
} else {
|
||||||
for (i = 0; i < arity; i++) {
|
typp = calloc(sizeof(PyTypeObject), 1);
|
||||||
PyObject *pArg = PyTuple_GET_ITEM(tuple, i);
|
PyStructSequence_Desc *desc = calloc(sizeof(PyStructSequence_Desc), 1);
|
||||||
Py_INCREF(pArg);
|
desc->name = PyMem_Malloc(strlen(s) + 1);
|
||||||
if (pArg)
|
strcpy(desc->name, s);
|
||||||
PyStructSequence_SET_ITEM(o, i, pArg);
|
desc->doc = "YAPTerm";
|
||||||
// PyObject_Print(pArg,stderr,0);fputc('\n',stderr);
|
desc->fields = pnull;
|
||||||
}
|
desc->n_in_sequence = arity;
|
||||||
//((PyStructSequence *)o)->ob_base.ob_size = arity;
|
if (PyStructSequence_InitType2(typp, desc) < 0)
|
||||||
// PyObject_Print(o,stderr,0);fputc('\n',stderr);
|
return NULL;
|
||||||
return o;
|
// typp->tp_flags &= ~Py_TPFLAGS_HEAPTYPE;
|
||||||
|
// typp->tp_flags &= ~Py_TPFLAGS_HAVE_GC;
|
||||||
|
// typp->tp_str = structseq_str;
|
||||||
|
typp->tp_repr = structseq_repr;
|
||||||
|
// typp = PyStructSequence_NewType(desc);
|
||||||
|
// don't do this: we cannot add a type as an atribute.
|
||||||
|
// PyModule_AddGObject(py_Main, s, (PyObject *)typp);
|
||||||
|
if (d && !PyDict_Contains(d, key))
|
||||||
|
PyDict_SetItem(d, key, (PyObject *)typp);
|
||||||
|
Py_DECREF(key);
|
||||||
|
Py_INCREF(typp);
|
||||||
|
}
|
||||||
|
o = PyStructSequence_New(typp);
|
||||||
|
Py_INCREF(typp);
|
||||||
|
arity_t i;
|
||||||
|
for (i = 0; i < arity; i++) {
|
||||||
|
PyObject *pArg = PyTuple_GET_ITEM(tuple, i);
|
||||||
|
Py_INCREF(pArg);
|
||||||
|
if (pArg)
|
||||||
|
PyStructSequence_SET_ITEM(o, i, pArg);
|
||||||
|
// PyObject_Print(pArg,stderr,0);fputc('\n',stderr);
|
||||||
|
}
|
||||||
|
//((PyStructSequence *)o)->ob_base.ob_size = arity;
|
||||||
|
// PyObject_Print(o,stderr,0);fputc('\n',stderr);
|
||||||
|
return o;
|
||||||
} else {
|
} else {
|
||||||
PyObject *o1;
|
PyObject *o1;
|
||||||
o1 = PyTuple_New(2);
|
o1 = PyTuple_New(2);
|
||||||
PyTuple_SET_ITEM(o1, 0, PyUnicode_FromString(s));
|
PyTuple_SET_ITEM(o1, 0, PyUnicode_FromString(s));
|
||||||
PyTuple_SET_ITEM(o1, 1, tuple);
|
PyTuple_SET_ITEM(o1, 1, tuple);
|
||||||
return o1;
|
return o1;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -945,7 +943,7 @@ PyObject *compound_to_pyeval(term_t t, PyObject *context, bool cvt) {
|
|||||||
AOK(PL_get_arg(1, t, targ), NULL);
|
AOK(PL_get_arg(1, t, targ), NULL);
|
||||||
ptr = term_to_python(targ, true, NULL, true);
|
ptr = term_to_python(targ, true, NULL, true);
|
||||||
return PyObject_Dir(ptr);
|
return PyObject_Dir(ptr);
|
||||||
|
{}
|
||||||
}
|
}
|
||||||
|
|
||||||
else if (fun == FUNCTOR_plus2) {
|
else if (fun == FUNCTOR_plus2) {
|
||||||
@ -1004,9 +1002,10 @@ PyObject *compound_to_pyeval(term_t t, PyObject *context, bool cvt) {
|
|||||||
if (!arity) {
|
if (!arity) {
|
||||||
char *s = NULL;
|
char *s = NULL;
|
||||||
PyObject *pValue;
|
PyObject *pValue;
|
||||||
|
|
||||||
AOK(PL_get_atom_chars(t, &s), NULL);
|
AOK(PL_get_atom_chars(t, &s), NULL);
|
||||||
|
PyObject_Print(o, stderr, 0);
|
||||||
pValue = PyObject_GetAttrString(o, s);
|
pValue = PyObject_GetAttrString(o, s);
|
||||||
|
PyObject_Print(pValue, stderr, 0);
|
||||||
if (CHECKNULL(t, pValue) == NULL) {
|
if (CHECKNULL(t, pValue) == NULL) {
|
||||||
PyErr_Print();
|
PyErr_Print();
|
||||||
return NULL;
|
return NULL;
|
||||||
@ -1014,43 +1013,68 @@ PyObject *compound_to_pyeval(term_t t, PyObject *context, bool cvt) {
|
|||||||
return pValue;
|
return pValue;
|
||||||
} else {
|
} else {
|
||||||
char *s = PL_atom_chars(name);
|
char *s = PL_atom_chars(name);
|
||||||
PyObject *ys = lookupPySymbol(s, o, NULL);
|
PyObject *ys = lookupPySymbol(s, o, NULL), *pArgs;
|
||||||
PyObject *pArgs = PyTuple_New(arity);
|
|
||||||
DebugPrintf("Tuple %p\n", pArgs);
|
DebugPrintf("Tuple %p\n", pArgs);
|
||||||
int i;
|
int i;
|
||||||
term_t tleft = PL_new_term_ref();
|
term_t tleft = PL_new_term_ref();
|
||||||
for (i = 0; i < arity; i++) {
|
bool indict = true;
|
||||||
|
PyObject *pyDict = PyDict_New();
|
||||||
|
|
||||||
|
for (i = arity; i > 0; i--) {
|
||||||
PyObject *pArg;
|
PyObject *pArg;
|
||||||
AOK(PL_get_arg(i + 1, t, tleft), NULL);
|
AOK(PL_get_arg(i, t, tleft), NULL);
|
||||||
/* ignore (_) */
|
/* ignore (_) */
|
||||||
if (i == 0 && PL_is_variable(tleft)) {
|
if (indict) {
|
||||||
pArg = Py_None;
|
if (PL_get_functor(tleft, &fun) && fun == FUNCTOR_equal2) {
|
||||||
} else {
|
term_t tatt = PL_new_term_ref();
|
||||||
pArg = term_to_python(tleft, true, NULL, true);
|
AOK(PL_get_arg(1, tleft, tatt), NULL);
|
||||||
// PyObject_Print(pArg,fdopen(2,"w"),0);
|
PyObject *key = term_to_python(tatt, true, NULL, true);
|
||||||
if (pArg == NULL) {
|
AOK(PL_get_arg(2, tleft, tatt), NULL);
|
||||||
pArg = Py_None;
|
PyObject *val = term_to_python(tatt, true, NULL, true);
|
||||||
|
PyDict_SetItem(pyDict, key, val);
|
||||||
|
} else {
|
||||||
|
indict = false;
|
||||||
|
pArgs = PyTuple_New(i);
|
||||||
}
|
}
|
||||||
/* pArg reference stolen here: */
|
|
||||||
Py_INCREF(pArg);
|
|
||||||
}
|
}
|
||||||
|
if (!indict) {
|
||||||
|
if (PL_is_variable(tleft)) {
|
||||||
|
pArg = Py_None;
|
||||||
|
} else {
|
||||||
|
pArg = term_to_python(tleft, true, NULL, true);
|
||||||
|
// PyObject_Print(pArg,fdopen(2,"w"),0);
|
||||||
|
if (pArg == NULL) {
|
||||||
|
pArg = Py_None;
|
||||||
|
}
|
||||||
|
/* pArg reference stolen here: */
|
||||||
|
Py_INCREF(pArg);
|
||||||
|
}
|
||||||
|
|
||||||
PyTuple_SetItem(pArgs, i, pArg);
|
PyTuple_SetItem(pArgs, i - 1, pArg);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
PyObject *rc;
|
if (indict) {
|
||||||
|
pArgs = PyTuple_New(0);
|
||||||
|
}
|
||||||
|
|
||||||
|
PyObject *rc;
|
||||||
if (ys && PyCallable_Check(ys)) {
|
if (ys && PyCallable_Check(ys)) {
|
||||||
|
PyObject_Print(ys, stderr, 0);
|
||||||
|
PyObject_Print(pArgs, stderr, 0);
|
||||||
|
PyObject_Print(pyDict, stderr, 0);
|
||||||
|
|
||||||
// PyObject_Print(pArgs, stderr, 0);
|
// PyObject_Print(pArgs, stderr, 0);
|
||||||
// PyObject_Print(o, stderr, 0);
|
// PyObject_Print(o, stderr, 0);
|
||||||
CHECK_CALL(rc, t, PyObject_CallObject(ys, pArgs));
|
CHECK_CALL(rc, t, PyObject_Call(ys, pArgs, pyDict));
|
||||||
Py_DECREF(pArgs);
|
Py_DECREF(pArgs);
|
||||||
Py_DECREF(ys);
|
Py_DECREF(ys);
|
||||||
DebugPrintf("CallObject %p\n", rc);
|
PyObject_Print(rc, stderr, 0);
|
||||||
|
DebugPrintf("CallObject %p\n", rc);
|
||||||
} else {
|
} else {
|
||||||
rc = term_to_nametuple(s, arity, pArgs);
|
rc = term_to_nametuple(s, arity, pArgs);
|
||||||
}
|
}
|
||||||
|
|
||||||
return rc;
|
return rc;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -77,14 +77,24 @@ static int py_put(int sno, int ch) {
|
|||||||
return ch;
|
return ch;
|
||||||
}
|
}
|
||||||
|
|
||||||
static int py_get(int sno) {
|
static int py_get(int sno)
|
||||||
|
{
|
||||||
StreamDesc *s = YAP_GetStreamFromId(sno);
|
StreamDesc *s = YAP_GetStreamFromId(sno);
|
||||||
PyObject *fget = PyObject_GetAttrString(s->u.private_data, "read");
|
PyObject *fget = PyObject_GetAttrString(s->u.private_data, "read");
|
||||||
PyObject *pyr = PyObject_CallFunctionObjArgs(fget, PyLong_FromLong(1), NULL);
|
PyObject *pyr = PyObject_CallFunctionObjArgs(fget, PyLong_FromLong(1), NULL);
|
||||||
return PyUnicode_READ_CHAR(pyr, 0);
|
return PyUnicode_READ_CHAR(pyr, 0);
|
||||||
}
|
}
|
||||||
|
|
||||||
static int64_t py_seek(int sno, int64_t where, int how) {
|
static int py_peek(int sno)
|
||||||
|
{
|
||||||
|
StreamDesc *s = YAP_GetStreamFromId(sno);
|
||||||
|
PyObject *fget = PyObject_GetAttrString(s->u.private_data, "peek");
|
||||||
|
PyObject *pyr = PyObject_CallFunctionObjArgs(fget, PyLong_FromLong(1), NULL);
|
||||||
|
return PyUnicode_READ_CHAR(pyr, 0);
|
||||||
|
}
|
||||||
|
|
||||||
|
static int64_t py_seek(int sno, int64_t where, int how)
|
||||||
|
{
|
||||||
StreamDesc *s = YAP_GetStreamFromId(sno);
|
StreamDesc *s = YAP_GetStreamFromId(sno);
|
||||||
PyObject *fseek = PyObject_GetAttrString(s->u.private_data, "seek");
|
PyObject *fseek = PyObject_GetAttrString(s->u.private_data, "seek");
|
||||||
PyObject *pyr = PyObject_CallFunctionObjArgs(fseek, PyLong_FromLong(where),
|
PyObject *pyr = PyObject_CallFunctionObjArgs(fseek, PyLong_FromLong(where),
|
||||||
@ -124,6 +134,7 @@ static bool init_python_stream(void) {
|
|||||||
pystream.open = py_open;
|
pystream.open = py_open;
|
||||||
pystream.close = py_close;
|
pystream.close = py_close;
|
||||||
pystream.get_char = py_get;
|
pystream.get_char = py_get;
|
||||||
|
pystream.peek_char = py_peek;
|
||||||
pystream.put_char = py_put;
|
pystream.put_char = py_put;
|
||||||
pystream.flush = py_flush;
|
pystream.flush = py_flush;
|
||||||
pystream.seek = py_seek;
|
pystream.seek = py_seek;
|
||||||
|
@ -1,4 +1,4 @@
|
|||||||
#!/usr/bin/env python
|
#!/usr/bin/env python
|
||||||
# coding: utf-8
|
# coding: utf-8
|
||||||
|
|
||||||
# Copyright (c) IPython Development Team.
|
# Copyright (c) IPython Development Team.
|
||||||
@ -64,7 +64,7 @@ if platform.system() == 'Windows':
|
|||||||
win_libs = ['wsock32','ws2_32']
|
win_libs = ['wsock32','ws2_32']
|
||||||
my_extra_link_args = ['-Wl,-export-all-symbols']
|
my_extra_link_args = ['-Wl,-export-all-symbols']
|
||||||
elif platform.system() == 'Darwin':
|
elif platform.system() == 'Darwin':
|
||||||
my_extra_link_args = ['-L','..']
|
my_extra_link_args = ['-L','..','-Wl,-rpath','-Wl,${CMAKE_INSTALL_FULL_LIBDIR}']
|
||||||
win_libs = []
|
win_libs = []
|
||||||
local_libs = ['Py4YAP']
|
local_libs = ['Py4YAP']
|
||||||
elif platform.system() == 'Linux':
|
elif platform.system() == 'Linux':
|
||||||
|
@ -13,19 +13,19 @@ if platform.system() == 'Windows':
|
|||||||
def load( dll ):
|
def load( dll ):
|
||||||
dll = glob.glob(os.path.join(yap_lib_path,dll))[0]
|
dll = glob.glob(os.path.join(yap_lib_path,dll))[0]
|
||||||
dll = os.path.abspath(dll)
|
dll = os.path.abspath(dll)
|
||||||
ctypes.WinDLL(dll)
|
ctypes.WinDLL(dll)s
|
||||||
elif platform.system() == 'Darwin':
|
elif platform.system() == 'Darwin':
|
||||||
def load( dll ):
|
def load( dll ):
|
||||||
dll = glob.glob(os.path.join(yap_lib_path,dll))[0]
|
dll = glob.glob(os.path.join(os.path.realpath(__file__),dll))[0]
|
||||||
dll = os.path.abspath(dll)
|
dll = os.path.abspath(dll)
|
||||||
ctypes.CDLL(dll)
|
ctypes.CDLL(dll)
|
||||||
load('libYap.dylib')
|
# load('libYap.dylib')
|
||||||
load('libPy4YAP.dylib')
|
# load('libPy4YAP.dylib')
|
||||||
else:
|
load( '_yap.dylib' )
|
||||||
def load( dll ):
|
#else:
|
||||||
dll = glob.glob(os.path.join(yap_lib_path,dll))[0]
|
# def load( dll ):
|
||||||
dll = os.path.abspath(dll)
|
# dll = glob.glob(os.path.join(yap_lib_path,dll))[0]
|
||||||
ctypes.CDLL(dll)
|
# dll = os.path.abspath(dll)
|
||||||
load('libYap.so')
|
# ctypes.CDLL(dll)
|
||||||
load('libPy4YAP.so')
|
# load('libYap.so')
|
||||||
|
# load('libPy4YAP.so')
|
@ -1,7 +1,6 @@
|
|||||||
"""The main routine of the yap python project."""
|
"""The main routine of the yap python project."""
|
||||||
|
|
||||||
import sys
|
import sys
|
||||||
import yap4py.yapi
|
|
||||||
|
|
||||||
|
|
||||||
def main(**args):
|
def main(**args):
|
||||||
@ -10,5 +9,6 @@ def main(**args):
|
|||||||
args = sys.argv[1:]
|
args = sys.argv[1:]
|
||||||
|
|
||||||
if __name__ == "__main__":
|
if __name__ == "__main__":
|
||||||
|
import yap4py.yapi
|
||||||
main()
|
main()
|
||||||
yap4py.yapi.main()
|
yap4py.yapi.main()
|
||||||
|
@ -1,4 +1,3 @@
|
|||||||
|
|
||||||
set (EXTRAS
|
set (EXTRAS
|
||||||
MANIFEST.in
|
MANIFEST.in
|
||||||
YAP_KERNEL.md
|
YAP_KERNEL.md
|
||||||
@ -60,21 +59,14 @@
|
|||||||
yap_kernel/pylab/config.py
|
yap_kernel/pylab/config.py
|
||||||
)
|
)
|
||||||
|
|
||||||
configure_file(setup.py.in ${CMAKE_CURRENT_BINARY_DIR}/setup.py)
|
configure_file(setup.py.in ${CMAKE_CURRENT_BINARY_DIR}/setup.py)
|
||||||
|
configure_file(${CMAKE_SOURCE_DIR}/misc/editors/prolog.js.in ${CMAKE_CURRENT_BINARY_DIR}/prolog.js )
|
||||||
|
|
||||||
file(MAKE_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR}/yap_kernel/resources )
|
|
||||||
file( COPY ${CMAKE_SOURCE_DIR}/docs/icons/yap_32x32x32.png
|
|
||||||
DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/yap_kernel/resources/ )
|
|
||||||
file( RENAME ${CMAKE_CURRENT_BINARY_DIR}/yap_kernel/resources/yap_32x32x32.png ${CMAKE_CURRENT_BINARY_DIR}/yap_kernel/resources/logo-32x32.png )
|
|
||||||
file( COPY ${CMAKE_SOURCE_DIR}/docs/icons/yap_64x64x32.png DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/yap_kernel/resources )
|
|
||||||
file( RENAME ${CMAKE_CURRENT_BINARY_DIR}/yap_kernel/resources/yap_64x64x32.png ${CMAKE_CURRENT_BINARY_DIR}/yap_kernel/resources/logo-64x64.png )
|
|
||||||
file( COPY ${CMAKE_CURRENT_SOURCE_DIR}/kernel.js DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/yap_kernel/resources/ )
|
|
||||||
file( COPY ${CMAKE_SOURCE_DIR}/misc/editors/prolog.js DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/yap_kernel/resources/)
|
|
||||||
|
|
||||||
set(SETUP_PY ${CMAKE_CURRENT_BINARY_DIR}/setup.py)
|
set(SETUP_PY ${CMAKE_CURRENT_BINARY_DIR}/setup.py)
|
||||||
|
|
||||||
add_custom_target( YAPKernel ALL
|
add_custom_target( YAPKernel ALL
|
||||||
COMMAND ${PYTHON_EXECUTABLE} ${SETUP_PY} build sdist bdist
|
COMMAND ${PYTHON_EXECUTABLE} ${SETUP_PY} build sdist bdist
|
||||||
WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR}
|
WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR}
|
||||||
DEPENDS YAP4PY
|
DEPENDS YAP4PY
|
||||||
)
|
)
|
||||||
@ -83,4 +75,3 @@
|
|||||||
WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR})")
|
WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR})")
|
||||||
|
|
||||||
install(FILES ${PL_SOURCES} DESTINATION ${libpl} )
|
install(FILES ${PL_SOURCES} DESTINATION ${libpl} )
|
||||||
|
|
||||||
|
@ -1,204 +1,9 @@
|
|||||||
define( function() {
|
/*define(['./prolog.js'], function(){
|
||||||
return {onload:function() {
|
|
||||||
console.info('Kernel specific javascript loaded');
|
|
||||||
// do more things here, like define a codemirror mode]]
|
|
||||||
require(['codemirror/lib/codemirror', 'codemirror/mode/meta'], function(CodeMirror) {
|
|
||||||
` CodeMirror.mI = [
|
|
||||||
{name: "APL", mime: "text/apl", mode: "apl", ext: ["dyalog", "apl"]},
|
|
||||||
{name: "PGP", mimes: ["application/pgp", "application/pgp-keys", "application/pgp-signature"], mode: "asciiarmor", ext: ["pgp"]},
|
|
||||||
{name: "ASN.1", mime: "text/x-ttcn-asn", mode: "asn.1", ext: ["asn", "asn1"]},
|
|
||||||
{name: "Asterisk", mime: "text/x-asterisk", mode: "asterisk", file: /^extensions\.conf$/i},
|
|
||||||
{name: "Brainfuck", mime: "text/x-brainfuck", mode: "brainfuck", ext: ["b", "bf"]},
|
|
||||||
{name: "C", mime: "text/x-csrc", mode: "clike", ext: ["c", "h"]},
|
|
||||||
{name: "C++", mime: "text/x-c++src", mode: "clike", ext: ["cpp", "c++", "cc", "cxx", "hpp", "h++", "hh", "hxx"], alias: ["cpp"]},
|
|
||||||
{name: "Cobol", mime: "text/x-cobol", mode: "cobol", ext: ["cob", "cpy"]},
|
|
||||||
{name: "C#", mime: "text/x-csharp", mode: "clike", ext: ["cs"], alias: ["csharp"]},
|
|
||||||
{name: "Clojure", mime: "text/x-clojure", mode: "clojure", ext: ["clj", "cljc", "cljx"]},
|
|
||||||
{name: "ClojureScript", mime: "text/x-clojurescript", mode: "clojure", ext: ["cljs"]},
|
|
||||||
{name: "Closure Stylesheets (GSS)", mime: "text/x-gss", mode: "css", ext: ["gss"]},
|
|
||||||
{name: "CMake", mime: "text/x-cmake", mode: "cmake", ext: ["cmake", "cmake.in"], file: /^CMakeLists.txt$/},
|
|
||||||
{name: "CoffeeScript", mime: "text/x-coffeescript", mode: "coffeescript", ext: ["coffee"], alias: ["coffee", "coffee-script"]},
|
|
||||||
{name: "Common Lisp", mime: "text/x-common-lisp", mode: "commonlisp", ext: ["cl", "lisp", "el"], alias: ["lisp"]},
|
|
||||||
{name: "Cypher", mime: "application/x-cypher-query", mode: "cypher", ext: ["cyp", "cypher"]},
|
|
||||||
{name: "Cython", mime: "text/x-cython", mode: "python", ext: ["pyx", "pxd", "pxi"]},
|
|
||||||
{name: "Crystal", mime: "text/x-crystal", mode: "crystal", ext: ["cr"]},
|
|
||||||
{name: "CSS", mime: "text/css", mode: "css", ext: ["css"]},
|
|
||||||
{name: "CQL", mime: "text/x-cassandra", mode: "sql", ext: ["cql"]},
|
|
||||||
{name: "D", mime: "text/x-d", mode: "d", ext: ["d"]},
|
|
||||||
{name: "Dart", mimes: ["application/dart", "text/x-dart"], mode: "dart", ext: ["dart"]},
|
|
||||||
{name: "diff", mime: "text/x-diff", mode: "diff", ext: ["diff", "patch"]},
|
|
||||||
{name: "Django", mime: "text/x-django", mode: "django"},
|
|
||||||
{name: "Dockerfile", mime: "text/x-dockerfile", mode: "dockerfile", file: /^Dockerfile$/},
|
|
||||||
{name: "DTD", mime: "application/xml-dtd", mode: "dtd", ext: ["dtd"]},
|
|
||||||
{name: "Dylan", mime: "text/x-dylan", mode: "dylan", ext: ["dylan", "dyl", "intr"]},
|
|
||||||
{name: "EBNF", mime: "text/x-ebnf", mode: "ebnf"},
|
|
||||||
{name: "ECL", mime: "text/x-ecl", mode: "ecl", ext: ["ecl"]},
|
|
||||||
{name: "edn", mime: "application/edn", mode: "clojure", ext: ["edn"]},
|
|
||||||
{name: "Eiffel", mime: "text/x-eiffel", mode: "eiffel", ext: ["e"]},
|
|
||||||
{name: "Elm", mime: "text/x-elm", mode: "elm", ext: ["elm"]},
|
|
||||||
{name: "Embedded Javascript", mime: "application/x-ejs", mode: "htmlembedded", ext: ["ejs"]},
|
|
||||||
{name: "Embedded Ruby", mime: "application/x-erb", mode: "htmlembedded", ext: ["erb"]},
|
|
||||||
{name: "Erlang", mime: "text/x-erlang", mode: "erlang", ext: ["erl"]},
|
|
||||||
{name: "Factor", mime: "text/x-factor", mode: "factor", ext: ["factor"]},
|
|
||||||
{name: "FCL", mime: "text/x-fcl", mode: "fcl"},
|
|
||||||
{name: "Forth", mime: "text/x-forth", mode: "forth", ext: ["forth", "fth", "4th"]},
|
|
||||||
{name: "Fortran", mime: "text/x-fortran", mode: "fortran", ext: ["f", "for", "f77", "f90"]},
|
|
||||||
{name: "F#", mime: "text/x-fsharp", mode: "mllike", ext: ["fs"], alias: ["fsharp"]},
|
|
||||||
{name: "Gas", mime: "text/x-gas", mode: "gas", ext: ["s"]},
|
|
||||||
{name: "Gherkin", mime: "text/x-feature", mode: "gherkin", ext: ["feature"]},
|
|
||||||
{name: "GitHub Flavored Markdown", mime: "text/x-gfm", mode: "gfm", file: /^(readme|contributing|history).md$/i},
|
|
||||||
{name: "Go", mime: "text/x-go", mode: "go", ext: ["go"]},
|
|
||||||
{name: "Groovy", mime: "text/x-groovy", mode: "groovy", ext: ["groovy", "gradle"], file: /^Jenkinsfile$/},
|
|
||||||
{name: "HAML", mime: "text/x-haml", mode: "haml", ext: ["haml"]},
|
|
||||||
{name: "Haskell", mime: "text/x-haskell", mode: "haskell", ext: ["hs"]},
|
|
||||||
{name: "Haskell (Literate)", mime: "text/x-literate-haskell", mode: "haskell-literate", ext: ["lhs"]},
|
|
||||||
{name: "Haxe", mime: "text/x-haxe", mode: "haxe", ext: ["hx"]},
|
|
||||||
{name: "HXML", mime: "text/x-hxml", mode: "haxe", ext: ["hxml"]},
|
|
||||||
{name: "ASP.NET", mime: "application/x-aspx", mode: "htmlembedded", ext: ["aspx"], alias: ["asp", "aspx"]},
|
|
||||||
{name: "HTML", mime: "text/html", mode: "htmlmixed", ext: ["html", "htm"], alias: ["xhtml"]},
|
|
||||||
{name: "HTTP", mime: "message/http", mode: "http"},
|
|
||||||
{name: "IDL", mime: "text/x-idl", mode: "idl", ext: ["pro"]},
|
|
||||||
{name: "Pug", mime: "text/x-pug", mode: "pug", ext: ["jade", "pug"], alias: ["jade"]},
|
|
||||||
{name: "Java", mime: "text/x-java", mode: "clike", ext: ["java"]},
|
|
||||||
{name: "Java Server Pages", mime: "application/x-jsp", mode: "htmlembedded", ext: ["jsp"], alias: ["jsp"]},
|
|
||||||
{name: "JavaScript", mimes: ["text/javascript", "text/ecmascript", "application/javascript", "application/x-javascript", "application/ecmascript"],
|
|
||||||
mode: "javascript", ext: ["js"], alias: ["ecmascript", "js", "node"]},
|
|
||||||
{name: "JSON", mimes: ["application/json", "application/x-json"], mode: "javascript", ext: ["json", "map"], alias: ["json5"]},
|
|
||||||
{name: "JSON-LD", mime: "application/ld+json", mode: "javascript", ext: ["jsonld"], alias: ["jsonld"]},
|
|
||||||
{name: "JSX", mime: "text/jsx", mode: "jsx", ext: ["jsx"]},
|
|
||||||
{name: "Jinja2", mime: "null", mode: "jinja2"},
|
|
||||||
{name: "Julia", mime: "text/x-julia", mode: "julia", ext: ["jl"]},
|
|
||||||
{name: "Kotlin", mime: "text/x-kotlin", mode: "clike", ext: ["kt"]},
|
|
||||||
{name: "LESS", mime: "text/x-less", mode: "css", ext: ["less"]},
|
|
||||||
{name: "LiveScript", mime: "text/x-livescript", mode: "livescript", ext: ["ls"], alias: ["ls"]},
|
|
||||||
{name: "Lua", mime: "text/x-lua", mode: "lua", ext: ["lua"]},
|
|
||||||
{name: "Markdown", mime: "text/x-markdown", mode: "markdown", ext: ["markdown", "md", "mkd"]},
|
|
||||||
{name: "mIRC", mime: "text/mirc", mode: "mirc"},
|
|
||||||
{name: "MariaDB SQL", mime: "text/x-mariadb", mode: "sql"},
|
|
||||||
{name: "Mathematica", mime: "text/x-mathematica", mode: "mathematica", ext: ["m", "nb"]},
|
|
||||||
{name: "Modelica", mime: "text/x-modelica", mode: "modelica", ext: ["mo"]},
|
|
||||||
{name: "MUMPS", mime: "text/x-mumps", mode: "mumps", ext: ["mps"]},
|
|
||||||
{name: "MS SQL", mime: "text/x-mssql", mode: "sql"},
|
|
||||||
{name: "mbox", mime: "application/mbox", mode: "mbox", ext: ["mbox"]},
|
|
||||||
{name: "MySQL", mime: "text/x-mysql", mode: "sql"},
|
|
||||||
{name: "Nginx", mime: "text/x-nginx-conf", mode: "nginx", file: /nginx.*\.conf$/i},
|
|
||||||
{name: "NSIS", mime: "text/x-nsis", mode: "nsis", ext: ["nsh", "nsi"]},
|
|
||||||
{name: "NTriples", mime: "text/n-triples", mode: "ntriples", ext: ["nt"]},
|
|
||||||
{name: "Objective C", mime: "text/x-objectivec", mode: "clike", ext: ["m", "mm"], alias: ["objective-c", "objc"]},
|
|
||||||
{name: "OCaml", mime: "text/x-ocaml", mode: "mllike", ext: ["ml", "mli", "mll", "mly"]},
|
|
||||||
{name: "Octave", mime: "text/x-octave", mode: "octave", ext: ["m"]},
|
|
||||||
{name: "Oz", mime: "text/x-oz", mode: "oz", ext: ["oz"]},
|
|
||||||
{name: "Pascal", mime: "text/x-pascal", mode: "pascal", ext: ["p", "pas"]},
|
|
||||||
{name: "PEG.js", mime: "null", mode: "pegjs", ext: ["jsonld"]},
|
|
||||||
{name: "Perl", mime: "text/x-perl", mode: "perl", ext: ["pl", "pm"]},
|
|
||||||
{name: "PHP", mime: "application/x-httpd-php", mode: "php", ext: ["php", "php3", "php4", "php5", "phtml"]},
|
|
||||||
{name: "Pig", mime: "text/x-pig", mode: "pig", ext: ["pig"]},
|
|
||||||
{name: "Plain Text", mime: "text/plain", mode: "null", ext: ["txt", "text", "conf", "def", "list", "log"]},
|
|
||||||
{name: "PLSQL", mime: "text/x-plsql", mode: "sql", ext: ["pls"]},
|
|
||||||
{name: "PowerShell", mime: "application/x-powershell", mode: "powershell", ext: ["ps1", "psd1", "psm1"]},
|
|
||||||
{name: "Properties files", mime: "text/x-properties", mode: "properties", ext: ["properties", "ini", "in"], alias: ["ini", "properties"]},
|
|
||||||
{ name: "Prolog", mime: "text/x-prolog",
|
|
||||||
mode: "prolog", ext: ["pl", "yap", "yss", "P"] },
|
|
||||||
|
|
||||||
{name: "ProtoBuf", mime: "text/x-protobuf", mode: "protobuf", ext: ["proto"]},
|
var onload = function(){
|
||||||
< {name: "Python", mime: "text/x-python", mode: "python", ext: ["BUILD", "bzl", "py", "pyw"], file: /^(BUCK|BUILD)$/},
|
console.log("I am being loaded");
|
||||||
{name: "Puppet", mime: "text/x-puppet", mode: "puppet", ext: ["pp"]},
|
|
||||||
{name: "Q", mime: "text/x-q", mode: "q", ext: ["q"]},
|
|
||||||
{name: "R", mime: "text/x-rsrc", mode: "r", ext: ["r", "R"], alias: ["rscript"]},
|
|
||||||
{name: "reStructuredText", mime: "text/x-rst", mode: "rst", ext: ["rst"], alias: ["rst"]},
|
|
||||||
{name: "RPM Changes", mime: "text/x-rpm-changes", mode: "rpm"},
|
|
||||||
{name: "RPM Spec", mime: "text/x-rpm-spec", mode: "rpm", ext: ["spec"]},
|
|
||||||
{name: "Ruby", mime: "text/x-ruby", mode: "ruby", ext: ["rb"], alias: ["jruby", "macruby", "rake", "rb", "rbx"]},
|
|
||||||
{name: "Rust", mime: "text/x-rustsrc", mode: "rust", ext: ["rs"]},
|
|
||||||
{name: "SAS", mime: "text/x-sas", mode: "sas", ext: ["sas"]},
|
|
||||||
{name: "Sass", mime: "text/x-sass", mode: "sass", ext: ["sass"]},
|
|
||||||
{name: "Scala", mime: "text/x-scala", mode: "clike", ext: ["scala"]},
|
|
||||||
{name: "Scheme", mime: "text/x-scheme", mode: "scheme", ext: ["scm", "ss"]},
|
|
||||||
{name: "SCSS", mime: "text/x-scss", mode: "css", ext: ["scss"]},
|
|
||||||
{name: "Shell", mime: "text/x-sh", mode: "shell", ext: ["sh", "ksh", "bash"], alias: ["bash", "sh", "zsh"], file: /^PKGBUILD$/},
|
|
||||||
{name: "Sieve", mime: "application/sieve", mode: "sieve", ext: ["siv", "sieve"]},
|
|
||||||
{name: "Slim", mimes: ["text/x-slim", "application/x-slim"], mode: "slim", ext: ["slim"]},
|
|
||||||
{name: "Smalltalk", mime: "text/x-stsrc", mode: "smalltalk", ext: ["st"]},
|
|
||||||
{name: "Smarty", mime: "text/x-smarty", mode: "smarty", ext: ["tpl"]},
|
|
||||||
{name: "Solr", mime: "text/x-solr", mode: "solr"},
|
|
||||||
{name: "Soy", mime: "text/x-soy", mode: "soy", ext: ["soy"], alias: ["closure template"]},
|
|
||||||
{name: "SPARQL", mime: "application/sparql-query", mode: "sparql", ext: ["rq", "sparql"], alias: ["sparul"]},
|
|
||||||
{name: "Spreadsheet", mime: "text/x-spreadsheet", mode: "spreadsheet", alias: ["excel", "formula"]},
|
|
||||||
{name: "SQL", mime: "text/x-sql", mode: "sql", ext: ["sql"]},
|
|
||||||
{name: "Squirrel", mime: "text/x-squirrel", mode: "clike", ext: ["nut"]},
|
|
||||||
{name: "Stylus", mime: "text/x-styl", mode: "stylus", ext: ["styl"]},
|
|
||||||
{name: "Swift", mime: "text/x-swift", mode: "swift", ext: ["swift"]},
|
|
||||||
{name: "sTeX", mime: "text/x-stex", mode: "stex"},
|
|
||||||
{name: "LaTeX", mime: "text/x-latex", mode: "stex", ext: ["text", "ltx"], alias: ["tex"]},
|
|
||||||
{name: "SystemVerilog", mime: "text/x-systemverilog", mode: "verilog", ext: ["v"]},
|
|
||||||
{name: "Tcl", mime: "text/x-tcl", mode: "tcl", ext: ["tcl"]},
|
|
||||||
{name: "Textile", mime: "text/x-textile", mode: "textile", ext: ["textile"]},
|
|
||||||
{name: "TiddlyWiki ", mime: "text/x-tiddlywiki", mode: "tiddlywiki"},
|
|
||||||
{name: "Tiki wiki", mime: "text/tiki", mode: "tiki"},
|
|
||||||
{name: "TOML", mime: "text/x-toml", mode: "toml", ext: ["toml"]},
|
|
||||||
{name: "Tornado", mime: "text/x-tornado", mode: "tornado"},
|
|
||||||
{name: "troff", mime: "text/troff", mode: "troff", ext: ["1", "2", "3", "4", "5", "6", "7", "8", "9"]},
|
|
||||||
{name: "TTCN", mime: "text/x-ttcn", mode: "ttcn", ext: ["ttcn", "ttcn3", "ttcnpp"]},
|
|
||||||
{name: "TTCN_CFG", mime: "text/x-ttcn-cfg", mode: "ttcn-cfg", ext: ["cfg"]},
|
|
||||||
{name: "Turtle", mime: "text/turtle", mode: "turtle", ext: ["ttl"]},
|
|
||||||
{name: "TypeScript", mime: "application/typescript", mode: "javascript", ext: ["ts"], alias: ["ts"]},
|
|
||||||
{name: "Twig", mime: "text/x-twig", mode: "twig"},
|
|
||||||
{name: "Web IDL", mime: "text/x-webidl", mode: "webidl", ext: ["webidl"]},
|
|
||||||
{name: "VB.NET", mime: "text/x-vb", mode: "vb", ext: ["vb"]},
|
|
||||||
{name: "VBScript", mime: "text/vbscript", mode: "vbscript", ext: ["vbs"]},
|
|
||||||
{name: "Velocity", mime: "text/velocity", mode: "velocity", ext: ["vtl"]},
|
|
||||||
{name: "Verilog", mime: "text/x-verilog", mode: "verilog", ext: ["v"]},
|
|
||||||
{name: "VHDL", mime: "text/x-vhdl", mode: "vhdl", ext: ["vhd", "vhdl"]},
|
|
||||||
{name: "Vue.js Component", mimes: ["script/x-vue", "text/x-vue"], mode: "vue", ext: ["vue"]},
|
|
||||||
{name: "XML", mimes: ["application/xml", "text/xml"], mode: "xml", ext: ["xml", "xsl", "xsd"], alias: ["rss", "wsdl", "xsd"]},
|
|
||||||
{name: "XQuery", mime: "application/xquery", mode: "xquery", ext: ["xy", "xquery"]},
|
|
||||||
{name: "Yacas", mime: "text/x-yacas", mode: "yacas", ext: ["ys"]},
|
|
||||||
{name: "YAML", mimes: ["text/x-yaml", "text/yaml"], mode: "yaml", ext: ["yaml", "yml"], alias: ["yml"]},
|
|
||||||
{name: "Z80", mime: "text/x-z80", mode: "z80", ext: ["z80"]},
|
|
||||||
{name: "mscgen", mime: "text/x-mscgen", mode: "mscgen", ext: ["mscgen", "mscin", "msc"]},
|
|
||||||
{name: "xu", mime: "text/x-xu", mode: "mscgen", ext: ["xu"]},
|
|
||||||
{name: "msgenny", mime: "text/x-msgenny", mode: "mscgen", ext: ["msgenny"]}
|
|
||||||
];
|
|
||||||
|
|
||||||
|
|
||||||
});
|
};
|
||||||
|
return {onload:onload}
|
||||||
|
});*/
|
||||||
CodeMirror.findModeByMIME = function(mime) {
|
|
||||||
mime = mime.toLowerCase();
|
|
||||||
for (var i = 0; i < CodeMirror.mI.length; i++) {
|
|
||||||
var info = CodeMirror.mI[i];
|
|
||||||
if (info.mime == mime) return info;
|
|
||||||
if (info.mimes) for (var j = 0; j < info.mimes.length; j++)
|
|
||||||
if (info.mimes[j] == mime) return info;
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
CodeMirror.findModeByExtension = function(ext) {
|
|
||||||
for (var i = 0; i < CodeMirror.mI.length; i++) {
|
|
||||||
var info = CodeMirror.mI[i];
|
|
||||||
if (info.ext) for (var j = 0; j < info.ext.length; j++)
|
|
||||||
if (info.ext[j] == ext) return info;
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
CodeMirror.findModeByFileName = function(filename) {
|
|
||||||
for (var i = 0; i < CodeMirror.mI.length; i++) {
|
|
||||||
var info = CodeMirror.mI[i];
|
|
||||||
if (info.file && info.file.test(filename)) return info;
|
|
||||||
}
|
|
||||||
var dot = filename.lastIndexOf(".");
|
|
||||||
var ext = dot > -1 && filename.substring(dot + 1, filename.length);
|
|
||||||
if (ext) return CodeMirror.findModeByExtension(ext);
|
|
||||||
};
|
|
||||||
|
|
||||||
CodeMirror.findModeByName = function(name) {
|
|
||||||
name = name.toLowerCase();
|
|
||||||
for (var i = 0; i < CodeMirror.mI.length; i++) {
|
|
||||||
var info = CodeMirror.mI[i];
|
|
||||||
if (info.name.toLowerCase() == name) return info;
|
|
||||||
if (info.alias) for (var j = 0; j < info.alias.length; j++)
|
|
||||||
if (info.alias[j].toLowerCase() == name) return info;
|
|
||||||
}
|
|
||||||
};
|
|
||||||
} }; });
|
|
@ -1,133 +0,0 @@
|
|||||||
#!/usr/bin/env python
|
|
||||||
# coding: utf-8
|
|
||||||
|
|
||||||
# Copyright (c) IPython Development Team.
|
|
||||||
# Distributed under the terms of the Modified BSD License.
|
|
||||||
|
|
||||||
from __future__ import print_function
|
|
||||||
|
|
||||||
# the name of the package
|
|
||||||
name = 'yap_kernel'
|
|
||||||
|
|
||||||
#-----------------------------------------------------------------------------
|
|
||||||
# Minimal Python version sanity check
|
|
||||||
#-----------------------------------------------------------------------------
|
|
||||||
|
|
||||||
import sys
|
|
||||||
import sysconfig
|
|
||||||
import setuptools
|
|
||||||
|
|
||||||
v = sys.version_info
|
|
||||||
if v[:2] < (2,7) or (v[0] >= 3 and v[:2] < (3,3)):
|
|
||||||
error = "ERROR: %s requires Python version 3.3 or above." % name
|
|
||||||
print(error, file=sys.stderr)
|
|
||||||
sys.exit(1)
|
|
||||||
|
|
||||||
PY3 = (sys.version_info[0] >= 3)
|
|
||||||
|
|
||||||
#-----------------------------------------------------------------------------
|
|
||||||
# get on with it
|
|
||||||
#-----------------------------------------------------------------------------
|
|
||||||
|
|
||||||
from glob import glob
|
|
||||||
import os
|
|
||||||
import shutil
|
|
||||||
|
|
||||||
from distutils.core import setup
|
|
||||||
|
|
||||||
pjoin = os.path.join
|
|
||||||
here = os.path.abspath(os.path.dirname(__file__))
|
|
||||||
# pkg_root = pjoin(here, name)
|
|
||||||
|
|
||||||
packages = setuptools.find_packages('/home/vsc/github/yap-6.3/packages/python/yap_kernel')
|
|
||||||
# for d, _, _ in os.walk(pjoin(here, name)):
|
|
||||||
# if os.path.exists(pjoin(d, '__init__.py')):
|
|
||||||
# packages.append(d[len(here)+1:].replace(os.path.sep, '.'))
|
|
||||||
|
|
||||||
sys.path.insert(0, "/home/vsc/github/yap-6.3/packages/python/yap_kernel")
|
|
||||||
package_data = {
|
|
||||||
'yap_ipython': ['prolog/*.*'],
|
|
||||||
'yap_kernel': ['resources/*.*']
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
version_ns = {}
|
|
||||||
with open(pjoin('/home/vsc/github/yap-6.3/packages/python/yap_kernel', name, '_version.py')) as f:
|
|
||||||
exec(f.read(), {}, version_ns)
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
setup_args = dict(
|
|
||||||
name = name,
|
|
||||||
version = version_ns['__version__'],
|
|
||||||
scripts = glob(pjoin('scripts', '*')),
|
|
||||||
packages = packages,
|
|
||||||
py_modules = ['yap_kernel_launcher'],
|
|
||||||
package_data = package_data,
|
|
||||||
package_dir = {'':"/home/vsc/github/yap-6.3/packages/python/yap_kernel"},
|
|
||||||
description = "YAP Kernel for Jupyter",
|
|
||||||
author = 'YAP Development Team',
|
|
||||||
author_email = 'YAP-dev@scipy.org',
|
|
||||||
url = 'http://ipython.org',
|
|
||||||
license = 'BSD',
|
|
||||||
platforms = "Linux, Mac OS X, Windows",
|
|
||||||
keywords = ['Interactive', 'Interpreter', 'Shell', 'Web'],
|
|
||||||
classifiers = [
|
|
||||||
'Intended Audience :: Developers',
|
|
||||||
'Intended Audience :: System Administrators',
|
|
||||||
'Intended Audience :: Science/Research',
|
|
||||||
'License :: OSI Approved :: BSD License',
|
|
||||||
'Programming Language :: Prolog',
|
|
||||||
'Programming Language :: Python',
|
|
||||||
'Programming Language :: Python :: 3',
|
|
||||||
],
|
|
||||||
)
|
|
||||||
|
|
||||||
if 'develop' in sys.argv or any(a.startswith('bdist') for a in sys.argv):
|
|
||||||
import setuptools
|
|
||||||
|
|
||||||
setuptools_args = {}
|
|
||||||
install_requires = setuptools_args['install_requires'] = [
|
|
||||||
]
|
|
||||||
|
|
||||||
if any(a.startswith(('bdist', 'build', 'install')) for a in sys.argv):
|
|
||||||
from yap_kernel.kernelspec import write_kernel_spec, make_yap_kernel_cmd, KERNEL_NAME
|
|
||||||
|
|
||||||
|
|
||||||
argv = make_yap_kernel_cmd(executable='python')
|
|
||||||
dest = os.path.join(here, 'resources')
|
|
||||||
if not os.path.exists(dest):
|
|
||||||
os.makedirs( dest )
|
|
||||||
shutil.copy('/home/vsc/github/yap-6.3/docs/icons/yap_32x32x32.png',os.path.join(dest,'logo-32x32.png'))
|
|
||||||
shutil.copy('/home/vsc/github/yap-6.3/docs/icons/yap_64x64x32.png',os.path.join(dest,'logo-64x64.png'))
|
|
||||||
try:
|
|
||||||
write_kernel_spec(dest, overrides={'argv': argv})
|
|
||||||
except:
|
|
||||||
none
|
|
||||||
# shutil.copy('/home/vsc/github/yap-6.3/packages/python/yap_kernel/kernel.js',dest)
|
|
||||||
# shutil.copy('/home/vsc/github/yap-6.3/misc/editors/prolog.js',dest)
|
|
||||||
setup_args['data_files'] = [
|
|
||||||
(pjoin('share', 'jupyter', 'kernels', KERNEL_NAME), glob(pjoin(dest, '*'))),
|
|
||||||
]
|
|
||||||
mode_loc = pjoin( sysconfig.get_path('platlib'), 'notebook', 'static', 'components', 'codemirror', 'mode', 'prolog')
|
|
||||||
custom_loc = pjoin( sysconfig.get_path('platlib'), 'notebook', 'static', 'custom')
|
|
||||||
try:
|
|
||||||
shutil.copy( pjoin( custom_loc, "custom.js") , pjoin( custom_loc, "custom.js.orig"))
|
|
||||||
shutil.copy( "/home/vsc/github/yap-6.3/packages/python/yap_kernel/custom.js" , pjoin( custom_loc, "custom.js"))
|
|
||||||
if not os.path.exists(mode_loc):
|
|
||||||
os.makedirs(mode_loc)
|
|
||||||
shutil.copy( "/home/vsc/github/yap-6.3/misc/editors/prolog.js" , mode_loc)
|
|
||||||
except:
|
|
||||||
pass
|
|
||||||
|
|
||||||
extras_require = setuptools_args['extras_require'] = {
|
|
||||||
'test:python_version=="2.7"': ['mock'],
|
|
||||||
'test': ['nose_warnings_filters', 'nose-timer'],
|
|
||||||
}
|
|
||||||
|
|
||||||
if 'setuptools' in sys.modules:
|
|
||||||
setup_args.update(setuptools_args)
|
|
||||||
|
|
||||||
if __name__ == '__main__':
|
|
||||||
setup(**setup_args)
|
|
@ -100,26 +100,24 @@ if any(a.startswith(('bdist', 'build', 'install')) for a in sys.argv):
|
|||||||
try:
|
try:
|
||||||
shutil.rmtree(dest)
|
shutil.rmtree(dest)
|
||||||
os.makedirs( dest )
|
os.makedirs( dest )
|
||||||
shutil.copy2('${CMAKE_SOURCE_DIR}/docs/icons/yap_32x32x32.png',dest)
|
shutil.copy2('${CMAKE_SOURCE_DIR}/docs/icons/yap_32x32x32.png',pjoin(dest,"logo_32x32.png"))
|
||||||
shutil.copy2('${CMAKE_SOURCE_DIR}/docs/icons/yap_64x64x32.png',dest)
|
shutil.copy2('${CMAKE_SOURCE_DIR}/docs/icons/yap_64x64x32.png',pjoin(dest,"logo_64x64.png"))
|
||||||
write_kernel_spec(dest, overrides={'argv': argv})
|
write_kernel_spec(dest, overrides={'argv': argv})
|
||||||
except:
|
except:
|
||||||
pass
|
pass
|
||||||
# shutil.copy('${CMAKE_CURRENT_SOURCE_DIR}/kernel.js',dest)
|
# shutil.copy('${CMAKE_CURRENT_SOURCE_DIR}/kernel.js',dest)
|
||||||
# shutil.copy('${CMAKE_SOURCE_DIR}/misc/editors/prolog.js',dest)
|
# shutil.copy('${CMAKE_SOURCE_DIR}/misc/editors/prolog.js',dest)
|
||||||
setup_args['data_files'] = [
|
setup_args['data_files'] = [(pjoin('share', 'jupyter', 'kernels', KERNEL_NAME), glob(pjoin(dest, '*')))]
|
||||||
(pjoin('share', 'jupyter', 'kernels', KERNEL_NAME), glob(pjoin(dest, '*'))),
|
|
||||||
]
|
|
||||||
mode_loc = pjoin( sysconfig.get_path('platlib'), 'notebook', 'static', 'components', 'codemirror', 'mode', 'prolog')
|
mode_loc = pjoin( sysconfig.get_path('platlib'), 'notebook', 'static', 'components', 'codemirror', 'mode', 'prolog')
|
||||||
custom_loc = pjoin( sysconfig.get_path('platlib'), 'notebook', 'static', 'custom')
|
custom_loc = pjoin( sysconfig.get_path('platlib'), 'notebook', 'static', 'custom')
|
||||||
try:
|
# try:
|
||||||
shutil.copy( pjoin( custom_loc, "custom.js") , pjoin( custom_loc, "custom.js.orig"))
|
# shutil.copy( pjoin( custom_loc, "custom.js") , pjoin( custom_loc, "custom.js.orig"))
|
||||||
shutil.copy( "${CMAKE_CURRENT_SOURCE_DIR}/custom.js" , pjoin( custom_loc, "custom.js"))
|
# shutil.copy( "${CMAKE_CURRENT_SOURCE_DIR}/custom.js" , pjoin( custom_loc, "custom.js"))
|
||||||
if not os.path.exists(mode_loc):
|
# if not os.path.exists(mode_loc):
|
||||||
os.makedirs(mode_loc)
|
# os.makedirs(mode_loc)
|
||||||
shutil.copy( "${CMAKE_SOURCE_DIR}/misc/editors/prolog.js" , mode_loc)
|
# shutil.copy( "${CMAKE_SOURCE_DIR}/misc/editors/prolog.js" , mode_loc)
|
||||||
except:
|
# except:
|
||||||
pass
|
# pass
|
||||||
|
|
||||||
extras_require = setuptools_args['extras_require'] = {
|
extras_require = setuptools_args['extras_require'] = {
|
||||||
'test:python_version=="2.7"': ['mock'],
|
'test:python_version=="2.7"': ['mock'],
|
||||||
|
@ -1,11 +1,11 @@
|
|||||||
# encoding: utf-8
|
# encoding: utf-8
|
||||||
"""
|
"""
|
||||||
IPython: tools for interactive and parallel computing in Python.
|
yap_ipython: tools for interactive and parallel computing in Python.
|
||||||
|
|
||||||
http://ipython.org
|
http://ipython.org
|
||||||
"""
|
"""
|
||||||
#-----------------------------------------------------------------------------
|
#-----------------------------------------------------------------------------
|
||||||
# Copyright (c) 2008-2011, IPython Development Team.
|
# Copyright (c) 2008-2011, yap_ipython Development Team.
|
||||||
# Copyright (c) 2001-2007, Fernando Perez <fernando.perez@colorado.edu>
|
# Copyright (c) 2001-2007, Fernando Perez <fernando.perez@colorado.edu>
|
||||||
# Copyright (c) 2001, Janko Hauser <jhauser@zscout.de>
|
# Copyright (c) 2001, Janko Hauser <jhauser@zscout.de>
|
||||||
# Copyright (c) 2001, Nathaniel Gray <n8gray@caltech.edu>
|
# Copyright (c) 2001, Nathaniel Gray <n8gray@caltech.edu>
|
||||||
@ -29,19 +29,19 @@ import sys
|
|||||||
# Don't forget to also update setup.py when this changes!
|
# Don't forget to also update setup.py when this changes!
|
||||||
if sys.version_info < (3,3):
|
if sys.version_info < (3,3):
|
||||||
raise ImportError(
|
raise ImportError(
|
||||||
"""
|
"""
|
||||||
IPython 6.0+ does not support Python 2.6, 2.7, 3.0, 3.1, or 3.2.
|
yap_ipython 6.0+ does not support Python 2.6, 2.7, 3.0, 3.1, or 3.2.
|
||||||
When using Python 2.7, please install IPython 5.x LTS Long Term Support version.
|
When using Python 2.7, please install yap_ipython 5.x LTS Long Term Support version.
|
||||||
Beginning with IPython 6.0, Python 3.3 and above is required.
|
Beginning with yap_ipython 6.0, Python 3.3 and above is required.
|
||||||
|
|
||||||
See IPython `README.rst` file for more information:
|
See yap_ipython `README.rst` file for more information:
|
||||||
|
|
||||||
https://github.com/ipython/ipython/blob/master/README.rst
|
https://github.com/ipython/ipython/blob/master/README.rst
|
||||||
|
|
||||||
""")
|
""")
|
||||||
|
|
||||||
# Make it easy to import extensions - they are always directly on pythonpath.
|
# Make it easy to import extensions - they are always directly on pythonpath.
|
||||||
# Therefore, non-IPython modules can be added to extensions directory.
|
# Therefore, non-yap_ipython modules can be added to extensions directory.
|
||||||
# This should probably be in ipapp.py.
|
# This should probably be in ipapp.py.
|
||||||
sys.path.append(os.path.join(os.path.dirname(__file__), "extensions"))
|
sys.path.append(os.path.join(os.path.dirname(__file__), "extensions"))
|
||||||
|
|
||||||
@ -51,13 +51,13 @@ sys.path.append(os.path.join(os.path.dirname(__file__), "extensions"))
|
|||||||
|
|
||||||
from .core.getipython import get_ipython
|
from .core.getipython import get_ipython
|
||||||
from .core import release
|
from .core import release
|
||||||
from IPython.core.application import Application
|
from .core.application import Application
|
||||||
from IPython.terminal.embed import embed
|
from .terminal.embed import embed
|
||||||
|
|
||||||
from .core.interactiveshell import YAPInteractive as InteractiveShell
|
from .core.interactiveshell import InteractiveShell
|
||||||
from IPython.testing import test
|
from .testing import test
|
||||||
from IPython.utils.sysinfo import sys_info
|
from .utils.sysinfo import sys_info
|
||||||
from IPython.utils.frame import extract_module_locals
|
from .utils.frame import extract_module_locals
|
||||||
|
|
||||||
# Release data
|
# Release data
|
||||||
__author__ = '%s <%s>' % (release.author, release.author_email)
|
__author__ = '%s <%s>' % (release.author, release.author_email)
|
||||||
@ -66,86 +66,86 @@ __version__ = release.version
|
|||||||
version_info = release.version_info
|
version_info = release.version_info
|
||||||
|
|
||||||
def embed_kernel(module=None, local_ns=None, **kwargs):
|
def embed_kernel(module=None, local_ns=None, **kwargs):
|
||||||
"""Embed and start an IPython kernel in a given scope.
|
"""Embed and start an yap_ipython kernel in a given scope.
|
||||||
|
|
||||||
If you don't want the kernel to initialize the namespace
|
If you don't want the kernel to initialize the namespace
|
||||||
from the scope of the surrounding function,
|
from the scope of the surrounding function,
|
||||||
and/or you want to load full IPython configuration,
|
and/or you want to load full yap_ipython configuration,
|
||||||
you probably want `IPython.start_kernel()` instead.
|
you probably want `yap_ipython.start_kernel()` instead.
|
||||||
|
|
||||||
Parameters
|
Parameters
|
||||||
----------
|
----------
|
||||||
module : ModuleType, optional
|
module : ModuleType, optional
|
||||||
The module to load into IPython globals (default: caller)
|
The module to load into yap_ipython globals (default: caller)
|
||||||
local_ns : dict, optional
|
local_ns : dict, optional
|
||||||
The namespace to load into IPython user namespace (default: caller)
|
The namespace to load into yap_ipython user namespace (default: caller)
|
||||||
|
|
||||||
kwargs : various, optional
|
kwargs : various, optional
|
||||||
Further keyword args are relayed to the IPKernelApp constructor,
|
Further keyword args are relayed to the YAPKernelApp constructor,
|
||||||
allowing configuration of the Kernel. Will only have an effect
|
allowing configuration of the Kernel. Will only have an effect
|
||||||
on the first embed_kernel call for a given process.
|
on the first embed_kernel call for a given process.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
(caller_module, caller_locals) = extract_module_locals(1)
|
(caller_module, caller_locals) = extract_module_locals(1)
|
||||||
if module is None:
|
if module is None:
|
||||||
module = caller_module
|
module = caller_module
|
||||||
if local_ns is None:
|
if local_ns is None:
|
||||||
local_ns = caller_locals
|
local_ns = caller_locals
|
||||||
|
|
||||||
# Only import .zmq when we really need it
|
# Only import .zmq when we really need it
|
||||||
from ipykernel.embed import embed_kernel as real_embed_kernel
|
from yap_kernel.embed import embed_kernel as real_embed_kernel
|
||||||
real_embed_kernel(module=module, local_ns=local_ns, **kwargs)
|
real_embed_kernel(module=module, local_ns=local_ns, **kwargs)
|
||||||
|
|
||||||
def start_ipython(argv=None, **kwargs):
|
def start_ipython(argv=None, **kwargs):
|
||||||
"""Launch a normal IPython instance (as opposed to embedded)
|
"""Launch a normal yap_ipython instance (as opposed to embedded)
|
||||||
|
|
||||||
`IPython.embed()` puts a shell in a particular calling scope,
|
`yap_ipython.embed()` puts a shell in a particular calling scope,
|
||||||
such as a function or method for debugging purposes,
|
such as a function or method for debugging purposes,
|
||||||
which is often not desirable.
|
which is often not desirable.
|
||||||
|
|
||||||
`start_ipython()` does full, regular IPython initialization,
|
`start_ipython()` does full, regular yap_ipython initialization,
|
||||||
including loading startup files, configuration, etc.
|
including loading startup files, configuration, etc.
|
||||||
much of which is skipped by `embed()`.
|
much of which is skipped by `embed()`.
|
||||||
|
|
||||||
This is a public API method, and will survive implementation changes.
|
This is a public API method, and will survive implementation changes.
|
||||||
|
|
||||||
Parameters
|
Parameters
|
||||||
----------
|
----------
|
||||||
|
|
||||||
argv : list or None, optional
|
argv : list or None, optional
|
||||||
If unspecified or None, IPython will parse command-line options from sys.argv.
|
If unspecified or None, yap_ipython will parse command-line options from sys.argv.
|
||||||
To prevent any command-line parsing, pass an empty list: `argv=[]`.
|
To prevent any command-line parsing, pass an empty list: `argv=[]`.
|
||||||
user_ns : dict, optional
|
user_ns : dict, optional
|
||||||
specify this dictionary to initialize the IPython user namespace with particular values.
|
specify this dictionary to initialize the yap_ipython user namespace with particular values.
|
||||||
kwargs : various, optional
|
kwargs : various, optional
|
||||||
Any other kwargs will be passed to the Application constructor,
|
Any other kwargs will be passed to the Application constructor,
|
||||||
such as `config`.
|
such as `config`.
|
||||||
"""
|
"""
|
||||||
from IPython.terminal.ipapp import launch_new_instance
|
from yap_ipython.terminal.ipapp import launch_new_instance
|
||||||
return launch_new_instance(argv=argv, **kwargs)
|
return launch_new_instance(argv=argv, **kwargs)
|
||||||
|
|
||||||
def start_kernel(argv=None, **kwargs):
|
def start_kernel(argv=None, **kwargs):
|
||||||
"""Launch a normal IPython kernel instance (as opposed to embedded)
|
"""Launch a normal yap_ipython kernel instance (as opposed to embedded)
|
||||||
|
|
||||||
`IPython.embed_kernel()` puts a shell in a particular calling scope,
|
`yap_ipython.embed_kernel()` puts a shell in a particular calling scope,
|
||||||
such as a function or method for debugging purposes,
|
such as a function or method for debugging purposes,
|
||||||
which is often not desirable.
|
which is often not desirable.
|
||||||
|
|
||||||
`start_kernel()` does full, regular IPython initialization,
|
`start_kernel()` does full, regular yap_ipython initialization,
|
||||||
including loading startup files, configuration, etc.
|
including loading startup files, configuration, etc.
|
||||||
much of which is skipped by `embed()`.
|
much of which is skipped by `embed()`.
|
||||||
|
|
||||||
Parameters
|
Parameters
|
||||||
----------
|
----------
|
||||||
|
|
||||||
argv : list or None, optional
|
argv : list or None, optional
|
||||||
If unspecified or None, IPython will parse command-line options from sys.argv.
|
If unspecified or None, yap_ipython will parse command-line options from sys.argv.
|
||||||
To prevent any command-line parsing, pass an empty list: `argv=[]`.
|
To prevent any command-line parsing, pass an empty list: `argv=[]`.
|
||||||
user_ns : dict, optional
|
user_ns : dict, optional
|
||||||
specify this dictionary to initialize the IPython user namespace with particular values.
|
specify this dictionary to initialize the yap_ipython user namespace with particular values.
|
||||||
kwargs : various, optional
|
kwargs : various, optional
|
||||||
Any other kwargs will be passed to the Application constructor,
|
Any other kwargs will be passed to the Application constructor,
|
||||||
such as `config`.
|
such as `config`.
|
||||||
"""
|
"""
|
||||||
from IPython.kernel.zmq.kernelapp import launch_new_instance
|
from yap_ipython.kernel.zmq.kernelapp import launch_new_instance
|
||||||
return launch_new_instance(argv=argv, **kwargs)
|
return launch_new_instance(argv=argv, **kwargs)
|
||||||
|
14
packages/python/yap_kernel/yap_ipython/__main__.py
Normal file
14
packages/python/yap_kernel/yap_ipython/__main__.py
Normal file
@ -0,0 +1,14 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""Terminal-based yap_ipython entry point.
|
||||||
|
"""
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (c) 2012, yap_ipython Development Team.
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
#
|
||||||
|
# The full license is in the file COPYING.txt, distributed with this software.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
from yap_ipython import start_ipython
|
||||||
|
|
||||||
|
start_ipython()
|
19
packages/python/yap_kernel/yap_ipython/config.py
Normal file
19
packages/python/yap_kernel/yap_ipython/config.py
Normal file
@ -0,0 +1,19 @@
|
|||||||
|
"""
|
||||||
|
Shim to maintain backwards compatibility with old yap_ipython.config imports.
|
||||||
|
"""
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
import sys
|
||||||
|
from warnings import warn
|
||||||
|
|
||||||
|
from yap_ipython.utils.shimmodule import ShimModule, ShimWarning
|
||||||
|
|
||||||
|
warn("The `yap_ipython.config` package has been deprecated since yap_ipython 4.0. "
|
||||||
|
"You should import from traitlets.config instead.", ShimWarning)
|
||||||
|
|
||||||
|
|
||||||
|
# Unconditionally insert the shim into sys.modules so that further import calls
|
||||||
|
# trigger the custom attribute access above
|
||||||
|
|
||||||
|
sys.modules['yap_ipython.config'] = ShimModule(src='yap_ipython.config', mirror='traitlets.config')
|
12
packages/python/yap_kernel/yap_ipython/consoleapp.py
Normal file
12
packages/python/yap_kernel/yap_ipython/consoleapp.py
Normal file
@ -0,0 +1,12 @@
|
|||||||
|
"""
|
||||||
|
Shim to maintain backwards compatibility with old yap_ipython.consoleapp imports.
|
||||||
|
"""
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
from warnings import warn
|
||||||
|
|
||||||
|
warn("The `yap_ipython.consoleapp` package has been deprecated. "
|
||||||
|
"You should import from jupyter_client.consoleapp instead.")
|
||||||
|
|
||||||
|
from jupyter_client.consoleapp import *
|
256
packages/python/yap_kernel/yap_ipython/core/alias.py
Normal file
256
packages/python/yap_kernel/yap_ipython/core/alias.py
Normal file
@ -0,0 +1,256 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""
|
||||||
|
System command aliases.
|
||||||
|
|
||||||
|
Authors:
|
||||||
|
|
||||||
|
* Fernando Perez
|
||||||
|
* Brian Granger
|
||||||
|
"""
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2008-2011 The yap_ipython Development Team
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License.
|
||||||
|
#
|
||||||
|
# The full license is in the file COPYING.txt, distributed with this software.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Imports
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
import os
|
||||||
|
import re
|
||||||
|
import sys
|
||||||
|
|
||||||
|
from traitlets.config.configurable import Configurable
|
||||||
|
from yap_ipython.core.error import UsageError
|
||||||
|
|
||||||
|
from traitlets import List, Instance
|
||||||
|
from logging import error
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Utilities
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
# This is used as the pattern for calls to split_user_input.
|
||||||
|
shell_line_split = re.compile(r'^(\s*)()(\S+)(.*$)')
|
||||||
|
|
||||||
|
def default_aliases():
|
||||||
|
"""Return list of shell aliases to auto-define.
|
||||||
|
"""
|
||||||
|
# Note: the aliases defined here should be safe to use on a kernel
|
||||||
|
# regardless of what frontend it is attached to. Frontends that use a
|
||||||
|
# kernel in-process can define additional aliases that will only work in
|
||||||
|
# their case. For example, things like 'less' or 'clear' that manipulate
|
||||||
|
# the terminal should NOT be declared here, as they will only work if the
|
||||||
|
# kernel is running inside a true terminal, and not over the network.
|
||||||
|
|
||||||
|
if os.name == 'posix':
|
||||||
|
default_aliases = [('mkdir', 'mkdir'), ('rmdir', 'rmdir'),
|
||||||
|
('mv', 'mv'), ('rm', 'rm'), ('cp', 'cp'),
|
||||||
|
('cat', 'cat'),
|
||||||
|
]
|
||||||
|
# Useful set of ls aliases. The GNU and BSD options are a little
|
||||||
|
# different, so we make aliases that provide as similar as possible
|
||||||
|
# behavior in ipython, by passing the right flags for each platform
|
||||||
|
if sys.platform.startswith('linux'):
|
||||||
|
ls_aliases = [('ls', 'ls -F --color'),
|
||||||
|
# long ls
|
||||||
|
('ll', 'ls -F -o --color'),
|
||||||
|
# ls normal files only
|
||||||
|
('lf', 'ls -F -o --color %l | grep ^-'),
|
||||||
|
# ls symbolic links
|
||||||
|
('lk', 'ls -F -o --color %l | grep ^l'),
|
||||||
|
# directories or links to directories,
|
||||||
|
('ldir', 'ls -F -o --color %l | grep /$'),
|
||||||
|
# things which are executable
|
||||||
|
('lx', 'ls -F -o --color %l | grep ^-..x'),
|
||||||
|
]
|
||||||
|
elif sys.platform.startswith('openbsd') or sys.platform.startswith('netbsd'):
|
||||||
|
# OpenBSD, NetBSD. The ls implementation on these platforms do not support
|
||||||
|
# the -G switch and lack the ability to use colorized output.
|
||||||
|
ls_aliases = [('ls', 'ls -F'),
|
||||||
|
# long ls
|
||||||
|
('ll', 'ls -F -l'),
|
||||||
|
# ls normal files only
|
||||||
|
('lf', 'ls -F -l %l | grep ^-'),
|
||||||
|
# ls symbolic links
|
||||||
|
('lk', 'ls -F -l %l | grep ^l'),
|
||||||
|
# directories or links to directories,
|
||||||
|
('ldir', 'ls -F -l %l | grep /$'),
|
||||||
|
# things which are executable
|
||||||
|
('lx', 'ls -F -l %l | grep ^-..x'),
|
||||||
|
]
|
||||||
|
else:
|
||||||
|
# BSD, OSX, etc.
|
||||||
|
ls_aliases = [('ls', 'ls -F -G'),
|
||||||
|
# long ls
|
||||||
|
('ll', 'ls -F -l -G'),
|
||||||
|
# ls normal files only
|
||||||
|
('lf', 'ls -F -l -G %l | grep ^-'),
|
||||||
|
# ls symbolic links
|
||||||
|
('lk', 'ls -F -l -G %l | grep ^l'),
|
||||||
|
# directories or links to directories,
|
||||||
|
('ldir', 'ls -F -G -l %l | grep /$'),
|
||||||
|
# things which are executable
|
||||||
|
('lx', 'ls -F -l -G %l | grep ^-..x'),
|
||||||
|
]
|
||||||
|
default_aliases = default_aliases + ls_aliases
|
||||||
|
elif os.name in ['nt', 'dos']:
|
||||||
|
default_aliases = [('ls', 'dir /on'),
|
||||||
|
('ddir', 'dir /ad /on'), ('ldir', 'dir /ad /on'),
|
||||||
|
('mkdir', 'mkdir'), ('rmdir', 'rmdir'),
|
||||||
|
('echo', 'echo'), ('ren', 'ren'), ('copy', 'copy'),
|
||||||
|
]
|
||||||
|
else:
|
||||||
|
default_aliases = []
|
||||||
|
|
||||||
|
return default_aliases
|
||||||
|
|
||||||
|
|
||||||
|
class AliasError(Exception):
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
|
class InvalidAliasError(AliasError):
|
||||||
|
pass
|
||||||
|
|
||||||
|
class Alias(object):
|
||||||
|
"""Callable object storing the details of one alias.
|
||||||
|
|
||||||
|
Instances are registered as magic functions to allow use of aliases.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Prepare blacklist
|
||||||
|
blacklist = {'cd','popd','pushd','dhist','alias','unalias'}
|
||||||
|
|
||||||
|
def __init__(self, shell, name, cmd):
|
||||||
|
self.shell = shell
|
||||||
|
self.name = name
|
||||||
|
self.cmd = cmd
|
||||||
|
self.__doc__ = "Alias for `!{}`".format(cmd)
|
||||||
|
self.nargs = self.validate()
|
||||||
|
|
||||||
|
def validate(self):
|
||||||
|
"""Validate the alias, and return the number of arguments."""
|
||||||
|
if self.name in self.blacklist:
|
||||||
|
raise InvalidAliasError("The name %s can't be aliased "
|
||||||
|
"because it is a keyword or builtin." % self.name)
|
||||||
|
try:
|
||||||
|
caller = self.shell.magics_manager.magics['line'][self.name]
|
||||||
|
except KeyError:
|
||||||
|
pass
|
||||||
|
else:
|
||||||
|
if not isinstance(caller, Alias):
|
||||||
|
raise InvalidAliasError("The name %s can't be aliased "
|
||||||
|
"because it is another magic command." % self.name)
|
||||||
|
|
||||||
|
if not (isinstance(self.cmd, str)):
|
||||||
|
raise InvalidAliasError("An alias command must be a string, "
|
||||||
|
"got: %r" % self.cmd)
|
||||||
|
|
||||||
|
nargs = self.cmd.count('%s') - self.cmd.count('%%s')
|
||||||
|
|
||||||
|
if (nargs > 0) and (self.cmd.find('%l') >= 0):
|
||||||
|
raise InvalidAliasError('The %s and %l specifiers are mutually '
|
||||||
|
'exclusive in alias definitions.')
|
||||||
|
|
||||||
|
return nargs
|
||||||
|
|
||||||
|
def __repr__(self):
|
||||||
|
return "<alias {} for {!r}>".format(self.name, self.cmd)
|
||||||
|
|
||||||
|
def __call__(self, rest=''):
|
||||||
|
cmd = self.cmd
|
||||||
|
nargs = self.nargs
|
||||||
|
# Expand the %l special to be the user's input line
|
||||||
|
if cmd.find('%l') >= 0:
|
||||||
|
cmd = cmd.replace('%l', rest)
|
||||||
|
rest = ''
|
||||||
|
|
||||||
|
if nargs==0:
|
||||||
|
if cmd.find('%%s') >= 1:
|
||||||
|
cmd = cmd.replace('%%s', '%s')
|
||||||
|
# Simple, argument-less aliases
|
||||||
|
cmd = '%s %s' % (cmd, rest)
|
||||||
|
else:
|
||||||
|
# Handle aliases with positional arguments
|
||||||
|
args = rest.split(None, nargs)
|
||||||
|
if len(args) < nargs:
|
||||||
|
raise UsageError('Alias <%s> requires %s arguments, %s given.' %
|
||||||
|
(self.name, nargs, len(args)))
|
||||||
|
cmd = '%s %s' % (cmd % tuple(args[:nargs]),' '.join(args[nargs:]))
|
||||||
|
|
||||||
|
self.shell.system(cmd)
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Main AliasManager class
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
class AliasManager(Configurable):
|
||||||
|
|
||||||
|
default_aliases = List(default_aliases()).tag(config=True)
|
||||||
|
user_aliases = List(default_value=[]).tag(config=True)
|
||||||
|
shell = Instance('yap_ipython.core.interactiveshell.InteractiveShellABC', allow_none=True)
|
||||||
|
|
||||||
|
def __init__(self, shell=None, **kwargs):
|
||||||
|
super(AliasManager, self).__init__(shell=shell, **kwargs)
|
||||||
|
# For convenient access
|
||||||
|
self.linemagics = self.shell.magics_manager.magics['line']
|
||||||
|
self.init_aliases()
|
||||||
|
|
||||||
|
def init_aliases(self):
|
||||||
|
# Load default & user aliases
|
||||||
|
for name, cmd in self.default_aliases + self.user_aliases:
|
||||||
|
self.soft_define_alias(name, cmd)
|
||||||
|
|
||||||
|
@property
|
||||||
|
def aliases(self):
|
||||||
|
return [(n, func.cmd) for (n, func) in self.linemagics.items()
|
||||||
|
if isinstance(func, Alias)]
|
||||||
|
|
||||||
|
def soft_define_alias(self, name, cmd):
|
||||||
|
"""Define an alias, but don't raise on an AliasError."""
|
||||||
|
try:
|
||||||
|
self.define_alias(name, cmd)
|
||||||
|
except AliasError as e:
|
||||||
|
error("Invalid alias: %s" % e)
|
||||||
|
|
||||||
|
def define_alias(self, name, cmd):
|
||||||
|
"""Define a new alias after validating it.
|
||||||
|
|
||||||
|
This will raise an :exc:`AliasError` if there are validation
|
||||||
|
problems.
|
||||||
|
"""
|
||||||
|
caller = Alias(shell=self.shell, name=name, cmd=cmd)
|
||||||
|
self.shell.magics_manager.register_function(caller, magic_kind='line',
|
||||||
|
magic_name=name)
|
||||||
|
|
||||||
|
def get_alias(self, name):
|
||||||
|
"""Return an alias, or None if no alias by that name exists."""
|
||||||
|
aname = self.linemagics.get(name, None)
|
||||||
|
return aname if isinstance(aname, Alias) else None
|
||||||
|
|
||||||
|
def is_alias(self, name):
|
||||||
|
"""Return whether or not a given name has been defined as an alias"""
|
||||||
|
return self.get_alias(name) is not None
|
||||||
|
|
||||||
|
def undefine_alias(self, name):
|
||||||
|
if self.is_alias(name):
|
||||||
|
del self.linemagics[name]
|
||||||
|
else:
|
||||||
|
raise ValueError('%s is not an alias' % name)
|
||||||
|
|
||||||
|
def clear_aliases(self):
|
||||||
|
for name, cmd in self.aliases:
|
||||||
|
self.undefine_alias(name)
|
||||||
|
|
||||||
|
def retrieve_alias(self, name):
|
||||||
|
"""Retrieve the command to which an alias expands."""
|
||||||
|
caller = self.get_alias(name)
|
||||||
|
if caller:
|
||||||
|
return caller.cmd
|
||||||
|
else:
|
||||||
|
raise ValueError('%s is not an alias' % name)
|
462
packages/python/yap_kernel/yap_ipython/core/application.py
Normal file
462
packages/python/yap_kernel/yap_ipython/core/application.py
Normal file
@ -0,0 +1,462 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""
|
||||||
|
An application for yap_ipython.
|
||||||
|
|
||||||
|
All top-level applications should use the classes in this module for
|
||||||
|
handling configuration and creating configurables.
|
||||||
|
|
||||||
|
The job of an :class:`Application` is to create the master configuration
|
||||||
|
object and then create the configurable objects, passing the config to them.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
import atexit
|
||||||
|
from copy import deepcopy
|
||||||
|
import glob
|
||||||
|
import logging
|
||||||
|
import os
|
||||||
|
import shutil
|
||||||
|
import sys
|
||||||
|
|
||||||
|
from traitlets.config.application import Application, catch_config_error
|
||||||
|
from traitlets.config.loader import ConfigFileNotFound, PyFileConfigLoader
|
||||||
|
from yap_ipython.core import release, crashhandler
|
||||||
|
from yap_ipython.core.profiledir import ProfileDir, ProfileDirError
|
||||||
|
from yap_ipython.paths import get_ipython_dir, get_ipython_package_dir
|
||||||
|
from yap_ipython.utils.path import ensure_dir_exists
|
||||||
|
from traitlets import (
|
||||||
|
List, Unicode, Type, Bool, Set, Instance, Undefined,
|
||||||
|
default, observe,
|
||||||
|
)
|
||||||
|
|
||||||
|
if os.name == 'nt':
|
||||||
|
programdata = os.environ.get('PROGRAMDATA', None)
|
||||||
|
if programdata:
|
||||||
|
SYSTEM_CONFIG_DIRS = [os.path.join(programdata, 'ipython')]
|
||||||
|
else: # PROGRAMDATA is not defined by default on XP.
|
||||||
|
SYSTEM_CONFIG_DIRS = []
|
||||||
|
else:
|
||||||
|
SYSTEM_CONFIG_DIRS = [
|
||||||
|
"/usr/local/etc/ipython",
|
||||||
|
"/etc/ipython",
|
||||||
|
]
|
||||||
|
|
||||||
|
|
||||||
|
ENV_CONFIG_DIRS = []
|
||||||
|
_env_config_dir = os.path.join(sys.prefix, 'etc', 'ipython')
|
||||||
|
if _env_config_dir not in SYSTEM_CONFIG_DIRS:
|
||||||
|
# only add ENV_CONFIG if sys.prefix is not already included
|
||||||
|
ENV_CONFIG_DIRS.append(_env_config_dir)
|
||||||
|
|
||||||
|
|
||||||
|
_envvar = os.environ.get('IPYTHON_SUPPRESS_CONFIG_ERRORS')
|
||||||
|
if _envvar in {None, ''}:
|
||||||
|
IPYTHON_SUPPRESS_CONFIG_ERRORS = None
|
||||||
|
else:
|
||||||
|
if _envvar.lower() in {'1','true'}:
|
||||||
|
IPYTHON_SUPPRESS_CONFIG_ERRORS = True
|
||||||
|
elif _envvar.lower() in {'0','false'} :
|
||||||
|
IPYTHON_SUPPRESS_CONFIG_ERRORS = False
|
||||||
|
else:
|
||||||
|
sys.exit("Unsupported value for environment variable: 'IPYTHON_SUPPRESS_CONFIG_ERRORS' is set to '%s' which is none of {'0', '1', 'false', 'true', ''}."% _envvar )
|
||||||
|
|
||||||
|
# aliases and flags
|
||||||
|
|
||||||
|
base_aliases = {
|
||||||
|
'profile-dir' : 'ProfileDir.location',
|
||||||
|
'profile' : 'BaseYAPApplication.profile',
|
||||||
|
'ipython-dir' : 'BaseYAPApplication.ipython_dir',
|
||||||
|
'log-level' : 'Application.log_level',
|
||||||
|
'config' : 'BaseYAPApplication.extra_config_file',
|
||||||
|
}
|
||||||
|
|
||||||
|
base_flags = dict(
|
||||||
|
debug = ({'Application' : {'log_level' : logging.DEBUG}},
|
||||||
|
"set log level to logging.DEBUG (maximize logging output)"),
|
||||||
|
quiet = ({'Application' : {'log_level' : logging.CRITICAL}},
|
||||||
|
"set log level to logging.CRITICAL (minimize logging output)"),
|
||||||
|
init = ({'BaseYAPApplication' : {
|
||||||
|
'copy_config_files' : True,
|
||||||
|
'auto_create' : True}
|
||||||
|
}, """Initialize profile with default config files. This is equivalent
|
||||||
|
to running `ipython profile create <profile>` prior to startup.
|
||||||
|
""")
|
||||||
|
)
|
||||||
|
|
||||||
|
class ProfileAwareConfigLoader(PyFileConfigLoader):
|
||||||
|
"""A Python file config loader that is aware of yap_ipython profiles."""
|
||||||
|
def load_subconfig(self, fname, path=None, profile=None):
|
||||||
|
if profile is not None:
|
||||||
|
try:
|
||||||
|
profile_dir = ProfileDir.find_profile_dir_by_name(
|
||||||
|
get_ipython_dir(),
|
||||||
|
profile,
|
||||||
|
)
|
||||||
|
except ProfileDirError:
|
||||||
|
return
|
||||||
|
path = profile_dir.location
|
||||||
|
return super(ProfileAwareConfigLoader, self).load_subconfig(fname, path=path)
|
||||||
|
|
||||||
|
class BaseYAPApplication(Application):
|
||||||
|
|
||||||
|
name = u'ipython'
|
||||||
|
description = Unicode(u'yap_ipython: an enhanced interactive Python shell.')
|
||||||
|
version = Unicode(release.version)
|
||||||
|
|
||||||
|
aliases = base_aliases
|
||||||
|
flags = base_flags
|
||||||
|
classes = List([ProfileDir])
|
||||||
|
|
||||||
|
# enable `load_subconfig('cfg.py', profile='name')`
|
||||||
|
python_config_loader_class = ProfileAwareConfigLoader
|
||||||
|
|
||||||
|
# Track whether the config_file has changed,
|
||||||
|
# because some logic happens only if we aren't using the default.
|
||||||
|
config_file_specified = Set()
|
||||||
|
|
||||||
|
config_file_name = Unicode()
|
||||||
|
@default('config_file_name')
|
||||||
|
def _config_file_name_default(self):
|
||||||
|
return self.name.replace('-','_') + u'_config.py'
|
||||||
|
@observe('config_file_name')
|
||||||
|
def _config_file_name_changed(self, change):
|
||||||
|
if change['new'] != change['old']:
|
||||||
|
self.config_file_specified.add(change['new'])
|
||||||
|
|
||||||
|
# The directory that contains yap_ipython's builtin profiles.
|
||||||
|
builtin_profile_dir = Unicode(
|
||||||
|
os.path.join(get_ipython_package_dir(), u'config', u'profile', u'default')
|
||||||
|
)
|
||||||
|
|
||||||
|
config_file_paths = List(Unicode())
|
||||||
|
@default('config_file_paths')
|
||||||
|
def _config_file_paths_default(self):
|
||||||
|
return [os.getcwd()]
|
||||||
|
|
||||||
|
extra_config_file = Unicode(
|
||||||
|
help="""Path to an extra config file to load.
|
||||||
|
|
||||||
|
If specified, load this config file in addition to any other yap_ipython config.
|
||||||
|
""").tag(config=True)
|
||||||
|
@observe('extra_config_file')
|
||||||
|
def _extra_config_file_changed(self, change):
|
||||||
|
old = change['old']
|
||||||
|
new = change['new']
|
||||||
|
try:
|
||||||
|
self.config_files.remove(old)
|
||||||
|
except ValueError:
|
||||||
|
pass
|
||||||
|
self.config_file_specified.add(new)
|
||||||
|
self.config_files.append(new)
|
||||||
|
|
||||||
|
profile = Unicode(u'default',
|
||||||
|
help="""The yap_ipython profile to use."""
|
||||||
|
).tag(config=True)
|
||||||
|
|
||||||
|
@observe('profile')
|
||||||
|
def _profile_changed(self, change):
|
||||||
|
self.builtin_profile_dir = os.path.join(
|
||||||
|
get_ipython_package_dir(), u'config', u'profile', change['new']
|
||||||
|
)
|
||||||
|
|
||||||
|
ipython_dir = Unicode(
|
||||||
|
help="""
|
||||||
|
The name of the yap_ipython directory. This directory is used for logging
|
||||||
|
configuration (through profiles), history storage, etc. The default
|
||||||
|
is usually $HOME/.ipython. This option can also be specified through
|
||||||
|
the environment variable IPYTHONDIR.
|
||||||
|
"""
|
||||||
|
).tag(config=True)
|
||||||
|
@default('ipython_dir')
|
||||||
|
def _ipython_dir_default(self):
|
||||||
|
d = get_ipython_dir()
|
||||||
|
self._ipython_dir_changed({
|
||||||
|
'name': 'ipython_dir',
|
||||||
|
'old': d,
|
||||||
|
'new': d,
|
||||||
|
})
|
||||||
|
return d
|
||||||
|
|
||||||
|
_in_init_profile_dir = False
|
||||||
|
profile_dir = Instance(ProfileDir, allow_none=True)
|
||||||
|
@default('profile_dir')
|
||||||
|
def _profile_dir_default(self):
|
||||||
|
# avoid recursion
|
||||||
|
if self._in_init_profile_dir:
|
||||||
|
return
|
||||||
|
# profile_dir requested early, force initialization
|
||||||
|
self.init_profile_dir()
|
||||||
|
return self.profile_dir
|
||||||
|
|
||||||
|
overwrite = Bool(False,
|
||||||
|
help="""Whether to overwrite existing config files when copying"""
|
||||||
|
).tag(config=True)
|
||||||
|
auto_create = Bool(False,
|
||||||
|
help="""Whether to create profile dir if it doesn't exist"""
|
||||||
|
).tag(config=True)
|
||||||
|
|
||||||
|
config_files = List(Unicode())
|
||||||
|
@default('config_files')
|
||||||
|
def _config_files_default(self):
|
||||||
|
return [self.config_file_name]
|
||||||
|
|
||||||
|
copy_config_files = Bool(False,
|
||||||
|
help="""Whether to install the default config files into the profile dir.
|
||||||
|
If a new profile is being created, and yap_ipython contains config files for that
|
||||||
|
profile, then they will be staged into the new directory. Otherwise,
|
||||||
|
default config files will be automatically generated.
|
||||||
|
""").tag(config=True)
|
||||||
|
|
||||||
|
verbose_crash = Bool(False,
|
||||||
|
help="""Create a massive crash report when yap_ipython encounters what may be an
|
||||||
|
internal error. The default is to append a short message to the
|
||||||
|
usual traceback""").tag(config=True)
|
||||||
|
|
||||||
|
# The class to use as the crash handler.
|
||||||
|
crash_handler_class = Type(crashhandler.CrashHandler)
|
||||||
|
|
||||||
|
@catch_config_error
|
||||||
|
def __init__(self, **kwargs):
|
||||||
|
super(BaseYAPApplication, self).__init__(**kwargs)
|
||||||
|
# ensure current working directory exists
|
||||||
|
try:
|
||||||
|
os.getcwd()
|
||||||
|
except:
|
||||||
|
# exit if cwd doesn't exist
|
||||||
|
self.log.error("Current working directory doesn't exist.")
|
||||||
|
self.exit(1)
|
||||||
|
|
||||||
|
#-------------------------------------------------------------------------
|
||||||
|
# Various stages of Application creation
|
||||||
|
#-------------------------------------------------------------------------
|
||||||
|
|
||||||
|
deprecated_subcommands = {}
|
||||||
|
|
||||||
|
def initialize_subcommand(self, subc, argv=None):
|
||||||
|
if subc in self.deprecated_subcommands:
|
||||||
|
self.log.warning("Subcommand `ipython {sub}` is deprecated and will be removed "
|
||||||
|
"in future versions.".format(sub=subc))
|
||||||
|
self.log.warning("You likely want to use `jupyter {sub}` in the "
|
||||||
|
"future".format(sub=subc))
|
||||||
|
return super(BaseYAPApplication, self).initialize_subcommand(subc, argv)
|
||||||
|
|
||||||
|
def init_crash_handler(self):
|
||||||
|
"""Create a crash handler, typically setting sys.excepthook to it."""
|
||||||
|
self.crash_handler = self.crash_handler_class(self)
|
||||||
|
sys.excepthook = self.excepthook
|
||||||
|
def unset_crashhandler():
|
||||||
|
sys.excepthook = sys.__excepthook__
|
||||||
|
atexit.register(unset_crashhandler)
|
||||||
|
|
||||||
|
def excepthook(self, etype, evalue, tb):
|
||||||
|
"""this is sys.excepthook after init_crashhandler
|
||||||
|
|
||||||
|
set self.verbose_crash=True to use our full crashhandler, instead of
|
||||||
|
a regular traceback with a short message (crash_handler_lite)
|
||||||
|
"""
|
||||||
|
|
||||||
|
if self.verbose_crash:
|
||||||
|
return self.crash_handler(etype, evalue, tb)
|
||||||
|
else:
|
||||||
|
return crashhandler.crash_handler_lite(etype, evalue, tb)
|
||||||
|
|
||||||
|
@observe('ipython_dir')
|
||||||
|
def _ipython_dir_changed(self, change):
|
||||||
|
old = change['old']
|
||||||
|
new = change['new']
|
||||||
|
if old is not Undefined:
|
||||||
|
str_old = os.path.abspath(old)
|
||||||
|
if str_old in sys.path:
|
||||||
|
sys.path.remove(str_old)
|
||||||
|
str_path = os.path.abspath(new)
|
||||||
|
sys.path.append(str_path)
|
||||||
|
ensure_dir_exists(new)
|
||||||
|
readme = os.path.join(new, 'README')
|
||||||
|
readme_src = os.path.join(get_ipython_package_dir(), u'config', u'profile', 'README')
|
||||||
|
if not os.path.exists(readme) and os.path.exists(readme_src):
|
||||||
|
shutil.copy(readme_src, readme)
|
||||||
|
for d in ('extensions', 'nbextensions'):
|
||||||
|
path = os.path.join(new, d)
|
||||||
|
try:
|
||||||
|
ensure_dir_exists(path)
|
||||||
|
except OSError as e:
|
||||||
|
# this will not be EEXIST
|
||||||
|
self.log.error("couldn't create path %s: %s", path, e)
|
||||||
|
self.log.debug("IPYTHONDIR set to: %s" % new)
|
||||||
|
|
||||||
|
def load_config_file(self, suppress_errors=IPYTHON_SUPPRESS_CONFIG_ERRORS):
|
||||||
|
"""Load the config file.
|
||||||
|
|
||||||
|
By default, errors in loading config are handled, and a warning
|
||||||
|
printed on screen. For testing, the suppress_errors option is set
|
||||||
|
to False, so errors will make tests fail.
|
||||||
|
|
||||||
|
`supress_errors` default value is to be `None` in which case the
|
||||||
|
behavior default to the one of `traitlets.Application`.
|
||||||
|
|
||||||
|
The default value can be set :
|
||||||
|
- to `False` by setting 'IPYTHON_SUPPRESS_CONFIG_ERRORS' environment variable to '0', or 'false' (case insensitive).
|
||||||
|
- to `True` by setting 'IPYTHON_SUPPRESS_CONFIG_ERRORS' environment variable to '1' or 'true' (case insensitive).
|
||||||
|
- to `None` by setting 'IPYTHON_SUPPRESS_CONFIG_ERRORS' environment variable to '' (empty string) or leaving it unset.
|
||||||
|
|
||||||
|
Any other value are invalid, and will make yap_ipython exit with a non-zero return code.
|
||||||
|
"""
|
||||||
|
|
||||||
|
|
||||||
|
self.log.debug("Searching path %s for config files", self.config_file_paths)
|
||||||
|
base_config = 'ipython_config.py'
|
||||||
|
self.log.debug("Attempting to load config file: %s" %
|
||||||
|
base_config)
|
||||||
|
try:
|
||||||
|
if suppress_errors is not None:
|
||||||
|
old_value = Application.raise_config_file_errors
|
||||||
|
Application.raise_config_file_errors = not suppress_errors;
|
||||||
|
Application.load_config_file(
|
||||||
|
self,
|
||||||
|
base_config,
|
||||||
|
path=self.config_file_paths
|
||||||
|
)
|
||||||
|
except ConfigFileNotFound:
|
||||||
|
# ignore errors loading parent
|
||||||
|
self.log.debug("Config file %s not found", base_config)
|
||||||
|
pass
|
||||||
|
if suppress_errors is not None:
|
||||||
|
Application.raise_config_file_errors = old_value
|
||||||
|
|
||||||
|
for config_file_name in self.config_files:
|
||||||
|
if not config_file_name or config_file_name == base_config:
|
||||||
|
continue
|
||||||
|
self.log.debug("Attempting to load config file: %s" %
|
||||||
|
self.config_file_name)
|
||||||
|
try:
|
||||||
|
Application.load_config_file(
|
||||||
|
self,
|
||||||
|
config_file_name,
|
||||||
|
path=self.config_file_paths
|
||||||
|
)
|
||||||
|
except ConfigFileNotFound:
|
||||||
|
# Only warn if the default config file was NOT being used.
|
||||||
|
if config_file_name in self.config_file_specified:
|
||||||
|
msg = self.log.warning
|
||||||
|
else:
|
||||||
|
msg = self.log.debug
|
||||||
|
msg("Config file not found, skipping: %s", config_file_name)
|
||||||
|
except Exception:
|
||||||
|
# For testing purposes.
|
||||||
|
if not suppress_errors:
|
||||||
|
raise
|
||||||
|
self.log.warning("Error loading config file: %s" %
|
||||||
|
self.config_file_name, exc_info=True)
|
||||||
|
|
||||||
|
def init_profile_dir(self):
|
||||||
|
"""initialize the profile dir"""
|
||||||
|
self._in_init_profile_dir = True
|
||||||
|
if self.profile_dir is not None:
|
||||||
|
# already ran
|
||||||
|
return
|
||||||
|
if 'ProfileDir.location' not in self.config:
|
||||||
|
# location not specified, find by profile name
|
||||||
|
try:
|
||||||
|
p = ProfileDir.find_profile_dir_by_name(self.ipython_dir, self.profile, self.config)
|
||||||
|
except ProfileDirError:
|
||||||
|
# not found, maybe create it (always create default profile)
|
||||||
|
if self.auto_create or self.profile == 'default':
|
||||||
|
try:
|
||||||
|
p = ProfileDir.create_profile_dir_by_name(self.ipython_dir, self.profile, self.config)
|
||||||
|
except ProfileDirError:
|
||||||
|
self.log.fatal("Could not create profile: %r"%self.profile)
|
||||||
|
self.exit(1)
|
||||||
|
else:
|
||||||
|
self.log.info("Created profile dir: %r"%p.location)
|
||||||
|
else:
|
||||||
|
self.log.fatal("Profile %r not found."%self.profile)
|
||||||
|
self.exit(1)
|
||||||
|
else:
|
||||||
|
self.log.debug("Using existing profile dir: %r"%p.location)
|
||||||
|
else:
|
||||||
|
location = self.config.ProfileDir.location
|
||||||
|
# location is fully specified
|
||||||
|
try:
|
||||||
|
p = ProfileDir.find_profile_dir(location, self.config)
|
||||||
|
except ProfileDirError:
|
||||||
|
# not found, maybe create it
|
||||||
|
if self.auto_create:
|
||||||
|
try:
|
||||||
|
p = ProfileDir.create_profile_dir(location, self.config)
|
||||||
|
except ProfileDirError:
|
||||||
|
self.log.fatal("Could not create profile directory: %r"%location)
|
||||||
|
self.exit(1)
|
||||||
|
else:
|
||||||
|
self.log.debug("Creating new profile dir: %r"%location)
|
||||||
|
else:
|
||||||
|
self.log.fatal("Profile directory %r not found."%location)
|
||||||
|
self.exit(1)
|
||||||
|
else:
|
||||||
|
self.log.info("Using existing profile dir: %r"%location)
|
||||||
|
# if profile_dir is specified explicitly, set profile name
|
||||||
|
dir_name = os.path.basename(p.location)
|
||||||
|
if dir_name.startswith('profile_'):
|
||||||
|
self.profile = dir_name[8:]
|
||||||
|
|
||||||
|
self.profile_dir = p
|
||||||
|
self.config_file_paths.append(p.location)
|
||||||
|
self._in_init_profile_dir = False
|
||||||
|
|
||||||
|
def init_config_files(self):
|
||||||
|
"""[optionally] copy default config files into profile dir."""
|
||||||
|
self.config_file_paths.extend(ENV_CONFIG_DIRS)
|
||||||
|
self.config_file_paths.extend(SYSTEM_CONFIG_DIRS)
|
||||||
|
# copy config files
|
||||||
|
path = self.builtin_profile_dir
|
||||||
|
if self.copy_config_files:
|
||||||
|
src = self.profile
|
||||||
|
|
||||||
|
cfg = self.config_file_name
|
||||||
|
if path and os.path.exists(os.path.join(path, cfg)):
|
||||||
|
self.log.warning("Staging %r from %s into %r [overwrite=%s]"%(
|
||||||
|
cfg, src, self.profile_dir.location, self.overwrite)
|
||||||
|
)
|
||||||
|
self.profile_dir.copy_config_file(cfg, path=path, overwrite=self.overwrite)
|
||||||
|
else:
|
||||||
|
self.stage_default_config_file()
|
||||||
|
else:
|
||||||
|
# Still stage *bundled* config files, but not generated ones
|
||||||
|
# This is necessary for `ipython profile=sympy` to load the profile
|
||||||
|
# on the first go
|
||||||
|
files = glob.glob(os.path.join(path, '*.py'))
|
||||||
|
for fullpath in files:
|
||||||
|
cfg = os.path.basename(fullpath)
|
||||||
|
if self.profile_dir.copy_config_file(cfg, path=path, overwrite=False):
|
||||||
|
# file was copied
|
||||||
|
self.log.warning("Staging bundled %s from %s into %r"%(
|
||||||
|
cfg, self.profile, self.profile_dir.location)
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def stage_default_config_file(self):
|
||||||
|
"""auto generate default config file, and stage it into the profile."""
|
||||||
|
s = self.generate_config_file()
|
||||||
|
fname = os.path.join(self.profile_dir.location, self.config_file_name)
|
||||||
|
if self.overwrite or not os.path.exists(fname):
|
||||||
|
self.log.warning("Generating default config file: %r"%(fname))
|
||||||
|
with open(fname, 'w') as f:
|
||||||
|
f.write(s)
|
||||||
|
|
||||||
|
@catch_config_error
|
||||||
|
def initialize(self, argv=None):
|
||||||
|
# don't hook up crash handler before parsing command-line
|
||||||
|
self.parse_command_line(argv)
|
||||||
|
self.init_crash_handler()
|
||||||
|
if self.subapp is not None:
|
||||||
|
# stop here if subapp is taking over
|
||||||
|
return
|
||||||
|
# save a copy of CLI config to re-load after config files
|
||||||
|
# so that it has highest priority
|
||||||
|
cl_config = deepcopy(self.config)
|
||||||
|
self.init_profile_dir()
|
||||||
|
self.init_config_files()
|
||||||
|
self.load_config_file()
|
||||||
|
# enforce cl-opts override configfile opts:
|
||||||
|
self.update_config(cl_config)
|
70
packages/python/yap_kernel/yap_ipython/core/autocall.py
Normal file
70
packages/python/yap_kernel/yap_ipython/core/autocall.py
Normal file
@ -0,0 +1,70 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""
|
||||||
|
Autocall capabilities for yap_ipython.core.
|
||||||
|
|
||||||
|
Authors:
|
||||||
|
|
||||||
|
* Brian Granger
|
||||||
|
* Fernando Perez
|
||||||
|
* Thomas Kluyver
|
||||||
|
|
||||||
|
Notes
|
||||||
|
-----
|
||||||
|
"""
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2008-2011 The yap_ipython Development Team
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
|
# the file COPYING, distributed as part of this software.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Imports
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Code
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
class IPyAutocall(object):
|
||||||
|
""" Instances of this class are always autocalled
|
||||||
|
|
||||||
|
This happens regardless of 'autocall' variable state. Use this to
|
||||||
|
develop macro-like mechanisms.
|
||||||
|
"""
|
||||||
|
_ip = None
|
||||||
|
rewrite = True
|
||||||
|
def __init__(self, ip=None):
|
||||||
|
self._ip = ip
|
||||||
|
|
||||||
|
def set_ip(self, ip):
|
||||||
|
""" Will be used to set _ip point to current ipython instance b/f call
|
||||||
|
|
||||||
|
Override this method if you don't want this to happen.
|
||||||
|
|
||||||
|
"""
|
||||||
|
self._ip = ip
|
||||||
|
|
||||||
|
|
||||||
|
class ExitAutocall(IPyAutocall):
|
||||||
|
"""An autocallable object which will be added to the user namespace so that
|
||||||
|
exit, exit(), quit or quit() are all valid ways to close the shell."""
|
||||||
|
rewrite = False
|
||||||
|
|
||||||
|
def __call__(self):
|
||||||
|
self._ip.ask_exit()
|
||||||
|
|
||||||
|
class ZMQExitAutocall(ExitAutocall):
|
||||||
|
"""Exit yap_ipython. Autocallable, so it needn't be explicitly called.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
keep_kernel : bool
|
||||||
|
If True, leave the kernel alive. Otherwise, tell the kernel to exit too
|
||||||
|
(default).
|
||||||
|
"""
|
||||||
|
def __call__(self, keep_kernel=False):
|
||||||
|
self._ip.keepkernel_on_exit = keep_kernel
|
||||||
|
self._ip.ask_exit()
|
86
packages/python/yap_kernel/yap_ipython/core/builtin_trap.py
Normal file
86
packages/python/yap_kernel/yap_ipython/core/builtin_trap.py
Normal file
@ -0,0 +1,86 @@
|
|||||||
|
"""
|
||||||
|
A context manager for managing things injected into :mod:`builtins`.
|
||||||
|
"""
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
import builtins as builtin_mod
|
||||||
|
|
||||||
|
from traitlets.config.configurable import Configurable
|
||||||
|
|
||||||
|
from traitlets import Instance
|
||||||
|
|
||||||
|
|
||||||
|
class __BuiltinUndefined(object): pass
|
||||||
|
BuiltinUndefined = __BuiltinUndefined()
|
||||||
|
|
||||||
|
class __HideBuiltin(object): pass
|
||||||
|
HideBuiltin = __HideBuiltin()
|
||||||
|
|
||||||
|
|
||||||
|
class BuiltinTrap(Configurable):
|
||||||
|
|
||||||
|
shell = Instance('yap_ipython.core.interactiveshell.InteractiveShellABC',
|
||||||
|
allow_none=True)
|
||||||
|
|
||||||
|
def __init__(self, shell=None):
|
||||||
|
super(BuiltinTrap, self).__init__(shell=shell, config=None)
|
||||||
|
self._orig_builtins = {}
|
||||||
|
# We define this to track if a single BuiltinTrap is nested.
|
||||||
|
# Only turn off the trap when the outermost call to __exit__ is made.
|
||||||
|
self._nested_level = 0
|
||||||
|
self.shell = shell
|
||||||
|
# builtins we always add - if set to HideBuiltin, they will just
|
||||||
|
# be removed instead of being replaced by something else
|
||||||
|
self.auto_builtins = {'exit': HideBuiltin,
|
||||||
|
'quit': HideBuiltin,
|
||||||
|
'get_ipython': self.shell.get_ipython,
|
||||||
|
}
|
||||||
|
|
||||||
|
def __enter__(self):
|
||||||
|
if self._nested_level == 0:
|
||||||
|
self.activate()
|
||||||
|
self._nested_level += 1
|
||||||
|
# I return self, so callers can use add_builtin in a with clause.
|
||||||
|
return self
|
||||||
|
|
||||||
|
def __exit__(self, type, value, traceback):
|
||||||
|
if self._nested_level == 1:
|
||||||
|
self.deactivate()
|
||||||
|
self._nested_level -= 1
|
||||||
|
# Returning False will cause exceptions to propagate
|
||||||
|
return False
|
||||||
|
|
||||||
|
def add_builtin(self, key, value):
|
||||||
|
"""Add a builtin and save the original."""
|
||||||
|
bdict = builtin_mod.__dict__
|
||||||
|
orig = bdict.get(key, BuiltinUndefined)
|
||||||
|
if value is HideBuiltin:
|
||||||
|
if orig is not BuiltinUndefined: #same as 'key in bdict'
|
||||||
|
self._orig_builtins[key] = orig
|
||||||
|
del bdict[key]
|
||||||
|
else:
|
||||||
|
self._orig_builtins[key] = orig
|
||||||
|
bdict[key] = value
|
||||||
|
|
||||||
|
def remove_builtin(self, key, orig):
|
||||||
|
"""Remove an added builtin and re-set the original."""
|
||||||
|
if orig is BuiltinUndefined:
|
||||||
|
del builtin_mod.__dict__[key]
|
||||||
|
else:
|
||||||
|
builtin_mod.__dict__[key] = orig
|
||||||
|
|
||||||
|
def activate(self):
|
||||||
|
"""Store ipython references in the __builtin__ namespace."""
|
||||||
|
|
||||||
|
add_builtin = self.add_builtin
|
||||||
|
for name, func in self.auto_builtins.items():
|
||||||
|
add_builtin(name, func)
|
||||||
|
|
||||||
|
def deactivate(self):
|
||||||
|
"""Remove any builtins which might have been added by add_builtins, or
|
||||||
|
restore overwritten ones to their previous values."""
|
||||||
|
remove_builtin = self.remove_builtin
|
||||||
|
for key, val in self._orig_builtins.items():
|
||||||
|
remove_builtin(key, val)
|
||||||
|
self._orig_builtins.clear()
|
||||||
|
self._builtins_added = False
|
143
packages/python/yap_kernel/yap_ipython/core/compilerop.py
Normal file
143
packages/python/yap_kernel/yap_ipython/core/compilerop.py
Normal file
@ -0,0 +1,143 @@
|
|||||||
|
"""Compiler tools with improved interactive support.
|
||||||
|
|
||||||
|
Provides compilation machinery similar to codeop, but with caching support so
|
||||||
|
we can provide interactive tracebacks.
|
||||||
|
|
||||||
|
Authors
|
||||||
|
-------
|
||||||
|
* Robert Kern
|
||||||
|
* Fernando Perez
|
||||||
|
* Thomas Kluyver
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Note: though it might be more natural to name this module 'compiler', that
|
||||||
|
# name is in the stdlib and name collisions with the stdlib tend to produce
|
||||||
|
# weird problems (often with third-party tools).
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2010-2011 The yap_ipython Development Team.
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License.
|
||||||
|
#
|
||||||
|
# The full license is in the file COPYING.txt, distributed with this software.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Imports
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
# Stdlib imports
|
||||||
|
import __future__
|
||||||
|
from ast import PyCF_ONLY_AST
|
||||||
|
import codeop
|
||||||
|
import functools
|
||||||
|
import hashlib
|
||||||
|
import linecache
|
||||||
|
import operator
|
||||||
|
import time
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Constants
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
# Roughtly equal to PyCF_MASK | PyCF_MASK_OBSOLETE as defined in pythonrun.h,
|
||||||
|
# this is used as a bitmask to extract future-related code flags.
|
||||||
|
PyCF_MASK = functools.reduce(operator.or_,
|
||||||
|
(getattr(__future__, fname).compiler_flag
|
||||||
|
for fname in __future__.all_feature_names))
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Local utilities
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
def code_name(code, number=0):
|
||||||
|
""" Compute a (probably) unique name for code for caching.
|
||||||
|
|
||||||
|
This now expects code to be unicode.
|
||||||
|
"""
|
||||||
|
hash_digest = hashlib.sha1(code.encode("utf-8")).hexdigest()
|
||||||
|
# Include the number and 12 characters of the hash in the name. It's
|
||||||
|
# pretty much impossible that in a single session we'll have collisions
|
||||||
|
# even with truncated hashes, and the full one makes tracebacks too long
|
||||||
|
return '<ipython-input-{0}-{1}>'.format(number, hash_digest[:12])
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Classes and functions
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
class CachingCompiler(codeop.Compile):
|
||||||
|
"""A compiler that caches code compiled from interactive statements.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self):
|
||||||
|
codeop.Compile.__init__(self)
|
||||||
|
|
||||||
|
# This is ugly, but it must be done this way to allow multiple
|
||||||
|
# simultaneous ipython instances to coexist. Since Python itself
|
||||||
|
# directly accesses the data structures in the linecache module, and
|
||||||
|
# the cache therein is global, we must work with that data structure.
|
||||||
|
# We must hold a reference to the original checkcache routine and call
|
||||||
|
# that in our own check_cache() below, but the special yap_ipython cache
|
||||||
|
# must also be shared by all yap_ipython instances. If we were to hold
|
||||||
|
# separate caches (one in each CachingCompiler instance), any call made
|
||||||
|
# by Python itself to linecache.checkcache() would obliterate the
|
||||||
|
# cached data from the other yap_ipython instances.
|
||||||
|
if not hasattr(linecache, '_ipython_cache'):
|
||||||
|
linecache._ipython_cache = {}
|
||||||
|
if not hasattr(linecache, '_checkcache_ori'):
|
||||||
|
linecache._checkcache_ori = linecache.checkcache
|
||||||
|
# Now, we must monkeypatch the linecache directly so that parts of the
|
||||||
|
# stdlib that call it outside our control go through our codepath
|
||||||
|
# (otherwise we'd lose our tracebacks).
|
||||||
|
linecache.checkcache = check_linecache_ipython
|
||||||
|
|
||||||
|
def ast_parse(self, source, filename='<unknown>', symbol='exec'):
|
||||||
|
"""Parse code to an AST with the current compiler flags active.
|
||||||
|
|
||||||
|
Arguments are exactly the same as ast.parse (in the standard library),
|
||||||
|
and are passed to the built-in compile function."""
|
||||||
|
return compile(source, filename, symbol, self.flags | PyCF_ONLY_AST, 1)
|
||||||
|
|
||||||
|
def reset_compiler_flags(self):
|
||||||
|
"""Reset compiler flags to default state."""
|
||||||
|
# This value is copied from codeop.Compile.__init__, so if that ever
|
||||||
|
# changes, it will need to be updated.
|
||||||
|
self.flags = codeop.PyCF_DONT_IMPLY_DEDENT
|
||||||
|
|
||||||
|
@property
|
||||||
|
def compiler_flags(self):
|
||||||
|
"""Flags currently active in the compilation process.
|
||||||
|
"""
|
||||||
|
return self.flags
|
||||||
|
|
||||||
|
def cache(self, code, number=0):
|
||||||
|
"""Make a name for a block of code, and cache the code.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
code : str
|
||||||
|
The Python source code to cache.
|
||||||
|
number : int
|
||||||
|
A number which forms part of the code's name. Used for the execution
|
||||||
|
counter.
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
The name of the cached code (as a string). Pass this as the filename
|
||||||
|
argument to compilation, so that tracebacks are correctly hooked up.
|
||||||
|
"""
|
||||||
|
name = code_name(code, number)
|
||||||
|
entry = (len(code), time.time(),
|
||||||
|
[line+'\n' for line in code.splitlines()], name)
|
||||||
|
linecache.cache[name] = entry
|
||||||
|
linecache._ipython_cache[name] = entry
|
||||||
|
return name
|
||||||
|
|
||||||
|
def check_linecache_ipython(*args):
|
||||||
|
"""Call linecache.checkcache() safely protecting our cached values.
|
||||||
|
"""
|
||||||
|
# First call the orignal checkcache as intended
|
||||||
|
linecache._checkcache_ori(*args)
|
||||||
|
# Then, update back the cache with our data, so that tracebacks related
|
||||||
|
# to our compiled codes can be produced.
|
||||||
|
linecache.cache.update(linecache._ipython_cache)
|
2045
packages/python/yap_kernel/yap_ipython/core/completer.py
Normal file
2045
packages/python/yap_kernel/yap_ipython/core/completer.py
Normal file
File diff suppressed because it is too large
Load Diff
354
packages/python/yap_kernel/yap_ipython/core/completerlib.py
Normal file
354
packages/python/yap_kernel/yap_ipython/core/completerlib.py
Normal file
@ -0,0 +1,354 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""Implementations for various useful completers.
|
||||||
|
|
||||||
|
These are all loaded by default by yap_ipython.
|
||||||
|
"""
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2010-2011 The yap_ipython Development Team.
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License.
|
||||||
|
#
|
||||||
|
# The full license is in the file COPYING.txt, distributed with this software.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Imports
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
# Stdlib imports
|
||||||
|
import glob
|
||||||
|
import inspect
|
||||||
|
import os
|
||||||
|
import re
|
||||||
|
import sys
|
||||||
|
from importlib import import_module
|
||||||
|
from importlib.machinery import all_suffixes
|
||||||
|
|
||||||
|
|
||||||
|
# Third-party imports
|
||||||
|
from time import time
|
||||||
|
from zipimport import zipimporter
|
||||||
|
|
||||||
|
# Our own imports
|
||||||
|
from yap_ipython.core.completer import expand_user, compress_user
|
||||||
|
from yap_ipython.core.error import TryNext
|
||||||
|
from yap_ipython.utils._process_common import arg_split
|
||||||
|
|
||||||
|
# FIXME: this should be pulled in with the right call via the component system
|
||||||
|
from yap_ipython import get_ipython
|
||||||
|
|
||||||
|
from typing import List
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Globals and constants
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
_suffixes = all_suffixes()
|
||||||
|
|
||||||
|
# Time in seconds after which the rootmodules will be stored permanently in the
|
||||||
|
# ipython ip.db database (kept in the user's .ipython dir).
|
||||||
|
TIMEOUT_STORAGE = 2
|
||||||
|
|
||||||
|
# Time in seconds after which we give up
|
||||||
|
TIMEOUT_GIVEUP = 20
|
||||||
|
|
||||||
|
# Regular expression for the python import statement
|
||||||
|
import_re = re.compile(r'(?P<name>[a-zA-Z_][a-zA-Z0-9_]*?)'
|
||||||
|
r'(?P<package>[/\\]__init__)?'
|
||||||
|
r'(?P<suffix>%s)$' %
|
||||||
|
r'|'.join(re.escape(s) for s in _suffixes))
|
||||||
|
|
||||||
|
# RE for the ipython %run command (python + ipython scripts)
|
||||||
|
magic_run_re = re.compile(r'.*(\.ipy|\.ipynb|\.py[w]?)$')
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Local utilities
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
def module_list(path):
|
||||||
|
"""
|
||||||
|
Return the list containing the names of the modules available in the given
|
||||||
|
folder.
|
||||||
|
"""
|
||||||
|
# sys.path has the cwd as an empty string, but isdir/listdir need it as '.'
|
||||||
|
if path == '':
|
||||||
|
path = '.'
|
||||||
|
|
||||||
|
# A few local constants to be used in loops below
|
||||||
|
pjoin = os.path.join
|
||||||
|
|
||||||
|
if os.path.isdir(path):
|
||||||
|
# Build a list of all files in the directory and all files
|
||||||
|
# in its subdirectories. For performance reasons, do not
|
||||||
|
# recurse more than one level into subdirectories.
|
||||||
|
files = []
|
||||||
|
for root, dirs, nondirs in os.walk(path, followlinks=True):
|
||||||
|
subdir = root[len(path)+1:]
|
||||||
|
if subdir:
|
||||||
|
files.extend(pjoin(subdir, f) for f in nondirs)
|
||||||
|
dirs[:] = [] # Do not recurse into additional subdirectories.
|
||||||
|
else:
|
||||||
|
files.extend(nondirs)
|
||||||
|
|
||||||
|
else:
|
||||||
|
try:
|
||||||
|
files = list(zipimporter(path)._files.keys())
|
||||||
|
except:
|
||||||
|
files = []
|
||||||
|
|
||||||
|
# Build a list of modules which match the import_re regex.
|
||||||
|
modules = []
|
||||||
|
for f in files:
|
||||||
|
m = import_re.match(f)
|
||||||
|
if m:
|
||||||
|
modules.append(m.group('name'))
|
||||||
|
return list(set(modules))
|
||||||
|
|
||||||
|
|
||||||
|
def get_root_modules():
|
||||||
|
"""
|
||||||
|
Returns a list containing the names of all the modules available in the
|
||||||
|
folders of the pythonpath.
|
||||||
|
|
||||||
|
ip.db['rootmodules_cache'] maps sys.path entries to list of modules.
|
||||||
|
"""
|
||||||
|
ip = get_ipython()
|
||||||
|
if ip is None:
|
||||||
|
# No global shell instance to store cached list of modules.
|
||||||
|
# Don't try to scan for modules every time.
|
||||||
|
return list(sys.builtin_module_names)
|
||||||
|
|
||||||
|
rootmodules_cache = ip.db.get('rootmodules_cache', {})
|
||||||
|
rootmodules = list(sys.builtin_module_names)
|
||||||
|
start_time = time()
|
||||||
|
store = False
|
||||||
|
for path in sys.path:
|
||||||
|
try:
|
||||||
|
modules = rootmodules_cache[path]
|
||||||
|
except KeyError:
|
||||||
|
modules = module_list(path)
|
||||||
|
try:
|
||||||
|
modules.remove('__init__')
|
||||||
|
except ValueError:
|
||||||
|
pass
|
||||||
|
if path not in ('', '.'): # cwd modules should not be cached
|
||||||
|
rootmodules_cache[path] = modules
|
||||||
|
if time() - start_time > TIMEOUT_STORAGE and not store:
|
||||||
|
store = True
|
||||||
|
print("\nCaching the list of root modules, please wait!")
|
||||||
|
print("(This will only be done once - type '%rehashx' to "
|
||||||
|
"reset cache!)\n")
|
||||||
|
sys.stdout.flush()
|
||||||
|
if time() - start_time > TIMEOUT_GIVEUP:
|
||||||
|
print("This is taking too long, we give up.\n")
|
||||||
|
return []
|
||||||
|
rootmodules.extend(modules)
|
||||||
|
if store:
|
||||||
|
ip.db['rootmodules_cache'] = rootmodules_cache
|
||||||
|
rootmodules = list(set(rootmodules))
|
||||||
|
return rootmodules
|
||||||
|
|
||||||
|
|
||||||
|
def is_importable(module, attr, only_modules):
|
||||||
|
if only_modules:
|
||||||
|
return inspect.ismodule(getattr(module, attr))
|
||||||
|
else:
|
||||||
|
return not(attr[:2] == '__' and attr[-2:] == '__')
|
||||||
|
|
||||||
|
|
||||||
|
def try_import(mod: str, only_modules=False) -> List[str]:
|
||||||
|
"""
|
||||||
|
Try to import given module and return list of potential completions.
|
||||||
|
"""
|
||||||
|
mod = mod.rstrip('.')
|
||||||
|
try:
|
||||||
|
m = import_module(mod)
|
||||||
|
except:
|
||||||
|
return []
|
||||||
|
|
||||||
|
m_is_init = hasattr(m, '__file__') and '__init__' in m.__file__
|
||||||
|
|
||||||
|
completions = []
|
||||||
|
if (not hasattr(m, '__file__')) or (not only_modules) or m_is_init:
|
||||||
|
completions.extend( [attr for attr in dir(m) if
|
||||||
|
is_importable(m, attr, only_modules)])
|
||||||
|
|
||||||
|
completions.extend(getattr(m, '__all__', []))
|
||||||
|
if m_is_init:
|
||||||
|
completions.extend(module_list(os.path.dirname(m.__file__)))
|
||||||
|
completions_set = {c for c in completions if isinstance(c, str)}
|
||||||
|
completions_set.discard('__init__')
|
||||||
|
return list(completions_set)
|
||||||
|
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Completion-related functions.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
def quick_completer(cmd, completions):
|
||||||
|
""" Easily create a trivial completer for a command.
|
||||||
|
|
||||||
|
Takes either a list of completions, or all completions in string (that will
|
||||||
|
be split on whitespace).
|
||||||
|
|
||||||
|
Example::
|
||||||
|
|
||||||
|
[d:\ipython]|1> import ipy_completers
|
||||||
|
[d:\ipython]|2> ipy_completers.quick_completer('foo', ['bar','baz'])
|
||||||
|
[d:\ipython]|3> foo b<TAB>
|
||||||
|
bar baz
|
||||||
|
[d:\ipython]|3> foo ba
|
||||||
|
"""
|
||||||
|
|
||||||
|
if isinstance(completions, str):
|
||||||
|
completions = completions.split()
|
||||||
|
|
||||||
|
def do_complete(self, event):
|
||||||
|
return completions
|
||||||
|
|
||||||
|
get_ipython().set_hook('complete_command',do_complete, str_key = cmd)
|
||||||
|
|
||||||
|
def module_completion(line):
|
||||||
|
"""
|
||||||
|
Returns a list containing the completion possibilities for an import line.
|
||||||
|
|
||||||
|
The line looks like this :
|
||||||
|
'import xml.d'
|
||||||
|
'from xml.dom import'
|
||||||
|
"""
|
||||||
|
|
||||||
|
words = line.split(' ')
|
||||||
|
nwords = len(words)
|
||||||
|
|
||||||
|
# from whatever <tab> -> 'import '
|
||||||
|
if nwords == 3 and words[0] == 'from':
|
||||||
|
return ['import ']
|
||||||
|
|
||||||
|
# 'from xy<tab>' or 'import xy<tab>'
|
||||||
|
if nwords < 3 and (words[0] in {'%aimport', 'import', 'from'}) :
|
||||||
|
if nwords == 1:
|
||||||
|
return get_root_modules()
|
||||||
|
mod = words[1].split('.')
|
||||||
|
if len(mod) < 2:
|
||||||
|
return get_root_modules()
|
||||||
|
completion_list = try_import('.'.join(mod[:-1]), True)
|
||||||
|
return ['.'.join(mod[:-1] + [el]) for el in completion_list]
|
||||||
|
|
||||||
|
# 'from xyz import abc<tab>'
|
||||||
|
if nwords >= 3 and words[0] == 'from':
|
||||||
|
mod = words[1]
|
||||||
|
return try_import(mod)
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Completers
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# These all have the func(self, event) signature to be used as custom
|
||||||
|
# completers
|
||||||
|
|
||||||
|
def module_completer(self,event):
|
||||||
|
"""Give completions after user has typed 'import ...' or 'from ...'"""
|
||||||
|
|
||||||
|
# This works in all versions of python. While 2.5 has
|
||||||
|
# pkgutil.walk_packages(), that particular routine is fairly dangerous,
|
||||||
|
# since it imports *EVERYTHING* on sys.path. That is: a) very slow b) full
|
||||||
|
# of possibly problematic side effects.
|
||||||
|
# This search the folders in the sys.path for available modules.
|
||||||
|
|
||||||
|
return module_completion(event.line)
|
||||||
|
|
||||||
|
# FIXME: there's a lot of logic common to the run, cd and builtin file
|
||||||
|
# completers, that is currently reimplemented in each.
|
||||||
|
|
||||||
|
def magic_run_completer(self, event):
|
||||||
|
"""Complete files that end in .py or .ipy or .ipynb for the %run command.
|
||||||
|
"""
|
||||||
|
comps = arg_split(event.line, strict=False)
|
||||||
|
# relpath should be the current token that we need to complete.
|
||||||
|
if (len(comps) > 1) and (not event.line.endswith(' ')):
|
||||||
|
relpath = comps[-1].strip("'\"")
|
||||||
|
else:
|
||||||
|
relpath = ''
|
||||||
|
|
||||||
|
#print("\nev=", event) # dbg
|
||||||
|
#print("rp=", relpath) # dbg
|
||||||
|
#print('comps=', comps) # dbg
|
||||||
|
|
||||||
|
lglob = glob.glob
|
||||||
|
isdir = os.path.isdir
|
||||||
|
relpath, tilde_expand, tilde_val = expand_user(relpath)
|
||||||
|
|
||||||
|
# Find if the user has already typed the first filename, after which we
|
||||||
|
# should complete on all files, since after the first one other files may
|
||||||
|
# be arguments to the input script.
|
||||||
|
|
||||||
|
if any(magic_run_re.match(c) for c in comps):
|
||||||
|
matches = [f.replace('\\','/') + ('/' if isdir(f) else '')
|
||||||
|
for f in lglob(relpath+'*')]
|
||||||
|
else:
|
||||||
|
dirs = [f.replace('\\','/') + "/" for f in lglob(relpath+'*') if isdir(f)]
|
||||||
|
pys = [f.replace('\\','/')
|
||||||
|
for f in lglob(relpath+'*.py') + lglob(relpath+'*.ipy') +
|
||||||
|
lglob(relpath+'*.ipynb') + lglob(relpath + '*.pyw')]
|
||||||
|
|
||||||
|
matches = dirs + pys
|
||||||
|
|
||||||
|
#print('run comp:', dirs+pys) # dbg
|
||||||
|
return [compress_user(p, tilde_expand, tilde_val) for p in matches]
|
||||||
|
|
||||||
|
|
||||||
|
def cd_completer(self, event):
|
||||||
|
"""Completer function for cd, which only returns directories."""
|
||||||
|
ip = get_ipython()
|
||||||
|
relpath = event.symbol
|
||||||
|
|
||||||
|
#print(event) # dbg
|
||||||
|
if event.line.endswith('-b') or ' -b ' in event.line:
|
||||||
|
# return only bookmark completions
|
||||||
|
bkms = self.db.get('bookmarks', None)
|
||||||
|
if bkms:
|
||||||
|
return bkms.keys()
|
||||||
|
else:
|
||||||
|
return []
|
||||||
|
|
||||||
|
if event.symbol == '-':
|
||||||
|
width_dh = str(len(str(len(ip.user_ns['_dh']) + 1)))
|
||||||
|
# jump in directory history by number
|
||||||
|
fmt = '-%0' + width_dh +'d [%s]'
|
||||||
|
ents = [ fmt % (i,s) for i,s in enumerate(ip.user_ns['_dh'])]
|
||||||
|
if len(ents) > 1:
|
||||||
|
return ents
|
||||||
|
return []
|
||||||
|
|
||||||
|
if event.symbol.startswith('--'):
|
||||||
|
return ["--" + os.path.basename(d) for d in ip.user_ns['_dh']]
|
||||||
|
|
||||||
|
# Expand ~ in path and normalize directory separators.
|
||||||
|
relpath, tilde_expand, tilde_val = expand_user(relpath)
|
||||||
|
relpath = relpath.replace('\\','/')
|
||||||
|
|
||||||
|
found = []
|
||||||
|
for d in [f.replace('\\','/') + '/' for f in glob.glob(relpath+'*')
|
||||||
|
if os.path.isdir(f)]:
|
||||||
|
if ' ' in d:
|
||||||
|
# we don't want to deal with any of that, complex code
|
||||||
|
# for this is elsewhere
|
||||||
|
raise TryNext
|
||||||
|
|
||||||
|
found.append(d)
|
||||||
|
|
||||||
|
if not found:
|
||||||
|
if os.path.isdir(relpath):
|
||||||
|
return [compress_user(relpath, tilde_expand, tilde_val)]
|
||||||
|
|
||||||
|
# if no completions so far, try bookmarks
|
||||||
|
bks = self.db.get('bookmarks',{})
|
||||||
|
bkmatches = [s for s in bks if s.startswith(event.symbol)]
|
||||||
|
if bkmatches:
|
||||||
|
return bkmatches
|
||||||
|
|
||||||
|
raise TryNext
|
||||||
|
|
||||||
|
return [compress_user(p, tilde_expand, tilde_val) for p in found]
|
||||||
|
|
||||||
|
def reset_completer(self, event):
|
||||||
|
"A completer for %reset magic"
|
||||||
|
return '-f -s in out array dhist'.split()
|
215
packages/python/yap_kernel/yap_ipython/core/crashhandler.py
Normal file
215
packages/python/yap_kernel/yap_ipython/core/crashhandler.py
Normal file
@ -0,0 +1,215 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""sys.excepthook for yap_ipython itself, leaves a detailed report on disk.
|
||||||
|
|
||||||
|
Authors:
|
||||||
|
|
||||||
|
* Fernando Perez
|
||||||
|
* Brian E. Granger
|
||||||
|
"""
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu>
|
||||||
|
# Copyright (C) 2008-2011 The yap_ipython Development Team
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
|
# the file COPYING, distributed as part of this software.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Imports
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
import os
|
||||||
|
import sys
|
||||||
|
import traceback
|
||||||
|
from pprint import pformat
|
||||||
|
|
||||||
|
from yap_ipython.core import ultratb
|
||||||
|
from yap_ipython.core.release import author_email
|
||||||
|
from yap_ipython.utils.sysinfo import sys_info
|
||||||
|
from yap_ipython.utils.py3compat import input
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Code
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
# Template for the user message.
|
||||||
|
_default_message_template = """\
|
||||||
|
Oops, {app_name} crashed. We do our best to make it stable, but...
|
||||||
|
|
||||||
|
A crash report was automatically generated with the following information:
|
||||||
|
- A verbatim copy of the crash traceback.
|
||||||
|
- A copy of your input history during this session.
|
||||||
|
- Data on your current {app_name} configuration.
|
||||||
|
|
||||||
|
It was left in the file named:
|
||||||
|
\t'{crash_report_fname}'
|
||||||
|
If you can email this file to the developers, the information in it will help
|
||||||
|
them in understanding and correcting the problem.
|
||||||
|
|
||||||
|
You can mail it to: {contact_name} at {contact_email}
|
||||||
|
with the subject '{app_name} Crash Report'.
|
||||||
|
|
||||||
|
If you want to do it now, the following command will work (under Unix):
|
||||||
|
mail -s '{app_name} Crash Report' {contact_email} < {crash_report_fname}
|
||||||
|
|
||||||
|
To ensure accurate tracking of this issue, please file a report about it at:
|
||||||
|
{bug_tracker}
|
||||||
|
"""
|
||||||
|
|
||||||
|
_lite_message_template = """
|
||||||
|
If you suspect this is an yap_ipython bug, please report it at:
|
||||||
|
https://github.com/ipython/ipython/issues
|
||||||
|
or send an email to the mailing list at {email}
|
||||||
|
|
||||||
|
You can print a more detailed traceback right now with "%tb", or use "%debug"
|
||||||
|
to interactively debug it.
|
||||||
|
|
||||||
|
Extra-detailed tracebacks for bug-reporting purposes can be enabled via:
|
||||||
|
{config}Application.verbose_crash=True
|
||||||
|
"""
|
||||||
|
|
||||||
|
|
||||||
|
class CrashHandler(object):
|
||||||
|
"""Customizable crash handlers for yap_ipython applications.
|
||||||
|
|
||||||
|
Instances of this class provide a :meth:`__call__` method which can be
|
||||||
|
used as a ``sys.excepthook``. The :meth:`__call__` signature is::
|
||||||
|
|
||||||
|
def __call__(self, etype, evalue, etb)
|
||||||
|
"""
|
||||||
|
|
||||||
|
message_template = _default_message_template
|
||||||
|
section_sep = '\n\n'+'*'*75+'\n\n'
|
||||||
|
|
||||||
|
def __init__(self, app, contact_name=None, contact_email=None,
|
||||||
|
bug_tracker=None, show_crash_traceback=True, call_pdb=False):
|
||||||
|
"""Create a new crash handler
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
app : Application
|
||||||
|
A running :class:`Application` instance, which will be queried at
|
||||||
|
crash time for internal information.
|
||||||
|
|
||||||
|
contact_name : str
|
||||||
|
A string with the name of the person to contact.
|
||||||
|
|
||||||
|
contact_email : str
|
||||||
|
A string with the email address of the contact.
|
||||||
|
|
||||||
|
bug_tracker : str
|
||||||
|
A string with the URL for your project's bug tracker.
|
||||||
|
|
||||||
|
show_crash_traceback : bool
|
||||||
|
If false, don't print the crash traceback on stderr, only generate
|
||||||
|
the on-disk report
|
||||||
|
|
||||||
|
Non-argument instance attributes:
|
||||||
|
|
||||||
|
These instances contain some non-argument attributes which allow for
|
||||||
|
further customization of the crash handler's behavior. Please see the
|
||||||
|
source for further details.
|
||||||
|
"""
|
||||||
|
self.crash_report_fname = "Crash_report_%s.txt" % app.name
|
||||||
|
self.app = app
|
||||||
|
self.call_pdb = call_pdb
|
||||||
|
#self.call_pdb = True # dbg
|
||||||
|
self.show_crash_traceback = show_crash_traceback
|
||||||
|
self.info = dict(app_name = app.name,
|
||||||
|
contact_name = contact_name,
|
||||||
|
contact_email = contact_email,
|
||||||
|
bug_tracker = bug_tracker,
|
||||||
|
crash_report_fname = self.crash_report_fname)
|
||||||
|
|
||||||
|
|
||||||
|
def __call__(self, etype, evalue, etb):
|
||||||
|
"""Handle an exception, call for compatible with sys.excepthook"""
|
||||||
|
|
||||||
|
# do not allow the crash handler to be called twice without reinstalling it
|
||||||
|
# this prevents unlikely errors in the crash handling from entering an
|
||||||
|
# infinite loop.
|
||||||
|
sys.excepthook = sys.__excepthook__
|
||||||
|
|
||||||
|
# Report tracebacks shouldn't use color in general (safer for users)
|
||||||
|
color_scheme = 'NoColor'
|
||||||
|
|
||||||
|
# Use this ONLY for developer debugging (keep commented out for release)
|
||||||
|
#color_scheme = 'Linux' # dbg
|
||||||
|
try:
|
||||||
|
rptdir = self.app.ipython_dir
|
||||||
|
except:
|
||||||
|
rptdir = os.getcwd()
|
||||||
|
if rptdir is None or not os.path.isdir(rptdir):
|
||||||
|
rptdir = os.getcwd()
|
||||||
|
report_name = os.path.join(rptdir,self.crash_report_fname)
|
||||||
|
# write the report filename into the instance dict so it can get
|
||||||
|
# properly expanded out in the user message template
|
||||||
|
self.crash_report_fname = report_name
|
||||||
|
self.info['crash_report_fname'] = report_name
|
||||||
|
TBhandler = ultratb.VerboseTB(
|
||||||
|
color_scheme=color_scheme,
|
||||||
|
long_header=1,
|
||||||
|
call_pdb=self.call_pdb,
|
||||||
|
)
|
||||||
|
if self.call_pdb:
|
||||||
|
TBhandler(etype,evalue,etb)
|
||||||
|
return
|
||||||
|
else:
|
||||||
|
traceback = TBhandler.text(etype,evalue,etb,context=31)
|
||||||
|
|
||||||
|
# print traceback to screen
|
||||||
|
if self.show_crash_traceback:
|
||||||
|
print(traceback, file=sys.stderr)
|
||||||
|
|
||||||
|
# and generate a complete report on disk
|
||||||
|
try:
|
||||||
|
report = open(report_name,'w')
|
||||||
|
except:
|
||||||
|
print('Could not create crash report on disk.', file=sys.stderr)
|
||||||
|
return
|
||||||
|
|
||||||
|
# Inform user on stderr of what happened
|
||||||
|
print('\n'+'*'*70+'\n', file=sys.stderr)
|
||||||
|
print(self.message_template.format(**self.info), file=sys.stderr)
|
||||||
|
|
||||||
|
# Construct report on disk
|
||||||
|
report.write(self.make_report(traceback))
|
||||||
|
report.close()
|
||||||
|
input("Hit <Enter> to quit (your terminal may close):")
|
||||||
|
|
||||||
|
def make_report(self,traceback):
|
||||||
|
"""Return a string containing a crash report."""
|
||||||
|
|
||||||
|
sec_sep = self.section_sep
|
||||||
|
|
||||||
|
report = ['*'*75+'\n\n'+'yap_ipython post-mortem report\n\n']
|
||||||
|
rpt_add = report.append
|
||||||
|
rpt_add(sys_info())
|
||||||
|
|
||||||
|
try:
|
||||||
|
config = pformat(self.app.config)
|
||||||
|
rpt_add(sec_sep)
|
||||||
|
rpt_add('Application name: %s\n\n' % self.app_name)
|
||||||
|
rpt_add('Current user configuration structure:\n\n')
|
||||||
|
rpt_add(config)
|
||||||
|
except:
|
||||||
|
pass
|
||||||
|
rpt_add(sec_sep+'Crash traceback:\n\n' + traceback)
|
||||||
|
|
||||||
|
return ''.join(report)
|
||||||
|
|
||||||
|
|
||||||
|
def crash_handler_lite(etype, evalue, tb):
|
||||||
|
"""a light excepthook, adding a small message to the usual traceback"""
|
||||||
|
traceback.print_exception(etype, evalue, tb)
|
||||||
|
|
||||||
|
from yap_ipython.core.interactiveshell import InteractiveShell
|
||||||
|
if InteractiveShell.initialized():
|
||||||
|
# we are in a Shell environment, give %magic example
|
||||||
|
config = "%config "
|
||||||
|
else:
|
||||||
|
# we are not in a shell, show generic config
|
||||||
|
config = "c."
|
||||||
|
print(_lite_message_template.format(email=author_email, config=config), file=sys.stderr)
|
||||||
|
|
645
packages/python/yap_kernel/yap_ipython/core/debugger.py
Normal file
645
packages/python/yap_kernel/yap_ipython/core/debugger.py
Normal file
@ -0,0 +1,645 @@
|
|||||||
|
# -*- coding: utf-8 -*-
|
||||||
|
"""
|
||||||
|
Pdb debugger class.
|
||||||
|
|
||||||
|
Modified from the standard pdb.Pdb class to avoid including readline, so that
|
||||||
|
the command line completion of other programs which include this isn't
|
||||||
|
damaged.
|
||||||
|
|
||||||
|
In the future, this class will be expanded with improvements over the standard
|
||||||
|
pdb.
|
||||||
|
|
||||||
|
The code in this file is mainly lifted out of cmd.py in Python 2.2, with minor
|
||||||
|
changes. Licensing should therefore be under the standard Python terms. For
|
||||||
|
details on the PSF (Python Software Foundation) standard license, see:
|
||||||
|
|
||||||
|
https://docs.python.org/2/license.html
|
||||||
|
"""
|
||||||
|
|
||||||
|
#*****************************************************************************
|
||||||
|
#
|
||||||
|
# This file is licensed under the PSF license.
|
||||||
|
#
|
||||||
|
# Copyright (C) 2001 Python Software Foundation, www.python.org
|
||||||
|
# Copyright (C) 2005-2006 Fernando Perez. <fperez@colorado.edu>
|
||||||
|
#
|
||||||
|
#
|
||||||
|
#*****************************************************************************
|
||||||
|
|
||||||
|
import bdb
|
||||||
|
import functools
|
||||||
|
import inspect
|
||||||
|
import linecache
|
||||||
|
import sys
|
||||||
|
import warnings
|
||||||
|
import re
|
||||||
|
|
||||||
|
from yap_ipython import get_ipython
|
||||||
|
from yap_ipython.utils import PyColorize
|
||||||
|
from yap_ipython.utils import coloransi, py3compat
|
||||||
|
from yap_ipython.core.excolors import exception_colors
|
||||||
|
from yap_ipython.testing.skipdoctest import skip_doctest
|
||||||
|
|
||||||
|
|
||||||
|
prompt = 'ipdb> '
|
||||||
|
|
||||||
|
#We have to check this directly from sys.argv, config struct not yet available
|
||||||
|
from pdb import Pdb as OldPdb
|
||||||
|
|
||||||
|
# Allow the set_trace code to operate outside of an ipython instance, even if
|
||||||
|
# it does so with some limitations. The rest of this support is implemented in
|
||||||
|
# the Tracer constructor.
|
||||||
|
|
||||||
|
def make_arrow(pad):
|
||||||
|
"""generate the leading arrow in front of traceback or debugger"""
|
||||||
|
if pad >= 2:
|
||||||
|
return '-'*(pad-2) + '> '
|
||||||
|
elif pad == 1:
|
||||||
|
return '>'
|
||||||
|
return ''
|
||||||
|
|
||||||
|
|
||||||
|
def BdbQuit_excepthook(et, ev, tb, excepthook=None):
|
||||||
|
"""Exception hook which handles `BdbQuit` exceptions.
|
||||||
|
|
||||||
|
All other exceptions are processed using the `excepthook`
|
||||||
|
parameter.
|
||||||
|
"""
|
||||||
|
warnings.warn("`BdbQuit_excepthook` is deprecated since version 5.1",
|
||||||
|
DeprecationWarning, stacklevel=2)
|
||||||
|
if et==bdb.BdbQuit:
|
||||||
|
print('Exiting Debugger.')
|
||||||
|
elif excepthook is not None:
|
||||||
|
excepthook(et, ev, tb)
|
||||||
|
else:
|
||||||
|
# Backwards compatibility. Raise deprecation warning?
|
||||||
|
BdbQuit_excepthook.excepthook_ori(et,ev,tb)
|
||||||
|
|
||||||
|
|
||||||
|
def BdbQuit_IPython_excepthook(self,et,ev,tb,tb_offset=None):
|
||||||
|
warnings.warn(
|
||||||
|
"`BdbQuit_IPython_excepthook` is deprecated since version 5.1",
|
||||||
|
DeprecationWarning, stacklevel=2)
|
||||||
|
print('Exiting Debugger.')
|
||||||
|
|
||||||
|
|
||||||
|
class Tracer(object):
|
||||||
|
"""
|
||||||
|
DEPRECATED
|
||||||
|
|
||||||
|
Class for local debugging, similar to pdb.set_trace.
|
||||||
|
|
||||||
|
Instances of this class, when called, behave like pdb.set_trace, but
|
||||||
|
providing yap_ipython's enhanced capabilities.
|
||||||
|
|
||||||
|
This is implemented as a class which must be initialized in your own code
|
||||||
|
and not as a standalone function because we need to detect at runtime
|
||||||
|
whether yap_ipython is already active or not. That detection is done in the
|
||||||
|
constructor, ensuring that this code plays nicely with a running yap_ipython,
|
||||||
|
while functioning acceptably (though with limitations) if outside of it.
|
||||||
|
"""
|
||||||
|
|
||||||
|
@skip_doctest
|
||||||
|
def __init__(self, colors=None):
|
||||||
|
"""
|
||||||
|
DEPRECATED
|
||||||
|
|
||||||
|
Create a local debugger instance.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
|
||||||
|
colors : str, optional
|
||||||
|
The name of the color scheme to use, it must be one of yap_ipython's
|
||||||
|
valid color schemes. If not given, the function will default to
|
||||||
|
the current yap_ipython scheme when running inside yap_ipython, and to
|
||||||
|
'NoColor' otherwise.
|
||||||
|
|
||||||
|
Examples
|
||||||
|
--------
|
||||||
|
::
|
||||||
|
|
||||||
|
from yap_ipython.core.debugger import Tracer; debug_here = Tracer()
|
||||||
|
|
||||||
|
Later in your code::
|
||||||
|
|
||||||
|
debug_here() # -> will open up the debugger at that point.
|
||||||
|
|
||||||
|
Once the debugger activates, you can use all of its regular commands to
|
||||||
|
step through code, set breakpoints, etc. See the pdb documentation
|
||||||
|
from the Python standard library for usage details.
|
||||||
|
"""
|
||||||
|
warnings.warn("`Tracer` is deprecated since version 5.1, directly use "
|
||||||
|
"`yap_ipython.core.debugger.Pdb.set_trace()`",
|
||||||
|
DeprecationWarning, stacklevel=2)
|
||||||
|
|
||||||
|
ip = get_ipython()
|
||||||
|
if ip is None:
|
||||||
|
# Outside of ipython, we set our own exception hook manually
|
||||||
|
sys.excepthook = functools.partial(BdbQuit_excepthook,
|
||||||
|
excepthook=sys.excepthook)
|
||||||
|
def_colors = 'NoColor'
|
||||||
|
else:
|
||||||
|
# In ipython, we use its custom exception handler mechanism
|
||||||
|
def_colors = ip.colors
|
||||||
|
ip.set_custom_exc((bdb.BdbQuit,), BdbQuit_IPython_excepthook)
|
||||||
|
|
||||||
|
if colors is None:
|
||||||
|
colors = def_colors
|
||||||
|
|
||||||
|
# The stdlib debugger internally uses a modified repr from the `repr`
|
||||||
|
# module, that limits the length of printed strings to a hardcoded
|
||||||
|
# limit of 30 characters. That much trimming is too aggressive, let's
|
||||||
|
# at least raise that limit to 80 chars, which should be enough for
|
||||||
|
# most interactive uses.
|
||||||
|
try:
|
||||||
|
try:
|
||||||
|
from reprlib import aRepr # Py 3
|
||||||
|
except ImportError:
|
||||||
|
from repr import aRepr # Py 2
|
||||||
|
aRepr.maxstring = 80
|
||||||
|
except:
|
||||||
|
# This is only a user-facing convenience, so any error we encounter
|
||||||
|
# here can be warned about but can be otherwise ignored. These
|
||||||
|
# printouts will tell us about problems if this API changes
|
||||||
|
import traceback
|
||||||
|
traceback.print_exc()
|
||||||
|
|
||||||
|
self.debugger = Pdb(colors)
|
||||||
|
|
||||||
|
def __call__(self):
|
||||||
|
"""Starts an interactive debugger at the point where called.
|
||||||
|
|
||||||
|
This is similar to the pdb.set_trace() function from the std lib, but
|
||||||
|
using yap_ipython's enhanced debugger."""
|
||||||
|
|
||||||
|
self.debugger.set_trace(sys._getframe().f_back)
|
||||||
|
|
||||||
|
|
||||||
|
RGX_EXTRA_INDENT = re.compile('(?<=\n)\s+')
|
||||||
|
|
||||||
|
|
||||||
|
def strip_indentation(multiline_string):
|
||||||
|
return RGX_EXTRA_INDENT.sub('', multiline_string)
|
||||||
|
|
||||||
|
|
||||||
|
def decorate_fn_with_doc(new_fn, old_fn, additional_text=""):
|
||||||
|
"""Make new_fn have old_fn's doc string. This is particularly useful
|
||||||
|
for the ``do_...`` commands that hook into the help system.
|
||||||
|
Adapted from from a comp.lang.python posting
|
||||||
|
by Duncan Booth."""
|
||||||
|
def wrapper(*args, **kw):
|
||||||
|
return new_fn(*args, **kw)
|
||||||
|
if old_fn.__doc__:
|
||||||
|
wrapper.__doc__ = strip_indentation(old_fn.__doc__) + additional_text
|
||||||
|
return wrapper
|
||||||
|
|
||||||
|
|
||||||
|
def _file_lines(fname):
|
||||||
|
"""Return the contents of a named file as a list of lines.
|
||||||
|
|
||||||
|
This function never raises an IOError exception: if the file can't be
|
||||||
|
read, it simply returns an empty list."""
|
||||||
|
|
||||||
|
try:
|
||||||
|
outfile = open(fname)
|
||||||
|
except IOError:
|
||||||
|
return []
|
||||||
|
else:
|
||||||
|
out = outfile.readlines()
|
||||||
|
outfile.close()
|
||||||
|
return out
|
||||||
|
|
||||||
|
|
||||||
|
class Pdb(OldPdb):
|
||||||
|
"""Modified Pdb class, does not load readline.
|
||||||
|
|
||||||
|
for a standalone version that uses prompt_toolkit, see
|
||||||
|
`yap_ipython.terminal.debugger.TerminalPdb` and
|
||||||
|
`yap_ipython.terminal.debugger.set_trace()`
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, color_scheme=None, completekey=None,
|
||||||
|
stdin=None, stdout=None, context=5):
|
||||||
|
|
||||||
|
# Parent constructor:
|
||||||
|
try:
|
||||||
|
self.context = int(context)
|
||||||
|
if self.context <= 0:
|
||||||
|
raise ValueError("Context must be a positive integer")
|
||||||
|
except (TypeError, ValueError):
|
||||||
|
raise ValueError("Context must be a positive integer")
|
||||||
|
|
||||||
|
OldPdb.__init__(self, completekey, stdin, stdout)
|
||||||
|
|
||||||
|
# yap_ipython changes...
|
||||||
|
self.shell = get_ipython()
|
||||||
|
|
||||||
|
if self.shell is None:
|
||||||
|
save_main = sys.modules['__main__']
|
||||||
|
# No yap_ipython instance running, we must create one
|
||||||
|
from yap_ipython.terminal.interactiveshell import \
|
||||||
|
TerminalInteractiveShell
|
||||||
|
self.shell = TerminalInteractiveShell.instance()
|
||||||
|
# needed by any code which calls __import__("__main__") after
|
||||||
|
# the debugger was entered. See also #9941.
|
||||||
|
sys.modules['__main__'] = save_main
|
||||||
|
|
||||||
|
if color_scheme is not None:
|
||||||
|
warnings.warn(
|
||||||
|
"The `color_scheme` argument is deprecated since version 5.1",
|
||||||
|
DeprecationWarning, stacklevel=2)
|
||||||
|
else:
|
||||||
|
color_scheme = self.shell.colors
|
||||||
|
|
||||||
|
self.aliases = {}
|
||||||
|
|
||||||
|
# Create color table: we copy the default one from the traceback
|
||||||
|
# module and add a few attributes needed for debugging
|
||||||
|
self.color_scheme_table = exception_colors()
|
||||||
|
|
||||||
|
# shorthands
|
||||||
|
C = coloransi.TermColors
|
||||||
|
cst = self.color_scheme_table
|
||||||
|
|
||||||
|
cst['NoColor'].colors.prompt = C.NoColor
|
||||||
|
cst['NoColor'].colors.breakpoint_enabled = C.NoColor
|
||||||
|
cst['NoColor'].colors.breakpoint_disabled = C.NoColor
|
||||||
|
|
||||||
|
cst['Linux'].colors.prompt = C.Green
|
||||||
|
cst['Linux'].colors.breakpoint_enabled = C.LightRed
|
||||||
|
cst['Linux'].colors.breakpoint_disabled = C.Red
|
||||||
|
|
||||||
|
cst['LightBG'].colors.prompt = C.Blue
|
||||||
|
cst['LightBG'].colors.breakpoint_enabled = C.LightRed
|
||||||
|
cst['LightBG'].colors.breakpoint_disabled = C.Red
|
||||||
|
|
||||||
|
cst['Neutral'].colors.prompt = C.Blue
|
||||||
|
cst['Neutral'].colors.breakpoint_enabled = C.LightRed
|
||||||
|
cst['Neutral'].colors.breakpoint_disabled = C.Red
|
||||||
|
|
||||||
|
|
||||||
|
# Add a python parser so we can syntax highlight source while
|
||||||
|
# debugging.
|
||||||
|
self.parser = PyColorize.Parser(style=color_scheme)
|
||||||
|
self.set_colors(color_scheme)
|
||||||
|
|
||||||
|
# Set the prompt - the default prompt is '(Pdb)'
|
||||||
|
self.prompt = prompt
|
||||||
|
|
||||||
|
def set_colors(self, scheme):
|
||||||
|
"""Shorthand access to the color table scheme selector method."""
|
||||||
|
self.color_scheme_table.set_active_scheme(scheme)
|
||||||
|
self.parser.style = scheme
|
||||||
|
|
||||||
|
def interaction(self, frame, traceback):
|
||||||
|
try:
|
||||||
|
OldPdb.interaction(self, frame, traceback)
|
||||||
|
except KeyboardInterrupt:
|
||||||
|
sys.stdout.write('\n' + self.shell.get_exception_only())
|
||||||
|
|
||||||
|
def new_do_up(self, arg):
|
||||||
|
OldPdb.do_up(self, arg)
|
||||||
|
do_u = do_up = decorate_fn_with_doc(new_do_up, OldPdb.do_up)
|
||||||
|
|
||||||
|
def new_do_down(self, arg):
|
||||||
|
OldPdb.do_down(self, arg)
|
||||||
|
|
||||||
|
do_d = do_down = decorate_fn_with_doc(new_do_down, OldPdb.do_down)
|
||||||
|
|
||||||
|
def new_do_frame(self, arg):
|
||||||
|
OldPdb.do_frame(self, arg)
|
||||||
|
|
||||||
|
def new_do_quit(self, arg):
|
||||||
|
|
||||||
|
if hasattr(self, 'old_all_completions'):
|
||||||
|
self.shell.Completer.all_completions=self.old_all_completions
|
||||||
|
|
||||||
|
return OldPdb.do_quit(self, arg)
|
||||||
|
|
||||||
|
do_q = do_quit = decorate_fn_with_doc(new_do_quit, OldPdb.do_quit)
|
||||||
|
|
||||||
|
def new_do_restart(self, arg):
|
||||||
|
"""Restart command. In the context of ipython this is exactly the same
|
||||||
|
thing as 'quit'."""
|
||||||
|
self.msg("Restart doesn't make sense here. Using 'quit' instead.")
|
||||||
|
return self.do_quit(arg)
|
||||||
|
|
||||||
|
def print_stack_trace(self, context=None):
|
||||||
|
if context is None:
|
||||||
|
context = self.context
|
||||||
|
try:
|
||||||
|
context=int(context)
|
||||||
|
if context <= 0:
|
||||||
|
raise ValueError("Context must be a positive integer")
|
||||||
|
except (TypeError, ValueError):
|
||||||
|
raise ValueError("Context must be a positive integer")
|
||||||
|
try:
|
||||||
|
for frame_lineno in self.stack:
|
||||||
|
self.print_stack_entry(frame_lineno, context=context)
|
||||||
|
except KeyboardInterrupt:
|
||||||
|
pass
|
||||||
|
|
||||||
|
def print_stack_entry(self,frame_lineno, prompt_prefix='\n-> ',
|
||||||
|
context=None):
|
||||||
|
if context is None:
|
||||||
|
context = self.context
|
||||||
|
try:
|
||||||
|
context=int(context)
|
||||||
|
if context <= 0:
|
||||||
|
raise ValueError("Context must be a positive integer")
|
||||||
|
except (TypeError, ValueError):
|
||||||
|
raise ValueError("Context must be a positive integer")
|
||||||
|
print(self.format_stack_entry(frame_lineno, '', context))
|
||||||
|
|
||||||
|
# vds: >>
|
||||||
|
frame, lineno = frame_lineno
|
||||||
|
filename = frame.f_code.co_filename
|
||||||
|
self.shell.hooks.synchronize_with_editor(filename, lineno, 0)
|
||||||
|
# vds: <<
|
||||||
|
|
||||||
|
def format_stack_entry(self, frame_lineno, lprefix=': ', context=None):
|
||||||
|
if context is None:
|
||||||
|
context = self.context
|
||||||
|
try:
|
||||||
|
context=int(context)
|
||||||
|
if context <= 0:
|
||||||
|
print("Context must be a positive integer")
|
||||||
|
except (TypeError, ValueError):
|
||||||
|
print("Context must be a positive integer")
|
||||||
|
try:
|
||||||
|
import reprlib # Py 3
|
||||||
|
except ImportError:
|
||||||
|
import repr as reprlib # Py 2
|
||||||
|
|
||||||
|
ret = []
|
||||||
|
|
||||||
|
Colors = self.color_scheme_table.active_colors
|
||||||
|
ColorsNormal = Colors.Normal
|
||||||
|
tpl_link = u'%s%%s%s' % (Colors.filenameEm, ColorsNormal)
|
||||||
|
tpl_call = u'%s%%s%s%%s%s' % (Colors.vName, Colors.valEm, ColorsNormal)
|
||||||
|
tpl_line = u'%%s%s%%s %s%%s' % (Colors.lineno, ColorsNormal)
|
||||||
|
tpl_line_em = u'%%s%s%%s %s%%s%s' % (Colors.linenoEm, Colors.line,
|
||||||
|
ColorsNormal)
|
||||||
|
|
||||||
|
frame, lineno = frame_lineno
|
||||||
|
|
||||||
|
return_value = ''
|
||||||
|
if '__return__' in frame.f_locals:
|
||||||
|
rv = frame.f_locals['__return__']
|
||||||
|
#return_value += '->'
|
||||||
|
return_value += reprlib.repr(rv) + '\n'
|
||||||
|
ret.append(return_value)
|
||||||
|
|
||||||
|
#s = filename + '(' + `lineno` + ')'
|
||||||
|
filename = self.canonic(frame.f_code.co_filename)
|
||||||
|
link = tpl_link % py3compat.cast_unicode(filename)
|
||||||
|
|
||||||
|
if frame.f_code.co_name:
|
||||||
|
func = frame.f_code.co_name
|
||||||
|
else:
|
||||||
|
func = "<lambda>"
|
||||||
|
|
||||||
|
call = ''
|
||||||
|
if func != '?':
|
||||||
|
if '__args__' in frame.f_locals:
|
||||||
|
args = reprlib.repr(frame.f_locals['__args__'])
|
||||||
|
else:
|
||||||
|
args = '()'
|
||||||
|
call = tpl_call % (func, args)
|
||||||
|
|
||||||
|
# The level info should be generated in the same format pdb uses, to
|
||||||
|
# avoid breaking the pdbtrack functionality of python-mode in *emacs.
|
||||||
|
if frame is self.curframe:
|
||||||
|
ret.append('> ')
|
||||||
|
else:
|
||||||
|
ret.append(' ')
|
||||||
|
ret.append(u'%s(%s)%s\n' % (link,lineno,call))
|
||||||
|
|
||||||
|
start = lineno - 1 - context//2
|
||||||
|
lines = linecache.getlines(filename)
|
||||||
|
start = min(start, len(lines) - context)
|
||||||
|
start = max(start, 0)
|
||||||
|
lines = lines[start : start + context]
|
||||||
|
|
||||||
|
for i,line in enumerate(lines):
|
||||||
|
show_arrow = (start + 1 + i == lineno)
|
||||||
|
linetpl = (frame is self.curframe or show_arrow) \
|
||||||
|
and tpl_line_em \
|
||||||
|
or tpl_line
|
||||||
|
ret.append(self.__format_line(linetpl, filename,
|
||||||
|
start + 1 + i, line,
|
||||||
|
arrow = show_arrow) )
|
||||||
|
return ''.join(ret)
|
||||||
|
|
||||||
|
def __format_line(self, tpl_line, filename, lineno, line, arrow = False):
|
||||||
|
bp_mark = ""
|
||||||
|
bp_mark_color = ""
|
||||||
|
|
||||||
|
new_line, err = self.parser.format2(line, 'str')
|
||||||
|
if not err:
|
||||||
|
line = new_line
|
||||||
|
|
||||||
|
bp = None
|
||||||
|
if lineno in self.get_file_breaks(filename):
|
||||||
|
bps = self.get_breaks(filename, lineno)
|
||||||
|
bp = bps[-1]
|
||||||
|
|
||||||
|
if bp:
|
||||||
|
Colors = self.color_scheme_table.active_colors
|
||||||
|
bp_mark = str(bp.number)
|
||||||
|
bp_mark_color = Colors.breakpoint_enabled
|
||||||
|
if not bp.enabled:
|
||||||
|
bp_mark_color = Colors.breakpoint_disabled
|
||||||
|
|
||||||
|
numbers_width = 7
|
||||||
|
if arrow:
|
||||||
|
# This is the line with the error
|
||||||
|
pad = numbers_width - len(str(lineno)) - len(bp_mark)
|
||||||
|
num = '%s%s' % (make_arrow(pad), str(lineno))
|
||||||
|
else:
|
||||||
|
num = '%*s' % (numbers_width - len(bp_mark), str(lineno))
|
||||||
|
|
||||||
|
return tpl_line % (bp_mark_color + bp_mark, num, line)
|
||||||
|
|
||||||
|
|
||||||
|
def print_list_lines(self, filename, first, last):
|
||||||
|
"""The printing (as opposed to the parsing part of a 'list'
|
||||||
|
command."""
|
||||||
|
try:
|
||||||
|
Colors = self.color_scheme_table.active_colors
|
||||||
|
ColorsNormal = Colors.Normal
|
||||||
|
tpl_line = '%%s%s%%s %s%%s' % (Colors.lineno, ColorsNormal)
|
||||||
|
tpl_line_em = '%%s%s%%s %s%%s%s' % (Colors.linenoEm, Colors.line, ColorsNormal)
|
||||||
|
src = []
|
||||||
|
if filename == "<string>" and hasattr(self, "_exec_filename"):
|
||||||
|
filename = self._exec_filename
|
||||||
|
|
||||||
|
for lineno in range(first, last+1):
|
||||||
|
line = linecache.getline(filename, lineno)
|
||||||
|
if not line:
|
||||||
|
break
|
||||||
|
|
||||||
|
if lineno == self.curframe.f_lineno:
|
||||||
|
line = self.__format_line(tpl_line_em, filename, lineno, line, arrow = True)
|
||||||
|
else:
|
||||||
|
line = self.__format_line(tpl_line, filename, lineno, line, arrow = False)
|
||||||
|
|
||||||
|
src.append(line)
|
||||||
|
self.lineno = lineno
|
||||||
|
|
||||||
|
print(''.join(src))
|
||||||
|
|
||||||
|
except KeyboardInterrupt:
|
||||||
|
pass
|
||||||
|
|
||||||
|
def do_list(self, arg):
|
||||||
|
"""Print lines of code from the current stack frame
|
||||||
|
"""
|
||||||
|
self.lastcmd = 'list'
|
||||||
|
last = None
|
||||||
|
if arg:
|
||||||
|
try:
|
||||||
|
x = eval(arg, {}, {})
|
||||||
|
if type(x) == type(()):
|
||||||
|
first, last = x
|
||||||
|
first = int(first)
|
||||||
|
last = int(last)
|
||||||
|
if last < first:
|
||||||
|
# Assume it's a count
|
||||||
|
last = first + last
|
||||||
|
else:
|
||||||
|
first = max(1, int(x) - 5)
|
||||||
|
except:
|
||||||
|
print('*** Error in argument:', repr(arg))
|
||||||
|
return
|
||||||
|
elif self.lineno is None:
|
||||||
|
first = max(1, self.curframe.f_lineno - 5)
|
||||||
|
else:
|
||||||
|
first = self.lineno + 1
|
||||||
|
if last is None:
|
||||||
|
last = first + 10
|
||||||
|
self.print_list_lines(self.curframe.f_code.co_filename, first, last)
|
||||||
|
|
||||||
|
# vds: >>
|
||||||
|
lineno = first
|
||||||
|
filename = self.curframe.f_code.co_filename
|
||||||
|
self.shell.hooks.synchronize_with_editor(filename, lineno, 0)
|
||||||
|
# vds: <<
|
||||||
|
|
||||||
|
do_l = do_list
|
||||||
|
|
||||||
|
def getsourcelines(self, obj):
|
||||||
|
lines, lineno = inspect.findsource(obj)
|
||||||
|
if inspect.isframe(obj) and obj.f_globals is obj.f_locals:
|
||||||
|
# must be a module frame: do not try to cut a block out of it
|
||||||
|
return lines, 1
|
||||||
|
elif inspect.ismodule(obj):
|
||||||
|
return lines, 1
|
||||||
|
return inspect.getblock(lines[lineno:]), lineno+1
|
||||||
|
|
||||||
|
def do_longlist(self, arg):
|
||||||
|
"""Print lines of code from the current stack frame.
|
||||||
|
|
||||||
|
Shows more lines than 'list' does.
|
||||||
|
"""
|
||||||
|
self.lastcmd = 'longlist'
|
||||||
|
try:
|
||||||
|
lines, lineno = self.getsourcelines(self.curframe)
|
||||||
|
except OSError as err:
|
||||||
|
self.error(err)
|
||||||
|
return
|
||||||
|
last = lineno + len(lines)
|
||||||
|
self.print_list_lines(self.curframe.f_code.co_filename, lineno, last)
|
||||||
|
do_ll = do_longlist
|
||||||
|
|
||||||
|
def do_debug(self, arg):
|
||||||
|
"""debug code
|
||||||
|
Enter a recursive debugger that steps through the code
|
||||||
|
argument (which is an arbitrary expression or statement to be
|
||||||
|
executed in the current environment).
|
||||||
|
"""
|
||||||
|
sys.settrace(None)
|
||||||
|
globals = self.curframe.f_globals
|
||||||
|
locals = self.curframe_locals
|
||||||
|
p = self.__class__(completekey=self.completekey,
|
||||||
|
stdin=self.stdin, stdout=self.stdout)
|
||||||
|
p.use_rawinput = self.use_rawinput
|
||||||
|
p.prompt = "(%s) " % self.prompt.strip()
|
||||||
|
self.message("ENTERING RECURSIVE DEBUGGER")
|
||||||
|
sys.call_tracing(p.run, (arg, globals, locals))
|
||||||
|
self.message("LEAVING RECURSIVE DEBUGGER")
|
||||||
|
sys.settrace(self.trace_dispatch)
|
||||||
|
self.lastcmd = p.lastcmd
|
||||||
|
|
||||||
|
def do_pdef(self, arg):
|
||||||
|
"""Print the call signature for any callable object.
|
||||||
|
|
||||||
|
The debugger interface to %pdef"""
|
||||||
|
namespaces = [('Locals', self.curframe.f_locals),
|
||||||
|
('Globals', self.curframe.f_globals)]
|
||||||
|
self.shell.find_line_magic('pdef')(arg, namespaces=namespaces)
|
||||||
|
|
||||||
|
def do_pdoc(self, arg):
|
||||||
|
"""Print the docstring for an object.
|
||||||
|
|
||||||
|
The debugger interface to %pdoc."""
|
||||||
|
namespaces = [('Locals', self.curframe.f_locals),
|
||||||
|
('Globals', self.curframe.f_globals)]
|
||||||
|
self.shell.find_line_magic('pdoc')(arg, namespaces=namespaces)
|
||||||
|
|
||||||
|
def do_pfile(self, arg):
|
||||||
|
"""Print (or run through pager) the file where an object is defined.
|
||||||
|
|
||||||
|
The debugger interface to %pfile.
|
||||||
|
"""
|
||||||
|
namespaces = [('Locals', self.curframe.f_locals),
|
||||||
|
('Globals', self.curframe.f_globals)]
|
||||||
|
self.shell.find_line_magic('pfile')(arg, namespaces=namespaces)
|
||||||
|
|
||||||
|
def do_pinfo(self, arg):
|
||||||
|
"""Provide detailed information about an object.
|
||||||
|
|
||||||
|
The debugger interface to %pinfo, i.e., obj?."""
|
||||||
|
namespaces = [('Locals', self.curframe.f_locals),
|
||||||
|
('Globals', self.curframe.f_globals)]
|
||||||
|
self.shell.find_line_magic('pinfo')(arg, namespaces=namespaces)
|
||||||
|
|
||||||
|
def do_pinfo2(self, arg):
|
||||||
|
"""Provide extra detailed information about an object.
|
||||||
|
|
||||||
|
The debugger interface to %pinfo2, i.e., obj??."""
|
||||||
|
namespaces = [('Locals', self.curframe.f_locals),
|
||||||
|
('Globals', self.curframe.f_globals)]
|
||||||
|
self.shell.find_line_magic('pinfo2')(arg, namespaces=namespaces)
|
||||||
|
|
||||||
|
def do_psource(self, arg):
|
||||||
|
"""Print (or run through pager) the source code for an object."""
|
||||||
|
namespaces = [('Locals', self.curframe.f_locals),
|
||||||
|
('Globals', self.curframe.f_globals)]
|
||||||
|
self.shell.find_line_magic('psource')(arg, namespaces=namespaces)
|
||||||
|
|
||||||
|
def do_where(self, arg):
|
||||||
|
"""w(here)
|
||||||
|
Print a stack trace, with the most recent frame at the bottom.
|
||||||
|
An arrow indicates the "current frame", which determines the
|
||||||
|
context of most commands. 'bt' is an alias for this command.
|
||||||
|
|
||||||
|
Take a number as argument as an (optional) number of context line to
|
||||||
|
print"""
|
||||||
|
if arg:
|
||||||
|
context = int(arg)
|
||||||
|
self.print_stack_trace(context)
|
||||||
|
else:
|
||||||
|
self.print_stack_trace()
|
||||||
|
|
||||||
|
do_w = do_where
|
||||||
|
|
||||||
|
|
||||||
|
def set_trace(frame=None):
|
||||||
|
"""
|
||||||
|
Start debugging from `frame`.
|
||||||
|
|
||||||
|
If frame is not specified, debugging starts from caller's frame.
|
||||||
|
"""
|
||||||
|
Pdb().set_trace(frame or sys._getframe().f_back)
|
1413
packages/python/yap_kernel/yap_ipython/core/display.py
Normal file
1413
packages/python/yap_kernel/yap_ipython/core/display.py
Normal file
File diff suppressed because it is too large
Load Diff
70
packages/python/yap_kernel/yap_ipython/core/display_trap.py
Normal file
70
packages/python/yap_kernel/yap_ipython/core/display_trap.py
Normal file
@ -0,0 +1,70 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""
|
||||||
|
A context manager for handling sys.displayhook.
|
||||||
|
|
||||||
|
Authors:
|
||||||
|
|
||||||
|
* Robert Kern
|
||||||
|
* Brian Granger
|
||||||
|
"""
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2008-2011 The yap_ipython Development Team
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
|
# the file COPYING, distributed as part of this software.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Imports
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
import sys
|
||||||
|
|
||||||
|
from traitlets.config.configurable import Configurable
|
||||||
|
from traitlets import Any
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Classes and functions
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
|
||||||
|
class DisplayTrap(Configurable):
|
||||||
|
"""Object to manage sys.displayhook.
|
||||||
|
|
||||||
|
This came from yap_ipython.core.kernel.display_hook, but is simplified
|
||||||
|
(no callbacks or formatters) until more of the core is refactored.
|
||||||
|
"""
|
||||||
|
|
||||||
|
hook = Any()
|
||||||
|
|
||||||
|
def __init__(self, hook=None):
|
||||||
|
super(DisplayTrap, self).__init__(hook=hook, config=None)
|
||||||
|
self.old_hook = None
|
||||||
|
# We define this to track if a single BuiltinTrap is nested.
|
||||||
|
# Only turn off the trap when the outermost call to __exit__ is made.
|
||||||
|
self._nested_level = 0
|
||||||
|
|
||||||
|
def __enter__(self):
|
||||||
|
if self._nested_level == 0:
|
||||||
|
self.set()
|
||||||
|
self._nested_level += 1
|
||||||
|
return self
|
||||||
|
|
||||||
|
def __exit__(self, type, value, traceback):
|
||||||
|
if self._nested_level == 1:
|
||||||
|
self.unset()
|
||||||
|
self._nested_level -= 1
|
||||||
|
# Returning False will cause exceptions to propagate
|
||||||
|
return False
|
||||||
|
|
||||||
|
def set(self):
|
||||||
|
"""Set the hook."""
|
||||||
|
if sys.displayhook is not self.hook:
|
||||||
|
self.old_hook = sys.displayhook
|
||||||
|
sys.displayhook = self.hook
|
||||||
|
|
||||||
|
def unset(self):
|
||||||
|
"""Unset the hook."""
|
||||||
|
sys.displayhook = self.old_hook
|
||||||
|
|
320
packages/python/yap_kernel/yap_ipython/core/displayhook.py
Normal file
320
packages/python/yap_kernel/yap_ipython/core/displayhook.py
Normal file
@ -0,0 +1,320 @@
|
|||||||
|
# -*- coding: utf-8 -*-
|
||||||
|
"""Displayhook for yap_ipython.
|
||||||
|
|
||||||
|
This defines a callable class that yap_ipython uses for `sys.displayhook`.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
import builtins as builtin_mod
|
||||||
|
import sys
|
||||||
|
import io as _io
|
||||||
|
import tokenize
|
||||||
|
|
||||||
|
from traitlets.config.configurable import Configurable
|
||||||
|
from traitlets import Instance, Float
|
||||||
|
from warnings import warn
|
||||||
|
|
||||||
|
# TODO: Move the various attributes (cache_size, [others now moved]). Some
|
||||||
|
# of these are also attributes of InteractiveShell. They should be on ONE object
|
||||||
|
# only and the other objects should ask that one object for their values.
|
||||||
|
|
||||||
|
class DisplayHook(Configurable):
|
||||||
|
"""The custom yap_ipython displayhook to replace sys.displayhook.
|
||||||
|
|
||||||
|
This class does many things, but the basic idea is that it is a callable
|
||||||
|
that gets called anytime user code returns a value.
|
||||||
|
"""
|
||||||
|
|
||||||
|
shell = Instance('yap_ipython.core.interactiveshell.InteractiveShellABC',
|
||||||
|
allow_none=True)
|
||||||
|
exec_result = Instance('yap_ipython.core.interactiveshell.ExecutionResult',
|
||||||
|
allow_none=True)
|
||||||
|
cull_fraction = Float(0.2)
|
||||||
|
|
||||||
|
def __init__(self, shell=None, cache_size=1000, **kwargs):
|
||||||
|
super(DisplayHook, self).__init__(shell=shell, **kwargs)
|
||||||
|
cache_size_min = 3
|
||||||
|
if cache_size <= 0:
|
||||||
|
self.do_full_cache = 0
|
||||||
|
cache_size = 0
|
||||||
|
elif cache_size < cache_size_min:
|
||||||
|
self.do_full_cache = 0
|
||||||
|
cache_size = 0
|
||||||
|
warn('caching was disabled (min value for cache size is %s).' %
|
||||||
|
cache_size_min,stacklevel=3)
|
||||||
|
else:
|
||||||
|
self.do_full_cache = 1
|
||||||
|
|
||||||
|
self.cache_size = cache_size
|
||||||
|
|
||||||
|
# we need a reference to the user-level namespace
|
||||||
|
self.shell = shell
|
||||||
|
|
||||||
|
self._,self.__,self.___ = '','',''
|
||||||
|
|
||||||
|
# these are deliberately global:
|
||||||
|
to_user_ns = {'_':self._,'__':self.__,'___':self.___}
|
||||||
|
self.shell.user_ns.update(to_user_ns)
|
||||||
|
|
||||||
|
@property
|
||||||
|
def prompt_count(self):
|
||||||
|
return self.shell.execution_count
|
||||||
|
|
||||||
|
#-------------------------------------------------------------------------
|
||||||
|
# Methods used in __call__. Override these methods to modify the behavior
|
||||||
|
# of the displayhook.
|
||||||
|
#-------------------------------------------------------------------------
|
||||||
|
|
||||||
|
def check_for_underscore(self):
|
||||||
|
"""Check if the user has set the '_' variable by hand."""
|
||||||
|
# If something injected a '_' variable in __builtin__, delete
|
||||||
|
# ipython's automatic one so we don't clobber that. gettext() in
|
||||||
|
# particular uses _, so we need to stay away from it.
|
||||||
|
if '_' in builtin_mod.__dict__:
|
||||||
|
try:
|
||||||
|
user_value = self.shell.user_ns['_']
|
||||||
|
if user_value is not self._:
|
||||||
|
return
|
||||||
|
del self.shell.user_ns['_']
|
||||||
|
except KeyError:
|
||||||
|
pass
|
||||||
|
|
||||||
|
def quiet(self):
|
||||||
|
"""Should we silence the display hook because of ';'?"""
|
||||||
|
# do not print output if input ends in ';'
|
||||||
|
|
||||||
|
try:
|
||||||
|
cell = self.shell.history_manager.input_hist_parsed[-1]
|
||||||
|
except IndexError:
|
||||||
|
# some uses of ipshellembed may fail here
|
||||||
|
return False
|
||||||
|
|
||||||
|
sio = _io.StringIO(cell)
|
||||||
|
tokens = list(tokenize.generate_tokens(sio.readline))
|
||||||
|
|
||||||
|
for token in reversed(tokens):
|
||||||
|
if token[0] in (tokenize.ENDMARKER, tokenize.NL, tokenize.NEWLINE, tokenize.COMMENT):
|
||||||
|
continue
|
||||||
|
if (token[0] == tokenize.OP) and (token[1] == ';'):
|
||||||
|
return True
|
||||||
|
else:
|
||||||
|
return False
|
||||||
|
|
||||||
|
def start_displayhook(self):
|
||||||
|
"""Start the displayhook, initializing resources."""
|
||||||
|
pass
|
||||||
|
|
||||||
|
def write_output_prompt(self):
|
||||||
|
"""Write the output prompt.
|
||||||
|
|
||||||
|
The default implementation simply writes the prompt to
|
||||||
|
``sys.stdout``.
|
||||||
|
"""
|
||||||
|
# Use write, not print which adds an extra space.
|
||||||
|
sys.stdout.write(self.shell.separate_out)
|
||||||
|
outprompt = 'Out[{}]: '.format(self.shell.execution_count)
|
||||||
|
if self.do_full_cache:
|
||||||
|
sys.stdout.write(outprompt)
|
||||||
|
|
||||||
|
def compute_format_data(self, result):
|
||||||
|
"""Compute format data of the object to be displayed.
|
||||||
|
|
||||||
|
The format data is a generalization of the :func:`repr` of an object.
|
||||||
|
In the default implementation the format data is a :class:`dict` of
|
||||||
|
key value pair where the keys are valid MIME types and the values
|
||||||
|
are JSON'able data structure containing the raw data for that MIME
|
||||||
|
type. It is up to frontends to determine pick a MIME to to use and
|
||||||
|
display that data in an appropriate manner.
|
||||||
|
|
||||||
|
This method only computes the format data for the object and should
|
||||||
|
NOT actually print or write that to a stream.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
result : object
|
||||||
|
The Python object passed to the display hook, whose format will be
|
||||||
|
computed.
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
(format_dict, md_dict) : dict
|
||||||
|
format_dict is a :class:`dict` whose keys are valid MIME types and values are
|
||||||
|
JSON'able raw data for that MIME type. It is recommended that
|
||||||
|
all return values of this should always include the "text/plain"
|
||||||
|
MIME type representation of the object.
|
||||||
|
md_dict is a :class:`dict` with the same MIME type keys
|
||||||
|
of metadata associated with each output.
|
||||||
|
|
||||||
|
"""
|
||||||
|
return self.shell.display_formatter.format(result)
|
||||||
|
|
||||||
|
# This can be set to True by the write_output_prompt method in a subclass
|
||||||
|
prompt_end_newline = False
|
||||||
|
|
||||||
|
def write_format_data(self, format_dict, md_dict=None):
|
||||||
|
"""Write the format data dict to the frontend.
|
||||||
|
|
||||||
|
This default version of this method simply writes the plain text
|
||||||
|
representation of the object to ``sys.stdout``. Subclasses should
|
||||||
|
override this method to send the entire `format_dict` to the
|
||||||
|
frontends.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
format_dict : dict
|
||||||
|
The format dict for the object passed to `sys.displayhook`.
|
||||||
|
md_dict : dict (optional)
|
||||||
|
The metadata dict to be associated with the display data.
|
||||||
|
"""
|
||||||
|
if 'text/plain' not in format_dict:
|
||||||
|
# nothing to do
|
||||||
|
return
|
||||||
|
# We want to print because we want to always make sure we have a
|
||||||
|
# newline, even if all the prompt separators are ''. This is the
|
||||||
|
# standard yap_ipython behavior.
|
||||||
|
result_repr = format_dict['text/plain']
|
||||||
|
if '\n' in result_repr:
|
||||||
|
# So that multi-line strings line up with the left column of
|
||||||
|
# the screen, instead of having the output prompt mess up
|
||||||
|
# their first line.
|
||||||
|
# We use the prompt template instead of the expanded prompt
|
||||||
|
# because the expansion may add ANSI escapes that will interfere
|
||||||
|
# with our ability to determine whether or not we should add
|
||||||
|
# a newline.
|
||||||
|
if not self.prompt_end_newline:
|
||||||
|
# But avoid extraneous empty lines.
|
||||||
|
result_repr = '\n' + result_repr
|
||||||
|
|
||||||
|
print(result_repr)
|
||||||
|
|
||||||
|
def update_user_ns(self, result):
|
||||||
|
"""Update user_ns with various things like _, __, _1, etc."""
|
||||||
|
|
||||||
|
# Avoid recursive reference when displaying _oh/Out
|
||||||
|
if result is not self.shell.user_ns['_oh']:
|
||||||
|
if len(self.shell.user_ns['_oh']) >= self.cache_size and self.do_full_cache:
|
||||||
|
self.cull_cache()
|
||||||
|
|
||||||
|
# Don't overwrite '_' and friends if '_' is in __builtin__
|
||||||
|
# (otherwise we cause buggy behavior for things like gettext). and
|
||||||
|
# do not overwrite _, __ or ___ if one of these has been assigned
|
||||||
|
# by the user.
|
||||||
|
update_unders = True
|
||||||
|
for unders in ['_'*i for i in range(1,4)]:
|
||||||
|
if not unders in self.shell.user_ns:
|
||||||
|
continue
|
||||||
|
if getattr(self, unders) is not self.shell.user_ns.get(unders):
|
||||||
|
update_unders = False
|
||||||
|
|
||||||
|
self.___ = self.__
|
||||||
|
self.__ = self._
|
||||||
|
self._ = result
|
||||||
|
|
||||||
|
if ('_' not in builtin_mod.__dict__) and (update_unders):
|
||||||
|
self.shell.push({'_':self._,
|
||||||
|
'__':self.__,
|
||||||
|
'___':self.___}, interactive=False)
|
||||||
|
|
||||||
|
# hackish access to top-level namespace to create _1,_2... dynamically
|
||||||
|
to_main = {}
|
||||||
|
if self.do_full_cache:
|
||||||
|
new_result = '_%s' % self.prompt_count
|
||||||
|
to_main[new_result] = result
|
||||||
|
self.shell.push(to_main, interactive=False)
|
||||||
|
self.shell.user_ns['_oh'][self.prompt_count] = result
|
||||||
|
|
||||||
|
def fill_exec_result(self, result):
|
||||||
|
if self.exec_result is not None:
|
||||||
|
self.exec_result.result = result
|
||||||
|
|
||||||
|
def log_output(self, format_dict):
|
||||||
|
"""Log the output."""
|
||||||
|
if 'text/plain' not in format_dict:
|
||||||
|
# nothing to do
|
||||||
|
return
|
||||||
|
if self.shell.logger.log_output:
|
||||||
|
self.shell.logger.log_write(format_dict['text/plain'], 'output')
|
||||||
|
self.shell.history_manager.output_hist_reprs[self.prompt_count] = \
|
||||||
|
format_dict['text/plain']
|
||||||
|
|
||||||
|
def finish_displayhook(self):
|
||||||
|
"""Finish up all displayhook activities."""
|
||||||
|
sys.stdout.write(self.shell.separate_out2)
|
||||||
|
sys.stdout.flush()
|
||||||
|
|
||||||
|
def __call__(self, result=None):
|
||||||
|
"""Printing with history cache management.
|
||||||
|
|
||||||
|
This is invoked everytime the interpreter needs to print, and is
|
||||||
|
activated by setting the variable sys.displayhook to it.
|
||||||
|
"""
|
||||||
|
self.check_for_underscore()
|
||||||
|
if result is not None and not self.quiet():
|
||||||
|
self.start_displayhook()
|
||||||
|
self.write_output_prompt()
|
||||||
|
format_dict, md_dict = self.compute_format_data(result)
|
||||||
|
self.update_user_ns(result)
|
||||||
|
self.fill_exec_result(result)
|
||||||
|
if format_dict:
|
||||||
|
self.write_format_data(format_dict, md_dict)
|
||||||
|
self.log_output(format_dict)
|
||||||
|
self.finish_displayhook()
|
||||||
|
|
||||||
|
def cull_cache(self):
|
||||||
|
"""Output cache is full, cull the oldest entries"""
|
||||||
|
oh = self.shell.user_ns.get('_oh', {})
|
||||||
|
sz = len(oh)
|
||||||
|
cull_count = max(int(sz * self.cull_fraction), 2)
|
||||||
|
warn('Output cache limit (currently {sz} entries) hit.\n'
|
||||||
|
'Flushing oldest {cull_count} entries.'.format(sz=sz, cull_count=cull_count))
|
||||||
|
|
||||||
|
for i, n in enumerate(sorted(oh)):
|
||||||
|
if i >= cull_count:
|
||||||
|
break
|
||||||
|
self.shell.user_ns.pop('_%i' % n, None)
|
||||||
|
oh.pop(n, None)
|
||||||
|
|
||||||
|
|
||||||
|
def flush(self):
|
||||||
|
if not self.do_full_cache:
|
||||||
|
raise ValueError("You shouldn't have reached the cache flush "
|
||||||
|
"if full caching is not enabled!")
|
||||||
|
# delete auto-generated vars from global namespace
|
||||||
|
|
||||||
|
for n in range(1,self.prompt_count + 1):
|
||||||
|
key = '_'+repr(n)
|
||||||
|
try:
|
||||||
|
del self.shell.user_ns[key]
|
||||||
|
except: pass
|
||||||
|
# In some embedded circumstances, the user_ns doesn't have the
|
||||||
|
# '_oh' key set up.
|
||||||
|
oh = self.shell.user_ns.get('_oh', None)
|
||||||
|
if oh is not None:
|
||||||
|
oh.clear()
|
||||||
|
|
||||||
|
# Release our own references to objects:
|
||||||
|
self._, self.__, self.___ = '', '', ''
|
||||||
|
|
||||||
|
if '_' not in builtin_mod.__dict__:
|
||||||
|
self.shell.user_ns.update({'_':None,'__':None, '___':None})
|
||||||
|
import gc
|
||||||
|
# TODO: Is this really needed?
|
||||||
|
# IronPython blocks here forever
|
||||||
|
if sys.platform != "cli":
|
||||||
|
gc.collect()
|
||||||
|
|
||||||
|
|
||||||
|
class CapturingDisplayHook(object):
|
||||||
|
def __init__(self, shell, outputs=None):
|
||||||
|
self.shell = shell
|
||||||
|
if outputs is None:
|
||||||
|
outputs = []
|
||||||
|
self.outputs = outputs
|
||||||
|
|
||||||
|
def __call__(self, result=None):
|
||||||
|
if result is None:
|
||||||
|
return
|
||||||
|
format_dict, md_dict = self.shell.display_formatter.format(result)
|
||||||
|
self.outputs.append((format_dict, md_dict))
|
125
packages/python/yap_kernel/yap_ipython/core/displaypub.py
Normal file
125
packages/python/yap_kernel/yap_ipython/core/displaypub.py
Normal file
@ -0,0 +1,125 @@
|
|||||||
|
"""An interface for publishing rich data to frontends.
|
||||||
|
|
||||||
|
There are two components of the display system:
|
||||||
|
|
||||||
|
* Display formatters, which take a Python object and compute the
|
||||||
|
representation of the object in various formats (text, HTML, SVG, etc.).
|
||||||
|
* The display publisher that is used to send the representation data to the
|
||||||
|
various frontends.
|
||||||
|
|
||||||
|
This module defines the logic display publishing. The display publisher uses
|
||||||
|
the ``display_data`` message type that is defined in the yap_ipython messaging
|
||||||
|
spec.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
|
||||||
|
import sys
|
||||||
|
|
||||||
|
from traitlets.config.configurable import Configurable
|
||||||
|
from traitlets import List
|
||||||
|
|
||||||
|
# This used to be defined here - it is imported for backwards compatibility
|
||||||
|
from .display import publish_display_data
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Main payload class
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
class DisplayPublisher(Configurable):
|
||||||
|
"""A traited class that publishes display data to frontends.
|
||||||
|
|
||||||
|
Instances of this class are created by the main yap_ipython object and should
|
||||||
|
be accessed there.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def _validate_data(self, data, metadata=None):
|
||||||
|
"""Validate the display data.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
data : dict
|
||||||
|
The formata data dictionary.
|
||||||
|
metadata : dict
|
||||||
|
Any metadata for the data.
|
||||||
|
"""
|
||||||
|
|
||||||
|
if not isinstance(data, dict):
|
||||||
|
raise TypeError('data must be a dict, got: %r' % data)
|
||||||
|
if metadata is not None:
|
||||||
|
if not isinstance(metadata, dict):
|
||||||
|
raise TypeError('metadata must be a dict, got: %r' % data)
|
||||||
|
|
||||||
|
# use * to indicate transient, update are keyword-only
|
||||||
|
def publish(self, data, metadata=None, source=None, *, transient=None, update=False, **kwargs):
|
||||||
|
"""Publish data and metadata to all frontends.
|
||||||
|
|
||||||
|
See the ``display_data`` message in the messaging documentation for
|
||||||
|
more details about this message type.
|
||||||
|
|
||||||
|
The following MIME types are currently implemented:
|
||||||
|
|
||||||
|
* text/plain
|
||||||
|
* text/html
|
||||||
|
* text/markdown
|
||||||
|
* text/latex
|
||||||
|
* application/json
|
||||||
|
* application/javascript
|
||||||
|
* image/png
|
||||||
|
* image/jpeg
|
||||||
|
* image/svg+xml
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
data : dict
|
||||||
|
A dictionary having keys that are valid MIME types (like
|
||||||
|
'text/plain' or 'image/svg+xml') and values that are the data for
|
||||||
|
that MIME type. The data itself must be a JSON'able data
|
||||||
|
structure. Minimally all data should have the 'text/plain' data,
|
||||||
|
which can be displayed by all frontends. If more than the plain
|
||||||
|
text is given, it is up to the frontend to decide which
|
||||||
|
representation to use.
|
||||||
|
metadata : dict
|
||||||
|
A dictionary for metadata related to the data. This can contain
|
||||||
|
arbitrary key, value pairs that frontends can use to interpret
|
||||||
|
the data. Metadata specific to each mime-type can be specified
|
||||||
|
in the metadata dict with the same mime-type keys as
|
||||||
|
the data itself.
|
||||||
|
source : str, deprecated
|
||||||
|
Unused.
|
||||||
|
transient: dict, keyword-only
|
||||||
|
A dictionary for transient data.
|
||||||
|
Data in this dictionary should not be persisted as part of saving this output.
|
||||||
|
Examples include 'display_id'.
|
||||||
|
update: bool, keyword-only, default: False
|
||||||
|
If True, only update existing outputs with the same display_id,
|
||||||
|
rather than creating a new output.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# The default is to simply write the plain text data using sys.stdout.
|
||||||
|
if 'text/plain' in data:
|
||||||
|
print(data['text/plain'])
|
||||||
|
|
||||||
|
def clear_output(self, wait=False):
|
||||||
|
"""Clear the output of the cell receiving output."""
|
||||||
|
print('\033[2K\r', end='')
|
||||||
|
sys.stdout.flush()
|
||||||
|
print('\033[2K\r', end='')
|
||||||
|
sys.stderr.flush()
|
||||||
|
|
||||||
|
|
||||||
|
class CapturingDisplayPublisher(DisplayPublisher):
|
||||||
|
"""A DisplayPublisher that stores"""
|
||||||
|
outputs = List()
|
||||||
|
|
||||||
|
def publish(self, data, metadata=None, source=None, *, transient=None, update=False):
|
||||||
|
self.outputs.append({'data':data, 'metadata':metadata,
|
||||||
|
'transient':transient, 'update':update})
|
||||||
|
|
||||||
|
def clear_output(self, wait=False):
|
||||||
|
super(CapturingDisplayPublisher, self).clear_output(wait)
|
||||||
|
|
||||||
|
# empty the list, *do not* reassign a new list
|
||||||
|
self.outputs.clear()
|
60
packages/python/yap_kernel/yap_ipython/core/error.py
Normal file
60
packages/python/yap_kernel/yap_ipython/core/error.py
Normal file
@ -0,0 +1,60 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""
|
||||||
|
Global exception classes for yap_ipython.core.
|
||||||
|
|
||||||
|
Authors:
|
||||||
|
|
||||||
|
* Brian Granger
|
||||||
|
* Fernando Perez
|
||||||
|
* Min Ragan-Kelley
|
||||||
|
|
||||||
|
Notes
|
||||||
|
-----
|
||||||
|
"""
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2008 The yap_ipython Development Team
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
|
# the file COPYING, distributed as part of this software.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Imports
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Exception classes
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
class IPythonCoreError(Exception):
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
|
class TryNext(IPythonCoreError):
|
||||||
|
"""Try next hook exception.
|
||||||
|
|
||||||
|
Raise this in your hook function to indicate that the next hook handler
|
||||||
|
should be used to handle the operation.
|
||||||
|
"""
|
||||||
|
|
||||||
|
class UsageError(IPythonCoreError):
|
||||||
|
"""Error in magic function arguments, etc.
|
||||||
|
|
||||||
|
Something that probably won't warrant a full traceback, but should
|
||||||
|
nevertheless interrupt a macro / batch file.
|
||||||
|
"""
|
||||||
|
|
||||||
|
class StdinNotImplementedError(IPythonCoreError, NotImplementedError):
|
||||||
|
"""raw_input was requested in a context where it is not supported
|
||||||
|
|
||||||
|
For use in yap_ipython kernels, where only some frontends may support
|
||||||
|
stdin requests.
|
||||||
|
"""
|
||||||
|
|
||||||
|
class InputRejected(Exception):
|
||||||
|
"""Input rejected by ast transformer.
|
||||||
|
|
||||||
|
Raise this in your NodeTransformer to indicate that InteractiveShell should
|
||||||
|
not execute the supplied input.
|
||||||
|
"""
|
160
packages/python/yap_kernel/yap_ipython/core/events.py
Normal file
160
packages/python/yap_kernel/yap_ipython/core/events.py
Normal file
@ -0,0 +1,160 @@
|
|||||||
|
"""Infrastructure for registering and firing callbacks on application events.
|
||||||
|
|
||||||
|
Unlike :mod:`yap_ipython.core.hooks`, which lets end users set single functions to
|
||||||
|
be called at specific times, or a collection of alternative methods to try,
|
||||||
|
callbacks are designed to be used by extension authors. A number of callbacks
|
||||||
|
can be registered for the same event without needing to be aware of one another.
|
||||||
|
|
||||||
|
The functions defined in this module are no-ops indicating the names of available
|
||||||
|
events and the arguments which will be passed to them.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
This API is experimental in yap_ipython 2.0, and may be revised in future versions.
|
||||||
|
"""
|
||||||
|
|
||||||
|
from backcall import callback_prototype
|
||||||
|
|
||||||
|
|
||||||
|
class EventManager(object):
|
||||||
|
"""Manage a collection of events and a sequence of callbacks for each.
|
||||||
|
|
||||||
|
This is attached to :class:`~yap_ipython.core.interactiveshell.InteractiveShell`
|
||||||
|
instances as an ``events`` attribute.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
This API is experimental in yap_ipython 2.0, and may be revised in future versions.
|
||||||
|
"""
|
||||||
|
def __init__(self, shell, available_events):
|
||||||
|
"""Initialise the :class:`CallbackManager`.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
shell
|
||||||
|
The :class:`~yap_ipython.core.interactiveshell.InteractiveShell` instance
|
||||||
|
available_callbacks
|
||||||
|
An iterable of names for callback events.
|
||||||
|
"""
|
||||||
|
self.shell = shell
|
||||||
|
self.callbacks = {n:[] for n in available_events}
|
||||||
|
|
||||||
|
def register(self, event, function):
|
||||||
|
"""Register a new event callback.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
event : str
|
||||||
|
The event for which to register this callback.
|
||||||
|
function : callable
|
||||||
|
A function to be called on the given event. It should take the same
|
||||||
|
parameters as the appropriate callback prototype.
|
||||||
|
|
||||||
|
Raises
|
||||||
|
------
|
||||||
|
TypeError
|
||||||
|
If ``function`` is not callable.
|
||||||
|
KeyError
|
||||||
|
If ``event`` is not one of the known events.
|
||||||
|
"""
|
||||||
|
if not callable(function):
|
||||||
|
raise TypeError('Need a callable, got %r' % function)
|
||||||
|
callback_proto = available_events.get(event)
|
||||||
|
self.callbacks[event].append(callback_proto.adapt(function))
|
||||||
|
|
||||||
|
def unregister(self, event, function):
|
||||||
|
"""Remove a callback from the given event."""
|
||||||
|
if function in self.callbacks[event]:
|
||||||
|
return self.callbacks[event].remove(function)
|
||||||
|
|
||||||
|
# Remove callback in case ``function`` was adapted by `backcall`.
|
||||||
|
for callback in self.callbacks[event]:
|
||||||
|
try:
|
||||||
|
if callback.__wrapped__ is function:
|
||||||
|
return self.callbacks[event].remove(callback)
|
||||||
|
except AttributeError:
|
||||||
|
pass
|
||||||
|
|
||||||
|
raise ValueError('Function {!r} is not registered as a {} callback'.format(function, event))
|
||||||
|
|
||||||
|
def trigger(self, event, *args, **kwargs):
|
||||||
|
"""Call callbacks for ``event``.
|
||||||
|
|
||||||
|
Any additional arguments are passed to all callbacks registered for this
|
||||||
|
event. Exceptions raised by callbacks are caught, and a message printed.
|
||||||
|
"""
|
||||||
|
for func in self.callbacks[event][:]:
|
||||||
|
try:
|
||||||
|
func(*args, **kwargs)
|
||||||
|
except Exception:
|
||||||
|
print("Error in callback {} (for {}):".format(func, event))
|
||||||
|
self.shell.showtraceback()
|
||||||
|
|
||||||
|
# event_name -> prototype mapping
|
||||||
|
available_events = {}
|
||||||
|
|
||||||
|
def _define_event(callback_function):
|
||||||
|
callback_proto = callback_prototype(callback_function)
|
||||||
|
available_events[callback_function.__name__] = callback_proto
|
||||||
|
return callback_proto
|
||||||
|
|
||||||
|
# ------------------------------------------------------------------------------
|
||||||
|
# Callback prototypes
|
||||||
|
#
|
||||||
|
# No-op functions which describe the names of available events and the
|
||||||
|
# signatures of callbacks for those events.
|
||||||
|
# ------------------------------------------------------------------------------
|
||||||
|
|
||||||
|
@_define_event
|
||||||
|
def pre_execute():
|
||||||
|
"""Fires before code is executed in response to user/frontend action.
|
||||||
|
|
||||||
|
This includes comm and widget messages and silent execution, as well as user
|
||||||
|
code cells.
|
||||||
|
"""
|
||||||
|
pass
|
||||||
|
|
||||||
|
@_define_event
|
||||||
|
def pre_run_cell(info):
|
||||||
|
"""Fires before user-entered code runs.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
info : :class:`~yap_ipython.core.interactiveshell.ExecutionInfo`
|
||||||
|
An object containing information used for the code execution.
|
||||||
|
"""
|
||||||
|
pass
|
||||||
|
|
||||||
|
@_define_event
|
||||||
|
def post_execute():
|
||||||
|
"""Fires after code is executed in response to user/frontend action.
|
||||||
|
|
||||||
|
This includes comm and widget messages and silent execution, as well as user
|
||||||
|
code cells.
|
||||||
|
"""
|
||||||
|
pass
|
||||||
|
|
||||||
|
@_define_event
|
||||||
|
def post_run_cell(result):
|
||||||
|
"""Fires after user-entered code runs.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
result : :class:`~yap_ipython.core.interactiveshell.ExecutionResult`
|
||||||
|
The object which will be returned as the execution result.
|
||||||
|
"""
|
||||||
|
pass
|
||||||
|
|
||||||
|
@_define_event
|
||||||
|
def shell_initialized(ip):
|
||||||
|
"""Fires after initialisation of :class:`~yap_ipython.core.interactiveshell.InteractiveShell`.
|
||||||
|
|
||||||
|
This is before extensions and startup scripts are loaded, so it can only be
|
||||||
|
set by subclassing.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
ip : :class:`~yap_ipython.core.interactiveshell.InteractiveShell`
|
||||||
|
The newly initialised shell.
|
||||||
|
"""
|
||||||
|
pass
|
184
packages/python/yap_kernel/yap_ipython/core/excolors.py
Normal file
184
packages/python/yap_kernel/yap_ipython/core/excolors.py
Normal file
@ -0,0 +1,184 @@
|
|||||||
|
# -*- coding: utf-8 -*-
|
||||||
|
"""
|
||||||
|
Color schemes for exception handling code in yap_ipython.
|
||||||
|
"""
|
||||||
|
|
||||||
|
import os
|
||||||
|
import warnings
|
||||||
|
|
||||||
|
#*****************************************************************************
|
||||||
|
# Copyright (C) 2005-2006 Fernando Perez <fperez@colorado.edu>
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
|
# the file COPYING, distributed as part of this software.
|
||||||
|
#*****************************************************************************
|
||||||
|
|
||||||
|
from yap_ipython.utils.coloransi import ColorSchemeTable, TermColors, ColorScheme
|
||||||
|
|
||||||
|
def exception_colors():
|
||||||
|
"""Return a color table with fields for exception reporting.
|
||||||
|
|
||||||
|
The table is an instance of ColorSchemeTable with schemes added for
|
||||||
|
'Neutral', 'Linux', 'LightBG' and 'NoColor' and fields for exception handling filled
|
||||||
|
in.
|
||||||
|
|
||||||
|
Examples:
|
||||||
|
|
||||||
|
>>> ec = exception_colors()
|
||||||
|
>>> ec.active_scheme_name
|
||||||
|
''
|
||||||
|
>>> print(ec.active_colors)
|
||||||
|
None
|
||||||
|
|
||||||
|
Now we activate a color scheme:
|
||||||
|
>>> ec.set_active_scheme('NoColor')
|
||||||
|
>>> ec.active_scheme_name
|
||||||
|
'NoColor'
|
||||||
|
>>> sorted(ec.active_colors.keys())
|
||||||
|
['Normal', 'caret', 'em', 'excName', 'filename', 'filenameEm', 'line',
|
||||||
|
'lineno', 'linenoEm', 'name', 'nameEm', 'normalEm', 'topline', 'vName',
|
||||||
|
'val', 'valEm']
|
||||||
|
"""
|
||||||
|
|
||||||
|
ex_colors = ColorSchemeTable()
|
||||||
|
|
||||||
|
# Populate it with color schemes
|
||||||
|
C = TermColors # shorthand and local lookup
|
||||||
|
ex_colors.add_scheme(ColorScheme(
|
||||||
|
'NoColor',
|
||||||
|
# The color to be used for the top line
|
||||||
|
topline = C.NoColor,
|
||||||
|
|
||||||
|
# The colors to be used in the traceback
|
||||||
|
filename = C.NoColor,
|
||||||
|
lineno = C.NoColor,
|
||||||
|
name = C.NoColor,
|
||||||
|
vName = C.NoColor,
|
||||||
|
val = C.NoColor,
|
||||||
|
em = C.NoColor,
|
||||||
|
|
||||||
|
# Emphasized colors for the last frame of the traceback
|
||||||
|
normalEm = C.NoColor,
|
||||||
|
filenameEm = C.NoColor,
|
||||||
|
linenoEm = C.NoColor,
|
||||||
|
nameEm = C.NoColor,
|
||||||
|
valEm = C.NoColor,
|
||||||
|
|
||||||
|
# Colors for printing the exception
|
||||||
|
excName = C.NoColor,
|
||||||
|
line = C.NoColor,
|
||||||
|
caret = C.NoColor,
|
||||||
|
Normal = C.NoColor
|
||||||
|
))
|
||||||
|
|
||||||
|
# make some schemes as instances so we can copy them for modification easily
|
||||||
|
ex_colors.add_scheme(ColorScheme(
|
||||||
|
'Linux',
|
||||||
|
# The color to be used for the top line
|
||||||
|
topline = C.LightRed,
|
||||||
|
|
||||||
|
# The colors to be used in the traceback
|
||||||
|
filename = C.Green,
|
||||||
|
lineno = C.Green,
|
||||||
|
name = C.Purple,
|
||||||
|
vName = C.Cyan,
|
||||||
|
val = C.Green,
|
||||||
|
em = C.LightCyan,
|
||||||
|
|
||||||
|
# Emphasized colors for the last frame of the traceback
|
||||||
|
normalEm = C.LightCyan,
|
||||||
|
filenameEm = C.LightGreen,
|
||||||
|
linenoEm = C.LightGreen,
|
||||||
|
nameEm = C.LightPurple,
|
||||||
|
valEm = C.LightBlue,
|
||||||
|
|
||||||
|
# Colors for printing the exception
|
||||||
|
excName = C.LightRed,
|
||||||
|
line = C.Yellow,
|
||||||
|
caret = C.White,
|
||||||
|
Normal = C.Normal
|
||||||
|
))
|
||||||
|
|
||||||
|
# For light backgrounds, swap dark/light colors
|
||||||
|
ex_colors.add_scheme(ColorScheme(
|
||||||
|
'LightBG',
|
||||||
|
# The color to be used for the top line
|
||||||
|
topline = C.Red,
|
||||||
|
|
||||||
|
# The colors to be used in the traceback
|
||||||
|
filename = C.LightGreen,
|
||||||
|
lineno = C.LightGreen,
|
||||||
|
name = C.LightPurple,
|
||||||
|
vName = C.Cyan,
|
||||||
|
val = C.LightGreen,
|
||||||
|
em = C.Cyan,
|
||||||
|
|
||||||
|
# Emphasized colors for the last frame of the traceback
|
||||||
|
normalEm = C.Cyan,
|
||||||
|
filenameEm = C.Green,
|
||||||
|
linenoEm = C.Green,
|
||||||
|
nameEm = C.Purple,
|
||||||
|
valEm = C.Blue,
|
||||||
|
|
||||||
|
# Colors for printing the exception
|
||||||
|
excName = C.Red,
|
||||||
|
#line = C.Brown, # brown often is displayed as yellow
|
||||||
|
line = C.Red,
|
||||||
|
caret = C.Normal,
|
||||||
|
Normal = C.Normal,
|
||||||
|
))
|
||||||
|
|
||||||
|
ex_colors.add_scheme(ColorScheme(
|
||||||
|
'Neutral',
|
||||||
|
# The color to be used for the top line
|
||||||
|
topline = C.Red,
|
||||||
|
|
||||||
|
# The colors to be used in the traceback
|
||||||
|
filename = C.LightGreen,
|
||||||
|
lineno = C.LightGreen,
|
||||||
|
name = C.LightPurple,
|
||||||
|
vName = C.Cyan,
|
||||||
|
val = C.LightGreen,
|
||||||
|
em = C.Cyan,
|
||||||
|
|
||||||
|
# Emphasized colors for the last frame of the traceback
|
||||||
|
normalEm = C.Cyan,
|
||||||
|
filenameEm = C.Green,
|
||||||
|
linenoEm = C.Green,
|
||||||
|
nameEm = C.Purple,
|
||||||
|
valEm = C.Blue,
|
||||||
|
|
||||||
|
# Colors for printing the exception
|
||||||
|
excName = C.Red,
|
||||||
|
#line = C.Brown, # brown often is displayed as yellow
|
||||||
|
line = C.Red,
|
||||||
|
caret = C.Normal,
|
||||||
|
Normal = C.Normal,
|
||||||
|
))
|
||||||
|
|
||||||
|
# Hack: the 'neutral' colours are not very visible on a dark background on
|
||||||
|
# Windows. Since Windows command prompts have a dark background by default, and
|
||||||
|
# relatively few users are likely to alter that, we will use the 'Linux' colours,
|
||||||
|
# designed for a dark background, as the default on Windows.
|
||||||
|
if os.name == "nt":
|
||||||
|
ex_colors.add_scheme(ex_colors['Linux'].copy('Neutral'))
|
||||||
|
|
||||||
|
return ex_colors
|
||||||
|
|
||||||
|
class Deprec(object):
|
||||||
|
|
||||||
|
def __init__(self, wrapped_obj):
|
||||||
|
self.wrapped=wrapped_obj
|
||||||
|
|
||||||
|
def __getattr__(self, name):
|
||||||
|
val = getattr(self.wrapped, name)
|
||||||
|
warnings.warn("Using ExceptionColors global is deprecated and will be removed in yap_ipython 6.0",
|
||||||
|
DeprecationWarning, stacklevel=2)
|
||||||
|
# using getattr after warnings break ipydoctest in weird way for 3.5
|
||||||
|
return val
|
||||||
|
|
||||||
|
# For backwards compatibility, keep around a single global object. Note that
|
||||||
|
# this should NOT be used, the factory function should be used instead, since
|
||||||
|
# these objects are stateful and it's very easy to get strange bugs if any code
|
||||||
|
# modifies the module-level object's state.
|
||||||
|
ExceptionColors = Deprec(exception_colors())
|
155
packages/python/yap_kernel/yap_ipython/core/extensions.py
Normal file
155
packages/python/yap_kernel/yap_ipython/core/extensions.py
Normal file
@ -0,0 +1,155 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""A class for managing yap_ipython extensions."""
|
||||||
|
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
import os
|
||||||
|
import os.path
|
||||||
|
import sys
|
||||||
|
from importlib import import_module
|
||||||
|
|
||||||
|
from traitlets.config.configurable import Configurable
|
||||||
|
from yap_ipython.utils.path import ensure_dir_exists, compress_user
|
||||||
|
from yap_ipython.utils.decorators import undoc
|
||||||
|
from traitlets import Instance
|
||||||
|
|
||||||
|
try:
|
||||||
|
from importlib import reload
|
||||||
|
except ImportError :
|
||||||
|
## deprecated since 3.4
|
||||||
|
from imp import reload
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Main class
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
class ExtensionManager(Configurable):
|
||||||
|
"""A class to manage yap_ipython extensions.
|
||||||
|
|
||||||
|
An yap_ipython extension is an importable Python module that has
|
||||||
|
a function with the signature::
|
||||||
|
|
||||||
|
def load_ipython_extension(ipython):
|
||||||
|
# Do things with ipython
|
||||||
|
|
||||||
|
This function is called after your extension is imported and the
|
||||||
|
currently active :class:`InteractiveShell` instance is passed as
|
||||||
|
the only argument. You can do anything you want with yap_ipython at
|
||||||
|
that point, including defining new magic and aliases, adding new
|
||||||
|
components, etc.
|
||||||
|
|
||||||
|
You can also optionally define an :func:`unload_ipython_extension(ipython)`
|
||||||
|
function, which will be called if the user unloads or reloads the extension.
|
||||||
|
The extension manager will only call :func:`load_ipython_extension` again
|
||||||
|
if the extension is reloaded.
|
||||||
|
|
||||||
|
You can put your extension modules anywhere you want, as long as
|
||||||
|
they can be imported by Python's standard import mechanism. However,
|
||||||
|
to make it easy to write extensions, you can also put your extensions
|
||||||
|
in ``os.path.join(self.ipython_dir, 'extensions')``. This directory
|
||||||
|
is added to ``sys.path`` automatically.
|
||||||
|
"""
|
||||||
|
|
||||||
|
shell = Instance('yap_ipython.core.interactiveshell.InteractiveShellABC', allow_none=True)
|
||||||
|
|
||||||
|
def __init__(self, shell=None, **kwargs):
|
||||||
|
super(ExtensionManager, self).__init__(shell=shell, **kwargs)
|
||||||
|
self.shell.observe(
|
||||||
|
self._on_ipython_dir_changed, names=('ipython_dir',)
|
||||||
|
)
|
||||||
|
self.loaded = set()
|
||||||
|
|
||||||
|
@property
|
||||||
|
def ipython_extension_dir(self):
|
||||||
|
return os.path.join(self.shell.ipython_dir, u'extensions')
|
||||||
|
|
||||||
|
def _on_ipython_dir_changed(self, change):
|
||||||
|
ensure_dir_exists(self.ipython_extension_dir)
|
||||||
|
|
||||||
|
def load_extension(self, module_str):
|
||||||
|
"""Load an yap_ipython extension by its module name.
|
||||||
|
|
||||||
|
Returns the string "already loaded" if the extension is already loaded,
|
||||||
|
"no load function" if the module doesn't have a load_ipython_extension
|
||||||
|
function, or None if it succeeded.
|
||||||
|
"""
|
||||||
|
if module_str in self.loaded:
|
||||||
|
return "already loaded"
|
||||||
|
|
||||||
|
from yap_ipython.utils.syspathcontext import prepended_to_syspath
|
||||||
|
|
||||||
|
with self.shell.builtin_trap:
|
||||||
|
if module_str not in sys.modules:
|
||||||
|
with prepended_to_syspath(self.ipython_extension_dir):
|
||||||
|
mod = import_module(module_str)
|
||||||
|
if mod.__file__.startswith(self.ipython_extension_dir):
|
||||||
|
print(("Loading extensions from {dir} is deprecated. "
|
||||||
|
"We recommend managing extensions like any "
|
||||||
|
"other Python packages, in site-packages.").format(
|
||||||
|
dir=compress_user(self.ipython_extension_dir)))
|
||||||
|
mod = sys.modules[module_str]
|
||||||
|
if self._call_load_ipython_extension(mod):
|
||||||
|
self.loaded.add(module_str)
|
||||||
|
else:
|
||||||
|
return "no load function"
|
||||||
|
|
||||||
|
def unload_extension(self, module_str):
|
||||||
|
"""Unload an yap_ipython extension by its module name.
|
||||||
|
|
||||||
|
This function looks up the extension's name in ``sys.modules`` and
|
||||||
|
simply calls ``mod.unload_ipython_extension(self)``.
|
||||||
|
|
||||||
|
Returns the string "no unload function" if the extension doesn't define
|
||||||
|
a function to unload itself, "not loaded" if the extension isn't loaded,
|
||||||
|
otherwise None.
|
||||||
|
"""
|
||||||
|
if module_str not in self.loaded:
|
||||||
|
return "not loaded"
|
||||||
|
|
||||||
|
if module_str in sys.modules:
|
||||||
|
mod = sys.modules[module_str]
|
||||||
|
if self._call_unload_ipython_extension(mod):
|
||||||
|
self.loaded.discard(module_str)
|
||||||
|
else:
|
||||||
|
return "no unload function"
|
||||||
|
|
||||||
|
def reload_extension(self, module_str):
|
||||||
|
"""Reload an yap_ipython extension by calling reload.
|
||||||
|
|
||||||
|
If the module has not been loaded before,
|
||||||
|
:meth:`InteractiveShell.load_extension` is called. Otherwise
|
||||||
|
:func:`reload` is called and then the :func:`load_ipython_extension`
|
||||||
|
function of the module, if it exists is called.
|
||||||
|
"""
|
||||||
|
from yap_ipython.utils.syspathcontext import prepended_to_syspath
|
||||||
|
|
||||||
|
if (module_str in self.loaded) and (module_str in sys.modules):
|
||||||
|
self.unload_extension(module_str)
|
||||||
|
mod = sys.modules[module_str]
|
||||||
|
with prepended_to_syspath(self.ipython_extension_dir):
|
||||||
|
reload(mod)
|
||||||
|
if self._call_load_ipython_extension(mod):
|
||||||
|
self.loaded.add(module_str)
|
||||||
|
else:
|
||||||
|
self.load_extension(module_str)
|
||||||
|
|
||||||
|
def _call_load_ipython_extension(self, mod):
|
||||||
|
if hasattr(mod, 'load_ipython_extension'):
|
||||||
|
mod.load_ipython_extension(self.shell)
|
||||||
|
return True
|
||||||
|
|
||||||
|
def _call_unload_ipython_extension(self, mod):
|
||||||
|
if hasattr(mod, 'unload_ipython_extension'):
|
||||||
|
mod.unload_ipython_extension(self.shell)
|
||||||
|
return True
|
||||||
|
|
||||||
|
@undoc
|
||||||
|
def install_extension(self, url, filename=None):
|
||||||
|
"""
|
||||||
|
Deprecated.
|
||||||
|
"""
|
||||||
|
# Ensure the extension directory exists
|
||||||
|
raise DeprecationWarning(
|
||||||
|
'`install_extension` and the `install_ext` magic have been deprecated since yap_ipython 4.0'
|
||||||
|
'Use pip or other package managers to manage ipython extensions.')
|
@ -3,11 +3,11 @@
|
|||||||
|
|
||||||
Inheritance diagram:
|
Inheritance diagram:
|
||||||
|
|
||||||
.. inheritance-diagram:: IPython.core.formatters
|
.. inheritance-diagram:: yap_ipython.core.formatters
|
||||||
:parts: 3
|
:parts: 3
|
||||||
"""
|
"""
|
||||||
|
|
||||||
# Copyright (c) IPython Development Team.
|
# Copyright (c) yap_ipython Development Team.
|
||||||
# Distributed under the terms of the Modified BSD License.
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
import abc
|
import abc
|
||||||
@ -17,18 +17,18 @@ import traceback
|
|||||||
import warnings
|
import warnings
|
||||||
from io import StringIO
|
from io import StringIO
|
||||||
|
|
||||||
from IPython.lib import pretty
|
|
||||||
from IPython.utils.dir2 import get_real_method
|
|
||||||
from IPython.utils.sentinel import Sentinel
|
|
||||||
from decorator import decorator
|
from decorator import decorator
|
||||||
|
|
||||||
|
from traitlets.config.configurable import Configurable
|
||||||
|
from yap_ipython.core.getipython import get_ipython
|
||||||
|
from yap_ipython.utils.sentinel import Sentinel
|
||||||
|
from yap_ipython.utils.dir2 import get_real_method
|
||||||
|
from yap_ipython.lib import pretty
|
||||||
from traitlets import (
|
from traitlets import (
|
||||||
Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List,
|
Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List,
|
||||||
ForwardDeclaredInstance,
|
ForwardDeclaredInstance,
|
||||||
default, observe,
|
default, observe,
|
||||||
)
|
)
|
||||||
from traitlets.config.configurable import Configurable
|
|
||||||
|
|
||||||
from packages.python.yap_kernel.core.yap_kernel.getipython import get_ipython
|
|
||||||
|
|
||||||
|
|
||||||
class DisplayFormatter(Configurable):
|
class DisplayFormatter(Configurable):
|
||||||
@ -51,12 +51,17 @@ class DisplayFormatter(Configurable):
|
|||||||
formatter.enabled = True
|
formatter.enabled = True
|
||||||
else:
|
else:
|
||||||
formatter.enabled = False
|
formatter.enabled = False
|
||||||
|
|
||||||
ipython_display_formatter = ForwardDeclaredInstance('FormatterABC')
|
ipython_display_formatter = ForwardDeclaredInstance('FormatterABC')
|
||||||
@default('ipython_display_formatter')
|
@default('ipython_display_formatter')
|
||||||
def _default_formatter(self):
|
def _default_formatter(self):
|
||||||
return IPythonDisplayFormatter(parent=self)
|
return IPythonDisplayFormatter(parent=self)
|
||||||
|
|
||||||
|
mimebundle_formatter = ForwardDeclaredInstance('FormatterABC')
|
||||||
|
@default('mimebundle_formatter')
|
||||||
|
def _default_mime_formatter(self):
|
||||||
|
return MimeBundleFormatter(parent=self)
|
||||||
|
|
||||||
# A dict of formatter whose keys are format types (MIME types) and whose
|
# A dict of formatter whose keys are format types (MIME types) and whose
|
||||||
# values are subclasses of BaseFormatter.
|
# values are subclasses of BaseFormatter.
|
||||||
formatters = Dict()
|
formatters = Dict()
|
||||||
@ -86,7 +91,7 @@ class DisplayFormatter(Configurable):
|
|||||||
|
|
||||||
By default all format types will be computed.
|
By default all format types will be computed.
|
||||||
|
|
||||||
The following MIME types are currently implemented:
|
The following MIME types are usually implemented:
|
||||||
|
|
||||||
* text/plain
|
* text/plain
|
||||||
* text/html
|
* text/html
|
||||||
@ -103,14 +108,15 @@ class DisplayFormatter(Configurable):
|
|||||||
----------
|
----------
|
||||||
obj : object
|
obj : object
|
||||||
The Python object whose format data will be computed.
|
The Python object whose format data will be computed.
|
||||||
include : list or tuple, optional
|
include : list, tuple or set; optional
|
||||||
A list of format type strings (MIME types) to include in the
|
A list of format type strings (MIME types) to include in the
|
||||||
format data dict. If this is set *only* the format types included
|
format data dict. If this is set *only* the format types included
|
||||||
in this list will be computed.
|
in this list will be computed.
|
||||||
exclude : list or tuple, optional
|
exclude : list, tuple or set; optional
|
||||||
A list of format type string (MIME types) to exclude in the format
|
A list of format type string (MIME types) to exclude in the format
|
||||||
data dict. If this is set all format types will be computed,
|
data dict. If this is set all format types will be computed,
|
||||||
except for those included in this argument.
|
except for those included in this argument.
|
||||||
|
Mimetypes present in exclude will take precedence over the ones in include
|
||||||
|
|
||||||
Returns
|
Returns
|
||||||
-------
|
-------
|
||||||
@ -124,6 +130,15 @@ class DisplayFormatter(Configurable):
|
|||||||
|
|
||||||
metadata_dict is a dictionary of metadata about each mime-type output.
|
metadata_dict is a dictionary of metadata about each mime-type output.
|
||||||
Its keys will be a strict subset of the keys in format_dict.
|
Its keys will be a strict subset of the keys in format_dict.
|
||||||
|
|
||||||
|
Notes
|
||||||
|
-----
|
||||||
|
|
||||||
|
If an object implement `_repr_mimebundle_` as well as various
|
||||||
|
`_repr_*_`, the data returned by `_repr_mimebundle_` will take
|
||||||
|
precedence and the corresponding `_repr_*_` for this mimetype will
|
||||||
|
not be called.
|
||||||
|
|
||||||
"""
|
"""
|
||||||
format_dict = {}
|
format_dict = {}
|
||||||
md_dict = {}
|
md_dict = {}
|
||||||
@ -131,8 +146,30 @@ class DisplayFormatter(Configurable):
|
|||||||
if self.ipython_display_formatter(obj):
|
if self.ipython_display_formatter(obj):
|
||||||
# object handled itself, don't proceed
|
# object handled itself, don't proceed
|
||||||
return {}, {}
|
return {}, {}
|
||||||
|
|
||||||
|
format_dict, md_dict = self.mimebundle_formatter(obj, include=include, exclude=exclude)
|
||||||
|
|
||||||
|
if format_dict or md_dict:
|
||||||
|
if include:
|
||||||
|
format_dict = {k:v for k,v in format_dict.items() if k in include}
|
||||||
|
md_dict = {k:v for k,v in md_dict.items() if k in include}
|
||||||
|
if exclude:
|
||||||
|
format_dict = {k:v for k,v in format_dict.items() if k not in exclude}
|
||||||
|
md_dict = {k:v for k,v in md_dict.items() if k not in exclude}
|
||||||
|
|
||||||
for format_type, formatter in self.formatters.items():
|
for format_type, formatter in self.formatters.items():
|
||||||
|
if format_type in format_dict:
|
||||||
|
# already got it from mimebundle, maybe don't render again.
|
||||||
|
# exception: manually registered per-mime renderer
|
||||||
|
# check priority:
|
||||||
|
# 1. user-registered per-mime formatter
|
||||||
|
# 2. mime-bundle (user-registered or repr method)
|
||||||
|
# 3. default per-mime formatter (e.g. repr method)
|
||||||
|
try:
|
||||||
|
formatter.lookup(obj)
|
||||||
|
except KeyError:
|
||||||
|
# no special formatter, use mime-bundle-provided value
|
||||||
|
continue
|
||||||
if include and format_type not in include:
|
if include and format_type not in include:
|
||||||
continue
|
continue
|
||||||
if exclude and format_type in exclude:
|
if exclude and format_type in exclude:
|
||||||
@ -153,7 +190,6 @@ class DisplayFormatter(Configurable):
|
|||||||
format_dict[format_type] = data
|
format_dict[format_type] = data
|
||||||
if md is not None:
|
if md is not None:
|
||||||
md_dict[format_type] = md
|
md_dict[format_type] = md
|
||||||
|
|
||||||
return format_dict, md_dict
|
return format_dict, md_dict
|
||||||
|
|
||||||
@property
|
@property
|
||||||
@ -188,7 +224,7 @@ def catch_format_error(method, self, *args, **kwargs):
|
|||||||
r = method(self, *args, **kwargs)
|
r = method(self, *args, **kwargs)
|
||||||
except NotImplementedError:
|
except NotImplementedError:
|
||||||
# don't warn on NotImplementedErrors
|
# don't warn on NotImplementedErrors
|
||||||
return None
|
return self._check_return(None, args[0])
|
||||||
except Exception:
|
except Exception:
|
||||||
exc_info = sys.exc_info()
|
exc_info = sys.exc_info()
|
||||||
ip = get_ipython()
|
ip = get_ipython()
|
||||||
@ -196,7 +232,7 @@ def catch_format_error(method, self, *args, **kwargs):
|
|||||||
ip.showtraceback(exc_info)
|
ip.showtraceback(exc_info)
|
||||||
else:
|
else:
|
||||||
traceback.print_exception(*exc_info)
|
traceback.print_exception(*exc_info)
|
||||||
return None
|
return self._check_return(None, args[0])
|
||||||
return self._check_return(r, args[0])
|
return self._check_return(r, args[0])
|
||||||
|
|
||||||
|
|
||||||
@ -531,9 +567,9 @@ class BaseFormatter(Configurable):
|
|||||||
class PlainTextFormatter(BaseFormatter):
|
class PlainTextFormatter(BaseFormatter):
|
||||||
"""The default pretty-printer.
|
"""The default pretty-printer.
|
||||||
|
|
||||||
This uses :mod:`IPython.lib.pretty` to compute the format data of
|
This uses :mod:`yap_ipython.lib.pretty` to compute the format data of
|
||||||
the object. If the object cannot be pretty printed, :func:`repr` is used.
|
the object. If the object cannot be pretty printed, :func:`repr` is used.
|
||||||
See the documentation of :mod:`IPython.lib.pretty` for details on
|
See the documentation of :mod:`yap_ipython.lib.pretty` for details on
|
||||||
how to write pretty printers. Here is a simple example::
|
how to write pretty printers. Here is a simple example::
|
||||||
|
|
||||||
def dtype_pprinter(obj, p, cycle):
|
def dtype_pprinter(obj, p, cycle):
|
||||||
@ -633,7 +669,7 @@ class PlainTextFormatter(BaseFormatter):
|
|||||||
numpy.set_printoptions(precision=8)
|
numpy.set_printoptions(precision=8)
|
||||||
self.float_format = fmt
|
self.float_format = fmt
|
||||||
|
|
||||||
# Use the default pretty printers from IPython.lib.pretty.
|
# Use the default pretty printers from yap_ipython.lib.pretty.
|
||||||
@default('singleton_printers')
|
@default('singleton_printers')
|
||||||
def _singleton_printers_default(self):
|
def _singleton_printers_default(self):
|
||||||
return pretty._singleton_pprinters.copy()
|
return pretty._singleton_pprinters.copy()
|
||||||
@ -797,7 +833,7 @@ class JSONFormatter(BaseFormatter):
|
|||||||
# unpack data, metadata tuple for type checking on first element
|
# unpack data, metadata tuple for type checking on first element
|
||||||
r, md = r
|
r, md = r
|
||||||
|
|
||||||
# handle deprecated JSON-as-string form from IPython < 3
|
# handle deprecated JSON-as-string form from yap_ipython < 3
|
||||||
if isinstance(r, str):
|
if isinstance(r, str):
|
||||||
warnings.warn("JSON expects JSONable list/dict containers, not JSON strings",
|
warnings.warn("JSON expects JSONable list/dict containers, not JSON strings",
|
||||||
FormatterWarning)
|
FormatterWarning)
|
||||||
@ -843,7 +879,7 @@ class PDFFormatter(BaseFormatter):
|
|||||||
_return_type = (bytes, str)
|
_return_type = (bytes, str)
|
||||||
|
|
||||||
class IPythonDisplayFormatter(BaseFormatter):
|
class IPythonDisplayFormatter(BaseFormatter):
|
||||||
"""A Formatter for objects that know how to display themselves.
|
"""An escape-hatch Formatter for objects that know how to display themselves.
|
||||||
|
|
||||||
To define the callables that compute the representation of your
|
To define the callables that compute the representation of your
|
||||||
objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type`
|
objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type`
|
||||||
@ -853,10 +889,16 @@ class IPythonDisplayFormatter(BaseFormatter):
|
|||||||
|
|
||||||
This display formatter has highest priority.
|
This display formatter has highest priority.
|
||||||
If it fires, no other display formatter will be called.
|
If it fires, no other display formatter will be called.
|
||||||
|
|
||||||
|
Prior to yap_ipython 6.1, `_ipython_display_` was the only way to display custom mime-types
|
||||||
|
without registering a new Formatter.
|
||||||
|
|
||||||
|
yap_ipython 6.1 introduces `_repr_mimebundle_` for displaying custom mime-types,
|
||||||
|
so `_ipython_display_` should only be used for objects that require unusual
|
||||||
|
display patterns, such as multiple display calls.
|
||||||
"""
|
"""
|
||||||
print_method = ObjectName('_ipython_display_')
|
print_method = ObjectName('_ipython_display_')
|
||||||
_return_type = (type(None), bool)
|
_return_type = (type(None), bool)
|
||||||
|
|
||||||
|
|
||||||
@catch_format_error
|
@catch_format_error
|
||||||
def __call__(self, obj):
|
def __call__(self, obj):
|
||||||
@ -877,6 +919,60 @@ class IPythonDisplayFormatter(BaseFormatter):
|
|||||||
return True
|
return True
|
||||||
|
|
||||||
|
|
||||||
|
class MimeBundleFormatter(BaseFormatter):
|
||||||
|
"""A Formatter for arbitrary mime-types.
|
||||||
|
|
||||||
|
Unlike other `_repr_<mimetype>_` methods,
|
||||||
|
`_repr_mimebundle_` should return mime-bundle data,
|
||||||
|
either the mime-keyed `data` dictionary or the tuple `(data, metadata)`.
|
||||||
|
Any mime-type is valid.
|
||||||
|
|
||||||
|
To define the callables that compute the mime-bundle representation of your
|
||||||
|
objects, define a :meth:`_repr_mimebundle_` method or use the :meth:`for_type`
|
||||||
|
or :meth:`for_type_by_name` methods to register functions that handle
|
||||||
|
this.
|
||||||
|
|
||||||
|
.. versionadded:: 6.1
|
||||||
|
"""
|
||||||
|
print_method = ObjectName('_repr_mimebundle_')
|
||||||
|
_return_type = dict
|
||||||
|
|
||||||
|
def _check_return(self, r, obj):
|
||||||
|
r = super(MimeBundleFormatter, self)._check_return(r, obj)
|
||||||
|
# always return (data, metadata):
|
||||||
|
if r is None:
|
||||||
|
return {}, {}
|
||||||
|
if not isinstance(r, tuple):
|
||||||
|
return r, {}
|
||||||
|
return r
|
||||||
|
|
||||||
|
@catch_format_error
|
||||||
|
def __call__(self, obj, include=None, exclude=None):
|
||||||
|
"""Compute the format for an object.
|
||||||
|
|
||||||
|
Identical to parent's method but we pass extra parameters to the method.
|
||||||
|
|
||||||
|
Unlike other _repr_*_ `_repr_mimebundle_` should allow extra kwargs, in
|
||||||
|
particular `include` and `exclude`.
|
||||||
|
"""
|
||||||
|
if self.enabled:
|
||||||
|
# lookup registered printer
|
||||||
|
try:
|
||||||
|
printer = self.lookup(obj)
|
||||||
|
except KeyError:
|
||||||
|
pass
|
||||||
|
else:
|
||||||
|
return printer(obj)
|
||||||
|
# Finally look for special method names
|
||||||
|
method = get_real_method(obj, self.print_method)
|
||||||
|
|
||||||
|
if method is not None:
|
||||||
|
return method(include=include, exclude=exclude)
|
||||||
|
return None
|
||||||
|
else:
|
||||||
|
return None
|
||||||
|
|
||||||
|
|
||||||
FormatterABC.register(BaseFormatter)
|
FormatterABC.register(BaseFormatter)
|
||||||
FormatterABC.register(PlainTextFormatter)
|
FormatterABC.register(PlainTextFormatter)
|
||||||
FormatterABC.register(HTMLFormatter)
|
FormatterABC.register(HTMLFormatter)
|
||||||
@ -889,6 +985,7 @@ FormatterABC.register(LatexFormatter)
|
|||||||
FormatterABC.register(JSONFormatter)
|
FormatterABC.register(JSONFormatter)
|
||||||
FormatterABC.register(JavascriptFormatter)
|
FormatterABC.register(JavascriptFormatter)
|
||||||
FormatterABC.register(IPythonDisplayFormatter)
|
FormatterABC.register(IPythonDisplayFormatter)
|
||||||
|
FormatterABC.register(MimeBundleFormatter)
|
||||||
|
|
||||||
|
|
||||||
def format_display_data(obj, include=None, exclude=None):
|
def format_display_data(obj, include=None, exclude=None):
|
||||||
@ -896,19 +993,6 @@ def format_display_data(obj, include=None, exclude=None):
|
|||||||
|
|
||||||
By default all format types will be computed.
|
By default all format types will be computed.
|
||||||
|
|
||||||
The following MIME types are currently implemented:
|
|
||||||
|
|
||||||
* text/plain
|
|
||||||
* text/html
|
|
||||||
* text/markdown
|
|
||||||
* text/latex
|
|
||||||
* application/json
|
|
||||||
* application/javascript
|
|
||||||
* application/pdf
|
|
||||||
* image/png
|
|
||||||
* image/jpeg
|
|
||||||
* image/svg+xml
|
|
||||||
|
|
||||||
Parameters
|
Parameters
|
||||||
----------
|
----------
|
||||||
obj : object
|
obj : object
|
||||||
@ -938,4 +1022,3 @@ def format_display_data(obj, include=None, exclude=None):
|
|||||||
include,
|
include,
|
||||||
exclude
|
exclude
|
||||||
)
|
)
|
||||||
|
|
@ -1,5 +1,9 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""Simple function to call to get the current InteractiveShell instance
|
||||||
|
"""
|
||||||
|
|
||||||
#-----------------------------------------------------------------------------
|
#-----------------------------------------------------------------------------
|
||||||
# Copyright (C) 2013 The IPython Development Team
|
# Copyright (C) 2013 The yap_ipython Development Team
|
||||||
#
|
#
|
||||||
# Distributed under the terms of the BSD License. The full license is in
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
# the file COPYING, distributed as part of this software.
|
# the file COPYING, distributed as part of this software.
|
||||||
@ -12,9 +16,9 @@
|
|||||||
|
|
||||||
def get_ipython():
|
def get_ipython():
|
||||||
"""Get the global InteractiveShell instance.
|
"""Get the global InteractiveShell instance.
|
||||||
|
|
||||||
Returns None if no InteractiveShell instance is registered.
|
Returns None if no InteractiveShell instance is registered.
|
||||||
"""
|
"""
|
||||||
from yap_ipython.core.interactiveshell import YAPInteractive
|
from yap_ipython.core.interactiveshell import InteractiveShell
|
||||||
if YAPInteractive.initialized():
|
if InteractiveShell.initialized():
|
||||||
return YAPInteractive.instance()
|
return InteractiveShell.instance()
|
||||||
|
906
packages/python/yap_kernel/yap_ipython/core/history.py
Normal file
906
packages/python/yap_kernel/yap_ipython/core/history.py
Normal file
@ -0,0 +1,906 @@
|
|||||||
|
""" History related magics and functionality """
|
||||||
|
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
|
||||||
|
import atexit
|
||||||
|
import datetime
|
||||||
|
import os
|
||||||
|
import re
|
||||||
|
try:
|
||||||
|
import sqlite3
|
||||||
|
except ImportError:
|
||||||
|
try:
|
||||||
|
from pysqlite2 import dbapi2 as sqlite3
|
||||||
|
except ImportError:
|
||||||
|
sqlite3 = None
|
||||||
|
import threading
|
||||||
|
|
||||||
|
from traitlets.config.configurable import LoggingConfigurable
|
||||||
|
from decorator import decorator
|
||||||
|
from yap_ipython.utils.decorators import undoc
|
||||||
|
from yap_ipython.utils.path import locate_profile
|
||||||
|
from traitlets import (
|
||||||
|
Any, Bool, Dict, Instance, Integer, List, Unicode, TraitError,
|
||||||
|
default, observe,
|
||||||
|
)
|
||||||
|
from warnings import warn
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Classes and functions
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
@undoc
|
||||||
|
class DummyDB(object):
|
||||||
|
"""Dummy DB that will act as a black hole for history.
|
||||||
|
|
||||||
|
Only used in the absence of sqlite"""
|
||||||
|
def execute(*args, **kwargs):
|
||||||
|
return []
|
||||||
|
|
||||||
|
def commit(self, *args, **kwargs):
|
||||||
|
pass
|
||||||
|
|
||||||
|
def __enter__(self, *args, **kwargs):
|
||||||
|
pass
|
||||||
|
|
||||||
|
def __exit__(self, *args, **kwargs):
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
|
@decorator
|
||||||
|
def needs_sqlite(f, self, *a, **kw):
|
||||||
|
"""Decorator: return an empty list in the absence of sqlite."""
|
||||||
|
if sqlite3 is None or not self.enabled:
|
||||||
|
return []
|
||||||
|
else:
|
||||||
|
return f(self, *a, **kw)
|
||||||
|
|
||||||
|
|
||||||
|
if sqlite3 is not None:
|
||||||
|
DatabaseError = sqlite3.DatabaseError
|
||||||
|
OperationalError = sqlite3.OperationalError
|
||||||
|
else:
|
||||||
|
@undoc
|
||||||
|
class DatabaseError(Exception):
|
||||||
|
"Dummy exception when sqlite could not be imported. Should never occur."
|
||||||
|
|
||||||
|
@undoc
|
||||||
|
class OperationalError(Exception):
|
||||||
|
"Dummy exception when sqlite could not be imported. Should never occur."
|
||||||
|
|
||||||
|
# use 16kB as threshold for whether a corrupt history db should be saved
|
||||||
|
# that should be at least 100 entries or so
|
||||||
|
_SAVE_DB_SIZE = 16384
|
||||||
|
|
||||||
|
@decorator
|
||||||
|
def catch_corrupt_db(f, self, *a, **kw):
|
||||||
|
"""A decorator which wraps HistoryAccessor method calls to catch errors from
|
||||||
|
a corrupt SQLite database, move the old database out of the way, and create
|
||||||
|
a new one.
|
||||||
|
|
||||||
|
We avoid clobbering larger databases because this may be triggered due to filesystem issues,
|
||||||
|
not just a corrupt file.
|
||||||
|
"""
|
||||||
|
try:
|
||||||
|
return f(self, *a, **kw)
|
||||||
|
except (DatabaseError, OperationalError) as e:
|
||||||
|
self._corrupt_db_counter += 1
|
||||||
|
self.log.error("Failed to open SQLite history %s (%s).", self.hist_file, e)
|
||||||
|
if self.hist_file != ':memory:':
|
||||||
|
if self._corrupt_db_counter > self._corrupt_db_limit:
|
||||||
|
self.hist_file = ':memory:'
|
||||||
|
self.log.error("Failed to load history too many times, history will not be saved.")
|
||||||
|
elif os.path.isfile(self.hist_file):
|
||||||
|
# move the file out of the way
|
||||||
|
base, ext = os.path.splitext(self.hist_file)
|
||||||
|
size = os.stat(self.hist_file).st_size
|
||||||
|
if size >= _SAVE_DB_SIZE:
|
||||||
|
# if there's significant content, avoid clobbering
|
||||||
|
now = datetime.datetime.now().isoformat().replace(':', '.')
|
||||||
|
newpath = base + '-corrupt-' + now + ext
|
||||||
|
# don't clobber previous corrupt backups
|
||||||
|
for i in range(100):
|
||||||
|
if not os.path.isfile(newpath):
|
||||||
|
break
|
||||||
|
else:
|
||||||
|
newpath = base + '-corrupt-' + now + (u'-%i' % i) + ext
|
||||||
|
else:
|
||||||
|
# not much content, possibly empty; don't worry about clobbering
|
||||||
|
# maybe we should just delete it?
|
||||||
|
newpath = base + '-corrupt' + ext
|
||||||
|
os.rename(self.hist_file, newpath)
|
||||||
|
self.log.error("History file was moved to %s and a new file created.", newpath)
|
||||||
|
self.init_db()
|
||||||
|
return []
|
||||||
|
else:
|
||||||
|
# Failed with :memory:, something serious is wrong
|
||||||
|
raise
|
||||||
|
|
||||||
|
class HistoryAccessorBase(LoggingConfigurable):
|
||||||
|
"""An abstract class for History Accessors """
|
||||||
|
|
||||||
|
def get_tail(self, n=10, raw=True, output=False, include_latest=False):
|
||||||
|
raise NotImplementedError
|
||||||
|
|
||||||
|
def search(self, pattern="*", raw=True, search_raw=True,
|
||||||
|
output=False, n=None, unique=False):
|
||||||
|
raise NotImplementedError
|
||||||
|
|
||||||
|
def get_range(self, session, start=1, stop=None, raw=True,output=False):
|
||||||
|
raise NotImplementedError
|
||||||
|
|
||||||
|
def get_range_by_str(self, rangestr, raw=True, output=False):
|
||||||
|
raise NotImplementedError
|
||||||
|
|
||||||
|
|
||||||
|
class HistoryAccessor(HistoryAccessorBase):
|
||||||
|
"""Access the history database without adding to it.
|
||||||
|
|
||||||
|
This is intended for use by standalone history tools. yap_ipython shells use
|
||||||
|
HistoryManager, below, which is a subclass of this."""
|
||||||
|
|
||||||
|
# counter for init_db retries, so we don't keep trying over and over
|
||||||
|
_corrupt_db_counter = 0
|
||||||
|
# after two failures, fallback on :memory:
|
||||||
|
_corrupt_db_limit = 2
|
||||||
|
|
||||||
|
# String holding the path to the history file
|
||||||
|
hist_file = Unicode(
|
||||||
|
help="""Path to file to use for SQLite history database.
|
||||||
|
|
||||||
|
By default, yap_ipython will put the history database in the yap_ipython
|
||||||
|
profile directory. If you would rather share one history among
|
||||||
|
profiles, you can set this value in each, so that they are consistent.
|
||||||
|
|
||||||
|
Due to an issue with fcntl, SQLite is known to misbehave on some NFS
|
||||||
|
mounts. If you see yap_ipython hanging, try setting this to something on a
|
||||||
|
local disk, e.g::
|
||||||
|
|
||||||
|
ipython --HistoryManager.hist_file=/tmp/ipython_hist.sqlite
|
||||||
|
|
||||||
|
you can also use the specific value `:memory:` (including the colon
|
||||||
|
at both end but not the back ticks), to avoid creating an history file.
|
||||||
|
|
||||||
|
""").tag(config=True)
|
||||||
|
|
||||||
|
enabled = Bool(True,
|
||||||
|
help="""enable the SQLite history
|
||||||
|
|
||||||
|
set enabled=False to disable the SQLite history,
|
||||||
|
in which case there will be no stored history, no SQLite connection,
|
||||||
|
and no background saving thread. This may be necessary in some
|
||||||
|
threaded environments where yap_ipython is embedded.
|
||||||
|
"""
|
||||||
|
).tag(config=True)
|
||||||
|
|
||||||
|
connection_options = Dict(
|
||||||
|
help="""Options for configuring the SQLite connection
|
||||||
|
|
||||||
|
These options are passed as keyword args to sqlite3.connect
|
||||||
|
when establishing database conenctions.
|
||||||
|
"""
|
||||||
|
).tag(config=True)
|
||||||
|
|
||||||
|
# The SQLite database
|
||||||
|
db = Any()
|
||||||
|
@observe('db')
|
||||||
|
def _db_changed(self, change):
|
||||||
|
"""validate the db, since it can be an Instance of two different types"""
|
||||||
|
new = change['new']
|
||||||
|
connection_types = (DummyDB,)
|
||||||
|
if sqlite3 is not None:
|
||||||
|
connection_types = (DummyDB, sqlite3.Connection)
|
||||||
|
if not isinstance(new, connection_types):
|
||||||
|
msg = "%s.db must be sqlite3 Connection or DummyDB, not %r" % \
|
||||||
|
(self.__class__.__name__, new)
|
||||||
|
raise TraitError(msg)
|
||||||
|
|
||||||
|
def __init__(self, profile='default', hist_file=u'', **traits):
|
||||||
|
"""Create a new history accessor.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
profile : str
|
||||||
|
The name of the profile from which to open history.
|
||||||
|
hist_file : str
|
||||||
|
Path to an SQLite history database stored by yap_ipython. If specified,
|
||||||
|
hist_file overrides profile.
|
||||||
|
config : :class:`~traitlets.config.loader.Config`
|
||||||
|
Config object. hist_file can also be set through this.
|
||||||
|
"""
|
||||||
|
# We need a pointer back to the shell for various tasks.
|
||||||
|
super(HistoryAccessor, self).__init__(**traits)
|
||||||
|
# defer setting hist_file from kwarg until after init,
|
||||||
|
# otherwise the default kwarg value would clobber any value
|
||||||
|
# set by config
|
||||||
|
if hist_file:
|
||||||
|
self.hist_file = hist_file
|
||||||
|
|
||||||
|
if self.hist_file == u'':
|
||||||
|
# No one has set the hist_file, yet.
|
||||||
|
self.hist_file = self._get_hist_file_name(profile)
|
||||||
|
|
||||||
|
if sqlite3 is None and self.enabled:
|
||||||
|
warn("yap_ipython History requires SQLite, your history will not be saved")
|
||||||
|
self.enabled = False
|
||||||
|
|
||||||
|
self.init_db()
|
||||||
|
|
||||||
|
def _get_hist_file_name(self, profile='default'):
|
||||||
|
"""Find the history file for the given profile name.
|
||||||
|
|
||||||
|
This is overridden by the HistoryManager subclass, to use the shell's
|
||||||
|
active profile.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
profile : str
|
||||||
|
The name of a profile which has a history file.
|
||||||
|
"""
|
||||||
|
return os.path.join(locate_profile(profile), 'history.sqlite')
|
||||||
|
|
||||||
|
@catch_corrupt_db
|
||||||
|
def init_db(self):
|
||||||
|
"""Connect to the database, and create tables if necessary."""
|
||||||
|
if not self.enabled:
|
||||||
|
self.db = DummyDB()
|
||||||
|
return
|
||||||
|
|
||||||
|
# use detect_types so that timestamps return datetime objects
|
||||||
|
kwargs = dict(detect_types=sqlite3.PARSE_DECLTYPES|sqlite3.PARSE_COLNAMES)
|
||||||
|
kwargs.update(self.connection_options)
|
||||||
|
self.db = sqlite3.connect(self.hist_file, **kwargs)
|
||||||
|
self.db.execute("""CREATE TABLE IF NOT EXISTS sessions (session integer
|
||||||
|
primary key autoincrement, start timestamp,
|
||||||
|
end timestamp, num_cmds integer, remark text)""")
|
||||||
|
self.db.execute("""CREATE TABLE IF NOT EXISTS history
|
||||||
|
(session integer, line integer, source text, source_raw text,
|
||||||
|
PRIMARY KEY (session, line))""")
|
||||||
|
# Output history is optional, but ensure the table's there so it can be
|
||||||
|
# enabled later.
|
||||||
|
self.db.execute("""CREATE TABLE IF NOT EXISTS output_history
|
||||||
|
(session integer, line integer, output text,
|
||||||
|
PRIMARY KEY (session, line))""")
|
||||||
|
self.db.commit()
|
||||||
|
# success! reset corrupt db count
|
||||||
|
self._corrupt_db_counter = 0
|
||||||
|
|
||||||
|
def writeout_cache(self):
|
||||||
|
"""Overridden by HistoryManager to dump the cache before certain
|
||||||
|
database lookups."""
|
||||||
|
pass
|
||||||
|
|
||||||
|
## -------------------------------
|
||||||
|
## Methods for retrieving history:
|
||||||
|
## -------------------------------
|
||||||
|
def _run_sql(self, sql, params, raw=True, output=False):
|
||||||
|
"""Prepares and runs an SQL query for the history database.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
sql : str
|
||||||
|
Any filtering expressions to go after SELECT ... FROM ...
|
||||||
|
params : tuple
|
||||||
|
Parameters passed to the SQL query (to replace "?")
|
||||||
|
raw, output : bool
|
||||||
|
See :meth:`get_range`
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
Tuples as :meth:`get_range`
|
||||||
|
"""
|
||||||
|
toget = 'source_raw' if raw else 'source'
|
||||||
|
sqlfrom = "history"
|
||||||
|
if output:
|
||||||
|
sqlfrom = "history LEFT JOIN output_history USING (session, line)"
|
||||||
|
toget = "history.%s, output_history.output" % toget
|
||||||
|
cur = self.db.execute("SELECT session, line, %s FROM %s " %\
|
||||||
|
(toget, sqlfrom) + sql, params)
|
||||||
|
if output: # Regroup into 3-tuples, and parse JSON
|
||||||
|
return ((ses, lin, (inp, out)) for ses, lin, inp, out in cur)
|
||||||
|
return cur
|
||||||
|
|
||||||
|
@needs_sqlite
|
||||||
|
@catch_corrupt_db
|
||||||
|
def get_session_info(self, session):
|
||||||
|
"""Get info about a session.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
|
||||||
|
session : int
|
||||||
|
Session number to retrieve.
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
|
||||||
|
session_id : int
|
||||||
|
Session ID number
|
||||||
|
start : datetime
|
||||||
|
Timestamp for the start of the session.
|
||||||
|
end : datetime
|
||||||
|
Timestamp for the end of the session, or None if yap_ipython crashed.
|
||||||
|
num_cmds : int
|
||||||
|
Number of commands run, or None if yap_ipython crashed.
|
||||||
|
remark : unicode
|
||||||
|
A manually set description.
|
||||||
|
"""
|
||||||
|
query = "SELECT * from sessions where session == ?"
|
||||||
|
return self.db.execute(query, (session,)).fetchone()
|
||||||
|
|
||||||
|
@catch_corrupt_db
|
||||||
|
def get_last_session_id(self):
|
||||||
|
"""Get the last session ID currently in the database.
|
||||||
|
|
||||||
|
Within yap_ipython, this should be the same as the value stored in
|
||||||
|
:attr:`HistoryManager.session_number`.
|
||||||
|
"""
|
||||||
|
for record in self.get_tail(n=1, include_latest=True):
|
||||||
|
return record[0]
|
||||||
|
|
||||||
|
@catch_corrupt_db
|
||||||
|
def get_tail(self, n=10, raw=True, output=False, include_latest=False):
|
||||||
|
"""Get the last n lines from the history database.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
n : int
|
||||||
|
The number of lines to get
|
||||||
|
raw, output : bool
|
||||||
|
See :meth:`get_range`
|
||||||
|
include_latest : bool
|
||||||
|
If False (default), n+1 lines are fetched, and the latest one
|
||||||
|
is discarded. This is intended to be used where the function
|
||||||
|
is called by a user command, which it should not return.
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
Tuples as :meth:`get_range`
|
||||||
|
"""
|
||||||
|
self.writeout_cache()
|
||||||
|
if not include_latest:
|
||||||
|
n += 1
|
||||||
|
cur = self._run_sql("ORDER BY session DESC, line DESC LIMIT ?",
|
||||||
|
(n,), raw=raw, output=output)
|
||||||
|
if not include_latest:
|
||||||
|
return reversed(list(cur)[1:])
|
||||||
|
return reversed(list(cur))
|
||||||
|
|
||||||
|
@catch_corrupt_db
|
||||||
|
def search(self, pattern="*", raw=True, search_raw=True,
|
||||||
|
output=False, n=None, unique=False):
|
||||||
|
"""Search the database using unix glob-style matching (wildcards
|
||||||
|
* and ?).
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
pattern : str
|
||||||
|
The wildcarded pattern to match when searching
|
||||||
|
search_raw : bool
|
||||||
|
If True, search the raw input, otherwise, the parsed input
|
||||||
|
raw, output : bool
|
||||||
|
See :meth:`get_range`
|
||||||
|
n : None or int
|
||||||
|
If an integer is given, it defines the limit of
|
||||||
|
returned entries.
|
||||||
|
unique : bool
|
||||||
|
When it is true, return only unique entries.
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
Tuples as :meth:`get_range`
|
||||||
|
"""
|
||||||
|
tosearch = "source_raw" if search_raw else "source"
|
||||||
|
if output:
|
||||||
|
tosearch = "history." + tosearch
|
||||||
|
self.writeout_cache()
|
||||||
|
sqlform = "WHERE %s GLOB ?" % tosearch
|
||||||
|
params = (pattern,)
|
||||||
|
if unique:
|
||||||
|
sqlform += ' GROUP BY {0}'.format(tosearch)
|
||||||
|
if n is not None:
|
||||||
|
sqlform += " ORDER BY session DESC, line DESC LIMIT ?"
|
||||||
|
params += (n,)
|
||||||
|
elif unique:
|
||||||
|
sqlform += " ORDER BY session, line"
|
||||||
|
cur = self._run_sql(sqlform, params, raw=raw, output=output)
|
||||||
|
if n is not None:
|
||||||
|
return reversed(list(cur))
|
||||||
|
return cur
|
||||||
|
|
||||||
|
@catch_corrupt_db
|
||||||
|
def get_range(self, session, start=1, stop=None, raw=True,output=False):
|
||||||
|
"""Retrieve input by session.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
session : int
|
||||||
|
Session number to retrieve.
|
||||||
|
start : int
|
||||||
|
First line to retrieve.
|
||||||
|
stop : int
|
||||||
|
End of line range (excluded from output itself). If None, retrieve
|
||||||
|
to the end of the session.
|
||||||
|
raw : bool
|
||||||
|
If True, return untranslated input
|
||||||
|
output : bool
|
||||||
|
If True, attempt to include output. This will be 'real' Python
|
||||||
|
objects for the current session, or text reprs from previous
|
||||||
|
sessions if db_log_output was enabled at the time. Where no output
|
||||||
|
is found, None is used.
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
entries
|
||||||
|
An iterator over the desired lines. Each line is a 3-tuple, either
|
||||||
|
(session, line, input) if output is False, or
|
||||||
|
(session, line, (input, output)) if output is True.
|
||||||
|
"""
|
||||||
|
if stop:
|
||||||
|
lineclause = "line >= ? AND line < ?"
|
||||||
|
params = (session, start, stop)
|
||||||
|
else:
|
||||||
|
lineclause = "line>=?"
|
||||||
|
params = (session, start)
|
||||||
|
|
||||||
|
return self._run_sql("WHERE session==? AND %s" % lineclause,
|
||||||
|
params, raw=raw, output=output)
|
||||||
|
|
||||||
|
def get_range_by_str(self, rangestr, raw=True, output=False):
|
||||||
|
"""Get lines of history from a string of ranges, as used by magic
|
||||||
|
commands %hist, %save, %macro, etc.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
rangestr : str
|
||||||
|
A string specifying ranges, e.g. "5 ~2/1-4". See
|
||||||
|
:func:`magic_history` for full details.
|
||||||
|
raw, output : bool
|
||||||
|
As :meth:`get_range`
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
Tuples as :meth:`get_range`
|
||||||
|
"""
|
||||||
|
for sess, s, e in extract_hist_ranges(rangestr):
|
||||||
|
for line in self.get_range(sess, s, e, raw=raw, output=output):
|
||||||
|
yield line
|
||||||
|
|
||||||
|
|
||||||
|
class HistoryManager(HistoryAccessor):
|
||||||
|
"""A class to organize all history-related functionality in one place.
|
||||||
|
"""
|
||||||
|
# Public interface
|
||||||
|
|
||||||
|
# An instance of the yap_ipython shell we are attached to
|
||||||
|
shell = Instance('yap_ipython.core.interactiveshell.InteractiveShellABC',
|
||||||
|
allow_none=True)
|
||||||
|
# Lists to hold processed and raw history. These start with a blank entry
|
||||||
|
# so that we can index them starting from 1
|
||||||
|
input_hist_parsed = List([""])
|
||||||
|
input_hist_raw = List([""])
|
||||||
|
# A list of directories visited during session
|
||||||
|
dir_hist = List()
|
||||||
|
@default('dir_hist')
|
||||||
|
def _dir_hist_default(self):
|
||||||
|
try:
|
||||||
|
return [os.getcwd()]
|
||||||
|
except OSError:
|
||||||
|
return []
|
||||||
|
|
||||||
|
# A dict of output history, keyed with ints from the shell's
|
||||||
|
# execution count.
|
||||||
|
output_hist = Dict()
|
||||||
|
# The text/plain repr of outputs.
|
||||||
|
output_hist_reprs = Dict()
|
||||||
|
|
||||||
|
# The number of the current session in the history database
|
||||||
|
session_number = Integer()
|
||||||
|
|
||||||
|
db_log_output = Bool(False,
|
||||||
|
help="Should the history database include output? (default: no)"
|
||||||
|
).tag(config=True)
|
||||||
|
db_cache_size = Integer(0,
|
||||||
|
help="Write to database every x commands (higher values save disk access & power).\n"
|
||||||
|
"Values of 1 or less effectively disable caching."
|
||||||
|
).tag(config=True)
|
||||||
|
# The input and output caches
|
||||||
|
db_input_cache = List()
|
||||||
|
db_output_cache = List()
|
||||||
|
|
||||||
|
# History saving in separate thread
|
||||||
|
save_thread = Instance('yap_ipython.core.history.HistorySavingThread',
|
||||||
|
allow_none=True)
|
||||||
|
save_flag = Instance(threading.Event, allow_none=True)
|
||||||
|
|
||||||
|
# Private interface
|
||||||
|
# Variables used to store the three last inputs from the user. On each new
|
||||||
|
# history update, we populate the user's namespace with these, shifted as
|
||||||
|
# necessary.
|
||||||
|
_i00 = Unicode(u'')
|
||||||
|
_i = Unicode(u'')
|
||||||
|
_ii = Unicode(u'')
|
||||||
|
_iii = Unicode(u'')
|
||||||
|
|
||||||
|
# A regex matching all forms of the exit command, so that we don't store
|
||||||
|
# them in the history (it's annoying to rewind the first entry and land on
|
||||||
|
# an exit call).
|
||||||
|
_exit_re = re.compile(r"(exit|quit)(\s*\(.*\))?$")
|
||||||
|
|
||||||
|
def __init__(self, shell=None, config=None, **traits):
|
||||||
|
"""Create a new history manager associated with a shell instance.
|
||||||
|
"""
|
||||||
|
# We need a pointer back to the shell for various tasks.
|
||||||
|
super(HistoryManager, self).__init__(shell=shell, config=config,
|
||||||
|
**traits)
|
||||||
|
self.save_flag = threading.Event()
|
||||||
|
self.db_input_cache_lock = threading.Lock()
|
||||||
|
self.db_output_cache_lock = threading.Lock()
|
||||||
|
|
||||||
|
try:
|
||||||
|
self.new_session()
|
||||||
|
except OperationalError:
|
||||||
|
self.log.error("Failed to create history session in %s. History will not be saved.",
|
||||||
|
self.hist_file, exc_info=True)
|
||||||
|
self.hist_file = ':memory:'
|
||||||
|
|
||||||
|
if self.enabled and self.hist_file != ':memory:':
|
||||||
|
self.save_thread = HistorySavingThread(self)
|
||||||
|
self.save_thread.start()
|
||||||
|
|
||||||
|
def _get_hist_file_name(self, profile=None):
|
||||||
|
"""Get default history file name based on the Shell's profile.
|
||||||
|
|
||||||
|
The profile parameter is ignored, but must exist for compatibility with
|
||||||
|
the parent class."""
|
||||||
|
profile_dir = self.shell.profile_dir.location
|
||||||
|
return os.path.join(profile_dir, 'history.sqlite')
|
||||||
|
|
||||||
|
@needs_sqlite
|
||||||
|
def new_session(self, conn=None):
|
||||||
|
"""Get a new session number."""
|
||||||
|
if conn is None:
|
||||||
|
conn = self.db
|
||||||
|
|
||||||
|
with conn:
|
||||||
|
cur = conn.execute("""INSERT INTO sessions VALUES (NULL, ?, NULL,
|
||||||
|
NULL, "") """, (datetime.datetime.now(),))
|
||||||
|
self.session_number = cur.lastrowid
|
||||||
|
|
||||||
|
def end_session(self):
|
||||||
|
"""Close the database session, filling in the end time and line count."""
|
||||||
|
self.writeout_cache()
|
||||||
|
with self.db:
|
||||||
|
self.db.execute("""UPDATE sessions SET end=?, num_cmds=? WHERE
|
||||||
|
session==?""", (datetime.datetime.now(),
|
||||||
|
len(self.input_hist_parsed)-1, self.session_number))
|
||||||
|
self.session_number = 0
|
||||||
|
|
||||||
|
def name_session(self, name):
|
||||||
|
"""Give the current session a name in the history database."""
|
||||||
|
with self.db:
|
||||||
|
self.db.execute("UPDATE sessions SET remark=? WHERE session==?",
|
||||||
|
(name, self.session_number))
|
||||||
|
|
||||||
|
def reset(self, new_session=True):
|
||||||
|
"""Clear the session history, releasing all object references, and
|
||||||
|
optionally open a new session."""
|
||||||
|
self.output_hist.clear()
|
||||||
|
# The directory history can't be completely empty
|
||||||
|
self.dir_hist[:] = [os.getcwd()]
|
||||||
|
|
||||||
|
if new_session:
|
||||||
|
if self.session_number:
|
||||||
|
self.end_session()
|
||||||
|
self.input_hist_parsed[:] = [""]
|
||||||
|
self.input_hist_raw[:] = [""]
|
||||||
|
self.new_session()
|
||||||
|
|
||||||
|
# ------------------------------
|
||||||
|
# Methods for retrieving history
|
||||||
|
# ------------------------------
|
||||||
|
def get_session_info(self, session=0):
|
||||||
|
"""Get info about a session.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
|
||||||
|
session : int
|
||||||
|
Session number to retrieve. The current session is 0, and negative
|
||||||
|
numbers count back from current session, so -1 is the previous session.
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
|
||||||
|
session_id : int
|
||||||
|
Session ID number
|
||||||
|
start : datetime
|
||||||
|
Timestamp for the start of the session.
|
||||||
|
end : datetime
|
||||||
|
Timestamp for the end of the session, or None if yap_ipython crashed.
|
||||||
|
num_cmds : int
|
||||||
|
Number of commands run, or None if yap_ipython crashed.
|
||||||
|
remark : unicode
|
||||||
|
A manually set description.
|
||||||
|
"""
|
||||||
|
if session <= 0:
|
||||||
|
session += self.session_number
|
||||||
|
|
||||||
|
return super(HistoryManager, self).get_session_info(session=session)
|
||||||
|
|
||||||
|
def _get_range_session(self, start=1, stop=None, raw=True, output=False):
|
||||||
|
"""Get input and output history from the current session. Called by
|
||||||
|
get_range, and takes similar parameters."""
|
||||||
|
input_hist = self.input_hist_raw if raw else self.input_hist_parsed
|
||||||
|
|
||||||
|
n = len(input_hist)
|
||||||
|
if start < 0:
|
||||||
|
start += n
|
||||||
|
if not stop or (stop > n):
|
||||||
|
stop = n
|
||||||
|
elif stop < 0:
|
||||||
|
stop += n
|
||||||
|
|
||||||
|
for i in range(start, stop):
|
||||||
|
if output:
|
||||||
|
line = (input_hist[i], self.output_hist_reprs.get(i))
|
||||||
|
else:
|
||||||
|
line = input_hist[i]
|
||||||
|
yield (0, i, line)
|
||||||
|
|
||||||
|
def get_range(self, session=0, start=1, stop=None, raw=True,output=False):
|
||||||
|
"""Retrieve input by session.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
session : int
|
||||||
|
Session number to retrieve. The current session is 0, and negative
|
||||||
|
numbers count back from current session, so -1 is previous session.
|
||||||
|
start : int
|
||||||
|
First line to retrieve.
|
||||||
|
stop : int
|
||||||
|
End of line range (excluded from output itself). If None, retrieve
|
||||||
|
to the end of the session.
|
||||||
|
raw : bool
|
||||||
|
If True, return untranslated input
|
||||||
|
output : bool
|
||||||
|
If True, attempt to include output. This will be 'real' Python
|
||||||
|
objects for the current session, or text reprs from previous
|
||||||
|
sessions if db_log_output was enabled at the time. Where no output
|
||||||
|
is found, None is used.
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
entries
|
||||||
|
An iterator over the desired lines. Each line is a 3-tuple, either
|
||||||
|
(session, line, input) if output is False, or
|
||||||
|
(session, line, (input, output)) if output is True.
|
||||||
|
"""
|
||||||
|
if session <= 0:
|
||||||
|
session += self.session_number
|
||||||
|
if session==self.session_number: # Current session
|
||||||
|
return self._get_range_session(start, stop, raw, output)
|
||||||
|
return super(HistoryManager, self).get_range(session, start, stop, raw,
|
||||||
|
output)
|
||||||
|
|
||||||
|
## ----------------------------
|
||||||
|
## Methods for storing history:
|
||||||
|
## ----------------------------
|
||||||
|
def store_inputs(self, line_num, source, source_raw=None):
|
||||||
|
"""Store source and raw input in history and create input cache
|
||||||
|
variables ``_i*``.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
line_num : int
|
||||||
|
The prompt number of this input.
|
||||||
|
|
||||||
|
source : str
|
||||||
|
Python input.
|
||||||
|
|
||||||
|
source_raw : str, optional
|
||||||
|
If given, this is the raw input without any yap_ipython transformations
|
||||||
|
applied to it. If not given, ``source`` is used.
|
||||||
|
"""
|
||||||
|
if source_raw is None:
|
||||||
|
source_raw = source
|
||||||
|
source = source.rstrip('\n')
|
||||||
|
source_raw = source_raw.rstrip('\n')
|
||||||
|
|
||||||
|
# do not store exit/quit commands
|
||||||
|
if self._exit_re.match(source_raw.strip()):
|
||||||
|
return
|
||||||
|
|
||||||
|
self.input_hist_parsed.append(source)
|
||||||
|
self.input_hist_raw.append(source_raw)
|
||||||
|
|
||||||
|
with self.db_input_cache_lock:
|
||||||
|
self.db_input_cache.append((line_num, source, source_raw))
|
||||||
|
# Trigger to flush cache and write to DB.
|
||||||
|
if len(self.db_input_cache) >= self.db_cache_size:
|
||||||
|
self.save_flag.set()
|
||||||
|
|
||||||
|
# update the auto _i variables
|
||||||
|
self._iii = self._ii
|
||||||
|
self._ii = self._i
|
||||||
|
self._i = self._i00
|
||||||
|
self._i00 = source_raw
|
||||||
|
|
||||||
|
# hackish access to user namespace to create _i1,_i2... dynamically
|
||||||
|
new_i = '_i%s' % line_num
|
||||||
|
to_main = {'_i': self._i,
|
||||||
|
'_ii': self._ii,
|
||||||
|
'_iii': self._iii,
|
||||||
|
new_i : self._i00 }
|
||||||
|
|
||||||
|
if self.shell is not None:
|
||||||
|
self.shell.push(to_main, interactive=False)
|
||||||
|
|
||||||
|
def store_output(self, line_num):
|
||||||
|
"""If database output logging is enabled, this saves all the
|
||||||
|
outputs from the indicated prompt number to the database. It's
|
||||||
|
called by run_cell after code has been executed.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
line_num : int
|
||||||
|
The line number from which to save outputs
|
||||||
|
"""
|
||||||
|
if (not self.db_log_output) or (line_num not in self.output_hist_reprs):
|
||||||
|
return
|
||||||
|
output = self.output_hist_reprs[line_num]
|
||||||
|
|
||||||
|
with self.db_output_cache_lock:
|
||||||
|
self.db_output_cache.append((line_num, output))
|
||||||
|
if self.db_cache_size <= 1:
|
||||||
|
self.save_flag.set()
|
||||||
|
|
||||||
|
def _writeout_input_cache(self, conn):
|
||||||
|
with conn:
|
||||||
|
for line in self.db_input_cache:
|
||||||
|
conn.execute("INSERT INTO history VALUES (?, ?, ?, ?)",
|
||||||
|
(self.session_number,)+line)
|
||||||
|
|
||||||
|
def _writeout_output_cache(self, conn):
|
||||||
|
with conn:
|
||||||
|
for line in self.db_output_cache:
|
||||||
|
conn.execute("INSERT INTO output_history VALUES (?, ?, ?)",
|
||||||
|
(self.session_number,)+line)
|
||||||
|
|
||||||
|
@needs_sqlite
|
||||||
|
def writeout_cache(self, conn=None):
|
||||||
|
"""Write any entries in the cache to the database."""
|
||||||
|
if conn is None:
|
||||||
|
conn = self.db
|
||||||
|
|
||||||
|
with self.db_input_cache_lock:
|
||||||
|
try:
|
||||||
|
self._writeout_input_cache(conn)
|
||||||
|
except sqlite3.IntegrityError:
|
||||||
|
self.new_session(conn)
|
||||||
|
print("ERROR! Session/line number was not unique in",
|
||||||
|
"database. History logging moved to new session",
|
||||||
|
self.session_number)
|
||||||
|
try:
|
||||||
|
# Try writing to the new session. If this fails, don't
|
||||||
|
# recurse
|
||||||
|
self._writeout_input_cache(conn)
|
||||||
|
except sqlite3.IntegrityError:
|
||||||
|
pass
|
||||||
|
finally:
|
||||||
|
self.db_input_cache = []
|
||||||
|
|
||||||
|
with self.db_output_cache_lock:
|
||||||
|
try:
|
||||||
|
self._writeout_output_cache(conn)
|
||||||
|
except sqlite3.IntegrityError:
|
||||||
|
print("!! Session/line number for output was not unique",
|
||||||
|
"in database. Output will not be stored.")
|
||||||
|
finally:
|
||||||
|
self.db_output_cache = []
|
||||||
|
|
||||||
|
|
||||||
|
class HistorySavingThread(threading.Thread):
|
||||||
|
"""This thread takes care of writing history to the database, so that
|
||||||
|
the UI isn't held up while that happens.
|
||||||
|
|
||||||
|
It waits for the HistoryManager's save_flag to be set, then writes out
|
||||||
|
the history cache. The main thread is responsible for setting the flag when
|
||||||
|
the cache size reaches a defined threshold."""
|
||||||
|
daemon = True
|
||||||
|
stop_now = False
|
||||||
|
enabled = True
|
||||||
|
def __init__(self, history_manager):
|
||||||
|
super(HistorySavingThread, self).__init__(name="IPythonHistorySavingThread")
|
||||||
|
self.history_manager = history_manager
|
||||||
|
self.enabled = history_manager.enabled
|
||||||
|
atexit.register(self.stop)
|
||||||
|
|
||||||
|
@needs_sqlite
|
||||||
|
def run(self):
|
||||||
|
# We need a separate db connection per thread:
|
||||||
|
try:
|
||||||
|
self.db = sqlite3.connect(self.history_manager.hist_file,
|
||||||
|
**self.history_manager.connection_options
|
||||||
|
)
|
||||||
|
while True:
|
||||||
|
self.history_manager.save_flag.wait()
|
||||||
|
if self.stop_now:
|
||||||
|
self.db.close()
|
||||||
|
return
|
||||||
|
self.history_manager.save_flag.clear()
|
||||||
|
self.history_manager.writeout_cache(self.db)
|
||||||
|
except Exception as e:
|
||||||
|
print(("The history saving thread hit an unexpected error (%s)."
|
||||||
|
"History will not be written to the database.") % repr(e))
|
||||||
|
|
||||||
|
def stop(self):
|
||||||
|
"""This can be called from the main thread to safely stop this thread.
|
||||||
|
|
||||||
|
Note that it does not attempt to write out remaining history before
|
||||||
|
exiting. That should be done by calling the HistoryManager's
|
||||||
|
end_session method."""
|
||||||
|
self.stop_now = True
|
||||||
|
self.history_manager.save_flag.set()
|
||||||
|
self.join()
|
||||||
|
|
||||||
|
|
||||||
|
# To match, e.g. ~5/8-~2/3
|
||||||
|
range_re = re.compile(r"""
|
||||||
|
((?P<startsess>~?\d+)/)?
|
||||||
|
(?P<start>\d+)?
|
||||||
|
((?P<sep>[\-:])
|
||||||
|
((?P<endsess>~?\d+)/)?
|
||||||
|
(?P<end>\d+))?
|
||||||
|
$""", re.VERBOSE)
|
||||||
|
|
||||||
|
|
||||||
|
def extract_hist_ranges(ranges_str):
|
||||||
|
"""Turn a string of history ranges into 3-tuples of (session, start, stop).
|
||||||
|
|
||||||
|
Examples
|
||||||
|
--------
|
||||||
|
>>> list(extract_hist_ranges("~8/5-~7/4 2"))
|
||||||
|
[(-8, 5, None), (-7, 1, 5), (0, 2, 3)]
|
||||||
|
"""
|
||||||
|
for range_str in ranges_str.split():
|
||||||
|
rmatch = range_re.match(range_str)
|
||||||
|
if not rmatch:
|
||||||
|
continue
|
||||||
|
start = rmatch.group("start")
|
||||||
|
if start:
|
||||||
|
start = int(start)
|
||||||
|
end = rmatch.group("end")
|
||||||
|
# If no end specified, get (a, a + 1)
|
||||||
|
end = int(end) if end else start + 1
|
||||||
|
else: # start not specified
|
||||||
|
if not rmatch.group('startsess'): # no startsess
|
||||||
|
continue
|
||||||
|
start = 1
|
||||||
|
end = None # provide the entire session hist
|
||||||
|
|
||||||
|
if rmatch.group("sep") == "-": # 1-3 == 1:4 --> [1, 2, 3]
|
||||||
|
end += 1
|
||||||
|
startsess = rmatch.group("startsess") or "0"
|
||||||
|
endsess = rmatch.group("endsess") or startsess
|
||||||
|
startsess = int(startsess.replace("~","-"))
|
||||||
|
endsess = int(endsess.replace("~","-"))
|
||||||
|
assert endsess >= startsess, "start session must be earlier than end session"
|
||||||
|
|
||||||
|
if endsess == startsess:
|
||||||
|
yield (startsess, start, end)
|
||||||
|
continue
|
||||||
|
# Multiple sessions in one range:
|
||||||
|
yield (startsess, start, None)
|
||||||
|
for sess in range(startsess+1, endsess):
|
||||||
|
yield (sess, 1, None)
|
||||||
|
yield (endsess, 1, end)
|
||||||
|
|
||||||
|
|
||||||
|
def _format_lineno(session, line):
|
||||||
|
"""Helper function to format line numbers properly."""
|
||||||
|
if session == 0:
|
||||||
|
return str(line)
|
||||||
|
return "%s#%s" % (session, line)
|
161
packages/python/yap_kernel/yap_ipython/core/historyapp.py
Normal file
161
packages/python/yap_kernel/yap_ipython/core/historyapp.py
Normal file
@ -0,0 +1,161 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""
|
||||||
|
An application for managing yap_ipython history.
|
||||||
|
|
||||||
|
To be invoked as the `ipython history` subcommand.
|
||||||
|
"""
|
||||||
|
|
||||||
|
import os
|
||||||
|
import sqlite3
|
||||||
|
|
||||||
|
from traitlets.config.application import Application
|
||||||
|
from yap_ipython.core.application import BaseYAPApplication
|
||||||
|
from traitlets import Bool, Int, Dict
|
||||||
|
from yap_ipython.utils.io import ask_yes_no
|
||||||
|
|
||||||
|
trim_hist_help = """Trim the yap_ipython history database to the last 1000 entries.
|
||||||
|
|
||||||
|
This actually copies the last 1000 entries to a new database, and then replaces
|
||||||
|
the old file with the new. Use the `--keep=` argument to specify a number
|
||||||
|
other than 1000.
|
||||||
|
"""
|
||||||
|
|
||||||
|
clear_hist_help = """Clear the yap_ipython history database, deleting all entries.
|
||||||
|
|
||||||
|
Because this is a destructive operation, yap_ipython will prompt the user if they
|
||||||
|
really want to do this. Passing a `-f` flag will force clearing without a
|
||||||
|
prompt.
|
||||||
|
|
||||||
|
This is an handy alias to `ipython history trim --keep=0`
|
||||||
|
"""
|
||||||
|
|
||||||
|
|
||||||
|
class HistoryTrim(BaseYAPApplication):
|
||||||
|
description = trim_hist_help
|
||||||
|
|
||||||
|
backup = Bool(False,
|
||||||
|
help="Keep the old history file as history.sqlite.<N>"
|
||||||
|
).tag(config=True)
|
||||||
|
|
||||||
|
keep = Int(1000,
|
||||||
|
help="Number of recent lines to keep in the database."
|
||||||
|
).tag(config=True)
|
||||||
|
|
||||||
|
flags = Dict(dict(
|
||||||
|
backup = ({'HistoryTrim' : {'backup' : True}},
|
||||||
|
backup.help
|
||||||
|
)
|
||||||
|
))
|
||||||
|
|
||||||
|
aliases=Dict(dict(
|
||||||
|
keep = 'HistoryTrim.keep'
|
||||||
|
))
|
||||||
|
|
||||||
|
def start(self):
|
||||||
|
profile_dir = self.profile_dir.location
|
||||||
|
hist_file = os.path.join(profile_dir, 'history.sqlite')
|
||||||
|
con = sqlite3.connect(hist_file)
|
||||||
|
|
||||||
|
# Grab the recent history from the current database.
|
||||||
|
inputs = list(con.execute('SELECT session, line, source, source_raw FROM '
|
||||||
|
'history ORDER BY session DESC, line DESC LIMIT ?', (self.keep+1,)))
|
||||||
|
if len(inputs) <= self.keep:
|
||||||
|
print("There are already at most %d entries in the history database." % self.keep)
|
||||||
|
print("Not doing anything. Use --keep= argument to keep fewer entries")
|
||||||
|
return
|
||||||
|
|
||||||
|
print("Trimming history to the most recent %d entries." % self.keep)
|
||||||
|
|
||||||
|
inputs.pop() # Remove the extra element we got to check the length.
|
||||||
|
inputs.reverse()
|
||||||
|
if inputs:
|
||||||
|
first_session = inputs[0][0]
|
||||||
|
outputs = list(con.execute('SELECT session, line, output FROM '
|
||||||
|
'output_history WHERE session >= ?', (first_session,)))
|
||||||
|
sessions = list(con.execute('SELECT session, start, end, num_cmds, remark FROM '
|
||||||
|
'sessions WHERE session >= ?', (first_session,)))
|
||||||
|
con.close()
|
||||||
|
|
||||||
|
# Create the new history database.
|
||||||
|
new_hist_file = os.path.join(profile_dir, 'history.sqlite.new')
|
||||||
|
i = 0
|
||||||
|
while os.path.exists(new_hist_file):
|
||||||
|
# Make sure we don't interfere with an existing file.
|
||||||
|
i += 1
|
||||||
|
new_hist_file = os.path.join(profile_dir, 'history.sqlite.new'+str(i))
|
||||||
|
new_db = sqlite3.connect(new_hist_file)
|
||||||
|
new_db.execute("""CREATE TABLE IF NOT EXISTS sessions (session integer
|
||||||
|
primary key autoincrement, start timestamp,
|
||||||
|
end timestamp, num_cmds integer, remark text)""")
|
||||||
|
new_db.execute("""CREATE TABLE IF NOT EXISTS history
|
||||||
|
(session integer, line integer, source text, source_raw text,
|
||||||
|
PRIMARY KEY (session, line))""")
|
||||||
|
new_db.execute("""CREATE TABLE IF NOT EXISTS output_history
|
||||||
|
(session integer, line integer, output text,
|
||||||
|
PRIMARY KEY (session, line))""")
|
||||||
|
new_db.commit()
|
||||||
|
|
||||||
|
|
||||||
|
if inputs:
|
||||||
|
with new_db:
|
||||||
|
# Add the recent history into the new database.
|
||||||
|
new_db.executemany('insert into sessions values (?,?,?,?,?)', sessions)
|
||||||
|
new_db.executemany('insert into history values (?,?,?,?)', inputs)
|
||||||
|
new_db.executemany('insert into output_history values (?,?,?)', outputs)
|
||||||
|
new_db.close()
|
||||||
|
|
||||||
|
if self.backup:
|
||||||
|
i = 1
|
||||||
|
backup_hist_file = os.path.join(profile_dir, 'history.sqlite.old.%d' % i)
|
||||||
|
while os.path.exists(backup_hist_file):
|
||||||
|
i += 1
|
||||||
|
backup_hist_file = os.path.join(profile_dir, 'history.sqlite.old.%d' % i)
|
||||||
|
os.rename(hist_file, backup_hist_file)
|
||||||
|
print("Backed up longer history file to", backup_hist_file)
|
||||||
|
else:
|
||||||
|
os.remove(hist_file)
|
||||||
|
|
||||||
|
os.rename(new_hist_file, hist_file)
|
||||||
|
|
||||||
|
class HistoryClear(HistoryTrim):
|
||||||
|
description = clear_hist_help
|
||||||
|
keep = Int(0,
|
||||||
|
help="Number of recent lines to keep in the database.")
|
||||||
|
|
||||||
|
force = Bool(False,
|
||||||
|
help="Don't prompt user for confirmation"
|
||||||
|
).tag(config=True)
|
||||||
|
|
||||||
|
flags = Dict(dict(
|
||||||
|
force = ({'HistoryClear' : {'force' : True}},
|
||||||
|
force.help),
|
||||||
|
f = ({'HistoryTrim' : {'force' : True}},
|
||||||
|
force.help
|
||||||
|
)
|
||||||
|
))
|
||||||
|
aliases = Dict()
|
||||||
|
|
||||||
|
def start(self):
|
||||||
|
if self.force or ask_yes_no("Really delete all ipython history? ",
|
||||||
|
default="no", interrupt="no"):
|
||||||
|
HistoryTrim.start(self)
|
||||||
|
|
||||||
|
class HistoryApp(Application):
|
||||||
|
name = u'ipython-history'
|
||||||
|
description = "Manage the yap_ipython history database."
|
||||||
|
|
||||||
|
subcommands = Dict(dict(
|
||||||
|
trim = (HistoryTrim, HistoryTrim.description.splitlines()[0]),
|
||||||
|
clear = (HistoryClear, HistoryClear.description.splitlines()[0]),
|
||||||
|
))
|
||||||
|
|
||||||
|
def start(self):
|
||||||
|
if self.subapp is None:
|
||||||
|
print("No subcommand specified. Must specify one of: %s" % \
|
||||||
|
(self.subcommands.keys()))
|
||||||
|
print()
|
||||||
|
self.print_description()
|
||||||
|
self.print_subcommands()
|
||||||
|
self.exit(1)
|
||||||
|
else:
|
||||||
|
return self.subapp.start()
|
229
packages/python/yap_kernel/yap_ipython/core/hooks.py
Normal file
229
packages/python/yap_kernel/yap_ipython/core/hooks.py
Normal file
@ -0,0 +1,229 @@
|
|||||||
|
"""Hooks for yap_ipython.
|
||||||
|
|
||||||
|
In Python, it is possible to overwrite any method of any object if you really
|
||||||
|
want to. But yap_ipython exposes a few 'hooks', methods which are *designed* to
|
||||||
|
be overwritten by users for customization purposes. This module defines the
|
||||||
|
default versions of all such hooks, which get used by yap_ipython if not
|
||||||
|
overridden by the user.
|
||||||
|
|
||||||
|
Hooks are simple functions, but they should be declared with ``self`` as their
|
||||||
|
first argument, because when activated they are registered into yap_ipython as
|
||||||
|
instance methods. The self argument will be the yap_ipython running instance
|
||||||
|
itself, so hooks have full access to the entire yap_ipython object.
|
||||||
|
|
||||||
|
If you wish to define a new hook and activate it, you can make an :doc:`extension
|
||||||
|
</config/extensions/index>` or a :ref:`startup script <startup_files>`. For
|
||||||
|
example, you could use a startup file like this::
|
||||||
|
|
||||||
|
import os
|
||||||
|
|
||||||
|
def calljed(self,filename, linenum):
|
||||||
|
"My editor hook calls the jed editor directly."
|
||||||
|
print "Calling my own editor, jed ..."
|
||||||
|
if os.system('jed +%d %s' % (linenum,filename)) != 0:
|
||||||
|
raise TryNext()
|
||||||
|
|
||||||
|
def load_ipython_extension(ip):
|
||||||
|
ip.set_hook('editor', calljed)
|
||||||
|
|
||||||
|
"""
|
||||||
|
|
||||||
|
#*****************************************************************************
|
||||||
|
# Copyright (C) 2005 Fernando Perez. <fperez@colorado.edu>
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
|
# the file COPYING, distributed as part of this software.
|
||||||
|
#*****************************************************************************
|
||||||
|
|
||||||
|
import os
|
||||||
|
import subprocess
|
||||||
|
import warnings
|
||||||
|
import sys
|
||||||
|
|
||||||
|
from yap_ipython.core.error import TryNext
|
||||||
|
|
||||||
|
# List here all the default hooks. For now it's just the editor functions
|
||||||
|
# but over time we'll move here all the public API for user-accessible things.
|
||||||
|
|
||||||
|
__all__ = ['editor', 'synchronize_with_editor',
|
||||||
|
'shutdown_hook', 'late_startup_hook',
|
||||||
|
'show_in_pager','pre_prompt_hook',
|
||||||
|
'pre_run_code_hook', 'clipboard_get']
|
||||||
|
|
||||||
|
deprecated = {'pre_run_code_hook': "a callback for the 'pre_execute' or 'pre_run_cell' event",
|
||||||
|
'late_startup_hook': "a callback for the 'shell_initialized' event",
|
||||||
|
'shutdown_hook': "the atexit module",
|
||||||
|
}
|
||||||
|
|
||||||
|
def editor(self, filename, linenum=None, wait=True):
|
||||||
|
"""Open the default editor at the given filename and linenumber.
|
||||||
|
|
||||||
|
This is yap_ipython's default editor hook, you can use it as an example to
|
||||||
|
write your own modified one. To set your own editor function as the
|
||||||
|
new editor hook, call ip.set_hook('editor',yourfunc)."""
|
||||||
|
|
||||||
|
# yap_ipython configures a default editor at startup by reading $EDITOR from
|
||||||
|
# the environment, and falling back on vi (unix) or notepad (win32).
|
||||||
|
editor = self.editor
|
||||||
|
|
||||||
|
# marker for at which line to open the file (for existing objects)
|
||||||
|
if linenum is None or editor=='notepad':
|
||||||
|
linemark = ''
|
||||||
|
else:
|
||||||
|
linemark = '+%d' % int(linenum)
|
||||||
|
|
||||||
|
# Enclose in quotes if necessary and legal
|
||||||
|
if ' ' in editor and os.path.isfile(editor) and editor[0] != '"':
|
||||||
|
editor = '"%s"' % editor
|
||||||
|
|
||||||
|
# Call the actual editor
|
||||||
|
proc = subprocess.Popen('%s %s %s' % (editor, linemark, filename),
|
||||||
|
shell=True)
|
||||||
|
if wait and proc.wait() != 0:
|
||||||
|
raise TryNext()
|
||||||
|
|
||||||
|
import tempfile
|
||||||
|
from yap_ipython.utils.decorators import undoc
|
||||||
|
|
||||||
|
@undoc
|
||||||
|
def fix_error_editor(self,filename,linenum,column,msg):
|
||||||
|
"""DEPRECATED
|
||||||
|
|
||||||
|
Open the editor at the given filename, linenumber, column and
|
||||||
|
show an error message. This is used for correcting syntax errors.
|
||||||
|
The current implementation only has special support for the VIM editor,
|
||||||
|
and falls back on the 'editor' hook if VIM is not used.
|
||||||
|
|
||||||
|
Call ip.set_hook('fix_error_editor',yourfunc) to use your own function,
|
||||||
|
"""
|
||||||
|
|
||||||
|
warnings.warn("""
|
||||||
|
`fix_error_editor` is deprecated as of yap_ipython 6.0 and will be removed
|
||||||
|
in future versions. It appears to be used only for automatically fixing syntax
|
||||||
|
error that has been broken for a few years and has thus been removed. If you
|
||||||
|
happened to use this function and still need it please make your voice heard on
|
||||||
|
the mailing list ipython-dev@python.org , or on the GitHub Issue tracker:
|
||||||
|
https://github.com/ipython/ipython/issues/9649 """, UserWarning)
|
||||||
|
|
||||||
|
def vim_quickfix_file():
|
||||||
|
t = tempfile.NamedTemporaryFile()
|
||||||
|
t.write('%s:%d:%d:%s\n' % (filename,linenum,column,msg))
|
||||||
|
t.flush()
|
||||||
|
return t
|
||||||
|
if os.path.basename(self.editor) != 'vim':
|
||||||
|
self.hooks.editor(filename,linenum)
|
||||||
|
return
|
||||||
|
t = vim_quickfix_file()
|
||||||
|
try:
|
||||||
|
if os.system('vim --cmd "set errorformat=%f:%l:%c:%m" -q ' + t.name):
|
||||||
|
raise TryNext()
|
||||||
|
finally:
|
||||||
|
t.close()
|
||||||
|
|
||||||
|
|
||||||
|
def synchronize_with_editor(self, filename, linenum, column):
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
|
class CommandChainDispatcher:
|
||||||
|
""" Dispatch calls to a chain of commands until some func can handle it
|
||||||
|
|
||||||
|
Usage: instantiate, execute "add" to add commands (with optional
|
||||||
|
priority), execute normally via f() calling mechanism.
|
||||||
|
|
||||||
|
"""
|
||||||
|
def __init__(self,commands=None):
|
||||||
|
if commands is None:
|
||||||
|
self.chain = []
|
||||||
|
else:
|
||||||
|
self.chain = commands
|
||||||
|
|
||||||
|
|
||||||
|
def __call__(self,*args, **kw):
|
||||||
|
""" Command chain is called just like normal func.
|
||||||
|
|
||||||
|
This will call all funcs in chain with the same args as were given to
|
||||||
|
this function, and return the result of first func that didn't raise
|
||||||
|
TryNext"""
|
||||||
|
last_exc = TryNext()
|
||||||
|
for prio,cmd in self.chain:
|
||||||
|
#print "prio",prio,"cmd",cmd #dbg
|
||||||
|
try:
|
||||||
|
return cmd(*args, **kw)
|
||||||
|
except TryNext as exc:
|
||||||
|
last_exc = exc
|
||||||
|
# if no function will accept it, raise TryNext up to the caller
|
||||||
|
raise last_exc
|
||||||
|
|
||||||
|
def __str__(self):
|
||||||
|
return str(self.chain)
|
||||||
|
|
||||||
|
def add(self, func, priority=0):
|
||||||
|
""" Add a func to the cmd chain with given priority """
|
||||||
|
self.chain.append((priority, func))
|
||||||
|
self.chain.sort(key=lambda x: x[0])
|
||||||
|
|
||||||
|
def __iter__(self):
|
||||||
|
""" Return all objects in chain.
|
||||||
|
|
||||||
|
Handy if the objects are not callable.
|
||||||
|
"""
|
||||||
|
return iter(self.chain)
|
||||||
|
|
||||||
|
|
||||||
|
def shutdown_hook(self):
|
||||||
|
""" default shutdown hook
|
||||||
|
|
||||||
|
Typically, shotdown hooks should raise TryNext so all shutdown ops are done
|
||||||
|
"""
|
||||||
|
|
||||||
|
#print "default shutdown hook ok" # dbg
|
||||||
|
return
|
||||||
|
|
||||||
|
|
||||||
|
def late_startup_hook(self):
|
||||||
|
""" Executed after ipython has been constructed and configured
|
||||||
|
|
||||||
|
"""
|
||||||
|
#print "default startup hook ok" # dbg
|
||||||
|
|
||||||
|
|
||||||
|
def show_in_pager(self, data, start, screen_lines):
|
||||||
|
""" Run a string through pager """
|
||||||
|
# raising TryNext here will use the default paging functionality
|
||||||
|
raise TryNext
|
||||||
|
|
||||||
|
|
||||||
|
def pre_prompt_hook(self):
|
||||||
|
""" Run before displaying the next prompt
|
||||||
|
|
||||||
|
Use this e.g. to display output from asynchronous operations (in order
|
||||||
|
to not mess up text entry)
|
||||||
|
"""
|
||||||
|
|
||||||
|
return None
|
||||||
|
|
||||||
|
|
||||||
|
def pre_run_code_hook(self):
|
||||||
|
""" Executed before running the (prefiltered) code in yap_ipython """
|
||||||
|
return None
|
||||||
|
|
||||||
|
|
||||||
|
def clipboard_get(self):
|
||||||
|
""" Get text from the clipboard.
|
||||||
|
"""
|
||||||
|
from yap_ipython.lib.clipboard import (
|
||||||
|
osx_clipboard_get, tkinter_clipboard_get,
|
||||||
|
win32_clipboard_get
|
||||||
|
)
|
||||||
|
if sys.platform == 'win32':
|
||||||
|
chain = [win32_clipboard_get, tkinter_clipboard_get]
|
||||||
|
elif sys.platform == 'darwin':
|
||||||
|
chain = [osx_clipboard_get, tkinter_clipboard_get]
|
||||||
|
else:
|
||||||
|
chain = [tkinter_clipboard_get]
|
||||||
|
dispatcher = CommandChainDispatcher()
|
||||||
|
for func in chain:
|
||||||
|
dispatcher.add(func)
|
||||||
|
text = dispatcher()
|
||||||
|
return text
|
766
packages/python/yap_kernel/yap_ipython/core/inputsplitter.py
Normal file
766
packages/python/yap_kernel/yap_ipython/core/inputsplitter.py
Normal file
@ -0,0 +1,766 @@
|
|||||||
|
"""Input handling and transformation machinery.
|
||||||
|
|
||||||
|
The first class in this module, :class:`InputSplitter`, is designed to tell when
|
||||||
|
input from a line-oriented frontend is complete and should be executed, and when
|
||||||
|
the user should be prompted for another line of code instead. The name 'input
|
||||||
|
splitter' is largely for historical reasons.
|
||||||
|
|
||||||
|
A companion, :class:`IPythonInputSplitter`, provides the same functionality but
|
||||||
|
with full support for the extended yap_ipython syntax (magics, system calls, etc).
|
||||||
|
The code to actually do these transformations is in :mod:`yap_ipython.core.inputtransformer`.
|
||||||
|
:class:`IPythonInputSplitter` feeds the raw code to the transformers in order
|
||||||
|
and stores the results.
|
||||||
|
|
||||||
|
For more details, see the class docstrings below.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
import ast
|
||||||
|
import codeop
|
||||||
|
import io
|
||||||
|
import re
|
||||||
|
import sys
|
||||||
|
import tokenize
|
||||||
|
import warnings
|
||||||
|
|
||||||
|
from yap_ipython.utils.py3compat import cast_unicode
|
||||||
|
from yap_ipython.core.inputtransformer import (leading_indent,
|
||||||
|
classic_prompt,
|
||||||
|
ipy_prompt,
|
||||||
|
cellmagic,
|
||||||
|
assemble_logical_lines,
|
||||||
|
help_end,
|
||||||
|
escaped_commands,
|
||||||
|
assign_from_magic,
|
||||||
|
assign_from_system,
|
||||||
|
assemble_python_lines,
|
||||||
|
)
|
||||||
|
|
||||||
|
# These are available in this module for backwards compatibility.
|
||||||
|
from yap_ipython.core.inputtransformer import (ESC_SHELL, ESC_SH_CAP, ESC_HELP,
|
||||||
|
ESC_HELP2, ESC_MAGIC, ESC_MAGIC2,
|
||||||
|
ESC_QUOTE, ESC_QUOTE2, ESC_PAREN, ESC_SEQUENCES)
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Utilities
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
# FIXME: These are general-purpose utilities that later can be moved to the
|
||||||
|
# general ward. Kept here for now because we're being very strict about test
|
||||||
|
# coverage with this code, and this lets us ensure that we keep 100% coverage
|
||||||
|
# while developing.
|
||||||
|
|
||||||
|
# compiled regexps for autoindent management
|
||||||
|
dedent_re = re.compile('|'.join([
|
||||||
|
r'^\s+raise(\s.*)?$', # raise statement (+ space + other stuff, maybe)
|
||||||
|
r'^\s+raise\([^\)]*\).*$', # wacky raise with immediate open paren
|
||||||
|
r'^\s+return(\s.*)?$', # normal return (+ space + other stuff, maybe)
|
||||||
|
r'^\s+return\([^\)]*\).*$', # wacky return with immediate open paren
|
||||||
|
r'^\s+pass\s*$', # pass (optionally followed by trailing spaces)
|
||||||
|
r'^\s+break\s*$', # break (optionally followed by trailing spaces)
|
||||||
|
r'^\s+continue\s*$', # continue (optionally followed by trailing spaces)
|
||||||
|
]))
|
||||||
|
ini_spaces_re = re.compile(r'^([ \t\r\f\v]+)')
|
||||||
|
|
||||||
|
# regexp to match pure comment lines so we don't accidentally insert 'if 1:'
|
||||||
|
# before pure comments
|
||||||
|
comment_line_re = re.compile('^\s*\#')
|
||||||
|
|
||||||
|
|
||||||
|
def num_ini_spaces(s):
|
||||||
|
"""Return the number of initial spaces in a string.
|
||||||
|
|
||||||
|
Note that tabs are counted as a single space. For now, we do *not* support
|
||||||
|
mixing of tabs and spaces in the user's input.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
s : string
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
n : int
|
||||||
|
"""
|
||||||
|
|
||||||
|
ini_spaces = ini_spaces_re.match(s)
|
||||||
|
if ini_spaces:
|
||||||
|
return ini_spaces.end()
|
||||||
|
else:
|
||||||
|
return 0
|
||||||
|
|
||||||
|
# Fake token types for partial_tokenize:
|
||||||
|
INCOMPLETE_STRING = tokenize.N_TOKENS
|
||||||
|
IN_MULTILINE_STATEMENT = tokenize.N_TOKENS + 1
|
||||||
|
|
||||||
|
# The 2 classes below have the same API as TokenInfo, but don't try to look up
|
||||||
|
# a token type name that they won't find.
|
||||||
|
class IncompleteString:
|
||||||
|
type = exact_type = INCOMPLETE_STRING
|
||||||
|
def __init__(self, s, start, end, line):
|
||||||
|
self.s = s
|
||||||
|
self.start = start
|
||||||
|
self.end = end
|
||||||
|
self.line = line
|
||||||
|
|
||||||
|
class InMultilineStatement:
|
||||||
|
type = exact_type = IN_MULTILINE_STATEMENT
|
||||||
|
def __init__(self, pos, line):
|
||||||
|
self.s = ''
|
||||||
|
self.start = self.end = pos
|
||||||
|
self.line = line
|
||||||
|
|
||||||
|
def partial_tokens(s):
|
||||||
|
"""Iterate over tokens from a possibly-incomplete string of code.
|
||||||
|
|
||||||
|
This adds two special token types: INCOMPLETE_STRING and
|
||||||
|
IN_MULTILINE_STATEMENT. These can only occur as the last token yielded, and
|
||||||
|
represent the two main ways for code to be incomplete.
|
||||||
|
"""
|
||||||
|
readline = io.StringIO(s).readline
|
||||||
|
token = tokenize.TokenInfo(tokenize.NEWLINE, '', (1, 0), (1, 0), '')
|
||||||
|
try:
|
||||||
|
for token in tokenize.generate_tokens(readline):
|
||||||
|
yield token
|
||||||
|
except tokenize.TokenError as e:
|
||||||
|
# catch EOF error
|
||||||
|
lines = s.splitlines(keepends=True)
|
||||||
|
end = len(lines), len(lines[-1])
|
||||||
|
if 'multi-line string' in e.args[0]:
|
||||||
|
l, c = start = token.end
|
||||||
|
s = lines[l-1][c:] + ''.join(lines[l:])
|
||||||
|
yield IncompleteString(s, start, end, lines[-1])
|
||||||
|
elif 'multi-line statement' in e.args[0]:
|
||||||
|
yield InMultilineStatement(end, lines[-1])
|
||||||
|
else:
|
||||||
|
raise
|
||||||
|
|
||||||
|
def find_next_indent(code):
|
||||||
|
"""Find the number of spaces for the next line of indentation"""
|
||||||
|
tokens = list(partial_tokens(code))
|
||||||
|
if tokens[-1].type == tokenize.ENDMARKER:
|
||||||
|
tokens.pop()
|
||||||
|
if not tokens:
|
||||||
|
return 0
|
||||||
|
while (tokens[-1].type in {tokenize.DEDENT, tokenize.NEWLINE, tokenize.COMMENT}):
|
||||||
|
tokens.pop()
|
||||||
|
|
||||||
|
if tokens[-1].type == INCOMPLETE_STRING:
|
||||||
|
# Inside a multiline string
|
||||||
|
return 0
|
||||||
|
|
||||||
|
# Find the indents used before
|
||||||
|
prev_indents = [0]
|
||||||
|
def _add_indent(n):
|
||||||
|
if n != prev_indents[-1]:
|
||||||
|
prev_indents.append(n)
|
||||||
|
|
||||||
|
tokiter = iter(tokens)
|
||||||
|
for tok in tokiter:
|
||||||
|
if tok.type in {tokenize.INDENT, tokenize.DEDENT}:
|
||||||
|
_add_indent(tok.end[1])
|
||||||
|
elif (tok.type == tokenize.NL):
|
||||||
|
try:
|
||||||
|
_add_indent(next(tokiter).start[1])
|
||||||
|
except StopIteration:
|
||||||
|
break
|
||||||
|
|
||||||
|
last_indent = prev_indents.pop()
|
||||||
|
|
||||||
|
# If we've just opened a multiline statement (e.g. 'a = ['), indent more
|
||||||
|
if tokens[-1].type == IN_MULTILINE_STATEMENT:
|
||||||
|
if tokens[-2].exact_type in {tokenize.LPAR, tokenize.LSQB, tokenize.LBRACE}:
|
||||||
|
return last_indent + 4
|
||||||
|
return last_indent
|
||||||
|
|
||||||
|
if tokens[-1].exact_type == tokenize.COLON:
|
||||||
|
# Line ends with colon - indent
|
||||||
|
return last_indent + 4
|
||||||
|
|
||||||
|
if last_indent:
|
||||||
|
# Examine the last line for dedent cues - statements like return or
|
||||||
|
# raise which normally end a block of code.
|
||||||
|
last_line_starts = 0
|
||||||
|
for i, tok in enumerate(tokens):
|
||||||
|
if tok.type == tokenize.NEWLINE:
|
||||||
|
last_line_starts = i + 1
|
||||||
|
|
||||||
|
last_line_tokens = tokens[last_line_starts:]
|
||||||
|
names = [t.string for t in last_line_tokens if t.type == tokenize.NAME]
|
||||||
|
if names and names[0] in {'raise', 'return', 'pass', 'break', 'continue'}:
|
||||||
|
# Find the most recent indentation less than the current level
|
||||||
|
for indent in reversed(prev_indents):
|
||||||
|
if indent < last_indent:
|
||||||
|
return indent
|
||||||
|
|
||||||
|
return last_indent
|
||||||
|
|
||||||
|
|
||||||
|
def last_blank(src):
|
||||||
|
"""Determine if the input source ends in a blank.
|
||||||
|
|
||||||
|
A blank is either a newline or a line consisting of whitespace.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
src : string
|
||||||
|
A single or multiline string.
|
||||||
|
"""
|
||||||
|
if not src: return False
|
||||||
|
ll = src.splitlines()[-1]
|
||||||
|
return (ll == '') or ll.isspace()
|
||||||
|
|
||||||
|
|
||||||
|
last_two_blanks_re = re.compile(r'\n\s*\n\s*$', re.MULTILINE)
|
||||||
|
last_two_blanks_re2 = re.compile(r'.+\n\s*\n\s+$', re.MULTILINE)
|
||||||
|
|
||||||
|
def last_two_blanks(src):
|
||||||
|
"""Determine if the input source ends in two blanks.
|
||||||
|
|
||||||
|
A blank is either a newline or a line consisting of whitespace.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
src : string
|
||||||
|
A single or multiline string.
|
||||||
|
"""
|
||||||
|
if not src: return False
|
||||||
|
# The logic here is tricky: I couldn't get a regexp to work and pass all
|
||||||
|
# the tests, so I took a different approach: split the source by lines,
|
||||||
|
# grab the last two and prepend '###\n' as a stand-in for whatever was in
|
||||||
|
# the body before the last two lines. Then, with that structure, it's
|
||||||
|
# possible to analyze with two regexps. Not the most elegant solution, but
|
||||||
|
# it works. If anyone tries to change this logic, make sure to validate
|
||||||
|
# the whole test suite first!
|
||||||
|
new_src = '\n'.join(['###\n'] + src.splitlines()[-2:])
|
||||||
|
return (bool(last_two_blanks_re.match(new_src)) or
|
||||||
|
bool(last_two_blanks_re2.match(new_src)) )
|
||||||
|
|
||||||
|
|
||||||
|
def remove_comments(src):
|
||||||
|
"""Remove all comments from input source.
|
||||||
|
|
||||||
|
Note: comments are NOT recognized inside of strings!
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
src : string
|
||||||
|
A single or multiline input string.
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
String with all Python comments removed.
|
||||||
|
"""
|
||||||
|
|
||||||
|
return re.sub('#.*', '', src)
|
||||||
|
|
||||||
|
|
||||||
|
def get_input_encoding():
|
||||||
|
"""Return the default standard input encoding.
|
||||||
|
|
||||||
|
If sys.stdin has no encoding, 'ascii' is returned."""
|
||||||
|
# There are strange environments for which sys.stdin.encoding is None. We
|
||||||
|
# ensure that a valid encoding is returned.
|
||||||
|
encoding = getattr(sys.stdin, 'encoding', None)
|
||||||
|
if encoding is None:
|
||||||
|
encoding = 'ascii'
|
||||||
|
return encoding
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Classes and functions for normal Python syntax handling
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
class InputSplitter(object):
|
||||||
|
r"""An object that can accumulate lines of Python source before execution.
|
||||||
|
|
||||||
|
This object is designed to be fed python source line-by-line, using
|
||||||
|
:meth:`push`. It will return on each push whether the currently pushed
|
||||||
|
code could be executed already. In addition, it provides a method called
|
||||||
|
:meth:`push_accepts_more` that can be used to query whether more input
|
||||||
|
can be pushed into a single interactive block.
|
||||||
|
|
||||||
|
This is a simple example of how an interactive terminal-based client can use
|
||||||
|
this tool::
|
||||||
|
|
||||||
|
isp = InputSplitter()
|
||||||
|
while isp.push_accepts_more():
|
||||||
|
indent = ' '*isp.indent_spaces
|
||||||
|
prompt = '>>> ' + indent
|
||||||
|
line = indent + raw_input(prompt)
|
||||||
|
isp.push(line)
|
||||||
|
print 'Input source was:\n', isp.source_reset(),
|
||||||
|
"""
|
||||||
|
# A cache for storing the current indentation
|
||||||
|
# The first value stores the most recently processed source input
|
||||||
|
# The second value is the number of spaces for the current indentation
|
||||||
|
# If self.source matches the first value, the second value is a valid
|
||||||
|
# current indentation. Otherwise, the cache is invalid and the indentation
|
||||||
|
# must be recalculated.
|
||||||
|
_indent_spaces_cache = None, None
|
||||||
|
# String, indicating the default input encoding. It is computed by default
|
||||||
|
# at initialization time via get_input_encoding(), but it can be reset by a
|
||||||
|
# client with specific knowledge of the encoding.
|
||||||
|
encoding = ''
|
||||||
|
# String where the current full source input is stored, properly encoded.
|
||||||
|
# Reading this attribute is the normal way of querying the currently pushed
|
||||||
|
# source code, that has been properly encoded.
|
||||||
|
source = ''
|
||||||
|
# Code object corresponding to the current source. It is automatically
|
||||||
|
# synced to the source, so it can be queried at any time to obtain the code
|
||||||
|
# object; it will be None if the source doesn't compile to valid Python.
|
||||||
|
code = None
|
||||||
|
|
||||||
|
# Private attributes
|
||||||
|
|
||||||
|
# List with lines of input accumulated so far
|
||||||
|
_buffer = None
|
||||||
|
# Command compiler
|
||||||
|
_compile = None
|
||||||
|
# Boolean indicating whether the current block is complete
|
||||||
|
_is_complete = None
|
||||||
|
# Boolean indicating whether the current block has an unrecoverable syntax error
|
||||||
|
_is_invalid = False
|
||||||
|
|
||||||
|
def __init__(self):
|
||||||
|
"""Create a new InputSplitter instance.
|
||||||
|
"""
|
||||||
|
self._buffer = []
|
||||||
|
self._compile = codeop.CommandCompiler()
|
||||||
|
self.encoding = get_input_encoding()
|
||||||
|
|
||||||
|
def reset(self):
|
||||||
|
"""Reset the input buffer and associated state."""
|
||||||
|
self._buffer[:] = []
|
||||||
|
self.source = ''
|
||||||
|
self.code = None
|
||||||
|
self._is_complete = False
|
||||||
|
self._is_invalid = False
|
||||||
|
|
||||||
|
def source_reset(self):
|
||||||
|
"""Return the input source and perform a full reset.
|
||||||
|
"""
|
||||||
|
out = self.source
|
||||||
|
self.reset()
|
||||||
|
return out
|
||||||
|
|
||||||
|
def check_complete(self, source):
|
||||||
|
"""Return whether a block of code is ready to execute, or should be continued
|
||||||
|
|
||||||
|
This is a non-stateful API, and will reset the state of this InputSplitter.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
source : string
|
||||||
|
Python input code, which can be multiline.
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
status : str
|
||||||
|
One of 'complete', 'incomplete', or 'invalid' if source is not a
|
||||||
|
prefix of valid code.
|
||||||
|
indent_spaces : int or None
|
||||||
|
The number of spaces by which to indent the next line of code. If
|
||||||
|
status is not 'incomplete', this is None.
|
||||||
|
"""
|
||||||
|
self.reset()
|
||||||
|
try:
|
||||||
|
self.push(source)
|
||||||
|
except SyntaxError:
|
||||||
|
# Transformers in IPythonInputSplitter can raise SyntaxError,
|
||||||
|
# which push() will not catch.
|
||||||
|
return 'invalid', None
|
||||||
|
else:
|
||||||
|
if self._is_invalid:
|
||||||
|
return 'invalid', None
|
||||||
|
elif self.push_accepts_more():
|
||||||
|
return 'incomplete', self.get_indent_spaces()
|
||||||
|
else:
|
||||||
|
return 'complete', None
|
||||||
|
finally:
|
||||||
|
self.reset()
|
||||||
|
|
||||||
|
def push(self, lines):
|
||||||
|
"""Push one or more lines of input.
|
||||||
|
|
||||||
|
This stores the given lines and returns a status code indicating
|
||||||
|
whether the code forms a complete Python block or not.
|
||||||
|
|
||||||
|
Any exceptions generated in compilation are swallowed, but if an
|
||||||
|
exception was produced, the method returns True.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
lines : string
|
||||||
|
One or more lines of Python input.
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
is_complete : boolean
|
||||||
|
True if the current input source (the result of the current input
|
||||||
|
plus prior inputs) forms a complete Python execution block. Note that
|
||||||
|
this value is also stored as a private attribute (``_is_complete``), so it
|
||||||
|
can be queried at any time.
|
||||||
|
"""
|
||||||
|
self._store(lines)
|
||||||
|
source = self.source
|
||||||
|
|
||||||
|
# Before calling _compile(), reset the code object to None so that if an
|
||||||
|
# exception is raised in compilation, we don't mislead by having
|
||||||
|
# inconsistent code/source attributes.
|
||||||
|
self.code, self._is_complete = None, None
|
||||||
|
self._is_invalid = False
|
||||||
|
|
||||||
|
# Honor termination lines properly
|
||||||
|
if source.endswith('\\\n'):
|
||||||
|
return False
|
||||||
|
|
||||||
|
try:
|
||||||
|
with warnings.catch_warnings():
|
||||||
|
warnings.simplefilter('error', SyntaxWarning)
|
||||||
|
self.code = self._compile(source, symbol="exec")
|
||||||
|
# Invalid syntax can produce any of a number of different errors from
|
||||||
|
# inside the compiler, so we have to catch them all. Syntax errors
|
||||||
|
# immediately produce a 'ready' block, so the invalid Python can be
|
||||||
|
# sent to the kernel for evaluation with possible ipython
|
||||||
|
# special-syntax conversion.
|
||||||
|
except (SyntaxError, OverflowError, ValueError, TypeError,
|
||||||
|
MemoryError, SyntaxWarning):
|
||||||
|
self._is_complete = True
|
||||||
|
self._is_invalid = True
|
||||||
|
else:
|
||||||
|
# Compilation didn't produce any exceptions (though it may not have
|
||||||
|
# given a complete code object)
|
||||||
|
self._is_complete = self.code is not None
|
||||||
|
|
||||||
|
return self._is_complete
|
||||||
|
|
||||||
|
def push_accepts_more(self):
|
||||||
|
"""Return whether a block of interactive input can accept more input.
|
||||||
|
|
||||||
|
This method is meant to be used by line-oriented frontends, who need to
|
||||||
|
guess whether a block is complete or not based solely on prior and
|
||||||
|
current input lines. The InputSplitter considers it has a complete
|
||||||
|
interactive block and will not accept more input when either:
|
||||||
|
|
||||||
|
* A SyntaxError is raised
|
||||||
|
|
||||||
|
* The code is complete and consists of a single line or a single
|
||||||
|
non-compound statement
|
||||||
|
|
||||||
|
* The code is complete and has a blank line at the end
|
||||||
|
|
||||||
|
If the current input produces a syntax error, this method immediately
|
||||||
|
returns False but does *not* raise the syntax error exception, as
|
||||||
|
typically clients will want to send invalid syntax to an execution
|
||||||
|
backend which might convert the invalid syntax into valid Python via
|
||||||
|
one of the dynamic yap_ipython mechanisms.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# With incomplete input, unconditionally accept more
|
||||||
|
# A syntax error also sets _is_complete to True - see push()
|
||||||
|
if not self._is_complete:
|
||||||
|
#print("Not complete") # debug
|
||||||
|
return True
|
||||||
|
|
||||||
|
# The user can make any (complete) input execute by leaving a blank line
|
||||||
|
last_line = self.source.splitlines()[-1]
|
||||||
|
if (not last_line) or last_line.isspace():
|
||||||
|
#print("Blank line") # debug
|
||||||
|
return False
|
||||||
|
|
||||||
|
# If there's just a single line or AST node, and we're flush left, as is
|
||||||
|
# the case after a simple statement such as 'a=1', we want to execute it
|
||||||
|
# straight away.
|
||||||
|
if self.get_indent_spaces() == 0:
|
||||||
|
if len(self.source.splitlines()) <= 1:
|
||||||
|
return False
|
||||||
|
|
||||||
|
try:
|
||||||
|
code_ast = ast.parse(u''.join(self._buffer))
|
||||||
|
except Exception:
|
||||||
|
#print("Can't parse AST") # debug
|
||||||
|
return False
|
||||||
|
else:
|
||||||
|
if len(code_ast.body) == 1 and \
|
||||||
|
not hasattr(code_ast.body[0], 'body'):
|
||||||
|
#print("Simple statement") # debug
|
||||||
|
return False
|
||||||
|
|
||||||
|
# General fallback - accept more code
|
||||||
|
return True
|
||||||
|
|
||||||
|
def get_indent_spaces(self):
|
||||||
|
sourcefor, n = self._indent_spaces_cache
|
||||||
|
if sourcefor == self.source:
|
||||||
|
return n
|
||||||
|
|
||||||
|
# self.source always has a trailing newline
|
||||||
|
n = find_next_indent(self.source[:-1])
|
||||||
|
self._indent_spaces_cache = (self.source, n)
|
||||||
|
return n
|
||||||
|
|
||||||
|
# Backwards compatibility. I think all code that used .indent_spaces was
|
||||||
|
# inside yap_ipython, but we can leave this here until yap_ipython 7 in case any
|
||||||
|
# other modules are using it. -TK, November 2017
|
||||||
|
indent_spaces = property(get_indent_spaces)
|
||||||
|
|
||||||
|
def _store(self, lines, buffer=None, store='source'):
|
||||||
|
"""Store one or more lines of input.
|
||||||
|
|
||||||
|
If input lines are not newline-terminated, a newline is automatically
|
||||||
|
appended."""
|
||||||
|
|
||||||
|
if buffer is None:
|
||||||
|
buffer = self._buffer
|
||||||
|
|
||||||
|
if lines.endswith('\n'):
|
||||||
|
buffer.append(lines)
|
||||||
|
else:
|
||||||
|
buffer.append(lines+'\n')
|
||||||
|
setattr(self, store, self._set_source(buffer))
|
||||||
|
|
||||||
|
def _set_source(self, buffer):
|
||||||
|
return u''.join(buffer)
|
||||||
|
|
||||||
|
|
||||||
|
class IPythonInputSplitter(InputSplitter):
|
||||||
|
"""An input splitter that recognizes all of yap_ipython's special syntax."""
|
||||||
|
|
||||||
|
# String with raw, untransformed input.
|
||||||
|
source_raw = ''
|
||||||
|
|
||||||
|
# Flag to track when a transformer has stored input that it hasn't given
|
||||||
|
# back yet.
|
||||||
|
transformer_accumulating = False
|
||||||
|
|
||||||
|
# Flag to track when assemble_python_lines has stored input that it hasn't
|
||||||
|
# given back yet.
|
||||||
|
within_python_line = False
|
||||||
|
|
||||||
|
# Private attributes
|
||||||
|
|
||||||
|
# List with lines of raw input accumulated so far.
|
||||||
|
_buffer_raw = None
|
||||||
|
|
||||||
|
def __init__(self, line_input_checker=True, physical_line_transforms=None,
|
||||||
|
logical_line_transforms=None, python_line_transforms=None):
|
||||||
|
super(IPythonInputSplitter, self).__init__()
|
||||||
|
self._buffer_raw = []
|
||||||
|
self._validate = True
|
||||||
|
|
||||||
|
if physical_line_transforms is not None:
|
||||||
|
self.physical_line_transforms = physical_line_transforms
|
||||||
|
else:
|
||||||
|
self.physical_line_transforms = [
|
||||||
|
leading_indent(),
|
||||||
|
classic_prompt(),
|
||||||
|
ipy_prompt(),
|
||||||
|
cellmagic(end_on_blank_line=line_input_checker),
|
||||||
|
]
|
||||||
|
|
||||||
|
self.assemble_logical_lines = assemble_logical_lines()
|
||||||
|
if logical_line_transforms is not None:
|
||||||
|
self.logical_line_transforms = logical_line_transforms
|
||||||
|
else:
|
||||||
|
self.logical_line_transforms = [
|
||||||
|
help_end(),
|
||||||
|
escaped_commands(),
|
||||||
|
assign_from_magic(),
|
||||||
|
assign_from_system(),
|
||||||
|
]
|
||||||
|
|
||||||
|
self.assemble_python_lines = assemble_python_lines()
|
||||||
|
if python_line_transforms is not None:
|
||||||
|
self.python_line_transforms = python_line_transforms
|
||||||
|
else:
|
||||||
|
# We don't use any of these at present
|
||||||
|
self.python_line_transforms = []
|
||||||
|
|
||||||
|
@property
|
||||||
|
def transforms(self):
|
||||||
|
"Quick access to all transformers."
|
||||||
|
return self.physical_line_transforms + \
|
||||||
|
[self.assemble_logical_lines] + self.logical_line_transforms + \
|
||||||
|
[self.assemble_python_lines] + self.python_line_transforms
|
||||||
|
|
||||||
|
@property
|
||||||
|
def transforms_in_use(self):
|
||||||
|
"""Transformers, excluding logical line transformers if we're in a
|
||||||
|
Python line."""
|
||||||
|
t = self.physical_line_transforms[:]
|
||||||
|
if not self.within_python_line:
|
||||||
|
t += [self.assemble_logical_lines] + self.logical_line_transforms
|
||||||
|
return t + [self.assemble_python_lines] + self.python_line_transforms
|
||||||
|
|
||||||
|
def reset(self):
|
||||||
|
"""Reset the input buffer and associated state."""
|
||||||
|
super(IPythonInputSplitter, self).reset()
|
||||||
|
self._buffer_raw[:] = []
|
||||||
|
self.source_raw = ''
|
||||||
|
self.transformer_accumulating = False
|
||||||
|
self.within_python_line = False
|
||||||
|
|
||||||
|
for t in self.transforms:
|
||||||
|
try:
|
||||||
|
t.reset()
|
||||||
|
except SyntaxError:
|
||||||
|
# Nothing that calls reset() expects to handle transformer
|
||||||
|
# errors
|
||||||
|
pass
|
||||||
|
|
||||||
|
def flush_transformers(self):
|
||||||
|
def _flush(transform, outs):
|
||||||
|
"""yield transformed lines
|
||||||
|
|
||||||
|
always strings, never None
|
||||||
|
|
||||||
|
transform: the current transform
|
||||||
|
outs: an iterable of previously transformed inputs.
|
||||||
|
Each may be multiline, which will be passed
|
||||||
|
one line at a time to transform.
|
||||||
|
"""
|
||||||
|
for out in outs:
|
||||||
|
for line in out.splitlines():
|
||||||
|
# push one line at a time
|
||||||
|
tmp = transform.push(line)
|
||||||
|
if tmp is not None:
|
||||||
|
yield tmp
|
||||||
|
|
||||||
|
# reset the transform
|
||||||
|
tmp = transform.reset()
|
||||||
|
if tmp is not None:
|
||||||
|
yield tmp
|
||||||
|
|
||||||
|
out = []
|
||||||
|
for t in self.transforms_in_use:
|
||||||
|
out = _flush(t, out)
|
||||||
|
|
||||||
|
out = list(out)
|
||||||
|
if out:
|
||||||
|
self._store('\n'.join(out))
|
||||||
|
|
||||||
|
def raw_reset(self):
|
||||||
|
"""Return raw input only and perform a full reset.
|
||||||
|
"""
|
||||||
|
out = self.source_raw
|
||||||
|
self.reset()
|
||||||
|
return out
|
||||||
|
|
||||||
|
def source_reset(self):
|
||||||
|
try:
|
||||||
|
self.flush_transformers()
|
||||||
|
return self.source
|
||||||
|
finally:
|
||||||
|
self.reset()
|
||||||
|
|
||||||
|
def push_accepts_more(self):
|
||||||
|
if self.transformer_accumulating:
|
||||||
|
return True
|
||||||
|
else:
|
||||||
|
return super(IPythonInputSplitter, self).push_accepts_more()
|
||||||
|
|
||||||
|
def transform_cell(self, cell):
|
||||||
|
"""Process and translate a cell of input.
|
||||||
|
"""
|
||||||
|
self.reset()
|
||||||
|
try:
|
||||||
|
self.push(cell)
|
||||||
|
self.flush_transformers()
|
||||||
|
return self.source
|
||||||
|
finally:
|
||||||
|
self.reset()
|
||||||
|
|
||||||
|
def push(self, lines):
|
||||||
|
"""Push one or more lines of yap_ipython input.
|
||||||
|
|
||||||
|
This stores the given lines and returns a status code indicating
|
||||||
|
whether the code forms a complete Python block or not, after processing
|
||||||
|
all input lines for special yap_ipython syntax.
|
||||||
|
|
||||||
|
Any exceptions generated in compilation are swallowed, but if an
|
||||||
|
exception was produced, the method returns True.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
lines : string
|
||||||
|
One or more lines of Python input.
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
is_complete : boolean
|
||||||
|
True if the current input source (the result of the current input
|
||||||
|
plus prior inputs) forms a complete Python execution block. Note that
|
||||||
|
this value is also stored as a private attribute (_is_complete), so it
|
||||||
|
can be queried at any time.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# We must ensure all input is pure unicode
|
||||||
|
lines = cast_unicode(lines, self.encoding)
|
||||||
|
# ''.splitlines() --> [], but we need to push the empty line to transformers
|
||||||
|
lines_list = lines.splitlines()
|
||||||
|
if not lines_list:
|
||||||
|
lines_list = ['']
|
||||||
|
|
||||||
|
# Store raw source before applying any transformations to it. Note
|
||||||
|
# that this must be done *after* the reset() call that would otherwise
|
||||||
|
# flush the buffer.
|
||||||
|
self._store(lines, self._buffer_raw, 'source_raw')
|
||||||
|
|
||||||
|
transformed_lines_list = []
|
||||||
|
for line in lines_list:
|
||||||
|
transformed = self._transform_line(line)
|
||||||
|
if transformed is not None:
|
||||||
|
transformed_lines_list.append(transformed)
|
||||||
|
|
||||||
|
if transformed_lines_list:
|
||||||
|
transformed_lines = '\n'.join(transformed_lines_list)
|
||||||
|
return super(IPythonInputSplitter, self).push(transformed_lines)
|
||||||
|
else:
|
||||||
|
# Got nothing back from transformers - they must be waiting for
|
||||||
|
# more input.
|
||||||
|
return False
|
||||||
|
|
||||||
|
def _transform_line(self, line):
|
||||||
|
"""Push a line of input code through the various transformers.
|
||||||
|
|
||||||
|
Returns any output from the transformers, or None if a transformer
|
||||||
|
is accumulating lines.
|
||||||
|
|
||||||
|
Sets self.transformer_accumulating as a side effect.
|
||||||
|
"""
|
||||||
|
def _accumulating(dbg):
|
||||||
|
#print(dbg)
|
||||||
|
self.transformer_accumulating = True
|
||||||
|
return None
|
||||||
|
|
||||||
|
for transformer in self.physical_line_transforms:
|
||||||
|
line = transformer.push(line)
|
||||||
|
if line is None:
|
||||||
|
return _accumulating(transformer)
|
||||||
|
|
||||||
|
if not self.within_python_line:
|
||||||
|
line = self.assemble_logical_lines.push(line)
|
||||||
|
if line is None:
|
||||||
|
return _accumulating('acc logical line')
|
||||||
|
|
||||||
|
for transformer in self.logical_line_transforms:
|
||||||
|
line = transformer.push(line)
|
||||||
|
if line is None:
|
||||||
|
return _accumulating(transformer)
|
||||||
|
|
||||||
|
line = self.assemble_python_lines.push(line)
|
||||||
|
if line is None:
|
||||||
|
self.within_python_line = True
|
||||||
|
return _accumulating('acc python line')
|
||||||
|
else:
|
||||||
|
self.within_python_line = False
|
||||||
|
|
||||||
|
for transformer in self.python_line_transforms:
|
||||||
|
line = transformer.push(line)
|
||||||
|
if line is None:
|
||||||
|
return _accumulating(transformer)
|
||||||
|
|
||||||
|
#print("transformers clear") #debug
|
||||||
|
self.transformer_accumulating = False
|
||||||
|
return line
|
||||||
|
|
@ -1,4 +1,4 @@
|
|||||||
"""Input transformer classes to support IPython special syntax.
|
"""Input transformer classes to support yap_ipython special syntax.
|
||||||
|
|
||||||
This includes the machinery to recognise and transform ``%magic`` commands,
|
This includes the machinery to recognise and transform ``%magic`` commands,
|
||||||
``!system`` commands, ``help?`` querying, prompt stripping, and so forth.
|
``!system`` commands, ``help?`` querying, prompt stripping, and so forth.
|
||||||
@ -8,18 +8,18 @@ import functools
|
|||||||
import re
|
import re
|
||||||
from io import StringIO
|
from io import StringIO
|
||||||
|
|
||||||
from IPython.core.splitinput import LineInfo
|
from yap_ipython.core.splitinput import LineInfo
|
||||||
from IPython.utils import tokenize2
|
from yap_ipython.utils import tokenize2
|
||||||
from IPython.utils.tokenize2 import generate_tokens, untokenize, TokenError
|
from yap_ipython.utils.tokenize2 import generate_tokens, untokenize, TokenError
|
||||||
|
|
||||||
#-----------------------------------------------------------------------------
|
#-----------------------------------------------------------------------------
|
||||||
# Globals
|
# Globals
|
||||||
#-----------------------------------------------------------------------------
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
# The escape sequences that define the syntax transformations IPython will
|
# The escape sequences that define the syntax transformations yap_ipython will
|
||||||
# apply to user input. These can NOT be just changed here: many regular
|
# apply to user input. These can NOT be just changed here: many regular
|
||||||
# expressions and other parts of the code may use their hardcoded values, and
|
# expressions and other parts of the code may use their hardcoded values, and
|
||||||
# for all intents and purposes they constitute the 'IPython syntax', so they
|
# for all intents and purposes they constitute the 'yap_ipython syntax', so they
|
||||||
# should be considered fixed.
|
# should be considered fixed.
|
||||||
|
|
||||||
ESC_SHELL = '!' # Send line to underlying system shell
|
ESC_SHELL = '!' # Send line to underlying system shell
|
||||||
@ -198,11 +198,14 @@ def _make_help_call(target, esc, lspace, next_input=None):
|
|||||||
else 'psearch' if '*' in target \
|
else 'psearch' if '*' in target \
|
||||||
else 'pinfo'
|
else 'pinfo'
|
||||||
arg = " ".join([method, target])
|
arg = " ".join([method, target])
|
||||||
|
#Prepare arguments for get_ipython().run_line_magic(magic_name, magic_args)
|
||||||
|
t_magic_name, _, t_magic_arg_s = arg.partition(' ')
|
||||||
|
t_magic_name = t_magic_name.lstrip(ESC_MAGIC)
|
||||||
if next_input is None:
|
if next_input is None:
|
||||||
return '%sget_ipython().magic(%r)' % (lspace, arg)
|
return '%sget_ipython().run_line_magic(%r, %r)' % (lspace, t_magic_name, t_magic_arg_s)
|
||||||
else:
|
else:
|
||||||
return '%sget_ipython().set_next_input(%r);get_ipython().magic(%r)' % \
|
return '%sget_ipython().set_next_input(%r);get_ipython().run_line_magic(%r, %r)' % \
|
||||||
(lspace, next_input, arg)
|
(lspace, next_input, t_magic_name, t_magic_arg_s)
|
||||||
|
|
||||||
# These define the transformations for the different escape characters.
|
# These define the transformations for the different escape characters.
|
||||||
def _tr_system(line_info):
|
def _tr_system(line_info):
|
||||||
@ -225,11 +228,14 @@ def _tr_help(line_info):
|
|||||||
|
|
||||||
def _tr_magic(line_info):
|
def _tr_magic(line_info):
|
||||||
"Translate lines escaped with: %"
|
"Translate lines escaped with: %"
|
||||||
tpl = '%sget_ipython().magic(%r)'
|
tpl = '%sget_ipython().run_line_magic(%r, %r)'
|
||||||
if line_info.line.startswith(ESC_MAGIC2):
|
if line_info.line.startswith(ESC_MAGIC2):
|
||||||
return line_info.line
|
return line_info.line
|
||||||
cmd = ' '.join([line_info.ifun, line_info.the_rest]).strip()
|
cmd = ' '.join([line_info.ifun, line_info.the_rest]).strip()
|
||||||
return tpl % (line_info.pre, cmd)
|
#Prepare arguments for get_ipython().run_line_magic(magic_name, magic_args)
|
||||||
|
t_magic_name, _, t_magic_arg_s = cmd.partition(' ')
|
||||||
|
t_magic_name = t_magic_name.lstrip(ESC_MAGIC)
|
||||||
|
return tpl % (line_info.pre, t_magic_name, t_magic_arg_s)
|
||||||
|
|
||||||
def _tr_quote(line_info):
|
def _tr_quote(line_info):
|
||||||
"Translate lines escaped with: ,"
|
"Translate lines escaped with: ,"
|
||||||
@ -450,13 +456,13 @@ def classic_prompt():
|
|||||||
# FIXME: non-capturing version (?:...) usable?
|
# FIXME: non-capturing version (?:...) usable?
|
||||||
prompt_re = re.compile(r'^(>>>|\.\.\.)( |$)')
|
prompt_re = re.compile(r'^(>>>|\.\.\.)( |$)')
|
||||||
initial_re = re.compile(r'^>>>( |$)')
|
initial_re = re.compile(r'^>>>( |$)')
|
||||||
# Any %magic/!system is IPython syntax, so we needn't look for >>> prompts
|
# Any %magic/!system is yap_ipython syntax, so we needn't look for >>> prompts
|
||||||
turnoff_re = re.compile(r'^[%!]')
|
turnoff_re = re.compile(r'^[%!]')
|
||||||
return _strip_prompts(prompt_re, initial_re, turnoff_re)
|
return _strip_prompts(prompt_re, initial_re, turnoff_re)
|
||||||
|
|
||||||
@CoroutineInputTransformer.wrap
|
@CoroutineInputTransformer.wrap
|
||||||
def ipy_prompt():
|
def ipy_prompt():
|
||||||
"""Strip IPython's In [1]:/...: prompts."""
|
"""Strip yap_ipython's In [1]:/...: prompts."""
|
||||||
# FIXME: non-capturing version (?:...) usable?
|
# FIXME: non-capturing version (?:...) usable?
|
||||||
prompt_re = re.compile(r'^(In \[\d+\]: |\s*\.{3,}: ?)')
|
prompt_re = re.compile(r'^(In \[\d+\]: |\s*\.{3,}: ?)')
|
||||||
# Disable prompt stripping inside cell magics
|
# Disable prompt stripping inside cell magics
|
||||||
@ -514,12 +520,15 @@ def assign_from_system(line):
|
|||||||
return assign_system_template % m.group('lhs', 'cmd')
|
return assign_system_template % m.group('lhs', 'cmd')
|
||||||
|
|
||||||
assign_magic_re = re.compile(r'{}%\s*(?P<cmd>.*)'.format(_assign_pat), re.VERBOSE)
|
assign_magic_re = re.compile(r'{}%\s*(?P<cmd>.*)'.format(_assign_pat), re.VERBOSE)
|
||||||
assign_magic_template = '%s = get_ipython().magic(%r)'
|
assign_magic_template = '%s = get_ipython().run_line_magic(%r, %r)'
|
||||||
@StatelessInputTransformer.wrap
|
@StatelessInputTransformer.wrap
|
||||||
def assign_from_magic(line):
|
def assign_from_magic(line):
|
||||||
"""Transform assignment from magic commands (e.g. a = %who_ls)"""
|
"""Transform assignment from magic commands (e.g. a = %who_ls)"""
|
||||||
m = assign_magic_re.match(line)
|
m = assign_magic_re.match(line)
|
||||||
if m is None:
|
if m is None:
|
||||||
return line
|
return line
|
||||||
|
#Prepare arguments for get_ipython().run_line_magic(magic_name, magic_args)
|
||||||
return assign_magic_template % m.group('lhs', 'cmd')
|
m_lhs, m_cmd = m.group('lhs', 'cmd')
|
||||||
|
t_magic_name, _, t_magic_arg_s = m_cmd.partition(' ')
|
||||||
|
t_magic_name = t_magic_name.lstrip(ESC_MAGIC)
|
||||||
|
return assign_magic_template % (m_lhs, t_magic_name, t_magic_arg_s)
|
File diff suppressed because it is too large
Load Diff
1300
packages/python/yap_kernel/yap_ipython/core/latex_symbols.py
Normal file
1300
packages/python/yap_kernel/yap_ipython/core/latex_symbols.py
Normal file
File diff suppressed because it is too large
Load Diff
218
packages/python/yap_kernel/yap_ipython/core/logger.py
Normal file
218
packages/python/yap_kernel/yap_ipython/core/logger.py
Normal file
@ -0,0 +1,218 @@
|
|||||||
|
"""Logger class for yap_ipython's logging facilities.
|
||||||
|
"""
|
||||||
|
|
||||||
|
#*****************************************************************************
|
||||||
|
# Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and
|
||||||
|
# Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu>
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
|
# the file COPYING, distributed as part of this software.
|
||||||
|
#*****************************************************************************
|
||||||
|
|
||||||
|
#****************************************************************************
|
||||||
|
# Modules and globals
|
||||||
|
|
||||||
|
# Python standard modules
|
||||||
|
import glob
|
||||||
|
import io
|
||||||
|
import os
|
||||||
|
import time
|
||||||
|
|
||||||
|
|
||||||
|
#****************************************************************************
|
||||||
|
# FIXME: This class isn't a mixin anymore, but it still needs attributes from
|
||||||
|
# ipython and does input cache management. Finish cleanup later...
|
||||||
|
|
||||||
|
class Logger(object):
|
||||||
|
"""A Logfile class with different policies for file creation"""
|
||||||
|
|
||||||
|
def __init__(self, home_dir, logfname='Logger.log', loghead=u'',
|
||||||
|
logmode='over'):
|
||||||
|
|
||||||
|
# this is the full ipython instance, we need some attributes from it
|
||||||
|
# which won't exist until later. What a mess, clean up later...
|
||||||
|
self.home_dir = home_dir
|
||||||
|
|
||||||
|
self.logfname = logfname
|
||||||
|
self.loghead = loghead
|
||||||
|
self.logmode = logmode
|
||||||
|
self.logfile = None
|
||||||
|
|
||||||
|
# Whether to log raw or processed input
|
||||||
|
self.log_raw_input = False
|
||||||
|
|
||||||
|
# whether to also log output
|
||||||
|
self.log_output = False
|
||||||
|
|
||||||
|
# whether to put timestamps before each log entry
|
||||||
|
self.timestamp = False
|
||||||
|
|
||||||
|
# activity control flags
|
||||||
|
self.log_active = False
|
||||||
|
|
||||||
|
# logmode is a validated property
|
||||||
|
def _set_mode(self,mode):
|
||||||
|
if mode not in ['append','backup','global','over','rotate']:
|
||||||
|
raise ValueError('invalid log mode %s given' % mode)
|
||||||
|
self._logmode = mode
|
||||||
|
|
||||||
|
def _get_mode(self):
|
||||||
|
return self._logmode
|
||||||
|
|
||||||
|
logmode = property(_get_mode,_set_mode)
|
||||||
|
|
||||||
|
def logstart(self, logfname=None, loghead=None, logmode=None,
|
||||||
|
log_output=False, timestamp=False, log_raw_input=False):
|
||||||
|
"""Generate a new log-file with a default header.
|
||||||
|
|
||||||
|
Raises RuntimeError if the log has already been started"""
|
||||||
|
|
||||||
|
if self.logfile is not None:
|
||||||
|
raise RuntimeError('Log file is already active: %s' %
|
||||||
|
self.logfname)
|
||||||
|
|
||||||
|
# The parameters can override constructor defaults
|
||||||
|
if logfname is not None: self.logfname = logfname
|
||||||
|
if loghead is not None: self.loghead = loghead
|
||||||
|
if logmode is not None: self.logmode = logmode
|
||||||
|
|
||||||
|
# Parameters not part of the constructor
|
||||||
|
self.timestamp = timestamp
|
||||||
|
self.log_output = log_output
|
||||||
|
self.log_raw_input = log_raw_input
|
||||||
|
|
||||||
|
# init depending on the log mode requested
|
||||||
|
isfile = os.path.isfile
|
||||||
|
logmode = self.logmode
|
||||||
|
|
||||||
|
if logmode == 'append':
|
||||||
|
self.logfile = io.open(self.logfname, 'a', encoding='utf-8')
|
||||||
|
|
||||||
|
elif logmode == 'backup':
|
||||||
|
if isfile(self.logfname):
|
||||||
|
backup_logname = self.logfname+'~'
|
||||||
|
# Manually remove any old backup, since os.rename may fail
|
||||||
|
# under Windows.
|
||||||
|
if isfile(backup_logname):
|
||||||
|
os.remove(backup_logname)
|
||||||
|
os.rename(self.logfname,backup_logname)
|
||||||
|
self.logfile = io.open(self.logfname, 'w', encoding='utf-8')
|
||||||
|
|
||||||
|
elif logmode == 'global':
|
||||||
|
self.logfname = os.path.join(self.home_dir,self.logfname)
|
||||||
|
self.logfile = io.open(self.logfname, 'a', encoding='utf-8')
|
||||||
|
|
||||||
|
elif logmode == 'over':
|
||||||
|
if isfile(self.logfname):
|
||||||
|
os.remove(self.logfname)
|
||||||
|
self.logfile = io.open(self.logfname,'w', encoding='utf-8')
|
||||||
|
|
||||||
|
elif logmode == 'rotate':
|
||||||
|
if isfile(self.logfname):
|
||||||
|
if isfile(self.logfname+'.001~'):
|
||||||
|
old = glob.glob(self.logfname+'.*~')
|
||||||
|
old.sort()
|
||||||
|
old.reverse()
|
||||||
|
for f in old:
|
||||||
|
root, ext = os.path.splitext(f)
|
||||||
|
num = int(ext[1:-1])+1
|
||||||
|
os.rename(f, root+'.'+repr(num).zfill(3)+'~')
|
||||||
|
os.rename(self.logfname, self.logfname+'.001~')
|
||||||
|
self.logfile = io.open(self.logfname, 'w', encoding='utf-8')
|
||||||
|
|
||||||
|
if logmode != 'append':
|
||||||
|
self.logfile.write(self.loghead)
|
||||||
|
|
||||||
|
self.logfile.flush()
|
||||||
|
self.log_active = True
|
||||||
|
|
||||||
|
def switch_log(self,val):
|
||||||
|
"""Switch logging on/off. val should be ONLY a boolean."""
|
||||||
|
|
||||||
|
if val not in [False,True,0,1]:
|
||||||
|
raise ValueError('Call switch_log ONLY with a boolean argument, '
|
||||||
|
'not with: %s' % val)
|
||||||
|
|
||||||
|
label = {0:'OFF',1:'ON',False:'OFF',True:'ON'}
|
||||||
|
|
||||||
|
if self.logfile is None:
|
||||||
|
print("""
|
||||||
|
Logging hasn't been started yet (use logstart for that).
|
||||||
|
|
||||||
|
%logon/%logoff are for temporarily starting and stopping logging for a logfile
|
||||||
|
which already exists. But you must first start the logging process with
|
||||||
|
%logstart (optionally giving a logfile name).""")
|
||||||
|
|
||||||
|
else:
|
||||||
|
if self.log_active == val:
|
||||||
|
print('Logging is already',label[val])
|
||||||
|
else:
|
||||||
|
print('Switching logging',label[val])
|
||||||
|
self.log_active = not self.log_active
|
||||||
|
self.log_active_out = self.log_active
|
||||||
|
|
||||||
|
def logstate(self):
|
||||||
|
"""Print a status message about the logger."""
|
||||||
|
if self.logfile is None:
|
||||||
|
print('Logging has not been activated.')
|
||||||
|
else:
|
||||||
|
state = self.log_active and 'active' or 'temporarily suspended'
|
||||||
|
print('Filename :', self.logfname)
|
||||||
|
print('Mode :', self.logmode)
|
||||||
|
print('Output logging :', self.log_output)
|
||||||
|
print('Raw input log :', self.log_raw_input)
|
||||||
|
print('Timestamping :', self.timestamp)
|
||||||
|
print('State :', state)
|
||||||
|
|
||||||
|
def log(self, line_mod, line_ori):
|
||||||
|
"""Write the sources to a log.
|
||||||
|
|
||||||
|
Inputs:
|
||||||
|
|
||||||
|
- line_mod: possibly modified input, such as the transformations made
|
||||||
|
by input prefilters or input handlers of various kinds. This should
|
||||||
|
always be valid Python.
|
||||||
|
|
||||||
|
- line_ori: unmodified input line from the user. This is not
|
||||||
|
necessarily valid Python.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Write the log line, but decide which one according to the
|
||||||
|
# log_raw_input flag, set when the log is started.
|
||||||
|
if self.log_raw_input:
|
||||||
|
self.log_write(line_ori)
|
||||||
|
else:
|
||||||
|
self.log_write(line_mod)
|
||||||
|
|
||||||
|
def log_write(self, data, kind='input'):
|
||||||
|
"""Write data to the log file, if active"""
|
||||||
|
|
||||||
|
#print 'data: %r' % data # dbg
|
||||||
|
if self.log_active and data:
|
||||||
|
write = self.logfile.write
|
||||||
|
if kind=='input':
|
||||||
|
if self.timestamp:
|
||||||
|
write(time.strftime('# %a, %d %b %Y %H:%M:%S\n', time.localtime()))
|
||||||
|
write(data)
|
||||||
|
elif kind=='output' and self.log_output:
|
||||||
|
odata = u'\n'.join([u'#[Out]# %s' % s
|
||||||
|
for s in data.splitlines()])
|
||||||
|
write(u'%s\n' % odata)
|
||||||
|
self.logfile.flush()
|
||||||
|
|
||||||
|
def logstop(self):
|
||||||
|
"""Fully stop logging and close log file.
|
||||||
|
|
||||||
|
In order to start logging again, a new logstart() call needs to be
|
||||||
|
made, possibly (though not necessarily) with a new filename, mode and
|
||||||
|
other options."""
|
||||||
|
|
||||||
|
if self.logfile is not None:
|
||||||
|
self.logfile.close()
|
||||||
|
self.logfile = None
|
||||||
|
else:
|
||||||
|
print("Logging hadn't been started.")
|
||||||
|
self.log_active = False
|
||||||
|
|
||||||
|
# For backwards compatibility, in case anyone was using this.
|
||||||
|
close_log = logstop
|
53
packages/python/yap_kernel/yap_ipython/core/macro.py
Normal file
53
packages/python/yap_kernel/yap_ipython/core/macro.py
Normal file
@ -0,0 +1,53 @@
|
|||||||
|
"""Support for interactive macros in yap_ipython"""
|
||||||
|
|
||||||
|
#*****************************************************************************
|
||||||
|
# Copyright (C) 2001-2005 Fernando Perez <fperez@colorado.edu>
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
|
# the file COPYING, distributed as part of this software.
|
||||||
|
#*****************************************************************************
|
||||||
|
|
||||||
|
import re
|
||||||
|
|
||||||
|
from yap_ipython.utils.encoding import DEFAULT_ENCODING
|
||||||
|
|
||||||
|
coding_declaration = re.compile(r"#\s*coding[:=]\s*([-\w.]+)")
|
||||||
|
|
||||||
|
class Macro(object):
|
||||||
|
"""Simple class to store the value of macros as strings.
|
||||||
|
|
||||||
|
Macro is just a callable that executes a string of yap_ipython
|
||||||
|
input when called.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self,code):
|
||||||
|
"""store the macro value, as a single string which can be executed"""
|
||||||
|
lines = []
|
||||||
|
enc = None
|
||||||
|
for line in code.splitlines():
|
||||||
|
coding_match = coding_declaration.match(line)
|
||||||
|
if coding_match:
|
||||||
|
enc = coding_match.group(1)
|
||||||
|
else:
|
||||||
|
lines.append(line)
|
||||||
|
code = "\n".join(lines)
|
||||||
|
if isinstance(code, bytes):
|
||||||
|
code = code.decode(enc or DEFAULT_ENCODING)
|
||||||
|
self.value = code + '\n'
|
||||||
|
|
||||||
|
def __str__(self):
|
||||||
|
return self.value
|
||||||
|
|
||||||
|
def __repr__(self):
|
||||||
|
return 'yap_ipython.macro.Macro(%s)' % repr(self.value)
|
||||||
|
|
||||||
|
def __getstate__(self):
|
||||||
|
""" needed for safe pickling via %store """
|
||||||
|
return {'value': self.value}
|
||||||
|
|
||||||
|
def __add__(self, other):
|
||||||
|
if isinstance(other, Macro):
|
||||||
|
return Macro(self.value + other.value)
|
||||||
|
elif isinstance(other, str):
|
||||||
|
return Macro(self.value + other)
|
||||||
|
raise TypeError
|
684
packages/python/yap_kernel/yap_ipython/core/magic.py
Normal file
684
packages/python/yap_kernel/yap_ipython/core/magic.py
Normal file
@ -0,0 +1,684 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""Magic functions for InteractiveShell.
|
||||||
|
"""
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and
|
||||||
|
# Copyright (C) 2001 Fernando Perez <fperez@colorado.edu>
|
||||||
|
# Copyright (C) 2008 The yap_ipython Development Team
|
||||||
|
|
||||||
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
|
# the file COPYING, distributed as part of this software.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
import os
|
||||||
|
import re
|
||||||
|
import sys
|
||||||
|
from getopt import getopt, GetoptError
|
||||||
|
|
||||||
|
from traitlets.config.configurable import Configurable
|
||||||
|
from yap_ipython.core import oinspect
|
||||||
|
from yap_ipython.core.error import UsageError
|
||||||
|
from yap_ipython.core.inputsplitter import ESC_MAGIC, ESC_MAGIC2
|
||||||
|
from decorator import decorator
|
||||||
|
from yap_ipython.utils.ipstruct import Struct
|
||||||
|
from yap_ipython.utils.process import arg_split
|
||||||
|
from yap_ipython.utils.text import dedent
|
||||||
|
from traitlets import Bool, Dict, Instance, observe
|
||||||
|
from logging import error
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Globals
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
# A dict we'll use for each class that has magics, used as temporary storage to
|
||||||
|
# pass information between the @line/cell_magic method decorators and the
|
||||||
|
# @magics_class class decorator, because the method decorators have no
|
||||||
|
# access to the class when they run. See for more details:
|
||||||
|
# http://stackoverflow.com/questions/2366713/can-a-python-decorator-of-an-instance-method-access-the-class
|
||||||
|
|
||||||
|
magics = dict(line={}, cell={})
|
||||||
|
|
||||||
|
magic_kinds = ('line', 'cell')
|
||||||
|
magic_spec = ('line', 'cell', 'line_cell')
|
||||||
|
magic_escapes = dict(line=ESC_MAGIC, cell=ESC_MAGIC2)
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Utility classes and functions
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
class Bunch: pass
|
||||||
|
|
||||||
|
|
||||||
|
def on_off(tag):
|
||||||
|
"""Return an ON/OFF string for a 1/0 input. Simple utility function."""
|
||||||
|
return ['OFF','ON'][tag]
|
||||||
|
|
||||||
|
|
||||||
|
def compress_dhist(dh):
|
||||||
|
"""Compress a directory history into a new one with at most 20 entries.
|
||||||
|
|
||||||
|
Return a new list made from the first and last 10 elements of dhist after
|
||||||
|
removal of duplicates.
|
||||||
|
"""
|
||||||
|
head, tail = dh[:-10], dh[-10:]
|
||||||
|
|
||||||
|
newhead = []
|
||||||
|
done = set()
|
||||||
|
for h in head:
|
||||||
|
if h in done:
|
||||||
|
continue
|
||||||
|
newhead.append(h)
|
||||||
|
done.add(h)
|
||||||
|
|
||||||
|
return newhead + tail
|
||||||
|
|
||||||
|
|
||||||
|
def needs_local_scope(func):
|
||||||
|
"""Decorator to mark magic functions which need to local scope to run."""
|
||||||
|
func.needs_local_scope = True
|
||||||
|
return func
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Class and method decorators for registering magics
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
def magics_class(cls):
|
||||||
|
"""Class decorator for all subclasses of the main Magics class.
|
||||||
|
|
||||||
|
Any class that subclasses Magics *must* also apply this decorator, to
|
||||||
|
ensure that all the methods that have been decorated as line/cell magics
|
||||||
|
get correctly registered in the class instance. This is necessary because
|
||||||
|
when method decorators run, the class does not exist yet, so they
|
||||||
|
temporarily store their information into a module global. Application of
|
||||||
|
this class decorator copies that global data to the class instance and
|
||||||
|
clears the global.
|
||||||
|
|
||||||
|
Obviously, this mechanism is not thread-safe, which means that the
|
||||||
|
*creation* of subclasses of Magic should only be done in a single-thread
|
||||||
|
context. Instantiation of the classes has no restrictions. Given that
|
||||||
|
these classes are typically created at yap_ipython startup time and before user
|
||||||
|
application code becomes active, in practice this should not pose any
|
||||||
|
problems.
|
||||||
|
"""
|
||||||
|
cls.registered = True
|
||||||
|
cls.magics = dict(line = magics['line'],
|
||||||
|
cell = magics['cell'])
|
||||||
|
magics['line'] = {}
|
||||||
|
magics['cell'] = {}
|
||||||
|
return cls
|
||||||
|
|
||||||
|
|
||||||
|
def record_magic(dct, magic_kind, magic_name, func):
|
||||||
|
"""Utility function to store a function as a magic of a specific kind.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
dct : dict
|
||||||
|
A dictionary with 'line' and 'cell' subdicts.
|
||||||
|
|
||||||
|
magic_kind : str
|
||||||
|
Kind of magic to be stored.
|
||||||
|
|
||||||
|
magic_name : str
|
||||||
|
Key to store the magic as.
|
||||||
|
|
||||||
|
func : function
|
||||||
|
Callable object to store.
|
||||||
|
"""
|
||||||
|
if magic_kind == 'line_cell':
|
||||||
|
dct['line'][magic_name] = dct['cell'][magic_name] = func
|
||||||
|
else:
|
||||||
|
dct[magic_kind][magic_name] = func
|
||||||
|
|
||||||
|
|
||||||
|
def validate_type(magic_kind):
|
||||||
|
"""Ensure that the given magic_kind is valid.
|
||||||
|
|
||||||
|
Check that the given magic_kind is one of the accepted spec types (stored
|
||||||
|
in the global `magic_spec`), raise ValueError otherwise.
|
||||||
|
"""
|
||||||
|
if magic_kind not in magic_spec:
|
||||||
|
raise ValueError('magic_kind must be one of %s, %s given' %
|
||||||
|
magic_kinds, magic_kind)
|
||||||
|
|
||||||
|
|
||||||
|
# The docstrings for the decorator below will be fairly similar for the two
|
||||||
|
# types (method and function), so we generate them here once and reuse the
|
||||||
|
# templates below.
|
||||||
|
_docstring_template = \
|
||||||
|
"""Decorate the given {0} as {1} magic.
|
||||||
|
|
||||||
|
The decorator can be used with or without arguments, as follows.
|
||||||
|
|
||||||
|
i) without arguments: it will create a {1} magic named as the {0} being
|
||||||
|
decorated::
|
||||||
|
|
||||||
|
@deco
|
||||||
|
def foo(...)
|
||||||
|
|
||||||
|
will create a {1} magic named `foo`.
|
||||||
|
|
||||||
|
ii) with one string argument: which will be used as the actual name of the
|
||||||
|
resulting magic::
|
||||||
|
|
||||||
|
@deco('bar')
|
||||||
|
def foo(...)
|
||||||
|
|
||||||
|
will create a {1} magic named `bar`.
|
||||||
|
|
||||||
|
To register a class magic use ``Interactiveshell.register_magic(class or instance)``.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# These two are decorator factories. While they are conceptually very similar,
|
||||||
|
# there are enough differences in the details that it's simpler to have them
|
||||||
|
# written as completely standalone functions rather than trying to share code
|
||||||
|
# and make a single one with convoluted logic.
|
||||||
|
|
||||||
|
def _method_magic_marker(magic_kind):
|
||||||
|
"""Decorator factory for methods in Magics subclasses.
|
||||||
|
"""
|
||||||
|
|
||||||
|
validate_type(magic_kind)
|
||||||
|
|
||||||
|
# This is a closure to capture the magic_kind. We could also use a class,
|
||||||
|
# but it's overkill for just that one bit of state.
|
||||||
|
def magic_deco(arg):
|
||||||
|
call = lambda f, *a, **k: f(*a, **k)
|
||||||
|
|
||||||
|
if callable(arg):
|
||||||
|
# "Naked" decorator call (just @foo, no args)
|
||||||
|
func = arg
|
||||||
|
name = func.__name__
|
||||||
|
retval = decorator(call, func)
|
||||||
|
record_magic(magics, magic_kind, name, name)
|
||||||
|
elif isinstance(arg, str):
|
||||||
|
# Decorator called with arguments (@foo('bar'))
|
||||||
|
name = arg
|
||||||
|
def mark(func, *a, **kw):
|
||||||
|
record_magic(magics, magic_kind, name, func.__name__)
|
||||||
|
return decorator(call, func)
|
||||||
|
retval = mark
|
||||||
|
else:
|
||||||
|
raise TypeError("Decorator can only be called with "
|
||||||
|
"string or function")
|
||||||
|
return retval
|
||||||
|
|
||||||
|
# Ensure the resulting decorator has a usable docstring
|
||||||
|
magic_deco.__doc__ = _docstring_template.format('method', magic_kind)
|
||||||
|
return magic_deco
|
||||||
|
|
||||||
|
|
||||||
|
def _function_magic_marker(magic_kind):
|
||||||
|
"""Decorator factory for standalone functions.
|
||||||
|
"""
|
||||||
|
validate_type(magic_kind)
|
||||||
|
|
||||||
|
# This is a closure to capture the magic_kind. We could also use a class,
|
||||||
|
# but it's overkill for just that one bit of state.
|
||||||
|
def magic_deco(arg):
|
||||||
|
call = lambda f, *a, **k: f(*a, **k)
|
||||||
|
|
||||||
|
# Find get_ipython() in the caller's namespace
|
||||||
|
caller = sys._getframe(1)
|
||||||
|
for ns in ['f_locals', 'f_globals', 'f_builtins']:
|
||||||
|
get_ipython = getattr(caller, ns).get('get_ipython')
|
||||||
|
if get_ipython is not None:
|
||||||
|
break
|
||||||
|
else:
|
||||||
|
raise NameError('Decorator can only run in context where '
|
||||||
|
'`get_ipython` exists')
|
||||||
|
|
||||||
|
ip = get_ipython()
|
||||||
|
|
||||||
|
if callable(arg):
|
||||||
|
# "Naked" decorator call (just @foo, no args)
|
||||||
|
func = arg
|
||||||
|
name = func.__name__
|
||||||
|
ip.register_magic_function(func, magic_kind, name)
|
||||||
|
retval = decorator(call, func)
|
||||||
|
elif isinstance(arg, str):
|
||||||
|
# Decorator called with arguments (@foo('bar'))
|
||||||
|
name = arg
|
||||||
|
def mark(func, *a, **kw):
|
||||||
|
ip.register_magic_function(func, magic_kind, name)
|
||||||
|
return decorator(call, func)
|
||||||
|
retval = mark
|
||||||
|
else:
|
||||||
|
raise TypeError("Decorator can only be called with "
|
||||||
|
"string or function")
|
||||||
|
return retval
|
||||||
|
|
||||||
|
# Ensure the resulting decorator has a usable docstring
|
||||||
|
ds = _docstring_template.format('function', magic_kind)
|
||||||
|
|
||||||
|
ds += dedent("""
|
||||||
|
Note: this decorator can only be used in a context where yap_ipython is already
|
||||||
|
active, so that the `get_ipython()` call succeeds. You can therefore use
|
||||||
|
it in your startup files loaded after yap_ipython initializes, but *not* in the
|
||||||
|
yap_ipython configuration file itself, which is executed before yap_ipython is
|
||||||
|
fully up and running. Any file located in the `startup` subdirectory of
|
||||||
|
your configuration profile will be OK in this sense.
|
||||||
|
""")
|
||||||
|
|
||||||
|
magic_deco.__doc__ = ds
|
||||||
|
return magic_deco
|
||||||
|
|
||||||
|
|
||||||
|
# Create the actual decorators for public use
|
||||||
|
|
||||||
|
# These three are used to decorate methods in class definitions
|
||||||
|
line_magic = _method_magic_marker('line')
|
||||||
|
cell_magic = _method_magic_marker('cell')
|
||||||
|
line_cell_magic = _method_magic_marker('line_cell')
|
||||||
|
|
||||||
|
# These three decorate standalone functions and perform the decoration
|
||||||
|
# immediately. They can only run where get_ipython() works
|
||||||
|
register_line_magic = _function_magic_marker('line')
|
||||||
|
register_cell_magic = _function_magic_marker('cell')
|
||||||
|
register_line_cell_magic = _function_magic_marker('line_cell')
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Core Magic classes
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
class MagicsManager(Configurable):
|
||||||
|
"""Object that handles all magic-related functionality for yap_ipython.
|
||||||
|
"""
|
||||||
|
# Non-configurable class attributes
|
||||||
|
|
||||||
|
# A two-level dict, first keyed by magic type, then by magic function, and
|
||||||
|
# holding the actual callable object as value. This is the dict used for
|
||||||
|
# magic function dispatch
|
||||||
|
magics = Dict()
|
||||||
|
|
||||||
|
# A registry of the original objects that we've been given holding magics.
|
||||||
|
registry = Dict()
|
||||||
|
|
||||||
|
shell = Instance('yap_ipython.core.interactiveshell.InteractiveShellABC', allow_none=True)
|
||||||
|
|
||||||
|
auto_magic = Bool(True, help=
|
||||||
|
"Automatically call line magics without requiring explicit % prefix"
|
||||||
|
).tag(config=True)
|
||||||
|
@observe('auto_magic')
|
||||||
|
def _auto_magic_changed(self, change):
|
||||||
|
self.shell.automagic = change['new']
|
||||||
|
|
||||||
|
_auto_status = [
|
||||||
|
'Automagic is OFF, % prefix IS needed for line magics.',
|
||||||
|
'Automagic is ON, % prefix IS NOT needed for line magics.']
|
||||||
|
|
||||||
|
user_magics = Instance('yap_ipython.core.magics.UserMagics', allow_none=True)
|
||||||
|
|
||||||
|
def __init__(self, shell=None, config=None, user_magics=None, **traits):
|
||||||
|
|
||||||
|
super(MagicsManager, self).__init__(shell=shell, config=config,
|
||||||
|
user_magics=user_magics, **traits)
|
||||||
|
self.magics = dict(line={}, cell={})
|
||||||
|
# Let's add the user_magics to the registry for uniformity, so *all*
|
||||||
|
# registered magic containers can be found there.
|
||||||
|
self.registry[user_magics.__class__.__name__] = user_magics
|
||||||
|
|
||||||
|
def auto_status(self):
|
||||||
|
"""Return descriptive string with automagic status."""
|
||||||
|
return self._auto_status[self.auto_magic]
|
||||||
|
|
||||||
|
def lsmagic(self):
|
||||||
|
"""Return a dict of currently available magic functions.
|
||||||
|
|
||||||
|
The return dict has the keys 'line' and 'cell', corresponding to the
|
||||||
|
two types of magics we support. Each value is a list of names.
|
||||||
|
"""
|
||||||
|
return self.magics
|
||||||
|
|
||||||
|
def lsmagic_docs(self, brief=False, missing=''):
|
||||||
|
"""Return dict of documentation of magic functions.
|
||||||
|
|
||||||
|
The return dict has the keys 'line' and 'cell', corresponding to the
|
||||||
|
two types of magics we support. Each value is a dict keyed by magic
|
||||||
|
name whose value is the function docstring. If a docstring is
|
||||||
|
unavailable, the value of `missing` is used instead.
|
||||||
|
|
||||||
|
If brief is True, only the first line of each docstring will be returned.
|
||||||
|
"""
|
||||||
|
docs = {}
|
||||||
|
for m_type in self.magics:
|
||||||
|
m_docs = {}
|
||||||
|
for m_name, m_func in self.magics[m_type].items():
|
||||||
|
if m_func.__doc__:
|
||||||
|
if brief:
|
||||||
|
m_docs[m_name] = m_func.__doc__.split('\n', 1)[0]
|
||||||
|
else:
|
||||||
|
m_docs[m_name] = m_func.__doc__.rstrip()
|
||||||
|
else:
|
||||||
|
m_docs[m_name] = missing
|
||||||
|
docs[m_type] = m_docs
|
||||||
|
return docs
|
||||||
|
|
||||||
|
def register(self, *magic_objects):
|
||||||
|
"""Register one or more instances of Magics.
|
||||||
|
|
||||||
|
Take one or more classes or instances of classes that subclass the main
|
||||||
|
`core.Magic` class, and register them with yap_ipython to use the magic
|
||||||
|
functions they provide. The registration process will then ensure that
|
||||||
|
any methods that have decorated to provide line and/or cell magics will
|
||||||
|
be recognized with the `%x`/`%%x` syntax as a line/cell magic
|
||||||
|
respectively.
|
||||||
|
|
||||||
|
If classes are given, they will be instantiated with the default
|
||||||
|
constructor. If your classes need a custom constructor, you should
|
||||||
|
instanitate them first and pass the instance.
|
||||||
|
|
||||||
|
The provided arguments can be an arbitrary mix of classes and instances.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
magic_objects : one or more classes or instances
|
||||||
|
"""
|
||||||
|
# Start by validating them to ensure they have all had their magic
|
||||||
|
# methods registered at the instance level
|
||||||
|
for m in magic_objects:
|
||||||
|
if not m.registered:
|
||||||
|
raise ValueError("Class of magics %r was constructed without "
|
||||||
|
"the @register_magics class decorator")
|
||||||
|
if isinstance(m, type):
|
||||||
|
# If we're given an uninstantiated class
|
||||||
|
m = m(shell=self.shell)
|
||||||
|
|
||||||
|
# Now that we have an instance, we can register it and update the
|
||||||
|
# table of callables
|
||||||
|
self.registry[m.__class__.__name__] = m
|
||||||
|
for mtype in magic_kinds:
|
||||||
|
self.magics[mtype].update(m.magics[mtype])
|
||||||
|
|
||||||
|
def register_function(self, func, magic_kind='line', magic_name=None):
|
||||||
|
"""Expose a standalone function as magic function for yap_ipython.
|
||||||
|
|
||||||
|
This will create an yap_ipython magic (line, cell or both) from a
|
||||||
|
standalone function. The functions should have the following
|
||||||
|
signatures:
|
||||||
|
|
||||||
|
* For line magics: `def f(line)`
|
||||||
|
* For cell magics: `def f(line, cell)`
|
||||||
|
* For a function that does both: `def f(line, cell=None)`
|
||||||
|
|
||||||
|
In the latter case, the function will be called with `cell==None` when
|
||||||
|
invoked as `%f`, and with cell as a string when invoked as `%%f`.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
func : callable
|
||||||
|
Function to be registered as a magic.
|
||||||
|
|
||||||
|
magic_kind : str
|
||||||
|
Kind of magic, one of 'line', 'cell' or 'line_cell'
|
||||||
|
|
||||||
|
magic_name : optional str
|
||||||
|
If given, the name the magic will have in the yap_ipython namespace. By
|
||||||
|
default, the name of the function itself is used.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Create the new method in the user_magics and register it in the
|
||||||
|
# global table
|
||||||
|
validate_type(magic_kind)
|
||||||
|
magic_name = func.__name__ if magic_name is None else magic_name
|
||||||
|
setattr(self.user_magics, magic_name, func)
|
||||||
|
record_magic(self.magics, magic_kind, magic_name, func)
|
||||||
|
|
||||||
|
def register_alias(self, alias_name, magic_name, magic_kind='line', magic_params=None):
|
||||||
|
"""Register an alias to a magic function.
|
||||||
|
|
||||||
|
The alias is an instance of :class:`MagicAlias`, which holds the
|
||||||
|
name and kind of the magic it should call. Binding is done at
|
||||||
|
call time, so if the underlying magic function is changed the alias
|
||||||
|
will call the new function.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
alias_name : str
|
||||||
|
The name of the magic to be registered.
|
||||||
|
|
||||||
|
magic_name : str
|
||||||
|
The name of an existing magic.
|
||||||
|
|
||||||
|
magic_kind : str
|
||||||
|
Kind of magic, one of 'line' or 'cell'
|
||||||
|
"""
|
||||||
|
|
||||||
|
# `validate_type` is too permissive, as it allows 'line_cell'
|
||||||
|
# which we do not handle.
|
||||||
|
if magic_kind not in magic_kinds:
|
||||||
|
raise ValueError('magic_kind must be one of %s, %s given' %
|
||||||
|
magic_kinds, magic_kind)
|
||||||
|
|
||||||
|
alias = MagicAlias(self.shell, magic_name, magic_kind, magic_params)
|
||||||
|
setattr(self.user_magics, alias_name, alias)
|
||||||
|
record_magic(self.magics, magic_kind, alias_name, alias)
|
||||||
|
|
||||||
|
# Key base class that provides the central functionality for magics.
|
||||||
|
|
||||||
|
|
||||||
|
class Magics(Configurable):
|
||||||
|
"""Base class for implementing magic functions.
|
||||||
|
|
||||||
|
Shell functions which can be reached as %function_name. All magic
|
||||||
|
functions should accept a string, which they can parse for their own
|
||||||
|
needs. This can make some functions easier to type, eg `%cd ../`
|
||||||
|
vs. `%cd("../")`
|
||||||
|
|
||||||
|
Classes providing magic functions need to subclass this class, and they
|
||||||
|
MUST:
|
||||||
|
|
||||||
|
- Use the method decorators `@line_magic` and `@cell_magic` to decorate
|
||||||
|
individual methods as magic functions, AND
|
||||||
|
|
||||||
|
- Use the class decorator `@magics_class` to ensure that the magic
|
||||||
|
methods are properly registered at the instance level upon instance
|
||||||
|
initialization.
|
||||||
|
|
||||||
|
See :mod:`magic_functions` for examples of actual implementation classes.
|
||||||
|
"""
|
||||||
|
# Dict holding all command-line options for each magic.
|
||||||
|
options_table = None
|
||||||
|
# Dict for the mapping of magic names to methods, set by class decorator
|
||||||
|
magics = None
|
||||||
|
# Flag to check that the class decorator was properly applied
|
||||||
|
registered = False
|
||||||
|
# Instance of yap_ipython shell
|
||||||
|
shell = None
|
||||||
|
|
||||||
|
def __init__(self, shell=None, **kwargs):
|
||||||
|
if not(self.__class__.registered):
|
||||||
|
raise ValueError('Magics subclass without registration - '
|
||||||
|
'did you forget to apply @magics_class?')
|
||||||
|
if shell is not None:
|
||||||
|
if hasattr(shell, 'configurables'):
|
||||||
|
shell.configurables.append(self)
|
||||||
|
if hasattr(shell, 'config'):
|
||||||
|
kwargs.setdefault('parent', shell)
|
||||||
|
|
||||||
|
self.shell = shell
|
||||||
|
self.options_table = {}
|
||||||
|
# The method decorators are run when the instance doesn't exist yet, so
|
||||||
|
# they can only record the names of the methods they are supposed to
|
||||||
|
# grab. Only now, that the instance exists, can we create the proper
|
||||||
|
# mapping to bound methods. So we read the info off the original names
|
||||||
|
# table and replace each method name by the actual bound method.
|
||||||
|
# But we mustn't clobber the *class* mapping, in case of multiple instances.
|
||||||
|
class_magics = self.magics
|
||||||
|
self.magics = {}
|
||||||
|
for mtype in magic_kinds:
|
||||||
|
tab = self.magics[mtype] = {}
|
||||||
|
cls_tab = class_magics[mtype]
|
||||||
|
for magic_name, meth_name in cls_tab.items():
|
||||||
|
if isinstance(meth_name, str):
|
||||||
|
# it's a method name, grab it
|
||||||
|
tab[magic_name] = getattr(self, meth_name)
|
||||||
|
else:
|
||||||
|
# it's the real thing
|
||||||
|
tab[magic_name] = meth_name
|
||||||
|
# Configurable **needs** to be initiated at the end or the config
|
||||||
|
# magics get screwed up.
|
||||||
|
super(Magics, self).__init__(**kwargs)
|
||||||
|
|
||||||
|
def arg_err(self,func):
|
||||||
|
"""Print docstring if incorrect arguments were passed"""
|
||||||
|
print('Error in arguments:')
|
||||||
|
print(oinspect.getdoc(func))
|
||||||
|
|
||||||
|
def format_latex(self, strng):
|
||||||
|
"""Format a string for latex inclusion."""
|
||||||
|
|
||||||
|
# Characters that need to be escaped for latex:
|
||||||
|
escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE)
|
||||||
|
# Magic command names as headers:
|
||||||
|
cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC,
|
||||||
|
re.MULTILINE)
|
||||||
|
# Magic commands
|
||||||
|
cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC,
|
||||||
|
re.MULTILINE)
|
||||||
|
# Paragraph continue
|
||||||
|
par_re = re.compile(r'\\$',re.MULTILINE)
|
||||||
|
|
||||||
|
# The "\n" symbol
|
||||||
|
newline_re = re.compile(r'\\n')
|
||||||
|
|
||||||
|
# Now build the string for output:
|
||||||
|
#strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng)
|
||||||
|
strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:',
|
||||||
|
strng)
|
||||||
|
strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng)
|
||||||
|
strng = par_re.sub(r'\\\\',strng)
|
||||||
|
strng = escape_re.sub(r'\\\1',strng)
|
||||||
|
strng = newline_re.sub(r'\\textbackslash{}n',strng)
|
||||||
|
return strng
|
||||||
|
|
||||||
|
def parse_options(self, arg_str, opt_str, *long_opts, **kw):
|
||||||
|
"""Parse options passed to an argument string.
|
||||||
|
|
||||||
|
The interface is similar to that of :func:`getopt.getopt`, but it
|
||||||
|
returns a :class:`~yap_ipython.utils.struct.Struct` with the options as keys
|
||||||
|
and the stripped argument string still as a string.
|
||||||
|
|
||||||
|
arg_str is quoted as a true sys.argv vector by using shlex.split.
|
||||||
|
This allows us to easily expand variables, glob files, quote
|
||||||
|
arguments, etc.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
|
||||||
|
arg_str : str
|
||||||
|
The arguments to parse.
|
||||||
|
|
||||||
|
opt_str : str
|
||||||
|
The options specification.
|
||||||
|
|
||||||
|
mode : str, default 'string'
|
||||||
|
If given as 'list', the argument string is returned as a list (split
|
||||||
|
on whitespace) instead of a string.
|
||||||
|
|
||||||
|
list_all : bool, default False
|
||||||
|
Put all option values in lists. Normally only options
|
||||||
|
appearing more than once are put in a list.
|
||||||
|
|
||||||
|
posix : bool, default True
|
||||||
|
Whether to split the input line in POSIX mode or not, as per the
|
||||||
|
conventions outlined in the :mod:`shlex` module from the standard
|
||||||
|
library.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# inject default options at the beginning of the input line
|
||||||
|
caller = sys._getframe(1).f_code.co_name
|
||||||
|
arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str)
|
||||||
|
|
||||||
|
mode = kw.get('mode','string')
|
||||||
|
if mode not in ['string','list']:
|
||||||
|
raise ValueError('incorrect mode given: %s' % mode)
|
||||||
|
# Get options
|
||||||
|
list_all = kw.get('list_all',0)
|
||||||
|
posix = kw.get('posix', os.name == 'posix')
|
||||||
|
strict = kw.get('strict', True)
|
||||||
|
|
||||||
|
# Check if we have more than one argument to warrant extra processing:
|
||||||
|
odict = {} # Dictionary with options
|
||||||
|
args = arg_str.split()
|
||||||
|
if len(args) >= 1:
|
||||||
|
# If the list of inputs only has 0 or 1 thing in it, there's no
|
||||||
|
# need to look for options
|
||||||
|
argv = arg_split(arg_str, posix, strict)
|
||||||
|
# Do regular option processing
|
||||||
|
try:
|
||||||
|
opts,args = getopt(argv, opt_str, long_opts)
|
||||||
|
except GetoptError as e:
|
||||||
|
raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str,
|
||||||
|
" ".join(long_opts)))
|
||||||
|
for o,a in opts:
|
||||||
|
if o.startswith('--'):
|
||||||
|
o = o[2:]
|
||||||
|
else:
|
||||||
|
o = o[1:]
|
||||||
|
try:
|
||||||
|
odict[o].append(a)
|
||||||
|
except AttributeError:
|
||||||
|
odict[o] = [odict[o],a]
|
||||||
|
except KeyError:
|
||||||
|
if list_all:
|
||||||
|
odict[o] = [a]
|
||||||
|
else:
|
||||||
|
odict[o] = a
|
||||||
|
|
||||||
|
# Prepare opts,args for return
|
||||||
|
opts = Struct(odict)
|
||||||
|
if mode == 'string':
|
||||||
|
args = ' '.join(args)
|
||||||
|
|
||||||
|
return opts,args
|
||||||
|
|
||||||
|
def default_option(self, fn, optstr):
|
||||||
|
"""Make an entry in the options_table for fn, with value optstr"""
|
||||||
|
|
||||||
|
if fn not in self.lsmagic():
|
||||||
|
error("%s is not a magic function" % fn)
|
||||||
|
self.options_table[fn] = optstr
|
||||||
|
|
||||||
|
|
||||||
|
class MagicAlias(object):
|
||||||
|
"""An alias to another magic function.
|
||||||
|
|
||||||
|
An alias is determined by its magic name and magic kind. Lookup
|
||||||
|
is done at call time, so if the underlying magic changes the alias
|
||||||
|
will call the new function.
|
||||||
|
|
||||||
|
Use the :meth:`MagicsManager.register_alias` method or the
|
||||||
|
`%alias_magic` magic function to create and register a new alias.
|
||||||
|
"""
|
||||||
|
def __init__(self, shell, magic_name, magic_kind, magic_params=None):
|
||||||
|
self.shell = shell
|
||||||
|
self.magic_name = magic_name
|
||||||
|
self.magic_params = magic_params
|
||||||
|
self.magic_kind = magic_kind
|
||||||
|
|
||||||
|
self.pretty_target = '%s%s' % (magic_escapes[self.magic_kind], self.magic_name)
|
||||||
|
self.__doc__ = "Alias for `%s`." % self.pretty_target
|
||||||
|
|
||||||
|
self._in_call = False
|
||||||
|
|
||||||
|
def __call__(self, *args, **kwargs):
|
||||||
|
"""Call the magic alias."""
|
||||||
|
fn = self.shell.find_magic(self.magic_name, self.magic_kind)
|
||||||
|
if fn is None:
|
||||||
|
raise UsageError("Magic `%s` not found." % self.pretty_target)
|
||||||
|
|
||||||
|
# Protect against infinite recursion.
|
||||||
|
if self._in_call:
|
||||||
|
raise UsageError("Infinite recursion detected; "
|
||||||
|
"magic aliases cannot call themselves.")
|
||||||
|
self._in_call = True
|
||||||
|
try:
|
||||||
|
if self.magic_params:
|
||||||
|
args_list = list(args)
|
||||||
|
args_list[0] = self.magic_params + " " + args[0]
|
||||||
|
args = tuple(args_list)
|
||||||
|
return fn(*args, **kwargs)
|
||||||
|
finally:
|
||||||
|
self._in_call = False
|
278
packages/python/yap_kernel/yap_ipython/core/magic_arguments.py
Normal file
278
packages/python/yap_kernel/yap_ipython/core/magic_arguments.py
Normal file
@ -0,0 +1,278 @@
|
|||||||
|
''' A decorator-based method of constructing yap_ipython magics with `argparse`
|
||||||
|
option handling.
|
||||||
|
|
||||||
|
New magic functions can be defined like so::
|
||||||
|
|
||||||
|
from yap_ipython.core.magic_arguments import (argument, magic_arguments,
|
||||||
|
parse_argstring)
|
||||||
|
|
||||||
|
@magic_arguments()
|
||||||
|
@argument('-o', '--option', help='An optional argument.')
|
||||||
|
@argument('arg', type=int, help='An integer positional argument.')
|
||||||
|
def magic_cool(self, arg):
|
||||||
|
""" A really cool magic command.
|
||||||
|
|
||||||
|
"""
|
||||||
|
args = parse_argstring(magic_cool, arg)
|
||||||
|
...
|
||||||
|
|
||||||
|
The `@magic_arguments` decorator marks the function as having argparse arguments.
|
||||||
|
The `@argument` decorator adds an argument using the same syntax as argparse's
|
||||||
|
`add_argument()` method. More sophisticated uses may also require the
|
||||||
|
`@argument_group` or `@kwds` decorator to customize the formatting and the
|
||||||
|
parsing.
|
||||||
|
|
||||||
|
Help text for the magic is automatically generated from the docstring and the
|
||||||
|
arguments::
|
||||||
|
|
||||||
|
In[1]: %cool?
|
||||||
|
%cool [-o OPTION] arg
|
||||||
|
|
||||||
|
A really cool magic command.
|
||||||
|
|
||||||
|
positional arguments:
|
||||||
|
arg An integer positional argument.
|
||||||
|
|
||||||
|
optional arguments:
|
||||||
|
-o OPTION, --option OPTION
|
||||||
|
An optional argument.
|
||||||
|
|
||||||
|
Inheritance diagram:
|
||||||
|
|
||||||
|
.. inheritance-diagram:: yap_ipython.core.magic_arguments
|
||||||
|
:parts: 3
|
||||||
|
|
||||||
|
'''
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2010-2011, yap_ipython Development Team.
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
#
|
||||||
|
# The full license is in the file COPYING.txt, distributed with this software.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
import argparse
|
||||||
|
import re
|
||||||
|
|
||||||
|
# Our own imports
|
||||||
|
from yap_ipython.core.error import UsageError
|
||||||
|
from yap_ipython.utils.decorators import undoc
|
||||||
|
from yap_ipython.utils.process import arg_split
|
||||||
|
from yap_ipython.utils.text import dedent
|
||||||
|
|
||||||
|
NAME_RE = re.compile(r"[a-zA-Z][a-zA-Z0-9_-]*$")
|
||||||
|
|
||||||
|
@undoc
|
||||||
|
class MagicHelpFormatter(argparse.RawDescriptionHelpFormatter):
|
||||||
|
"""A HelpFormatter with a couple of changes to meet our needs.
|
||||||
|
"""
|
||||||
|
# Modified to dedent text.
|
||||||
|
def _fill_text(self, text, width, indent):
|
||||||
|
return argparse.RawDescriptionHelpFormatter._fill_text(self, dedent(text), width, indent)
|
||||||
|
|
||||||
|
# Modified to wrap argument placeholders in <> where necessary.
|
||||||
|
def _format_action_invocation(self, action):
|
||||||
|
if not action.option_strings:
|
||||||
|
metavar, = self._metavar_formatter(action, action.dest)(1)
|
||||||
|
return metavar
|
||||||
|
|
||||||
|
else:
|
||||||
|
parts = []
|
||||||
|
|
||||||
|
# if the Optional doesn't take a value, format is:
|
||||||
|
# -s, --long
|
||||||
|
if action.nargs == 0:
|
||||||
|
parts.extend(action.option_strings)
|
||||||
|
|
||||||
|
# if the Optional takes a value, format is:
|
||||||
|
# -s ARGS, --long ARGS
|
||||||
|
else:
|
||||||
|
default = action.dest.upper()
|
||||||
|
args_string = self._format_args(action, default)
|
||||||
|
# IPYTHON MODIFICATION: If args_string is not a plain name, wrap
|
||||||
|
# it in <> so it's valid RST.
|
||||||
|
if not NAME_RE.match(args_string):
|
||||||
|
args_string = "<%s>" % args_string
|
||||||
|
for option_string in action.option_strings:
|
||||||
|
parts.append('%s %s' % (option_string, args_string))
|
||||||
|
|
||||||
|
return ', '.join(parts)
|
||||||
|
|
||||||
|
# Override the default prefix ('usage') to our % magic escape,
|
||||||
|
# in a code block.
|
||||||
|
def add_usage(self, usage, actions, groups, prefix="::\n\n %"):
|
||||||
|
super(MagicHelpFormatter, self).add_usage(usage, actions, groups, prefix)
|
||||||
|
|
||||||
|
class MagicArgumentParser(argparse.ArgumentParser):
|
||||||
|
""" An ArgumentParser tweaked for use by yap_ipython magics.
|
||||||
|
"""
|
||||||
|
def __init__(self,
|
||||||
|
prog=None,
|
||||||
|
usage=None,
|
||||||
|
description=None,
|
||||||
|
epilog=None,
|
||||||
|
parents=None,
|
||||||
|
formatter_class=MagicHelpFormatter,
|
||||||
|
prefix_chars='-',
|
||||||
|
argument_default=None,
|
||||||
|
conflict_handler='error',
|
||||||
|
add_help=False):
|
||||||
|
if parents is None:
|
||||||
|
parents = []
|
||||||
|
super(MagicArgumentParser, self).__init__(prog=prog, usage=usage,
|
||||||
|
description=description, epilog=epilog,
|
||||||
|
parents=parents, formatter_class=formatter_class,
|
||||||
|
prefix_chars=prefix_chars, argument_default=argument_default,
|
||||||
|
conflict_handler=conflict_handler, add_help=add_help)
|
||||||
|
|
||||||
|
def error(self, message):
|
||||||
|
""" Raise a catchable error instead of exiting.
|
||||||
|
"""
|
||||||
|
raise UsageError(message)
|
||||||
|
|
||||||
|
def parse_argstring(self, argstring):
|
||||||
|
""" Split a string into an argument list and parse that argument list.
|
||||||
|
"""
|
||||||
|
argv = arg_split(argstring)
|
||||||
|
return self.parse_args(argv)
|
||||||
|
|
||||||
|
|
||||||
|
def construct_parser(magic_func):
|
||||||
|
""" Construct an argument parser using the function decorations.
|
||||||
|
"""
|
||||||
|
kwds = getattr(magic_func, 'argcmd_kwds', {})
|
||||||
|
if 'description' not in kwds:
|
||||||
|
kwds['description'] = getattr(magic_func, '__doc__', None)
|
||||||
|
arg_name = real_name(magic_func)
|
||||||
|
parser = MagicArgumentParser(arg_name, **kwds)
|
||||||
|
# Reverse the list of decorators in order to apply them in the
|
||||||
|
# order in which they appear in the source.
|
||||||
|
group = None
|
||||||
|
for deco in magic_func.decorators[::-1]:
|
||||||
|
result = deco.add_to_parser(parser, group)
|
||||||
|
if result is not None:
|
||||||
|
group = result
|
||||||
|
|
||||||
|
# Replace the magic function's docstring with the full help text.
|
||||||
|
magic_func.__doc__ = parser.format_help()
|
||||||
|
|
||||||
|
return parser
|
||||||
|
|
||||||
|
|
||||||
|
def parse_argstring(magic_func, argstring):
|
||||||
|
""" Parse the string of arguments for the given magic function.
|
||||||
|
"""
|
||||||
|
return magic_func.parser.parse_argstring(argstring)
|
||||||
|
|
||||||
|
|
||||||
|
def real_name(magic_func):
|
||||||
|
""" Find the real name of the magic.
|
||||||
|
"""
|
||||||
|
magic_name = magic_func.__name__
|
||||||
|
if magic_name.startswith('magic_'):
|
||||||
|
magic_name = magic_name[len('magic_'):]
|
||||||
|
return getattr(magic_func, 'argcmd_name', magic_name)
|
||||||
|
|
||||||
|
|
||||||
|
class ArgDecorator(object):
|
||||||
|
""" Base class for decorators to add ArgumentParser information to a method.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __call__(self, func):
|
||||||
|
if not getattr(func, 'has_arguments', False):
|
||||||
|
func.has_arguments = True
|
||||||
|
func.decorators = []
|
||||||
|
func.decorators.append(self)
|
||||||
|
return func
|
||||||
|
|
||||||
|
def add_to_parser(self, parser, group):
|
||||||
|
""" Add this object's information to the parser, if necessary.
|
||||||
|
"""
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
|
class magic_arguments(ArgDecorator):
|
||||||
|
""" Mark the magic as having argparse arguments and possibly adjust the
|
||||||
|
name.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, name=None):
|
||||||
|
self.name = name
|
||||||
|
|
||||||
|
def __call__(self, func):
|
||||||
|
if not getattr(func, 'has_arguments', False):
|
||||||
|
func.has_arguments = True
|
||||||
|
func.decorators = []
|
||||||
|
if self.name is not None:
|
||||||
|
func.argcmd_name = self.name
|
||||||
|
# This should be the first decorator in the list of decorators, thus the
|
||||||
|
# last to execute. Build the parser.
|
||||||
|
func.parser = construct_parser(func)
|
||||||
|
return func
|
||||||
|
|
||||||
|
|
||||||
|
class ArgMethodWrapper(ArgDecorator):
|
||||||
|
|
||||||
|
"""
|
||||||
|
Base class to define a wrapper for ArgumentParser method.
|
||||||
|
|
||||||
|
Child class must define either `_method_name` or `add_to_parser`.
|
||||||
|
|
||||||
|
"""
|
||||||
|
|
||||||
|
_method_name = None
|
||||||
|
|
||||||
|
def __init__(self, *args, **kwds):
|
||||||
|
self.args = args
|
||||||
|
self.kwds = kwds
|
||||||
|
|
||||||
|
def add_to_parser(self, parser, group):
|
||||||
|
""" Add this object's information to the parser.
|
||||||
|
"""
|
||||||
|
if group is not None:
|
||||||
|
parser = group
|
||||||
|
getattr(parser, self._method_name)(*self.args, **self.kwds)
|
||||||
|
return None
|
||||||
|
|
||||||
|
|
||||||
|
class argument(ArgMethodWrapper):
|
||||||
|
""" Store arguments and keywords to pass to add_argument().
|
||||||
|
|
||||||
|
Instances also serve to decorate command methods.
|
||||||
|
"""
|
||||||
|
_method_name = 'add_argument'
|
||||||
|
|
||||||
|
|
||||||
|
class defaults(ArgMethodWrapper):
|
||||||
|
""" Store arguments and keywords to pass to set_defaults().
|
||||||
|
|
||||||
|
Instances also serve to decorate command methods.
|
||||||
|
"""
|
||||||
|
_method_name = 'set_defaults'
|
||||||
|
|
||||||
|
|
||||||
|
class argument_group(ArgMethodWrapper):
|
||||||
|
""" Store arguments and keywords to pass to add_argument_group().
|
||||||
|
|
||||||
|
Instances also serve to decorate command methods.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def add_to_parser(self, parser, group):
|
||||||
|
""" Add this object's information to the parser.
|
||||||
|
"""
|
||||||
|
return parser.add_argument_group(*self.args, **self.kwds)
|
||||||
|
|
||||||
|
|
||||||
|
class kwds(ArgDecorator):
|
||||||
|
""" Provide other keywords to the sub-parser constructor.
|
||||||
|
"""
|
||||||
|
def __init__(self, **kwds):
|
||||||
|
self.kwds = kwds
|
||||||
|
|
||||||
|
def __call__(self, func):
|
||||||
|
func = super(kwds, self).__call__(func)
|
||||||
|
func.argcmd_kwds = self.kwds
|
||||||
|
return func
|
||||||
|
|
||||||
|
|
||||||
|
__all__ = ['magic_arguments', 'argument', 'argument_group', 'kwds',
|
||||||
|
'parse_argstring']
|
@ -1,13 +0,0 @@
|
|||||||
from modulefinder import ModuleFinder
|
|
||||||
|
|
||||||
finder = ModuleFinder()
|
|
||||||
finder.run_script('__main__.py')
|
|
||||||
|
|
||||||
print('Loaded modules:')
|
|
||||||
for name, mod in finder.modules.items():
|
|
||||||
print('%s: ' % name, end='')
|
|
||||||
print(','.join(list(mod.globalnames.keys())[:3]))
|
|
||||||
|
|
||||||
print('-'*50)
|
|
||||||
print('Modules not imported:')
|
|
||||||
print('\n'.join(finder.badmodules.keys()))
|
|
File diff suppressed because it is too large
Load Diff
366
packages/python/yap_kernel/yap_ipython/core/page.py
Normal file
366
packages/python/yap_kernel/yap_ipython/core/page.py
Normal file
@ -0,0 +1,366 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""
|
||||||
|
Paging capabilities for yap_ipython.core
|
||||||
|
|
||||||
|
Notes
|
||||||
|
-----
|
||||||
|
|
||||||
|
For now this uses yap_ipython hooks, so it can't be in yap_ipython.utils. If we can get
|
||||||
|
rid of that dependency, we could move it there.
|
||||||
|
-----
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
|
||||||
|
import os
|
||||||
|
import re
|
||||||
|
import sys
|
||||||
|
import tempfile
|
||||||
|
|
||||||
|
from io import UnsupportedOperation
|
||||||
|
|
||||||
|
from yap_ipython import get_ipython
|
||||||
|
from yap_ipython.core.display import display
|
||||||
|
from yap_ipython.core.error import TryNext
|
||||||
|
from yap_ipython.utils.data import chop
|
||||||
|
from yap_ipython.utils.process import system
|
||||||
|
from yap_ipython.utils.terminal import get_terminal_size
|
||||||
|
from yap_ipython.utils import py3compat
|
||||||
|
|
||||||
|
|
||||||
|
def display_page(strng, start=0, screen_lines=25):
|
||||||
|
"""Just display, no paging. screen_lines is ignored."""
|
||||||
|
if isinstance(strng, dict):
|
||||||
|
data = strng
|
||||||
|
else:
|
||||||
|
if start:
|
||||||
|
strng = u'\n'.join(strng.splitlines()[start:])
|
||||||
|
data = { 'text/plain': strng }
|
||||||
|
display(data, raw=True)
|
||||||
|
|
||||||
|
|
||||||
|
def as_hook(page_func):
|
||||||
|
"""Wrap a pager func to strip the `self` arg
|
||||||
|
|
||||||
|
so it can be called as a hook.
|
||||||
|
"""
|
||||||
|
return lambda self, *args, **kwargs: page_func(*args, **kwargs)
|
||||||
|
|
||||||
|
|
||||||
|
esc_re = re.compile(r"(\x1b[^m]+m)")
|
||||||
|
|
||||||
|
def page_dumb(strng, start=0, screen_lines=25):
|
||||||
|
"""Very dumb 'pager' in Python, for when nothing else works.
|
||||||
|
|
||||||
|
Only moves forward, same interface as page(), except for pager_cmd and
|
||||||
|
mode.
|
||||||
|
"""
|
||||||
|
if isinstance(strng, dict):
|
||||||
|
strng = strng.get('text/plain', '')
|
||||||
|
out_ln = strng.splitlines()[start:]
|
||||||
|
screens = chop(out_ln,screen_lines-1)
|
||||||
|
if len(screens) == 1:
|
||||||
|
print(os.linesep.join(screens[0]))
|
||||||
|
else:
|
||||||
|
last_escape = ""
|
||||||
|
for scr in screens[0:-1]:
|
||||||
|
hunk = os.linesep.join(scr)
|
||||||
|
print(last_escape + hunk)
|
||||||
|
if not page_more():
|
||||||
|
return
|
||||||
|
esc_list = esc_re.findall(hunk)
|
||||||
|
if len(esc_list) > 0:
|
||||||
|
last_escape = esc_list[-1]
|
||||||
|
print(last_escape + os.linesep.join(screens[-1]))
|
||||||
|
|
||||||
|
def _detect_screen_size(screen_lines_def):
|
||||||
|
"""Attempt to work out the number of lines on the screen.
|
||||||
|
|
||||||
|
This is called by page(). It can raise an error (e.g. when run in the
|
||||||
|
test suite), so it's separated out so it can easily be called in a try block.
|
||||||
|
"""
|
||||||
|
TERM = os.environ.get('TERM',None)
|
||||||
|
if not((TERM=='xterm' or TERM=='xterm-color') and sys.platform != 'sunos5'):
|
||||||
|
# curses causes problems on many terminals other than xterm, and
|
||||||
|
# some termios calls lock up on Sun OS5.
|
||||||
|
return screen_lines_def
|
||||||
|
|
||||||
|
try:
|
||||||
|
import termios
|
||||||
|
import curses
|
||||||
|
except ImportError:
|
||||||
|
return screen_lines_def
|
||||||
|
|
||||||
|
# There is a bug in curses, where *sometimes* it fails to properly
|
||||||
|
# initialize, and then after the endwin() call is made, the
|
||||||
|
# terminal is left in an unusable state. Rather than trying to
|
||||||
|
# check everytime for this (by requesting and comparing termios
|
||||||
|
# flags each time), we just save the initial terminal state and
|
||||||
|
# unconditionally reset it every time. It's cheaper than making
|
||||||
|
# the checks.
|
||||||
|
try:
|
||||||
|
term_flags = termios.tcgetattr(sys.stdout)
|
||||||
|
except termios.error as err:
|
||||||
|
# can fail on Linux 2.6, pager_page will catch the TypeError
|
||||||
|
raise TypeError('termios error: {0}'.format(err))
|
||||||
|
|
||||||
|
try:
|
||||||
|
scr = curses.initscr()
|
||||||
|
except AttributeError:
|
||||||
|
# Curses on Solaris may not be complete, so we can't use it there
|
||||||
|
return screen_lines_def
|
||||||
|
|
||||||
|
screen_lines_real,screen_cols = scr.getmaxyx()
|
||||||
|
curses.endwin()
|
||||||
|
|
||||||
|
# Restore terminal state in case endwin() didn't.
|
||||||
|
termios.tcsetattr(sys.stdout,termios.TCSANOW,term_flags)
|
||||||
|
# Now we have what we needed: the screen size in rows/columns
|
||||||
|
return screen_lines_real
|
||||||
|
#print '***Screen size:',screen_lines_real,'lines x',\
|
||||||
|
#screen_cols,'columns.' # dbg
|
||||||
|
|
||||||
|
def pager_page(strng, start=0, screen_lines=0, pager_cmd=None):
|
||||||
|
"""Display a string, piping through a pager after a certain length.
|
||||||
|
|
||||||
|
strng can be a mime-bundle dict, supplying multiple representations,
|
||||||
|
keyed by mime-type.
|
||||||
|
|
||||||
|
The screen_lines parameter specifies the number of *usable* lines of your
|
||||||
|
terminal screen (total lines minus lines you need to reserve to show other
|
||||||
|
information).
|
||||||
|
|
||||||
|
If you set screen_lines to a number <=0, page() will try to auto-determine
|
||||||
|
your screen size and will only use up to (screen_size+screen_lines) for
|
||||||
|
printing, paging after that. That is, if you want auto-detection but need
|
||||||
|
to reserve the bottom 3 lines of the screen, use screen_lines = -3, and for
|
||||||
|
auto-detection without any lines reserved simply use screen_lines = 0.
|
||||||
|
|
||||||
|
If a string won't fit in the allowed lines, it is sent through the
|
||||||
|
specified pager command. If none given, look for PAGER in the environment,
|
||||||
|
and ultimately default to less.
|
||||||
|
|
||||||
|
If no system pager works, the string is sent through a 'dumb pager'
|
||||||
|
written in python, very simplistic.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# for compatibility with mime-bundle form:
|
||||||
|
if isinstance(strng, dict):
|
||||||
|
strng = strng['text/plain']
|
||||||
|
|
||||||
|
# Ugly kludge, but calling curses.initscr() flat out crashes in emacs
|
||||||
|
TERM = os.environ.get('TERM','dumb')
|
||||||
|
if TERM in ['dumb','emacs'] and os.name != 'nt':
|
||||||
|
print(strng)
|
||||||
|
return
|
||||||
|
# chop off the topmost part of the string we don't want to see
|
||||||
|
str_lines = strng.splitlines()[start:]
|
||||||
|
str_toprint = os.linesep.join(str_lines)
|
||||||
|
num_newlines = len(str_lines)
|
||||||
|
len_str = len(str_toprint)
|
||||||
|
|
||||||
|
# Dumb heuristics to guesstimate number of on-screen lines the string
|
||||||
|
# takes. Very basic, but good enough for docstrings in reasonable
|
||||||
|
# terminals. If someone later feels like refining it, it's not hard.
|
||||||
|
numlines = max(num_newlines,int(len_str/80)+1)
|
||||||
|
|
||||||
|
screen_lines_def = get_terminal_size()[1]
|
||||||
|
|
||||||
|
# auto-determine screen size
|
||||||
|
if screen_lines <= 0:
|
||||||
|
try:
|
||||||
|
screen_lines += _detect_screen_size(screen_lines_def)
|
||||||
|
except (TypeError, UnsupportedOperation):
|
||||||
|
print(str_toprint)
|
||||||
|
return
|
||||||
|
|
||||||
|
#print 'numlines',numlines,'screenlines',screen_lines # dbg
|
||||||
|
if numlines <= screen_lines :
|
||||||
|
#print '*** normal print' # dbg
|
||||||
|
print(str_toprint)
|
||||||
|
else:
|
||||||
|
# Try to open pager and default to internal one if that fails.
|
||||||
|
# All failure modes are tagged as 'retval=1', to match the return
|
||||||
|
# value of a failed system command. If any intermediate attempt
|
||||||
|
# sets retval to 1, at the end we resort to our own page_dumb() pager.
|
||||||
|
pager_cmd = get_pager_cmd(pager_cmd)
|
||||||
|
pager_cmd += ' ' + get_pager_start(pager_cmd,start)
|
||||||
|
if os.name == 'nt':
|
||||||
|
if pager_cmd.startswith('type'):
|
||||||
|
# The default WinXP 'type' command is failing on complex strings.
|
||||||
|
retval = 1
|
||||||
|
else:
|
||||||
|
fd, tmpname = tempfile.mkstemp('.txt')
|
||||||
|
try:
|
||||||
|
os.close(fd)
|
||||||
|
with open(tmpname, 'wt') as tmpfile:
|
||||||
|
tmpfile.write(strng)
|
||||||
|
cmd = "%s < %s" % (pager_cmd, tmpname)
|
||||||
|
# tmpfile needs to be closed for windows
|
||||||
|
if os.system(cmd):
|
||||||
|
retval = 1
|
||||||
|
else:
|
||||||
|
retval = None
|
||||||
|
finally:
|
||||||
|
os.remove(tmpname)
|
||||||
|
else:
|
||||||
|
try:
|
||||||
|
retval = None
|
||||||
|
# if I use popen4, things hang. No idea why.
|
||||||
|
#pager,shell_out = os.popen4(pager_cmd)
|
||||||
|
pager = os.popen(pager_cmd, 'w')
|
||||||
|
try:
|
||||||
|
pager_encoding = pager.encoding or sys.stdout.encoding
|
||||||
|
pager.write(strng)
|
||||||
|
finally:
|
||||||
|
retval = pager.close()
|
||||||
|
except IOError as msg: # broken pipe when user quits
|
||||||
|
if msg.args == (32, 'Broken pipe'):
|
||||||
|
retval = None
|
||||||
|
else:
|
||||||
|
retval = 1
|
||||||
|
except OSError:
|
||||||
|
# Other strange problems, sometimes seen in Win2k/cygwin
|
||||||
|
retval = 1
|
||||||
|
if retval is not None:
|
||||||
|
page_dumb(strng,screen_lines=screen_lines)
|
||||||
|
|
||||||
|
|
||||||
|
def page(data, start=0, screen_lines=0, pager_cmd=None):
|
||||||
|
"""Display content in a pager, piping through a pager after a certain length.
|
||||||
|
|
||||||
|
data can be a mime-bundle dict, supplying multiple representations,
|
||||||
|
keyed by mime-type, or text.
|
||||||
|
|
||||||
|
Pager is dispatched via the `show_in_pager` yap_ipython hook.
|
||||||
|
If no hook is registered, `pager_page` will be used.
|
||||||
|
"""
|
||||||
|
# Some routines may auto-compute start offsets incorrectly and pass a
|
||||||
|
# negative value. Offset to 0 for robustness.
|
||||||
|
start = max(0, start)
|
||||||
|
|
||||||
|
# first, try the hook
|
||||||
|
ip = get_ipython()
|
||||||
|
if ip:
|
||||||
|
try:
|
||||||
|
ip.hooks.show_in_pager(data, start=start, screen_lines=screen_lines)
|
||||||
|
return
|
||||||
|
except TryNext:
|
||||||
|
pass
|
||||||
|
|
||||||
|
# fallback on default pager
|
||||||
|
return pager_page(data, start, screen_lines, pager_cmd)
|
||||||
|
|
||||||
|
|
||||||
|
def page_file(fname, start=0, pager_cmd=None):
|
||||||
|
"""Page a file, using an optional pager command and starting line.
|
||||||
|
"""
|
||||||
|
|
||||||
|
pager_cmd = get_pager_cmd(pager_cmd)
|
||||||
|
pager_cmd += ' ' + get_pager_start(pager_cmd,start)
|
||||||
|
|
||||||
|
try:
|
||||||
|
if os.environ['TERM'] in ['emacs','dumb']:
|
||||||
|
raise EnvironmentError
|
||||||
|
system(pager_cmd + ' ' + fname)
|
||||||
|
except:
|
||||||
|
try:
|
||||||
|
if start > 0:
|
||||||
|
start -= 1
|
||||||
|
page(open(fname).read(),start)
|
||||||
|
except:
|
||||||
|
print('Unable to show file',repr(fname))
|
||||||
|
|
||||||
|
|
||||||
|
def get_pager_cmd(pager_cmd=None):
|
||||||
|
"""Return a pager command.
|
||||||
|
|
||||||
|
Makes some attempts at finding an OS-correct one.
|
||||||
|
"""
|
||||||
|
if os.name == 'posix':
|
||||||
|
default_pager_cmd = 'less -R' # -R for color control sequences
|
||||||
|
elif os.name in ['nt','dos']:
|
||||||
|
default_pager_cmd = 'type'
|
||||||
|
|
||||||
|
if pager_cmd is None:
|
||||||
|
try:
|
||||||
|
pager_cmd = os.environ['PAGER']
|
||||||
|
except:
|
||||||
|
pager_cmd = default_pager_cmd
|
||||||
|
|
||||||
|
if pager_cmd == 'less' and '-r' not in os.environ.get('LESS', '').lower():
|
||||||
|
pager_cmd += ' -R'
|
||||||
|
|
||||||
|
return pager_cmd
|
||||||
|
|
||||||
|
|
||||||
|
def get_pager_start(pager, start):
|
||||||
|
"""Return the string for paging files with an offset.
|
||||||
|
|
||||||
|
This is the '+N' argument which less and more (under Unix) accept.
|
||||||
|
"""
|
||||||
|
|
||||||
|
if pager in ['less','more']:
|
||||||
|
if start:
|
||||||
|
start_string = '+' + str(start)
|
||||||
|
else:
|
||||||
|
start_string = ''
|
||||||
|
else:
|
||||||
|
start_string = ''
|
||||||
|
return start_string
|
||||||
|
|
||||||
|
|
||||||
|
# (X)emacs on win32 doesn't like to be bypassed with msvcrt.getch()
|
||||||
|
if os.name == 'nt' and os.environ.get('TERM','dumb') != 'emacs':
|
||||||
|
import msvcrt
|
||||||
|
def page_more():
|
||||||
|
""" Smart pausing between pages
|
||||||
|
|
||||||
|
@return: True if need print more lines, False if quit
|
||||||
|
"""
|
||||||
|
sys.stdout.write('---Return to continue, q to quit--- ')
|
||||||
|
ans = msvcrt.getwch()
|
||||||
|
if ans in ("q", "Q"):
|
||||||
|
result = False
|
||||||
|
else:
|
||||||
|
result = True
|
||||||
|
sys.stdout.write("\b"*37 + " "*37 + "\b"*37)
|
||||||
|
return result
|
||||||
|
else:
|
||||||
|
def page_more():
|
||||||
|
ans = py3compat.input('---Return to continue, q to quit--- ')
|
||||||
|
if ans.lower().startswith('q'):
|
||||||
|
return False
|
||||||
|
else:
|
||||||
|
return True
|
||||||
|
|
||||||
|
|
||||||
|
def snip_print(str,width = 75,print_full = 0,header = ''):
|
||||||
|
"""Print a string snipping the midsection to fit in width.
|
||||||
|
|
||||||
|
print_full: mode control:
|
||||||
|
|
||||||
|
- 0: only snip long strings
|
||||||
|
- 1: send to page() directly.
|
||||||
|
- 2: snip long strings and ask for full length viewing with page()
|
||||||
|
|
||||||
|
Return 1 if snipping was necessary, 0 otherwise."""
|
||||||
|
|
||||||
|
if print_full == 1:
|
||||||
|
page(header+str)
|
||||||
|
return 0
|
||||||
|
|
||||||
|
print(header, end=' ')
|
||||||
|
if len(str) < width:
|
||||||
|
print(str)
|
||||||
|
snip = 0
|
||||||
|
else:
|
||||||
|
whalf = int((width -5)/2)
|
||||||
|
print(str[:whalf] + ' <...> ' + str[-whalf:])
|
||||||
|
snip = 1
|
||||||
|
if snip and print_full == 2:
|
||||||
|
if py3compat.input(header+' Snipped. View (y/n)? [N]').lower() == 'y':
|
||||||
|
page(str)
|
||||||
|
return snip
|
55
packages/python/yap_kernel/yap_ipython/core/payload.py
Normal file
55
packages/python/yap_kernel/yap_ipython/core/payload.py
Normal file
@ -0,0 +1,55 @@
|
|||||||
|
# -*- coding: utf-8 -*-
|
||||||
|
"""Payload system for yap_ipython.
|
||||||
|
|
||||||
|
Authors:
|
||||||
|
|
||||||
|
* Fernando Perez
|
||||||
|
* Brian Granger
|
||||||
|
"""
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2008-2011 The yap_ipython Development Team
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
|
# the file COPYING, distributed as part of this software.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Imports
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
from traitlets.config.configurable import Configurable
|
||||||
|
from traitlets import List
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Main payload class
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
class PayloadManager(Configurable):
|
||||||
|
|
||||||
|
_payload = List([])
|
||||||
|
|
||||||
|
def write_payload(self, data, single=True):
|
||||||
|
"""Include or update the specified `data` payload in the PayloadManager.
|
||||||
|
|
||||||
|
If a previous payload with the same source exists and `single` is True,
|
||||||
|
it will be overwritten with the new one.
|
||||||
|
"""
|
||||||
|
|
||||||
|
if not isinstance(data, dict):
|
||||||
|
raise TypeError('Each payload write must be a dict, got: %r' % data)
|
||||||
|
|
||||||
|
if single and 'source' in data:
|
||||||
|
source = data['source']
|
||||||
|
for i, pl in enumerate(self._payload):
|
||||||
|
if 'source' in pl and pl['source'] == source:
|
||||||
|
self._payload[i] = data
|
||||||
|
return
|
||||||
|
|
||||||
|
self._payload.append(data)
|
||||||
|
|
||||||
|
def read_payload(self):
|
||||||
|
return self._payload
|
||||||
|
|
||||||
|
def clear_payload(self):
|
||||||
|
self._payload = []
|
52
packages/python/yap_kernel/yap_ipython/core/payloadpage.py
Normal file
52
packages/python/yap_kernel/yap_ipython/core/payloadpage.py
Normal file
@ -0,0 +1,52 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""A payload based version of page."""
|
||||||
|
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
import warnings
|
||||||
|
from yap_ipython.core.getipython import get_ipython
|
||||||
|
|
||||||
|
|
||||||
|
def page(strng, start=0, screen_lines=0, pager_cmd=None):
|
||||||
|
"""Print a string, piping through a pager.
|
||||||
|
|
||||||
|
This version ignores the screen_lines and pager_cmd arguments and uses
|
||||||
|
yap_ipython's payload system instead.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
strng : str or mime-dict
|
||||||
|
Text to page, or a mime-type keyed dict of already formatted data.
|
||||||
|
|
||||||
|
start : int
|
||||||
|
Starting line at which to place the display.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Some routines may auto-compute start offsets incorrectly and pass a
|
||||||
|
# negative value. Offset to 0 for robustness.
|
||||||
|
start = max(0, start)
|
||||||
|
shell = get_ipython()
|
||||||
|
|
||||||
|
if isinstance(strng, dict):
|
||||||
|
data = strng
|
||||||
|
else:
|
||||||
|
data = {'text/plain' : strng}
|
||||||
|
payload = dict(
|
||||||
|
source='page',
|
||||||
|
data=data,
|
||||||
|
start=start,
|
||||||
|
)
|
||||||
|
shell.payload_manager.write_payload(payload)
|
||||||
|
|
||||||
|
|
||||||
|
def install_payload_page():
|
||||||
|
"""DEPRECATED, use show_in_pager hook
|
||||||
|
|
||||||
|
Install this version of page as yap_ipython.core.page.page.
|
||||||
|
"""
|
||||||
|
warnings.warn("""install_payload_page is deprecated.
|
||||||
|
Use `ip.set_hook('show_in_pager, page.as_hook(payloadpage.page))`
|
||||||
|
""")
|
||||||
|
from yap_ipython.core import page as corepage
|
||||||
|
corepage.page = page
|
709
packages/python/yap_kernel/yap_ipython/core/prefilter.py
Normal file
709
packages/python/yap_kernel/yap_ipython/core/prefilter.py
Normal file
@ -0,0 +1,709 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""
|
||||||
|
Prefiltering components.
|
||||||
|
|
||||||
|
Prefilters transform user input before it is exec'd by Python. These
|
||||||
|
transforms are used to implement additional syntax such as !ls and %magic.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
from keyword import iskeyword
|
||||||
|
import re
|
||||||
|
|
||||||
|
from yap_ipython.core.autocall import IPyAutocall
|
||||||
|
from traitlets.config.configurable import Configurable
|
||||||
|
from yap_ipython.core.inputsplitter import (
|
||||||
|
ESC_MAGIC,
|
||||||
|
ESC_QUOTE,
|
||||||
|
ESC_QUOTE2,
|
||||||
|
ESC_PAREN,
|
||||||
|
)
|
||||||
|
from yap_ipython.core.macro import Macro
|
||||||
|
from yap_ipython.core.splitinput import LineInfo
|
||||||
|
|
||||||
|
from traitlets import (
|
||||||
|
List, Integer, Unicode, Bool, Instance, CRegExp
|
||||||
|
)
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Global utilities, errors and constants
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
|
||||||
|
class PrefilterError(Exception):
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
|
# RegExp to identify potential function names
|
||||||
|
re_fun_name = re.compile(r'[a-zA-Z_]([a-zA-Z0-9_.]*) *$')
|
||||||
|
|
||||||
|
# RegExp to exclude strings with this start from autocalling. In
|
||||||
|
# particular, all binary operators should be excluded, so that if foo is
|
||||||
|
# callable, foo OP bar doesn't become foo(OP bar), which is invalid. The
|
||||||
|
# characters '!=()' don't need to be checked for, as the checkPythonChars
|
||||||
|
# routine explicitly does so, to catch direct calls and rebindings of
|
||||||
|
# existing names.
|
||||||
|
|
||||||
|
# Warning: the '-' HAS TO BE AT THE END of the first group, otherwise
|
||||||
|
# it affects the rest of the group in square brackets.
|
||||||
|
re_exclude_auto = re.compile(r'^[,&^\|\*/\+-]'
|
||||||
|
r'|^is |^not |^in |^and |^or ')
|
||||||
|
|
||||||
|
# try to catch also methods for stuff in lists/tuples/dicts: off
|
||||||
|
# (experimental). For this to work, the line_split regexp would need
|
||||||
|
# to be modified so it wouldn't break things at '['. That line is
|
||||||
|
# nasty enough that I shouldn't change it until I can test it _well_.
|
||||||
|
#self.re_fun_name = re.compile (r'[a-zA-Z_]([a-zA-Z0-9_.\[\]]*) ?$')
|
||||||
|
|
||||||
|
|
||||||
|
# Handler Check Utilities
|
||||||
|
def is_shadowed(identifier, ip):
|
||||||
|
"""Is the given identifier defined in one of the namespaces which shadow
|
||||||
|
the alias and magic namespaces? Note that an identifier is different
|
||||||
|
than ifun, because it can not contain a '.' character."""
|
||||||
|
# This is much safer than calling ofind, which can change state
|
||||||
|
return (identifier in ip.user_ns \
|
||||||
|
or identifier in ip.user_global_ns \
|
||||||
|
or identifier in ip.ns_table['builtin']\
|
||||||
|
or iskeyword(identifier))
|
||||||
|
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Main Prefilter manager
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
|
||||||
|
class PrefilterManager(Configurable):
|
||||||
|
"""Main prefilter component.
|
||||||
|
|
||||||
|
The yap_ipython prefilter is run on all user input before it is run. The
|
||||||
|
prefilter consumes lines of input and produces transformed lines of
|
||||||
|
input.
|
||||||
|
|
||||||
|
The iplementation consists of two phases:
|
||||||
|
|
||||||
|
1. Transformers
|
||||||
|
2. Checkers and handlers
|
||||||
|
|
||||||
|
Over time, we plan on deprecating the checkers and handlers and doing
|
||||||
|
everything in the transformers.
|
||||||
|
|
||||||
|
The transformers are instances of :class:`PrefilterTransformer` and have
|
||||||
|
a single method :meth:`transform` that takes a line and returns a
|
||||||
|
transformed line. The transformation can be accomplished using any
|
||||||
|
tool, but our current ones use regular expressions for speed.
|
||||||
|
|
||||||
|
After all the transformers have been run, the line is fed to the checkers,
|
||||||
|
which are instances of :class:`PrefilterChecker`. The line is passed to
|
||||||
|
the :meth:`check` method, which either returns `None` or a
|
||||||
|
:class:`PrefilterHandler` instance. If `None` is returned, the other
|
||||||
|
checkers are tried. If an :class:`PrefilterHandler` instance is returned,
|
||||||
|
the line is passed to the :meth:`handle` method of the returned
|
||||||
|
handler and no further checkers are tried.
|
||||||
|
|
||||||
|
Both transformers and checkers have a `priority` attribute, that determines
|
||||||
|
the order in which they are called. Smaller priorities are tried first.
|
||||||
|
|
||||||
|
Both transformers and checkers also have `enabled` attribute, which is
|
||||||
|
a boolean that determines if the instance is used.
|
||||||
|
|
||||||
|
Users or developers can change the priority or enabled attribute of
|
||||||
|
transformers or checkers, but they must call the :meth:`sort_checkers`
|
||||||
|
or :meth:`sort_transformers` method after changing the priority.
|
||||||
|
"""
|
||||||
|
|
||||||
|
multi_line_specials = Bool(True).tag(config=True)
|
||||||
|
shell = Instance('yap_ipython.core.interactiveshell.InteractiveShellABC', allow_none=True)
|
||||||
|
|
||||||
|
def __init__(self, shell=None, **kwargs):
|
||||||
|
super(PrefilterManager, self).__init__(shell=shell, **kwargs)
|
||||||
|
self.shell = shell
|
||||||
|
self.init_transformers()
|
||||||
|
self.init_handlers()
|
||||||
|
self.init_checkers()
|
||||||
|
|
||||||
|
#-------------------------------------------------------------------------
|
||||||
|
# API for managing transformers
|
||||||
|
#-------------------------------------------------------------------------
|
||||||
|
|
||||||
|
def init_transformers(self):
|
||||||
|
"""Create the default transformers."""
|
||||||
|
self._transformers = []
|
||||||
|
for transformer_cls in _default_transformers:
|
||||||
|
transformer_cls(
|
||||||
|
shell=self.shell, prefilter_manager=self, parent=self
|
||||||
|
)
|
||||||
|
|
||||||
|
def sort_transformers(self):
|
||||||
|
"""Sort the transformers by priority.
|
||||||
|
|
||||||
|
This must be called after the priority of a transformer is changed.
|
||||||
|
The :meth:`register_transformer` method calls this automatically.
|
||||||
|
"""
|
||||||
|
self._transformers.sort(key=lambda x: x.priority)
|
||||||
|
|
||||||
|
@property
|
||||||
|
def transformers(self):
|
||||||
|
"""Return a list of checkers, sorted by priority."""
|
||||||
|
return self._transformers
|
||||||
|
|
||||||
|
def register_transformer(self, transformer):
|
||||||
|
"""Register a transformer instance."""
|
||||||
|
if transformer not in self._transformers:
|
||||||
|
self._transformers.append(transformer)
|
||||||
|
self.sort_transformers()
|
||||||
|
|
||||||
|
def unregister_transformer(self, transformer):
|
||||||
|
"""Unregister a transformer instance."""
|
||||||
|
if transformer in self._transformers:
|
||||||
|
self._transformers.remove(transformer)
|
||||||
|
|
||||||
|
#-------------------------------------------------------------------------
|
||||||
|
# API for managing checkers
|
||||||
|
#-------------------------------------------------------------------------
|
||||||
|
|
||||||
|
def init_checkers(self):
|
||||||
|
"""Create the default checkers."""
|
||||||
|
self._checkers = []
|
||||||
|
for checker in _default_checkers:
|
||||||
|
checker(
|
||||||
|
shell=self.shell, prefilter_manager=self, parent=self
|
||||||
|
)
|
||||||
|
|
||||||
|
def sort_checkers(self):
|
||||||
|
"""Sort the checkers by priority.
|
||||||
|
|
||||||
|
This must be called after the priority of a checker is changed.
|
||||||
|
The :meth:`register_checker` method calls this automatically.
|
||||||
|
"""
|
||||||
|
self._checkers.sort(key=lambda x: x.priority)
|
||||||
|
|
||||||
|
@property
|
||||||
|
def checkers(self):
|
||||||
|
"""Return a list of checkers, sorted by priority."""
|
||||||
|
return self._checkers
|
||||||
|
|
||||||
|
def register_checker(self, checker):
|
||||||
|
"""Register a checker instance."""
|
||||||
|
if checker not in self._checkers:
|
||||||
|
self._checkers.append(checker)
|
||||||
|
self.sort_checkers()
|
||||||
|
|
||||||
|
def unregister_checker(self, checker):
|
||||||
|
"""Unregister a checker instance."""
|
||||||
|
if checker in self._checkers:
|
||||||
|
self._checkers.remove(checker)
|
||||||
|
|
||||||
|
#-------------------------------------------------------------------------
|
||||||
|
# API for managing handlers
|
||||||
|
#-------------------------------------------------------------------------
|
||||||
|
|
||||||
|
def init_handlers(self):
|
||||||
|
"""Create the default handlers."""
|
||||||
|
self._handlers = {}
|
||||||
|
self._esc_handlers = {}
|
||||||
|
for handler in _default_handlers:
|
||||||
|
handler(
|
||||||
|
shell=self.shell, prefilter_manager=self, parent=self
|
||||||
|
)
|
||||||
|
|
||||||
|
@property
|
||||||
|
def handlers(self):
|
||||||
|
"""Return a dict of all the handlers."""
|
||||||
|
return self._handlers
|
||||||
|
|
||||||
|
def register_handler(self, name, handler, esc_strings):
|
||||||
|
"""Register a handler instance by name with esc_strings."""
|
||||||
|
self._handlers[name] = handler
|
||||||
|
for esc_str in esc_strings:
|
||||||
|
self._esc_handlers[esc_str] = handler
|
||||||
|
|
||||||
|
def unregister_handler(self, name, handler, esc_strings):
|
||||||
|
"""Unregister a handler instance by name with esc_strings."""
|
||||||
|
try:
|
||||||
|
del self._handlers[name]
|
||||||
|
except KeyError:
|
||||||
|
pass
|
||||||
|
for esc_str in esc_strings:
|
||||||
|
h = self._esc_handlers.get(esc_str)
|
||||||
|
if h is handler:
|
||||||
|
del self._esc_handlers[esc_str]
|
||||||
|
|
||||||
|
def get_handler_by_name(self, name):
|
||||||
|
"""Get a handler by its name."""
|
||||||
|
return self._handlers.get(name)
|
||||||
|
|
||||||
|
def get_handler_by_esc(self, esc_str):
|
||||||
|
"""Get a handler by its escape string."""
|
||||||
|
return self._esc_handlers.get(esc_str)
|
||||||
|
|
||||||
|
#-------------------------------------------------------------------------
|
||||||
|
# Main prefiltering API
|
||||||
|
#-------------------------------------------------------------------------
|
||||||
|
|
||||||
|
def prefilter_line_info(self, line_info):
|
||||||
|
"""Prefilter a line that has been converted to a LineInfo object.
|
||||||
|
|
||||||
|
This implements the checker/handler part of the prefilter pipe.
|
||||||
|
"""
|
||||||
|
# print "prefilter_line_info: ", line_info
|
||||||
|
handler = self.find_handler(line_info)
|
||||||
|
return handler.handle(line_info)
|
||||||
|
|
||||||
|
def find_handler(self, line_info):
|
||||||
|
"""Find a handler for the line_info by trying checkers."""
|
||||||
|
for checker in self.checkers:
|
||||||
|
if checker.enabled:
|
||||||
|
handler = checker.check(line_info)
|
||||||
|
if handler:
|
||||||
|
return handler
|
||||||
|
return self.get_handler_by_name('normal')
|
||||||
|
|
||||||
|
def transform_line(self, line, continue_prompt):
|
||||||
|
"""Calls the enabled transformers in order of increasing priority."""
|
||||||
|
for transformer in self.transformers:
|
||||||
|
if transformer.enabled:
|
||||||
|
line = transformer.transform(line, continue_prompt)
|
||||||
|
return line
|
||||||
|
|
||||||
|
def prefilter_line(self, line, continue_prompt=False):
|
||||||
|
"""Prefilter a single input line as text.
|
||||||
|
|
||||||
|
This method prefilters a single line of text by calling the
|
||||||
|
transformers and then the checkers/handlers.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# print "prefilter_line: ", line, continue_prompt
|
||||||
|
# All handlers *must* return a value, even if it's blank ('').
|
||||||
|
|
||||||
|
# save the line away in case we crash, so the post-mortem handler can
|
||||||
|
# record it
|
||||||
|
self.shell._last_input_line = line
|
||||||
|
|
||||||
|
if not line:
|
||||||
|
# Return immediately on purely empty lines, so that if the user
|
||||||
|
# previously typed some whitespace that started a continuation
|
||||||
|
# prompt, he can break out of that loop with just an empty line.
|
||||||
|
# This is how the default python prompt works.
|
||||||
|
return ''
|
||||||
|
|
||||||
|
# At this point, we invoke our transformers.
|
||||||
|
if not continue_prompt or (continue_prompt and self.multi_line_specials):
|
||||||
|
line = self.transform_line(line, continue_prompt)
|
||||||
|
|
||||||
|
# Now we compute line_info for the checkers and handlers
|
||||||
|
line_info = LineInfo(line, continue_prompt)
|
||||||
|
|
||||||
|
# the input history needs to track even empty lines
|
||||||
|
stripped = line.strip()
|
||||||
|
|
||||||
|
normal_handler = self.get_handler_by_name('normal')
|
||||||
|
if not stripped:
|
||||||
|
return normal_handler.handle(line_info)
|
||||||
|
|
||||||
|
# special handlers are only allowed for single line statements
|
||||||
|
if continue_prompt and not self.multi_line_specials:
|
||||||
|
return normal_handler.handle(line_info)
|
||||||
|
|
||||||
|
prefiltered = self.prefilter_line_info(line_info)
|
||||||
|
# print "prefiltered line: %r" % prefiltered
|
||||||
|
return prefiltered
|
||||||
|
|
||||||
|
def prefilter_lines(self, lines, continue_prompt=False):
|
||||||
|
"""Prefilter multiple input lines of text.
|
||||||
|
|
||||||
|
This is the main entry point for prefiltering multiple lines of
|
||||||
|
input. This simply calls :meth:`prefilter_line` for each line of
|
||||||
|
input.
|
||||||
|
|
||||||
|
This covers cases where there are multiple lines in the user entry,
|
||||||
|
which is the case when the user goes back to a multiline history
|
||||||
|
entry and presses enter.
|
||||||
|
"""
|
||||||
|
llines = lines.rstrip('\n').split('\n')
|
||||||
|
# We can get multiple lines in one shot, where multiline input 'blends'
|
||||||
|
# into one line, in cases like recalling from the readline history
|
||||||
|
# buffer. We need to make sure that in such cases, we correctly
|
||||||
|
# communicate downstream which line is first and which are continuation
|
||||||
|
# ones.
|
||||||
|
if len(llines) > 1:
|
||||||
|
out = '\n'.join([self.prefilter_line(line, lnum>0)
|
||||||
|
for lnum, line in enumerate(llines) ])
|
||||||
|
else:
|
||||||
|
out = self.prefilter_line(llines[0], continue_prompt)
|
||||||
|
|
||||||
|
return out
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Prefilter transformers
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
|
||||||
|
class PrefilterTransformer(Configurable):
|
||||||
|
"""Transform a line of user input."""
|
||||||
|
|
||||||
|
priority = Integer(100).tag(config=True)
|
||||||
|
# Transformers don't currently use shell or prefilter_manager, but as we
|
||||||
|
# move away from checkers and handlers, they will need them.
|
||||||
|
shell = Instance('yap_ipython.core.interactiveshell.InteractiveShellABC', allow_none=True)
|
||||||
|
prefilter_manager = Instance('yap_ipython.core.prefilter.PrefilterManager', allow_none=True)
|
||||||
|
enabled = Bool(True).tag(config=True)
|
||||||
|
|
||||||
|
def __init__(self, shell=None, prefilter_manager=None, **kwargs):
|
||||||
|
super(PrefilterTransformer, self).__init__(
|
||||||
|
shell=shell, prefilter_manager=prefilter_manager, **kwargs
|
||||||
|
)
|
||||||
|
self.prefilter_manager.register_transformer(self)
|
||||||
|
|
||||||
|
def transform(self, line, continue_prompt):
|
||||||
|
"""Transform a line, returning the new one."""
|
||||||
|
return None
|
||||||
|
|
||||||
|
def __repr__(self):
|
||||||
|
return "<%s(priority=%r, enabled=%r)>" % (
|
||||||
|
self.__class__.__name__, self.priority, self.enabled)
|
||||||
|
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Prefilter checkers
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
|
||||||
|
class PrefilterChecker(Configurable):
|
||||||
|
"""Inspect an input line and return a handler for that line."""
|
||||||
|
|
||||||
|
priority = Integer(100).tag(config=True)
|
||||||
|
shell = Instance('yap_ipython.core.interactiveshell.InteractiveShellABC', allow_none=True)
|
||||||
|
prefilter_manager = Instance('yap_ipython.core.prefilter.PrefilterManager', allow_none=True)
|
||||||
|
enabled = Bool(True).tag(config=True)
|
||||||
|
|
||||||
|
def __init__(self, shell=None, prefilter_manager=None, **kwargs):
|
||||||
|
super(PrefilterChecker, self).__init__(
|
||||||
|
shell=shell, prefilter_manager=prefilter_manager, **kwargs
|
||||||
|
)
|
||||||
|
self.prefilter_manager.register_checker(self)
|
||||||
|
|
||||||
|
def check(self, line_info):
|
||||||
|
"""Inspect line_info and return a handler instance or None."""
|
||||||
|
return None
|
||||||
|
|
||||||
|
def __repr__(self):
|
||||||
|
return "<%s(priority=%r, enabled=%r)>" % (
|
||||||
|
self.__class__.__name__, self.priority, self.enabled)
|
||||||
|
|
||||||
|
|
||||||
|
class EmacsChecker(PrefilterChecker):
|
||||||
|
|
||||||
|
priority = Integer(100).tag(config=True)
|
||||||
|
enabled = Bool(False).tag(config=True)
|
||||||
|
|
||||||
|
def check(self, line_info):
|
||||||
|
"Emacs ipython-mode tags certain input lines."
|
||||||
|
if line_info.line.endswith('# PYTHON-MODE'):
|
||||||
|
return self.prefilter_manager.get_handler_by_name('emacs')
|
||||||
|
else:
|
||||||
|
return None
|
||||||
|
|
||||||
|
|
||||||
|
class MacroChecker(PrefilterChecker):
|
||||||
|
|
||||||
|
priority = Integer(250).tag(config=True)
|
||||||
|
|
||||||
|
def check(self, line_info):
|
||||||
|
obj = self.shell.user_ns.get(line_info.ifun)
|
||||||
|
if isinstance(obj, Macro):
|
||||||
|
return self.prefilter_manager.get_handler_by_name('macro')
|
||||||
|
else:
|
||||||
|
return None
|
||||||
|
|
||||||
|
|
||||||
|
class IPyAutocallChecker(PrefilterChecker):
|
||||||
|
|
||||||
|
priority = Integer(300).tag(config=True)
|
||||||
|
|
||||||
|
def check(self, line_info):
|
||||||
|
"Instances of IPyAutocall in user_ns get autocalled immediately"
|
||||||
|
obj = self.shell.user_ns.get(line_info.ifun, None)
|
||||||
|
if isinstance(obj, IPyAutocall):
|
||||||
|
obj.set_ip(self.shell)
|
||||||
|
return self.prefilter_manager.get_handler_by_name('auto')
|
||||||
|
else:
|
||||||
|
return None
|
||||||
|
|
||||||
|
|
||||||
|
class AssignmentChecker(PrefilterChecker):
|
||||||
|
|
||||||
|
priority = Integer(600).tag(config=True)
|
||||||
|
|
||||||
|
def check(self, line_info):
|
||||||
|
"""Check to see if user is assigning to a var for the first time, in
|
||||||
|
which case we want to avoid any sort of automagic / autocall games.
|
||||||
|
|
||||||
|
This allows users to assign to either alias or magic names true python
|
||||||
|
variables (the magic/alias systems always take second seat to true
|
||||||
|
python code). E.g. ls='hi', or ls,that=1,2"""
|
||||||
|
if line_info.the_rest:
|
||||||
|
if line_info.the_rest[0] in '=,':
|
||||||
|
return self.prefilter_manager.get_handler_by_name('normal')
|
||||||
|
else:
|
||||||
|
return None
|
||||||
|
|
||||||
|
|
||||||
|
class AutoMagicChecker(PrefilterChecker):
|
||||||
|
|
||||||
|
priority = Integer(700).tag(config=True)
|
||||||
|
|
||||||
|
def check(self, line_info):
|
||||||
|
"""If the ifun is magic, and automagic is on, run it. Note: normal,
|
||||||
|
non-auto magic would already have been triggered via '%' in
|
||||||
|
check_esc_chars. This just checks for automagic. Also, before
|
||||||
|
triggering the magic handler, make sure that there is nothing in the
|
||||||
|
user namespace which could shadow it."""
|
||||||
|
if not self.shell.automagic or not self.shell.find_magic(line_info.ifun):
|
||||||
|
return None
|
||||||
|
|
||||||
|
# We have a likely magic method. Make sure we should actually call it.
|
||||||
|
if line_info.continue_prompt and not self.prefilter_manager.multi_line_specials:
|
||||||
|
return None
|
||||||
|
|
||||||
|
head = line_info.ifun.split('.',1)[0]
|
||||||
|
if is_shadowed(head, self.shell):
|
||||||
|
return None
|
||||||
|
|
||||||
|
return self.prefilter_manager.get_handler_by_name('magic')
|
||||||
|
|
||||||
|
|
||||||
|
class PythonOpsChecker(PrefilterChecker):
|
||||||
|
|
||||||
|
priority = Integer(900).tag(config=True)
|
||||||
|
|
||||||
|
def check(self, line_info):
|
||||||
|
"""If the 'rest' of the line begins with a function call or pretty much
|
||||||
|
any python operator, we should simply execute the line (regardless of
|
||||||
|
whether or not there's a possible autocall expansion). This avoids
|
||||||
|
spurious (and very confusing) geattr() accesses."""
|
||||||
|
if line_info.the_rest and line_info.the_rest[0] in '!=()<>,+*/%^&|':
|
||||||
|
return self.prefilter_manager.get_handler_by_name('normal')
|
||||||
|
else:
|
||||||
|
return None
|
||||||
|
|
||||||
|
|
||||||
|
class AutocallChecker(PrefilterChecker):
|
||||||
|
|
||||||
|
priority = Integer(1000).tag(config=True)
|
||||||
|
|
||||||
|
function_name_regexp = CRegExp(re_fun_name,
|
||||||
|
help="RegExp to identify potential function names."
|
||||||
|
).tag(config=True)
|
||||||
|
exclude_regexp = CRegExp(re_exclude_auto,
|
||||||
|
help="RegExp to exclude strings with this start from autocalling."
|
||||||
|
).tag(config=True)
|
||||||
|
|
||||||
|
def check(self, line_info):
|
||||||
|
"Check if the initial word/function is callable and autocall is on."
|
||||||
|
if not self.shell.autocall:
|
||||||
|
return None
|
||||||
|
|
||||||
|
oinfo = line_info.ofind(self.shell) # This can mutate state via getattr
|
||||||
|
if not oinfo['found']:
|
||||||
|
return None
|
||||||
|
|
||||||
|
ignored_funs = ['b', 'f', 'r', 'u', 'br', 'rb', 'fr', 'rf']
|
||||||
|
ifun = line_info.ifun
|
||||||
|
line = line_info.line
|
||||||
|
if ifun.lower() in ignored_funs and (line.startswith(ifun + "'") or line.startswith(ifun + '"')):
|
||||||
|
return None
|
||||||
|
|
||||||
|
if callable(oinfo['obj']) \
|
||||||
|
and (not self.exclude_regexp.match(line_info.the_rest)) \
|
||||||
|
and self.function_name_regexp.match(line_info.ifun):
|
||||||
|
return self.prefilter_manager.get_handler_by_name('auto')
|
||||||
|
else:
|
||||||
|
return None
|
||||||
|
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Prefilter handlers
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
|
||||||
|
class PrefilterHandler(Configurable):
|
||||||
|
|
||||||
|
handler_name = Unicode('normal')
|
||||||
|
esc_strings = List([])
|
||||||
|
shell = Instance('yap_ipython.core.interactiveshell.InteractiveShellABC', allow_none=True)
|
||||||
|
prefilter_manager = Instance('yap_ipython.core.prefilter.PrefilterManager', allow_none=True)
|
||||||
|
|
||||||
|
def __init__(self, shell=None, prefilter_manager=None, **kwargs):
|
||||||
|
super(PrefilterHandler, self).__init__(
|
||||||
|
shell=shell, prefilter_manager=prefilter_manager, **kwargs
|
||||||
|
)
|
||||||
|
self.prefilter_manager.register_handler(
|
||||||
|
self.handler_name,
|
||||||
|
self,
|
||||||
|
self.esc_strings
|
||||||
|
)
|
||||||
|
|
||||||
|
def handle(self, line_info):
|
||||||
|
# print "normal: ", line_info
|
||||||
|
"""Handle normal input lines. Use as a template for handlers."""
|
||||||
|
|
||||||
|
# With autoindent on, we need some way to exit the input loop, and I
|
||||||
|
# don't want to force the user to have to backspace all the way to
|
||||||
|
# clear the line. The rule will be in this case, that either two
|
||||||
|
# lines of pure whitespace in a row, or a line of pure whitespace but
|
||||||
|
# of a size different to the indent level, will exit the input loop.
|
||||||
|
line = line_info.line
|
||||||
|
continue_prompt = line_info.continue_prompt
|
||||||
|
|
||||||
|
if (continue_prompt and
|
||||||
|
self.shell.autoindent and
|
||||||
|
line.isspace() and
|
||||||
|
0 < abs(len(line) - self.shell.indent_current_nsp) <= 2):
|
||||||
|
line = ''
|
||||||
|
|
||||||
|
return line
|
||||||
|
|
||||||
|
def __str__(self):
|
||||||
|
return "<%s(name=%s)>" % (self.__class__.__name__, self.handler_name)
|
||||||
|
|
||||||
|
|
||||||
|
class MacroHandler(PrefilterHandler):
|
||||||
|
handler_name = Unicode("macro")
|
||||||
|
|
||||||
|
def handle(self, line_info):
|
||||||
|
obj = self.shell.user_ns.get(line_info.ifun)
|
||||||
|
pre_space = line_info.pre_whitespace
|
||||||
|
line_sep = "\n" + pre_space
|
||||||
|
return pre_space + line_sep.join(obj.value.splitlines())
|
||||||
|
|
||||||
|
|
||||||
|
class MagicHandler(PrefilterHandler):
|
||||||
|
|
||||||
|
handler_name = Unicode('magic')
|
||||||
|
esc_strings = List([ESC_MAGIC])
|
||||||
|
|
||||||
|
def handle(self, line_info):
|
||||||
|
"""Execute magic functions."""
|
||||||
|
ifun = line_info.ifun
|
||||||
|
the_rest = line_info.the_rest
|
||||||
|
#Prepare arguments for get_ipython().run_line_magic(magic_name, magic_args)
|
||||||
|
t_arg_s = ifun + " " + the_rest
|
||||||
|
t_magic_name, _, t_magic_arg_s = t_arg_s.partition(' ')
|
||||||
|
t_magic_name = t_magic_name.lstrip(ESC_MAGIC)
|
||||||
|
cmd = '%sget_ipython().run_line_magic(%r, %r)' % (line_info.pre_whitespace, t_magic_name, t_magic_arg_s)
|
||||||
|
return cmd
|
||||||
|
|
||||||
|
|
||||||
|
class AutoHandler(PrefilterHandler):
|
||||||
|
|
||||||
|
handler_name = Unicode('auto')
|
||||||
|
esc_strings = List([ESC_PAREN, ESC_QUOTE, ESC_QUOTE2])
|
||||||
|
|
||||||
|
def handle(self, line_info):
|
||||||
|
"""Handle lines which can be auto-executed, quoting if requested."""
|
||||||
|
line = line_info.line
|
||||||
|
ifun = line_info.ifun
|
||||||
|
the_rest = line_info.the_rest
|
||||||
|
esc = line_info.esc
|
||||||
|
continue_prompt = line_info.continue_prompt
|
||||||
|
obj = line_info.ofind(self.shell)['obj']
|
||||||
|
|
||||||
|
# This should only be active for single-line input!
|
||||||
|
if continue_prompt:
|
||||||
|
return line
|
||||||
|
|
||||||
|
force_auto = isinstance(obj, IPyAutocall)
|
||||||
|
|
||||||
|
# User objects sometimes raise exceptions on attribute access other
|
||||||
|
# than AttributeError (we've seen it in the past), so it's safest to be
|
||||||
|
# ultra-conservative here and catch all.
|
||||||
|
try:
|
||||||
|
auto_rewrite = obj.rewrite
|
||||||
|
except Exception:
|
||||||
|
auto_rewrite = True
|
||||||
|
|
||||||
|
if esc == ESC_QUOTE:
|
||||||
|
# Auto-quote splitting on whitespace
|
||||||
|
newcmd = '%s("%s")' % (ifun,'", "'.join(the_rest.split()) )
|
||||||
|
elif esc == ESC_QUOTE2:
|
||||||
|
# Auto-quote whole string
|
||||||
|
newcmd = '%s("%s")' % (ifun,the_rest)
|
||||||
|
elif esc == ESC_PAREN:
|
||||||
|
newcmd = '%s(%s)' % (ifun,",".join(the_rest.split()))
|
||||||
|
else:
|
||||||
|
# Auto-paren.
|
||||||
|
if force_auto:
|
||||||
|
# Don't rewrite if it is already a call.
|
||||||
|
do_rewrite = not the_rest.startswith('(')
|
||||||
|
else:
|
||||||
|
if not the_rest:
|
||||||
|
# We only apply it to argument-less calls if the autocall
|
||||||
|
# parameter is set to 2.
|
||||||
|
do_rewrite = (self.shell.autocall >= 2)
|
||||||
|
elif the_rest.startswith('[') and hasattr(obj, '__getitem__'):
|
||||||
|
# Don't autocall in this case: item access for an object
|
||||||
|
# which is BOTH callable and implements __getitem__.
|
||||||
|
do_rewrite = False
|
||||||
|
else:
|
||||||
|
do_rewrite = True
|
||||||
|
|
||||||
|
# Figure out the rewritten command
|
||||||
|
if do_rewrite:
|
||||||
|
if the_rest.endswith(';'):
|
||||||
|
newcmd = '%s(%s);' % (ifun.rstrip(),the_rest[:-1])
|
||||||
|
else:
|
||||||
|
newcmd = '%s(%s)' % (ifun.rstrip(), the_rest)
|
||||||
|
else:
|
||||||
|
normal_handler = self.prefilter_manager.get_handler_by_name('normal')
|
||||||
|
return normal_handler.handle(line_info)
|
||||||
|
|
||||||
|
# Display the rewritten call
|
||||||
|
if auto_rewrite:
|
||||||
|
self.shell.auto_rewrite_input(newcmd)
|
||||||
|
|
||||||
|
return newcmd
|
||||||
|
|
||||||
|
|
||||||
|
class EmacsHandler(PrefilterHandler):
|
||||||
|
|
||||||
|
handler_name = Unicode('emacs')
|
||||||
|
esc_strings = List([])
|
||||||
|
|
||||||
|
def handle(self, line_info):
|
||||||
|
"""Handle input lines marked by python-mode."""
|
||||||
|
|
||||||
|
# Currently, nothing is done. Later more functionality can be added
|
||||||
|
# here if needed.
|
||||||
|
|
||||||
|
# The input cache shouldn't be updated
|
||||||
|
return line_info.line
|
||||||
|
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Defaults
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
|
||||||
|
_default_transformers = [
|
||||||
|
]
|
||||||
|
|
||||||
|
_default_checkers = [
|
||||||
|
EmacsChecker,
|
||||||
|
MacroChecker,
|
||||||
|
IPyAutocallChecker,
|
||||||
|
AssignmentChecker,
|
||||||
|
AutoMagicChecker,
|
||||||
|
PythonOpsChecker,
|
||||||
|
AutocallChecker
|
||||||
|
]
|
||||||
|
|
||||||
|
_default_handlers = [
|
||||||
|
PrefilterHandler,
|
||||||
|
MacroHandler,
|
||||||
|
MagicHandler,
|
||||||
|
AutoHandler,
|
||||||
|
EmacsHandler
|
||||||
|
]
|
312
packages/python/yap_kernel/yap_ipython/core/profileapp.py
Normal file
312
packages/python/yap_kernel/yap_ipython/core/profileapp.py
Normal file
@ -0,0 +1,312 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""
|
||||||
|
An application for managing yap_ipython profiles.
|
||||||
|
|
||||||
|
To be invoked as the `ipython profile` subcommand.
|
||||||
|
|
||||||
|
Authors:
|
||||||
|
|
||||||
|
* Min RK
|
||||||
|
|
||||||
|
"""
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2008 The yap_ipython Development Team
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
|
# the file COPYING, distributed as part of this software.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Imports
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
import os
|
||||||
|
|
||||||
|
from traitlets.config.application import Application
|
||||||
|
from yap_ipython.core.application import (
|
||||||
|
BaseYAPApplication, base_flags
|
||||||
|
)
|
||||||
|
from yap_ipython.core.profiledir import ProfileDir
|
||||||
|
from yap_ipython.utils.importstring import import_item
|
||||||
|
from yap_ipython.paths import get_ipython_dir, get_ipython_package_dir
|
||||||
|
from traitlets import Unicode, Bool, Dict, observe
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Constants
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
create_help = """Create an yap_ipython profile by name
|
||||||
|
|
||||||
|
Create an ipython profile directory by its name or
|
||||||
|
profile directory path. Profile directories contain
|
||||||
|
configuration, log and security related files and are named
|
||||||
|
using the convention 'profile_<name>'. By default they are
|
||||||
|
located in your ipython directory. Once created, you will
|
||||||
|
can edit the configuration files in the profile
|
||||||
|
directory to configure yap_ipython. Most users will create a
|
||||||
|
profile directory by name,
|
||||||
|
`ipython profile create myprofile`, which will put the directory
|
||||||
|
in `<ipython_dir>/profile_myprofile`.
|
||||||
|
"""
|
||||||
|
list_help = """List available yap_ipython profiles
|
||||||
|
|
||||||
|
List all available profiles, by profile location, that can
|
||||||
|
be found in the current working directly or in the ipython
|
||||||
|
directory. Profile directories are named using the convention
|
||||||
|
'profile_<profile>'.
|
||||||
|
"""
|
||||||
|
profile_help = """Manage yap_ipython profiles
|
||||||
|
|
||||||
|
Profile directories contain
|
||||||
|
configuration, log and security related files and are named
|
||||||
|
using the convention 'profile_<name>'. By default they are
|
||||||
|
located in your ipython directory. You can create profiles
|
||||||
|
with `ipython profile create <name>`, or see the profiles you
|
||||||
|
already have with `ipython profile list`
|
||||||
|
|
||||||
|
To get started configuring yap_ipython, simply do:
|
||||||
|
|
||||||
|
$> ipython profile create
|
||||||
|
|
||||||
|
and yap_ipython will create the default profile in <ipython_dir>/profile_default,
|
||||||
|
where you can edit ipython_config.py to start configuring yap_ipython.
|
||||||
|
|
||||||
|
"""
|
||||||
|
|
||||||
|
_list_examples = "ipython profile list # list all profiles"
|
||||||
|
|
||||||
|
_create_examples = """
|
||||||
|
ipython profile create foo # create profile foo w/ default config files
|
||||||
|
ipython profile create foo --reset # restage default config files over current
|
||||||
|
ipython profile create foo --parallel # also stage parallel config files
|
||||||
|
"""
|
||||||
|
|
||||||
|
_main_examples = """
|
||||||
|
ipython profile create -h # show the help string for the create subcommand
|
||||||
|
ipython profile list -h # show the help string for the list subcommand
|
||||||
|
|
||||||
|
ipython locate profile foo # print the path to the directory for profile 'foo'
|
||||||
|
"""
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Profile Application Class (for `ipython profile` subcommand)
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
|
||||||
|
def list_profiles_in(path):
|
||||||
|
"""list profiles in a given root directory"""
|
||||||
|
files = os.listdir(path)
|
||||||
|
profiles = []
|
||||||
|
for f in files:
|
||||||
|
try:
|
||||||
|
full_path = os.path.join(path, f)
|
||||||
|
except UnicodeError:
|
||||||
|
continue
|
||||||
|
if os.path.isdir(full_path) and f.startswith('profile_'):
|
||||||
|
profiles.append(f.split('_',1)[-1])
|
||||||
|
return profiles
|
||||||
|
|
||||||
|
|
||||||
|
def list_bundled_profiles():
|
||||||
|
"""list profiles that are bundled with yap_ipython."""
|
||||||
|
path = os.path.join(get_ipython_package_dir(), u'core', u'profile')
|
||||||
|
files = os.listdir(path)
|
||||||
|
profiles = []
|
||||||
|
for profile in files:
|
||||||
|
full_path = os.path.join(path, profile)
|
||||||
|
if os.path.isdir(full_path) and profile != "__pycache__":
|
||||||
|
profiles.append(profile)
|
||||||
|
return profiles
|
||||||
|
|
||||||
|
|
||||||
|
class ProfileLocate(BaseYAPApplication):
|
||||||
|
description = """print the path to an yap_ipython profile dir"""
|
||||||
|
|
||||||
|
def parse_command_line(self, argv=None):
|
||||||
|
super(ProfileLocate, self).parse_command_line(argv)
|
||||||
|
if self.extra_args:
|
||||||
|
self.profile = self.extra_args[0]
|
||||||
|
|
||||||
|
def start(self):
|
||||||
|
print(self.profile_dir.location)
|
||||||
|
|
||||||
|
|
||||||
|
class ProfileList(Application):
|
||||||
|
name = u'ipython-profile'
|
||||||
|
description = list_help
|
||||||
|
examples = _list_examples
|
||||||
|
|
||||||
|
aliases = Dict({
|
||||||
|
'ipython-dir' : 'ProfileList.ipython_dir',
|
||||||
|
'log-level' : 'Application.log_level',
|
||||||
|
})
|
||||||
|
flags = Dict(dict(
|
||||||
|
debug = ({'Application' : {'log_level' : 0}},
|
||||||
|
"Set Application.log_level to 0, maximizing log output."
|
||||||
|
)
|
||||||
|
))
|
||||||
|
|
||||||
|
ipython_dir = Unicode(get_ipython_dir(),
|
||||||
|
help="""
|
||||||
|
The name of the yap_ipython directory. This directory is used for logging
|
||||||
|
configuration (through profiles), history storage, etc. The default
|
||||||
|
is usually $HOME/.ipython. This options can also be specified through
|
||||||
|
the environment variable IPYTHONDIR.
|
||||||
|
"""
|
||||||
|
).tag(config=True)
|
||||||
|
|
||||||
|
|
||||||
|
def _print_profiles(self, profiles):
|
||||||
|
"""print list of profiles, indented."""
|
||||||
|
for profile in profiles:
|
||||||
|
print(' %s' % profile)
|
||||||
|
|
||||||
|
def list_profile_dirs(self):
|
||||||
|
profiles = list_bundled_profiles()
|
||||||
|
if profiles:
|
||||||
|
print()
|
||||||
|
print("Available profiles in yap_ipython:")
|
||||||
|
self._print_profiles(profiles)
|
||||||
|
print()
|
||||||
|
print(" The first request for a bundled profile will copy it")
|
||||||
|
print(" into your yap_ipython directory (%s)," % self.ipython_dir)
|
||||||
|
print(" where you can customize it.")
|
||||||
|
|
||||||
|
profiles = list_profiles_in(self.ipython_dir)
|
||||||
|
if profiles:
|
||||||
|
print()
|
||||||
|
print("Available profiles in %s:" % self.ipython_dir)
|
||||||
|
self._print_profiles(profiles)
|
||||||
|
|
||||||
|
profiles = list_profiles_in(os.getcwd())
|
||||||
|
if profiles:
|
||||||
|
print()
|
||||||
|
print("Available profiles in current directory (%s):" % os.getcwd())
|
||||||
|
self._print_profiles(profiles)
|
||||||
|
|
||||||
|
print()
|
||||||
|
print("To use any of the above profiles, start yap_ipython with:")
|
||||||
|
print(" ipython --profile=<name>")
|
||||||
|
print()
|
||||||
|
|
||||||
|
def start(self):
|
||||||
|
self.list_profile_dirs()
|
||||||
|
|
||||||
|
|
||||||
|
create_flags = {}
|
||||||
|
create_flags.update(base_flags)
|
||||||
|
# don't include '--init' flag, which implies running profile create in other apps
|
||||||
|
create_flags.pop('init')
|
||||||
|
create_flags['reset'] = ({'ProfileCreate': {'overwrite' : True}},
|
||||||
|
"reset config files in this profile to the defaults.")
|
||||||
|
create_flags['parallel'] = ({'ProfileCreate': {'parallel' : True}},
|
||||||
|
"Include the config files for parallel "
|
||||||
|
"computing apps (ipengine, ipcontroller, etc.)")
|
||||||
|
|
||||||
|
|
||||||
|
class ProfileCreate(BaseYAPApplication):
|
||||||
|
name = u'ipython-profile'
|
||||||
|
description = create_help
|
||||||
|
examples = _create_examples
|
||||||
|
auto_create = Bool(True)
|
||||||
|
def _log_format_default(self):
|
||||||
|
return "[%(name)s] %(message)s"
|
||||||
|
|
||||||
|
def _copy_config_files_default(self):
|
||||||
|
return True
|
||||||
|
|
||||||
|
parallel = Bool(False,
|
||||||
|
help="whether to include parallel computing config files"
|
||||||
|
).tag(config=True)
|
||||||
|
|
||||||
|
@observe('parallel')
|
||||||
|
def _parallel_changed(self, change):
|
||||||
|
parallel_files = [ 'ipcontroller_config.py',
|
||||||
|
'ipengine_config.py',
|
||||||
|
'ipcluster_config.py'
|
||||||
|
]
|
||||||
|
if change['new']:
|
||||||
|
for cf in parallel_files:
|
||||||
|
self.config_files.append(cf)
|
||||||
|
else:
|
||||||
|
for cf in parallel_files:
|
||||||
|
if cf in self.config_files:
|
||||||
|
self.config_files.remove(cf)
|
||||||
|
|
||||||
|
def parse_command_line(self, argv):
|
||||||
|
super(ProfileCreate, self).parse_command_line(argv)
|
||||||
|
# accept positional arg as profile name
|
||||||
|
if self.extra_args:
|
||||||
|
self.profile = self.extra_args[0]
|
||||||
|
|
||||||
|
flags = Dict(create_flags)
|
||||||
|
|
||||||
|
classes = [ProfileDir]
|
||||||
|
|
||||||
|
def _import_app(self, app_path):
|
||||||
|
"""import an app class"""
|
||||||
|
app = None
|
||||||
|
name = app_path.rsplit('.', 1)[-1]
|
||||||
|
try:
|
||||||
|
app = import_item(app_path)
|
||||||
|
except ImportError:
|
||||||
|
self.log.info("Couldn't import %s, config file will be excluded", name)
|
||||||
|
except Exception:
|
||||||
|
self.log.warning('Unexpected error importing %s', name, exc_info=True)
|
||||||
|
return app
|
||||||
|
|
||||||
|
def init_config_files(self):
|
||||||
|
super(ProfileCreate, self).init_config_files()
|
||||||
|
# use local imports, since these classes may import from here
|
||||||
|
from yap_ipython.terminal.ipapp import TerminalIPythonApp
|
||||||
|
apps = [TerminalIPythonApp]
|
||||||
|
for app_path in (
|
||||||
|
'yap_kernel.kernelapp.YAPKernelApp',
|
||||||
|
):
|
||||||
|
app = self._import_app(app_path)
|
||||||
|
if app is not None:
|
||||||
|
apps.append(app)
|
||||||
|
if self.parallel:
|
||||||
|
from ipyparallel.apps.ipcontrollerapp import IPControllerApp
|
||||||
|
from ipyparallel.apps.ipengineapp import IPEngineApp
|
||||||
|
from ipyparallel.apps.ipclusterapp import IPClusterStart
|
||||||
|
apps.extend([
|
||||||
|
IPControllerApp,
|
||||||
|
IPEngineApp,
|
||||||
|
IPClusterStart,
|
||||||
|
])
|
||||||
|
for App in apps:
|
||||||
|
app = App()
|
||||||
|
app.config.update(self.config)
|
||||||
|
app.log = self.log
|
||||||
|
app.overwrite = self.overwrite
|
||||||
|
app.copy_config_files=True
|
||||||
|
app.ipython_dir=self.ipython_dir
|
||||||
|
app.profile_dir=self.profile_dir
|
||||||
|
app.init_config_files()
|
||||||
|
|
||||||
|
def stage_default_config_file(self):
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
|
class ProfileApp(Application):
|
||||||
|
name = u'ipython profile'
|
||||||
|
description = profile_help
|
||||||
|
examples = _main_examples
|
||||||
|
|
||||||
|
subcommands = Dict(dict(
|
||||||
|
create = (ProfileCreate, ProfileCreate.description.splitlines()[0]),
|
||||||
|
list = (ProfileList, ProfileList.description.splitlines()[0]),
|
||||||
|
locate = (ProfileLocate, ProfileLocate.description.splitlines()[0]),
|
||||||
|
))
|
||||||
|
|
||||||
|
def start(self):
|
||||||
|
if self.subapp is None:
|
||||||
|
print("No subcommand specified. Must specify one of: %s"%(self.subcommands.keys()))
|
||||||
|
print()
|
||||||
|
self.print_description()
|
||||||
|
self.print_subcommands()
|
||||||
|
self.exit(1)
|
||||||
|
else:
|
||||||
|
return self.subapp.start()
|
223
packages/python/yap_kernel/yap_ipython/core/profiledir.py
Normal file
223
packages/python/yap_kernel/yap_ipython/core/profiledir.py
Normal file
@ -0,0 +1,223 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""An object for managing yap_ipython profile directories."""
|
||||||
|
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
import os
|
||||||
|
import shutil
|
||||||
|
import errno
|
||||||
|
|
||||||
|
from traitlets.config.configurable import LoggingConfigurable
|
||||||
|
from yap_ipython.paths import get_ipython_package_dir
|
||||||
|
from yap_ipython.utils.path import expand_path, ensure_dir_exists
|
||||||
|
from traitlets import Unicode, Bool, observe
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Module errors
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
class ProfileDirError(Exception):
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Class for managing profile directories
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
class ProfileDir(LoggingConfigurable):
|
||||||
|
"""An object to manage the profile directory and its resources.
|
||||||
|
|
||||||
|
The profile directory is used by all yap_ipython applications, to manage
|
||||||
|
configuration, logging and security.
|
||||||
|
|
||||||
|
This object knows how to find, create and manage these directories. This
|
||||||
|
should be used by any code that wants to handle profiles.
|
||||||
|
"""
|
||||||
|
|
||||||
|
security_dir_name = Unicode('security')
|
||||||
|
log_dir_name = Unicode('log')
|
||||||
|
startup_dir_name = Unicode('startup')
|
||||||
|
pid_dir_name = Unicode('pid')
|
||||||
|
static_dir_name = Unicode('static')
|
||||||
|
security_dir = Unicode(u'')
|
||||||
|
log_dir = Unicode(u'')
|
||||||
|
startup_dir = Unicode(u'')
|
||||||
|
pid_dir = Unicode(u'')
|
||||||
|
static_dir = Unicode(u'')
|
||||||
|
|
||||||
|
location = Unicode(u'',
|
||||||
|
help="""Set the profile location directly. This overrides the logic used by the
|
||||||
|
`profile` option.""",
|
||||||
|
).tag(config=True)
|
||||||
|
|
||||||
|
_location_isset = Bool(False) # flag for detecting multiply set location
|
||||||
|
@observe('location')
|
||||||
|
def _location_changed(self, change):
|
||||||
|
if self._location_isset:
|
||||||
|
raise RuntimeError("Cannot set profile location more than once.")
|
||||||
|
self._location_isset = True
|
||||||
|
new = change['new']
|
||||||
|
ensure_dir_exists(new)
|
||||||
|
|
||||||
|
# ensure config files exist:
|
||||||
|
self.security_dir = os.path.join(new, self.security_dir_name)
|
||||||
|
self.log_dir = os.path.join(new, self.log_dir_name)
|
||||||
|
self.startup_dir = os.path.join(new, self.startup_dir_name)
|
||||||
|
self.pid_dir = os.path.join(new, self.pid_dir_name)
|
||||||
|
self.static_dir = os.path.join(new, self.static_dir_name)
|
||||||
|
self.check_dirs()
|
||||||
|
|
||||||
|
def _mkdir(self, path, mode=None):
|
||||||
|
"""ensure a directory exists at a given path
|
||||||
|
|
||||||
|
This is a version of os.mkdir, with the following differences:
|
||||||
|
|
||||||
|
- returns True if it created the directory, False otherwise
|
||||||
|
- ignores EEXIST, protecting against race conditions where
|
||||||
|
the dir may have been created in between the check and
|
||||||
|
the creation
|
||||||
|
- sets permissions if requested and the dir already exists
|
||||||
|
"""
|
||||||
|
if os.path.exists(path):
|
||||||
|
if mode and os.stat(path).st_mode != mode:
|
||||||
|
try:
|
||||||
|
os.chmod(path, mode)
|
||||||
|
except OSError:
|
||||||
|
self.log.warning(
|
||||||
|
"Could not set permissions on %s",
|
||||||
|
path
|
||||||
|
)
|
||||||
|
return False
|
||||||
|
try:
|
||||||
|
if mode:
|
||||||
|
os.mkdir(path, mode)
|
||||||
|
else:
|
||||||
|
os.mkdir(path)
|
||||||
|
except OSError as e:
|
||||||
|
if e.errno == errno.EEXIST:
|
||||||
|
return False
|
||||||
|
else:
|
||||||
|
raise
|
||||||
|
|
||||||
|
return True
|
||||||
|
|
||||||
|
@observe('log_dir')
|
||||||
|
def check_log_dir(self, change=None):
|
||||||
|
self._mkdir(self.log_dir)
|
||||||
|
|
||||||
|
@observe('startup_dir')
|
||||||
|
def check_startup_dir(self, change=None):
|
||||||
|
self._mkdir(self.startup_dir)
|
||||||
|
|
||||||
|
readme = os.path.join(self.startup_dir, 'README')
|
||||||
|
src = os.path.join(get_ipython_package_dir(), u'core', u'profile', u'README_STARTUP')
|
||||||
|
|
||||||
|
if not os.path.exists(src):
|
||||||
|
self.log.warning("Could not copy README_STARTUP to startup dir. Source file %s does not exist.", src)
|
||||||
|
|
||||||
|
if os.path.exists(src) and not os.path.exists(readme):
|
||||||
|
shutil.copy(src, readme)
|
||||||
|
|
||||||
|
@observe('security_dir')
|
||||||
|
def check_security_dir(self, change=None):
|
||||||
|
self._mkdir(self.security_dir, 0o40700)
|
||||||
|
|
||||||
|
@observe('pid_dir')
|
||||||
|
def check_pid_dir(self, change=None):
|
||||||
|
self._mkdir(self.pid_dir, 0o40700)
|
||||||
|
|
||||||
|
def check_dirs(self):
|
||||||
|
self.check_security_dir()
|
||||||
|
self.check_log_dir()
|
||||||
|
self.check_pid_dir()
|
||||||
|
self.check_startup_dir()
|
||||||
|
|
||||||
|
def copy_config_file(self, config_file, path=None, overwrite=False):
|
||||||
|
"""Copy a default config file into the active profile directory.
|
||||||
|
|
||||||
|
Default configuration files are kept in :mod:`yap_ipython.core.profile`.
|
||||||
|
This function moves these from that location to the working profile
|
||||||
|
directory.
|
||||||
|
"""
|
||||||
|
dst = os.path.join(self.location, config_file)
|
||||||
|
if os.path.isfile(dst) and not overwrite:
|
||||||
|
return False
|
||||||
|
if path is None:
|
||||||
|
path = os.path.join(get_ipython_package_dir(), u'core', u'profile', u'default')
|
||||||
|
src = os.path.join(path, config_file)
|
||||||
|
shutil.copy(src, dst)
|
||||||
|
return True
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def create_profile_dir(cls, profile_dir, config=None):
|
||||||
|
"""Create a new profile directory given a full path.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
profile_dir : str
|
||||||
|
The full path to the profile directory. If it does exist, it will
|
||||||
|
be used. If not, it will be created.
|
||||||
|
"""
|
||||||
|
return cls(location=profile_dir, config=config)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def create_profile_dir_by_name(cls, path, name=u'default', config=None):
|
||||||
|
"""Create a profile dir by profile name and path.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
path : unicode
|
||||||
|
The path (directory) to put the profile directory in.
|
||||||
|
name : unicode
|
||||||
|
The name of the profile. The name of the profile directory will
|
||||||
|
be "profile_<profile>".
|
||||||
|
"""
|
||||||
|
if not os.path.isdir(path):
|
||||||
|
raise ProfileDirError('Directory not found: %s' % path)
|
||||||
|
profile_dir = os.path.join(path, u'profile_' + name)
|
||||||
|
return cls(location=profile_dir, config=config)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def find_profile_dir_by_name(cls, ipython_dir, name=u'default', config=None):
|
||||||
|
"""Find an existing profile dir by profile name, return its ProfileDir.
|
||||||
|
|
||||||
|
This searches through a sequence of paths for a profile dir. If it
|
||||||
|
is not found, a :class:`ProfileDirError` exception will be raised.
|
||||||
|
|
||||||
|
The search path algorithm is:
|
||||||
|
1. ``os.getcwd()``
|
||||||
|
2. ``ipython_dir``
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
ipython_dir : unicode or str
|
||||||
|
The yap_ipython directory to use.
|
||||||
|
name : unicode or str
|
||||||
|
The name of the profile. The name of the profile directory
|
||||||
|
will be "profile_<profile>".
|
||||||
|
"""
|
||||||
|
dirname = u'profile_' + name
|
||||||
|
paths = [os.getcwd(), ipython_dir]
|
||||||
|
for p in paths:
|
||||||
|
profile_dir = os.path.join(p, dirname)
|
||||||
|
if os.path.isdir(profile_dir):
|
||||||
|
return cls(location=profile_dir, config=config)
|
||||||
|
else:
|
||||||
|
raise ProfileDirError('Profile directory not found in paths: %s' % dirname)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def find_profile_dir(cls, profile_dir, config=None):
|
||||||
|
"""Find/create a profile dir and return its ProfileDir.
|
||||||
|
|
||||||
|
This will create the profile directory if it doesn't exist.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
profile_dir : unicode or str
|
||||||
|
The path of the profile directory.
|
||||||
|
"""
|
||||||
|
profile_dir = expand_path(profile_dir)
|
||||||
|
if not os.path.isdir(profile_dir):
|
||||||
|
raise ProfileDirError('Profile directory not found: %s' % profile_dir)
|
||||||
|
return cls(location=profile_dir, config=config)
|
21
packages/python/yap_kernel/yap_ipython/core/prompts.py
Normal file
21
packages/python/yap_kernel/yap_ipython/core/prompts.py
Normal file
@ -0,0 +1,21 @@
|
|||||||
|
# -*- coding: utf-8 -*-
|
||||||
|
"""Being removed
|
||||||
|
"""
|
||||||
|
|
||||||
|
class LazyEvaluate(object):
|
||||||
|
"""This is used for formatting strings with values that need to be updated
|
||||||
|
at that time, such as the current time or working directory."""
|
||||||
|
def __init__(self, func, *args, **kwargs):
|
||||||
|
self.func = func
|
||||||
|
self.args = args
|
||||||
|
self.kwargs = kwargs
|
||||||
|
|
||||||
|
def __call__(self, **kwargs):
|
||||||
|
self.kwargs.update(kwargs)
|
||||||
|
return self.func(*self.args, **self.kwargs)
|
||||||
|
|
||||||
|
def __str__(self):
|
||||||
|
return str(self())
|
||||||
|
|
||||||
|
def __format__(self, format_spec):
|
||||||
|
return format(self(), format_spec)
|
412
packages/python/yap_kernel/yap_ipython/core/pylabtools.py
Normal file
412
packages/python/yap_kernel/yap_ipython/core/pylabtools.py
Normal file
@ -0,0 +1,412 @@
|
|||||||
|
# -*- coding: utf-8 -*-
|
||||||
|
"""Pylab (matplotlib) support utilities."""
|
||||||
|
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
from io import BytesIO
|
||||||
|
|
||||||
|
from yap_ipython.core.display import _pngxy
|
||||||
|
from yap_ipython.utils.decorators import flag_calls
|
||||||
|
|
||||||
|
# If user specifies a GUI, that dictates the backend, otherwise we read the
|
||||||
|
# user's mpl default from the mpl rc structure
|
||||||
|
backends = {'tk': 'TkAgg',
|
||||||
|
'gtk': 'GTKAgg',
|
||||||
|
'gtk3': 'GTK3Agg',
|
||||||
|
'wx': 'WXAgg',
|
||||||
|
'qt4': 'Qt4Agg',
|
||||||
|
'qt5': 'Qt5Agg',
|
||||||
|
'qt': 'Qt5Agg',
|
||||||
|
'osx': 'MacOSX',
|
||||||
|
'nbagg': 'nbAgg',
|
||||||
|
'notebook': 'nbAgg',
|
||||||
|
'agg': 'agg',
|
||||||
|
'svg': 'svg',
|
||||||
|
'pdf': 'pdf',
|
||||||
|
'ps': 'ps',
|
||||||
|
'inline': 'module://yap_kernel.pylab.backend_inline',
|
||||||
|
'ipympl': 'module://ipympl.backend_nbagg',
|
||||||
|
'widget': 'module://ipympl.backend_nbagg',
|
||||||
|
}
|
||||||
|
|
||||||
|
# We also need a reverse backends2guis mapping that will properly choose which
|
||||||
|
# GUI support to activate based on the desired matplotlib backend. For the
|
||||||
|
# most part it's just a reverse of the above dict, but we also need to add a
|
||||||
|
# few others that map to the same GUI manually:
|
||||||
|
backend2gui = dict(zip(backends.values(), backends.keys()))
|
||||||
|
# Our tests expect backend2gui to just return 'qt'
|
||||||
|
backend2gui['Qt4Agg'] = 'qt'
|
||||||
|
# In the reverse mapping, there are a few extra valid matplotlib backends that
|
||||||
|
# map to the same GUI support
|
||||||
|
backend2gui['GTK'] = backend2gui['GTKCairo'] = 'gtk'
|
||||||
|
backend2gui['GTK3Cairo'] = 'gtk3'
|
||||||
|
backend2gui['WX'] = 'wx'
|
||||||
|
backend2gui['CocoaAgg'] = 'osx'
|
||||||
|
# And some backends that don't need GUI integration
|
||||||
|
del backend2gui['nbAgg']
|
||||||
|
del backend2gui['agg']
|
||||||
|
del backend2gui['module://yap_kernel.pylab.backend_inline']
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Matplotlib utilities
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
|
||||||
|
def getfigs(*fig_nums):
|
||||||
|
"""Get a list of matplotlib figures by figure numbers.
|
||||||
|
|
||||||
|
If no arguments are given, all available figures are returned. If the
|
||||||
|
argument list contains references to invalid figures, a warning is printed
|
||||||
|
but the function continues pasting further figures.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
figs : tuple
|
||||||
|
A tuple of ints giving the figure numbers of the figures to return.
|
||||||
|
"""
|
||||||
|
from matplotlib._pylab_helpers import Gcf
|
||||||
|
if not fig_nums:
|
||||||
|
fig_managers = Gcf.get_all_fig_managers()
|
||||||
|
return [fm.canvas.figure for fm in fig_managers]
|
||||||
|
else:
|
||||||
|
figs = []
|
||||||
|
for num in fig_nums:
|
||||||
|
f = Gcf.figs.get(num)
|
||||||
|
if f is None:
|
||||||
|
print('Warning: figure %s not available.' % num)
|
||||||
|
else:
|
||||||
|
figs.append(f.canvas.figure)
|
||||||
|
return figs
|
||||||
|
|
||||||
|
|
||||||
|
def figsize(sizex, sizey):
|
||||||
|
"""Set the default figure size to be [sizex, sizey].
|
||||||
|
|
||||||
|
This is just an easy to remember, convenience wrapper that sets::
|
||||||
|
|
||||||
|
matplotlib.rcParams['figure.figsize'] = [sizex, sizey]
|
||||||
|
"""
|
||||||
|
import matplotlib
|
||||||
|
matplotlib.rcParams['figure.figsize'] = [sizex, sizey]
|
||||||
|
|
||||||
|
|
||||||
|
def print_figure(fig, fmt='png', bbox_inches='tight', **kwargs):
|
||||||
|
"""Print a figure to an image, and return the resulting file data
|
||||||
|
|
||||||
|
Returned data will be bytes unless ``fmt='svg'``,
|
||||||
|
in which case it will be unicode.
|
||||||
|
|
||||||
|
Any keyword args are passed to fig.canvas.print_figure,
|
||||||
|
such as ``quality`` or ``bbox_inches``.
|
||||||
|
"""
|
||||||
|
# When there's an empty figure, we shouldn't return anything, otherwise we
|
||||||
|
# get big blank areas in the qt console.
|
||||||
|
if not fig.axes and not fig.lines:
|
||||||
|
return
|
||||||
|
|
||||||
|
dpi = fig.dpi
|
||||||
|
if fmt == 'retina':
|
||||||
|
dpi = dpi * 2
|
||||||
|
fmt = 'png'
|
||||||
|
|
||||||
|
# build keyword args
|
||||||
|
kw = {
|
||||||
|
"format":fmt,
|
||||||
|
"facecolor":fig.get_facecolor(),
|
||||||
|
"edgecolor":fig.get_edgecolor(),
|
||||||
|
"dpi":dpi,
|
||||||
|
"bbox_inches":bbox_inches,
|
||||||
|
}
|
||||||
|
# **kwargs get higher priority
|
||||||
|
kw.update(kwargs)
|
||||||
|
|
||||||
|
bytes_io = BytesIO()
|
||||||
|
fig.canvas.print_figure(bytes_io, **kw)
|
||||||
|
data = bytes_io.getvalue()
|
||||||
|
if fmt == 'svg':
|
||||||
|
data = data.decode('utf-8')
|
||||||
|
return data
|
||||||
|
|
||||||
|
def retina_figure(fig, **kwargs):
|
||||||
|
"""format a figure as a pixel-doubled (retina) PNG"""
|
||||||
|
pngdata = print_figure(fig, fmt='retina', **kwargs)
|
||||||
|
# Make sure that retina_figure acts just like print_figure and returns
|
||||||
|
# None when the figure is empty.
|
||||||
|
if pngdata is None:
|
||||||
|
return
|
||||||
|
w, h = _pngxy(pngdata)
|
||||||
|
metadata = {"width": w//2, "height":h//2}
|
||||||
|
return pngdata, metadata
|
||||||
|
|
||||||
|
# We need a little factory function here to create the closure where
|
||||||
|
# safe_execfile can live.
|
||||||
|
def mpl_runner(safe_execfile):
|
||||||
|
"""Factory to return a matplotlib-enabled runner for %run.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
safe_execfile : function
|
||||||
|
This must be a function with the same interface as the
|
||||||
|
:meth:`safe_execfile` method of yap_ipython.
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
A function suitable for use as the ``runner`` argument of the %run magic
|
||||||
|
function.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def mpl_execfile(fname,*where,**kw):
|
||||||
|
"""matplotlib-aware wrapper around safe_execfile.
|
||||||
|
|
||||||
|
Its interface is identical to that of the :func:`execfile` builtin.
|
||||||
|
|
||||||
|
This is ultimately a call to execfile(), but wrapped in safeties to
|
||||||
|
properly handle interactive rendering."""
|
||||||
|
|
||||||
|
import matplotlib
|
||||||
|
import matplotlib.pyplot as plt
|
||||||
|
|
||||||
|
#print '*** Matplotlib runner ***' # dbg
|
||||||
|
# turn off rendering until end of script
|
||||||
|
is_interactive = matplotlib.rcParams['interactive']
|
||||||
|
matplotlib.interactive(False)
|
||||||
|
safe_execfile(fname,*where,**kw)
|
||||||
|
matplotlib.interactive(is_interactive)
|
||||||
|
# make rendering call now, if the user tried to do it
|
||||||
|
if plt.draw_if_interactive.called:
|
||||||
|
plt.draw()
|
||||||
|
plt.draw_if_interactive.called = False
|
||||||
|
|
||||||
|
# re-draw everything that is stale
|
||||||
|
try:
|
||||||
|
da = plt.draw_all
|
||||||
|
except AttributeError:
|
||||||
|
pass
|
||||||
|
else:
|
||||||
|
da()
|
||||||
|
|
||||||
|
return mpl_execfile
|
||||||
|
|
||||||
|
|
||||||
|
def _reshow_nbagg_figure(fig):
|
||||||
|
"""reshow an nbagg figure"""
|
||||||
|
try:
|
||||||
|
reshow = fig.canvas.manager.reshow
|
||||||
|
except AttributeError:
|
||||||
|
raise NotImplementedError()
|
||||||
|
else:
|
||||||
|
reshow()
|
||||||
|
|
||||||
|
|
||||||
|
def select_figure_formats(shell, formats, **kwargs):
|
||||||
|
"""Select figure formats for the inline backend.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
==========
|
||||||
|
shell : InteractiveShell
|
||||||
|
The main yap_ipython instance.
|
||||||
|
formats : str or set
|
||||||
|
One or a set of figure formats to enable: 'png', 'retina', 'jpeg', 'svg', 'pdf'.
|
||||||
|
**kwargs : any
|
||||||
|
Extra keyword arguments to be passed to fig.canvas.print_figure.
|
||||||
|
"""
|
||||||
|
import matplotlib
|
||||||
|
from matplotlib.figure import Figure
|
||||||
|
|
||||||
|
svg_formatter = shell.display_formatter.formatters['image/svg+xml']
|
||||||
|
png_formatter = shell.display_formatter.formatters['image/png']
|
||||||
|
jpg_formatter = shell.display_formatter.formatters['image/jpeg']
|
||||||
|
pdf_formatter = shell.display_formatter.formatters['application/pdf']
|
||||||
|
|
||||||
|
if isinstance(formats, str):
|
||||||
|
formats = {formats}
|
||||||
|
# cast in case of list / tuple
|
||||||
|
formats = set(formats)
|
||||||
|
|
||||||
|
[ f.pop(Figure, None) for f in shell.display_formatter.formatters.values() ]
|
||||||
|
mplbackend = matplotlib.get_backend().lower()
|
||||||
|
if mplbackend == 'nbagg' or mplbackend == 'module://ipympl.backend_nbagg':
|
||||||
|
formatter = shell.display_formatter.ipython_display_formatter
|
||||||
|
formatter.for_type(Figure, _reshow_nbagg_figure)
|
||||||
|
|
||||||
|
supported = {'png', 'png2x', 'retina', 'jpg', 'jpeg', 'svg', 'pdf'}
|
||||||
|
bad = formats.difference(supported)
|
||||||
|
if bad:
|
||||||
|
bs = "%s" % ','.join([repr(f) for f in bad])
|
||||||
|
gs = "%s" % ','.join([repr(f) for f in supported])
|
||||||
|
raise ValueError("supported formats are: %s not %s" % (gs, bs))
|
||||||
|
|
||||||
|
if 'png' in formats:
|
||||||
|
png_formatter.for_type(Figure, lambda fig: print_figure(fig, 'png', **kwargs))
|
||||||
|
if 'retina' in formats or 'png2x' in formats:
|
||||||
|
png_formatter.for_type(Figure, lambda fig: retina_figure(fig, **kwargs))
|
||||||
|
if 'jpg' in formats or 'jpeg' in formats:
|
||||||
|
jpg_formatter.for_type(Figure, lambda fig: print_figure(fig, 'jpg', **kwargs))
|
||||||
|
if 'svg' in formats:
|
||||||
|
svg_formatter.for_type(Figure, lambda fig: print_figure(fig, 'svg', **kwargs))
|
||||||
|
if 'pdf' in formats:
|
||||||
|
pdf_formatter.for_type(Figure, lambda fig: print_figure(fig, 'pdf', **kwargs))
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Code for initializing matplotlib and importing pylab
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
|
||||||
|
def find_gui_and_backend(gui=None, gui_select=None):
|
||||||
|
"""Given a gui string return the gui and mpl backend.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
gui : str
|
||||||
|
Can be one of ('tk','gtk','wx','qt','qt4','inline','agg').
|
||||||
|
gui_select : str
|
||||||
|
Can be one of ('tk','gtk','wx','qt','qt4','inline').
|
||||||
|
This is any gui already selected by the shell.
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
A tuple of (gui, backend) where backend is one of ('TkAgg','GTKAgg',
|
||||||
|
'WXAgg','Qt4Agg','module://yap_kernel.pylab.backend_inline','agg').
|
||||||
|
"""
|
||||||
|
|
||||||
|
import matplotlib
|
||||||
|
|
||||||
|
if gui and gui != 'auto':
|
||||||
|
# select backend based on requested gui
|
||||||
|
backend = backends[gui]
|
||||||
|
if gui == 'agg':
|
||||||
|
gui = None
|
||||||
|
else:
|
||||||
|
# We need to read the backend from the original data structure, *not*
|
||||||
|
# from mpl.rcParams, since a prior invocation of %matplotlib may have
|
||||||
|
# overwritten that.
|
||||||
|
# WARNING: this assumes matplotlib 1.1 or newer!!
|
||||||
|
backend = matplotlib.rcParamsOrig['backend']
|
||||||
|
# In this case, we need to find what the appropriate gui selection call
|
||||||
|
# should be for yap_ipython, so we can activate inputhook accordingly
|
||||||
|
gui = backend2gui.get(backend, None)
|
||||||
|
|
||||||
|
# If we have already had a gui active, we need it and inline are the
|
||||||
|
# ones allowed.
|
||||||
|
if gui_select and gui != gui_select:
|
||||||
|
gui = gui_select
|
||||||
|
backend = backends[gui]
|
||||||
|
|
||||||
|
return gui, backend
|
||||||
|
|
||||||
|
|
||||||
|
def activate_matplotlib(backend):
|
||||||
|
"""Activate the given backend and set interactive to True."""
|
||||||
|
|
||||||
|
import matplotlib
|
||||||
|
matplotlib.interactive(True)
|
||||||
|
|
||||||
|
# Matplotlib had a bug where even switch_backend could not force
|
||||||
|
# the rcParam to update. This needs to be set *before* the module
|
||||||
|
# magic of switch_backend().
|
||||||
|
matplotlib.rcParams['backend'] = backend
|
||||||
|
|
||||||
|
import matplotlib.pyplot
|
||||||
|
matplotlib.pyplot.switch_backend(backend)
|
||||||
|
|
||||||
|
# This must be imported last in the matplotlib series, after
|
||||||
|
# backend/interactivity choices have been made
|
||||||
|
import matplotlib.pyplot as plt
|
||||||
|
|
||||||
|
plt.show._needmain = False
|
||||||
|
# We need to detect at runtime whether show() is called by the user.
|
||||||
|
# For this, we wrap it into a decorator which adds a 'called' flag.
|
||||||
|
plt.draw_if_interactive = flag_calls(plt.draw_if_interactive)
|
||||||
|
|
||||||
|
|
||||||
|
def import_pylab(user_ns, import_all=True):
|
||||||
|
"""Populate the namespace with pylab-related values.
|
||||||
|
|
||||||
|
Imports matplotlib, pylab, numpy, and everything from pylab and numpy.
|
||||||
|
|
||||||
|
Also imports a few names from yap_ipython (figsize, display, getfigs)
|
||||||
|
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Import numpy as np/pyplot as plt are conventions we're trying to
|
||||||
|
# somewhat standardize on. Making them available to users by default
|
||||||
|
# will greatly help this.
|
||||||
|
s = ("import numpy\n"
|
||||||
|
"import matplotlib\n"
|
||||||
|
"from matplotlib import pylab, mlab, pyplot\n"
|
||||||
|
"np = numpy\n"
|
||||||
|
"plt = pyplot\n"
|
||||||
|
)
|
||||||
|
exec(s, user_ns)
|
||||||
|
|
||||||
|
if import_all:
|
||||||
|
s = ("from matplotlib.pylab import *\n"
|
||||||
|
"from numpy import *\n")
|
||||||
|
exec(s, user_ns)
|
||||||
|
|
||||||
|
# yap_ipython symbols to add
|
||||||
|
user_ns['figsize'] = figsize
|
||||||
|
from yap_ipython.core.display import display
|
||||||
|
# Add display and getfigs to the user's namespace
|
||||||
|
user_ns['display'] = display
|
||||||
|
user_ns['getfigs'] = getfigs
|
||||||
|
|
||||||
|
|
||||||
|
def configure_inline_support(shell, backend):
|
||||||
|
"""Configure an yap_ipython shell object for matplotlib use.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
shell : InteractiveShell instance
|
||||||
|
|
||||||
|
backend : matplotlib backend
|
||||||
|
"""
|
||||||
|
# If using our svg payload backend, register the post-execution
|
||||||
|
# function that will pick up the results for display. This can only be
|
||||||
|
# done with access to the real shell object.
|
||||||
|
|
||||||
|
# Note: if we can't load the inline backend, then there's no point
|
||||||
|
# continuing (such as in terminal-only shells in environments without
|
||||||
|
# zeromq available).
|
||||||
|
try:
|
||||||
|
from yap_kernel.pylab.backend_inline import InlineBackend
|
||||||
|
except ImportError:
|
||||||
|
return
|
||||||
|
import matplotlib
|
||||||
|
|
||||||
|
cfg = InlineBackend.instance(parent=shell)
|
||||||
|
cfg.shell = shell
|
||||||
|
if cfg not in shell.configurables:
|
||||||
|
shell.configurables.append(cfg)
|
||||||
|
|
||||||
|
if backend == backends['inline']:
|
||||||
|
from yap_kernel.pylab.backend_inline import flush_figures
|
||||||
|
shell.events.register('post_execute', flush_figures)
|
||||||
|
|
||||||
|
# Save rcParams that will be overwrittern
|
||||||
|
shell._saved_rcParams = {}
|
||||||
|
for k in cfg.rc:
|
||||||
|
shell._saved_rcParams[k] = matplotlib.rcParams[k]
|
||||||
|
# load inline_rc
|
||||||
|
matplotlib.rcParams.update(cfg.rc)
|
||||||
|
new_backend_name = "inline"
|
||||||
|
else:
|
||||||
|
from yap_kernel.pylab.backend_inline import flush_figures
|
||||||
|
try:
|
||||||
|
shell.events.unregister('post_execute', flush_figures)
|
||||||
|
except ValueError:
|
||||||
|
pass
|
||||||
|
if hasattr(shell, '_saved_rcParams'):
|
||||||
|
matplotlib.rcParams.update(shell._saved_rcParams)
|
||||||
|
del shell._saved_rcParams
|
||||||
|
new_backend_name = "other"
|
||||||
|
|
||||||
|
# only enable the formats once -> don't change the enabled formats (which the user may
|
||||||
|
# has changed) when getting another "%matplotlib inline" call.
|
||||||
|
# See https://github.com/ipython/yap_kernel/issues/29
|
||||||
|
cur_backend = getattr(configure_inline_support, "current_backend", "unset")
|
||||||
|
if new_backend_name != cur_backend:
|
||||||
|
# Setup the default figure format
|
||||||
|
select_figure_formats(shell, cfg.figure_formats, **cfg.print_figure_kwargs)
|
||||||
|
configure_inline_support.current_backend = new_backend_name
|
@ -1,8 +1,8 @@
|
|||||||
# -*- coding: utf-8 -*-
|
# -*- coding: utf-8 -*-
|
||||||
"""Release data for the IPython project."""
|
"""Release data for the yap_ipython project."""
|
||||||
|
|
||||||
#-----------------------------------------------------------------------------
|
#-----------------------------------------------------------------------------
|
||||||
# Copyright (c) 2008, IPython Development Team.
|
# Copyright (c) 2008, yap_ipython Development Team.
|
||||||
# Copyright (c) 2001, Fernando Perez <fernando.perez@colorado.edu>
|
# Copyright (c) 2001, Fernando Perez <fernando.perez@colorado.edu>
|
||||||
# Copyright (c) 2001, Janko Hauser <jhauser@zscout.de>
|
# Copyright (c) 2001, Janko Hauser <jhauser@zscout.de>
|
||||||
# Copyright (c) 2001, Nathaniel Gray <n8gray@caltech.edu>
|
# Copyright (c) 2001, Nathaniel Gray <n8gray@caltech.edu>
|
||||||
@ -16,15 +16,15 @@
|
|||||||
# the tarballs and RPMs made by distutils, so it's best to lowercase it.
|
# the tarballs and RPMs made by distutils, so it's best to lowercase it.
|
||||||
name = 'ipython'
|
name = 'ipython'
|
||||||
|
|
||||||
# IPython version information. An empty _version_extra corresponds to a full
|
# yap_ipython version information. An empty _version_extra corresponds to a full
|
||||||
# release. 'dev' as a _version_extra string means this is a development
|
# release. 'dev' as a _version_extra string means this is a development
|
||||||
# version
|
# version
|
||||||
_version_major = 0
|
_version_major = 6
|
||||||
_version_minor = 1
|
_version_minor = 2
|
||||||
_version_patch = 0
|
_version_patch = 0
|
||||||
_version_extra = '.dev'
|
_version_extra = '.dev'
|
||||||
# _version_extra = 'rc2'
|
# _version_extra = 'rc2'
|
||||||
_version_extra = '' # Uncomment this for full releases
|
#_version_extra = '' # Uncomment this for full releases
|
||||||
|
|
||||||
# Construct full version string from these.
|
# Construct full version string from these.
|
||||||
_ver = [_version_major, _version_minor, _version_patch]
|
_ver = [_version_major, _version_minor, _version_patch]
|
||||||
@ -40,11 +40,11 @@ version_info = (_version_major, _version_minor, _version_patch, _version_extra)
|
|||||||
kernel_protocol_version_info = (5, 0)
|
kernel_protocol_version_info = (5, 0)
|
||||||
kernel_protocol_version = "%i.%i" % kernel_protocol_version_info
|
kernel_protocol_version = "%i.%i" % kernel_protocol_version_info
|
||||||
|
|
||||||
description = "IPython: Productive Interactive Computing"
|
description = "yap_ipython: Productive Interactive Computing"
|
||||||
|
|
||||||
long_description = \
|
long_description = \
|
||||||
"""
|
"""
|
||||||
IPython provides a rich toolkit to help you make the most out of using Python
|
yap_ipython provides a rich toolkit to help you make the most out of using Python
|
||||||
interactively. Its main components are:
|
interactively. Its main components are:
|
||||||
|
|
||||||
* A powerful interactive Python shell
|
* A powerful interactive Python shell
|
||||||
@ -64,7 +64,7 @@ The enhanced interactive Python shells have the following main features:
|
|||||||
variables and keywords, filenames and function keywords.
|
variables and keywords, filenames and function keywords.
|
||||||
|
|
||||||
* Extensible system of 'magic' commands for controlling the environment and
|
* Extensible system of 'magic' commands for controlling the environment and
|
||||||
performing many tasks related either to IPython or the operating system.
|
performing many tasks related either to yap_ipython or the operating system.
|
||||||
|
|
||||||
* A rich configuration system with easy switching between different setups
|
* A rich configuration system with easy switching between different setups
|
||||||
(simpler than changing $PYTHONSTARTUP environment variables every time).
|
(simpler than changing $PYTHONSTARTUP environment variables every time).
|
||||||
@ -79,7 +79,7 @@ The enhanced interactive Python shells have the following main features:
|
|||||||
|
|
||||||
* Integrated access to the pdb debugger and the Python profiler.
|
* Integrated access to the pdb debugger and the Python profiler.
|
||||||
|
|
||||||
The latest development version is always available from IPython's `GitHub
|
The latest development version is always available from yap_ipython's `GitHub
|
||||||
site <http://github.com/ipython>`_.
|
site <http://github.com/ipython>`_.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
@ -96,7 +96,7 @@ authors = {'Fernando' : ('Fernando Perez','fperez.net@gmail.com'),
|
|||||||
'Matthias' : ('Matthias Bussonnier', 'bussonniermatthias@gmail.com'),
|
'Matthias' : ('Matthias Bussonnier', 'bussonniermatthias@gmail.com'),
|
||||||
}
|
}
|
||||||
|
|
||||||
author = 'The IPython Development Team'
|
author = 'The yap_ipython Development Team'
|
||||||
|
|
||||||
author_email = 'ipython-dev@python.org'
|
author_email = 'ipython-dev@python.org'
|
||||||
|
|
||||||
@ -108,11 +108,12 @@ platforms = ['Linux','Mac OSX','Windows']
|
|||||||
keywords = ['Interactive','Interpreter','Shell', 'Embedding']
|
keywords = ['Interactive','Interpreter','Shell', 'Embedding']
|
||||||
|
|
||||||
classifiers = [
|
classifiers = [
|
||||||
'Framework :: IPython',
|
'Framework :: yap_ipython',
|
||||||
'Intended Audience :: Developers',
|
'Intended Audience :: Developers',
|
||||||
'Intended Audience :: Science/Research',
|
'Intended Audience :: Science/Research',
|
||||||
'License :: OSI Approved :: BSD License',
|
'License :: OSI Approved :: BSD License',
|
||||||
'Programming Language :: Python',
|
'Programming Language :: Python',
|
||||||
'Programming Language :: Python :: 3',
|
'Programming Language :: Python :: 3',
|
||||||
|
'Programming Language :: Python :: 3 :: Only',
|
||||||
'Topic :: System :: Shells'
|
'Topic :: System :: Shells'
|
||||||
]
|
]
|
||||||
|
@ -1,10 +1,10 @@
|
|||||||
# encoding: utf-8
|
# encoding: utf-8
|
||||||
"""
|
"""
|
||||||
A mixin for :class:`~IPython.core.application.Application` classes that
|
A mixin for :class:`~yap_ipython.core.application.Application` classes that
|
||||||
launch InteractiveShell instances, load extensions, etc.
|
launch InteractiveShell instances, load extensions, etc.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
# Copyright (c) IPython Development Team.
|
# Copyright (c) yap_ipython Development Team.
|
||||||
# Distributed under the terms of the Modified BSD License.
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
import glob
|
import glob
|
||||||
@ -15,20 +15,14 @@ import sys
|
|||||||
from traitlets.config.application import boolean_flag
|
from traitlets.config.application import boolean_flag
|
||||||
from traitlets.config.configurable import Configurable
|
from traitlets.config.configurable import Configurable
|
||||||
from traitlets.config.loader import Config
|
from traitlets.config.loader import Config
|
||||||
from IPython.core.application import SYSTEM_CONFIG_DIRS
|
from yap_ipython.core.application import SYSTEM_CONFIG_DIRS, ENV_CONFIG_DIRS
|
||||||
from IPython.core import pylabtools
|
from yap_ipython.core import pylabtools
|
||||||
from IPython.utils.contexts import preserve_keys
|
from yap_ipython.utils.contexts import preserve_keys
|
||||||
from IPython.utils.path import filefind
|
from yap_ipython.utils.path import filefind
|
||||||
from traitlets import (
|
from traitlets import (
|
||||||
Unicode, Instance, List, Bool, CaselessStrEnum, observe,
|
Unicode, Instance, List, Bool, CaselessStrEnum, observe,
|
||||||
)
|
)
|
||||||
from IPython.terminal import pt_inputhooks
|
from yap_ipython.terminal import pt_inputhooks
|
||||||
|
|
||||||
ENV_CONFIG_DIRS = []
|
|
||||||
_env_config_dir = os.path.join(sys.prefix, 'etc', 'ipython')
|
|
||||||
if _env_config_dir not in SYSTEM_CONFIG_DIRS:
|
|
||||||
# only add ENV_CONFIG if sys.prefix is not already included
|
|
||||||
ENV_CONFIG_DIRS.append(_env_config_dir)
|
|
||||||
|
|
||||||
#-----------------------------------------------------------------------------
|
#-----------------------------------------------------------------------------
|
||||||
# Aliases and Flags
|
# Aliases and Flags
|
||||||
@ -42,15 +36,15 @@ backend_keys.insert(0, 'auto')
|
|||||||
shell_flags = {}
|
shell_flags = {}
|
||||||
|
|
||||||
addflag = lambda *args: shell_flags.update(boolean_flag(*args))
|
addflag = lambda *args: shell_flags.update(boolean_flag(*args))
|
||||||
addflag('autoindent', 'YAPInteractive.autoindent',
|
addflag('autoindent', 'InteractiveShell.autoindent',
|
||||||
'Turn on autoindenting.', 'Turn off autoindenting.'
|
'Turn on autoindenting.', 'Turn off autoindenting.'
|
||||||
)
|
)
|
||||||
addflag('automagic', 'YAPInteractive.automagic',
|
addflag('automagic', 'InteractiveShell.automagic',
|
||||||
"""Turn on the auto calling of magic commands. Type %%magic at the
|
"""Turn on the auto calling of magic commands. Type %%magic at the
|
||||||
IPython prompt for more information.""",
|
yap_ipython prompt for more information.""",
|
||||||
'Turn off the auto calling of magic commands.'
|
'Turn off the auto calling of magic commands.'
|
||||||
)
|
)
|
||||||
addflag('pdb', 'YAPInteractive.pdb',
|
addflag('pdb', 'InteractiveShell.pdb',
|
||||||
"Enable auto calling the pdb debugger after every exception.",
|
"Enable auto calling the pdb debugger after every exception.",
|
||||||
"Disable auto calling the pdb debugger after every exception."
|
"Disable auto calling the pdb debugger after every exception."
|
||||||
)
|
)
|
||||||
@ -58,8 +52,8 @@ addflag('pprint', 'PlainTextFormatter.pprint',
|
|||||||
"Enable auto pretty printing of results.",
|
"Enable auto pretty printing of results.",
|
||||||
"Disable auto pretty printing of results."
|
"Disable auto pretty printing of results."
|
||||||
)
|
)
|
||||||
addflag('color-info', 'YAPInteractive.color_info',
|
addflag('color-info', 'InteractiveShell.color_info',
|
||||||
"""IPython can display information about objects via a set of functions,
|
"""yap_ipython can display information about objects via a set of functions,
|
||||||
and optionally can use colors for this, syntax highlighting
|
and optionally can use colors for this, syntax highlighting
|
||||||
source code and various other elements. This is on by default, but can cause
|
source code and various other elements. This is on by default, but can cause
|
||||||
problems with some pagers. If you see such problems, you can disable the
|
problems with some pagers. If you see such problems, you can disable the
|
||||||
@ -67,43 +61,43 @@ addflag('color-info', 'YAPInteractive.color_info',
|
|||||||
"Disable using colors for info related things."
|
"Disable using colors for info related things."
|
||||||
)
|
)
|
||||||
nosep_config = Config()
|
nosep_config = Config()
|
||||||
nosep_config.YAPInteractive.separate_in = ''
|
nosep_config.InteractiveShell.separate_in = ''
|
||||||
nosep_config.YAPInteractive.separate_out = ''
|
nosep_config.InteractiveShell.separate_out = ''
|
||||||
nosep_config.YAPInteractive.separate_out2 = ''
|
nosep_config.InteractiveShell.separate_out2 = ''
|
||||||
|
|
||||||
shell_flags['nosep']=(nosep_config, "Eliminate all spacing between prompts.")
|
shell_flags['nosep']=(nosep_config, "Eliminate all spacing between prompts.")
|
||||||
shell_flags['pylab'] = (
|
shell_flags['pylab'] = (
|
||||||
{'YAPInteractiveApp' : {'pylab' : 'auto'}},
|
{'InteractiveShellApp' : {'pylab' : 'auto'}},
|
||||||
"""Pre-load matplotlib and numpy for interactive use with
|
"""Pre-load matplotlib and numpy for interactive use with
|
||||||
the default matplotlib backend."""
|
the default matplotlib backend."""
|
||||||
)
|
)
|
||||||
shell_flags['matplotlib'] = (
|
shell_flags['matplotlib'] = (
|
||||||
{'YAPInteractiveApp' : {'matplotlib' : 'auto'}},
|
{'InteractiveShellApp' : {'matplotlib' : 'auto'}},
|
||||||
"""Configure matplotlib for interactive use with
|
"""Configure matplotlib for interactive use with
|
||||||
the default matplotlib backend."""
|
the default matplotlib backend."""
|
||||||
)
|
)
|
||||||
|
|
||||||
# it's possible we don't want short aliases for *all* of these:
|
# it's possible we don't want short aliases for *all* of these:
|
||||||
shell_aliases = dict(
|
shell_aliases = dict(
|
||||||
autocall='YAPInteractive.autocall',
|
autocall='InteractiveShell.autocall',
|
||||||
colors='YAPInteractive.colors',
|
colors='InteractiveShell.colors',
|
||||||
logfile='YAPInteractive.logfile',
|
logfile='InteractiveShell.logfile',
|
||||||
logappend='YAPInteractive.logappend',
|
logappend='InteractiveShell.logappend',
|
||||||
c='YAPInteractiveApp.code_to_run',
|
c='InteractiveShellApp.code_to_run',
|
||||||
m='YAPInteractiveApp.module_to_run',
|
m='InteractiveShellApp.module_to_run',
|
||||||
ext='YAPInteractiveApp.extra_extension',
|
ext='InteractiveShellApp.extra_extension',
|
||||||
gui='YAPInteractiveApp.gui',
|
gui='InteractiveShellApp.gui',
|
||||||
pylab='YAPInteractiveApp.pylab',
|
pylab='InteractiveShellApp.pylab',
|
||||||
matplotlib='YAPInteractiveApp.matplotlib',
|
matplotlib='InteractiveShellApp.matplotlib',
|
||||||
)
|
)
|
||||||
shell_aliases['cache-size'] = 'YAPInteractive.cache_size'
|
shell_aliases['cache-size'] = 'InteractiveShell.cache_size'
|
||||||
|
|
||||||
#-----------------------------------------------------------------------------
|
#-----------------------------------------------------------------------------
|
||||||
# Main classes and functions
|
# Main classes and functions
|
||||||
#-----------------------------------------------------------------------------
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
class YAPInteractiveApp(Configurable):
|
class InteractiveShellApp(Configurable):
|
||||||
"""A Mixin for applications that start YAPInteractive instances.
|
"""A Mixin for applications that start InteractiveShell instances.
|
||||||
|
|
||||||
Provides configurables for loading extensions and executing files
|
Provides configurables for loading extensions and executing files
|
||||||
as part of configuring a Shell environment.
|
as part of configuring a Shell environment.
|
||||||
@ -118,14 +112,14 @@ class YAPInteractiveApp(Configurable):
|
|||||||
- :meth:`init_code`
|
- :meth:`init_code`
|
||||||
"""
|
"""
|
||||||
extensions = List(Unicode(),
|
extensions = List(Unicode(),
|
||||||
help="A list of dotted module names of IPython extensions to load."
|
help="A list of dotted module names of yap_ipython extensions to load."
|
||||||
).tag(config=True)
|
).tag(config=True)
|
||||||
extra_extension = Unicode('',
|
extra_extension = Unicode('',
|
||||||
help="dotted module name of an IPython extension to load."
|
help="dotted module name of an yap_ipython extension to load."
|
||||||
).tag(config=True)
|
).tag(config=True)
|
||||||
|
|
||||||
reraise_ipython_extension_failures = Bool(False,
|
reraise_ipython_extension_failures = Bool(False,
|
||||||
help="Reraise exceptions encountered loading IPython extensions?",
|
help="Reraise exceptions encountered loading yap_ipython extensions?",
|
||||||
).tag(config=True)
|
).tag(config=True)
|
||||||
|
|
||||||
# Extensions that are always loaded (not configurable)
|
# Extensions that are always loaded (not configurable)
|
||||||
@ -137,17 +131,17 @@ class YAPInteractiveApp(Configurable):
|
|||||||
).tag(config=True)
|
).tag(config=True)
|
||||||
|
|
||||||
exec_files = List(Unicode(),
|
exec_files = List(Unicode(),
|
||||||
help="""List of files to run at IPython startup."""
|
help="""List of files to run at yap_ipython startup."""
|
||||||
).tag(config=True)
|
).tag(config=True)
|
||||||
exec_PYTHONSTARTUP = Bool(True,
|
exec_PYTHONSTARTUP = Bool(True,
|
||||||
help="""Run the file referenced by the PYTHONSTARTUP environment
|
help="""Run the file referenced by the PYTHONSTARTUP environment
|
||||||
variable at IPython startup."""
|
variable at yap_ipython startup."""
|
||||||
).tag(config=True)
|
).tag(config=True)
|
||||||
file_to_run = Unicode('',
|
file_to_run = Unicode('',
|
||||||
help="""A file to be run""").tag(config=True)
|
help="""A file to be run""").tag(config=True)
|
||||||
|
|
||||||
exec_lines = List(Unicode(),
|
exec_lines = List(Unicode(),
|
||||||
help="""lines of code to run at IPython startup."""
|
help="""lines of code to run at yap_ipython startup."""
|
||||||
).tag(config=True)
|
).tag(config=True)
|
||||||
code_to_run = Unicode('',
|
code_to_run = Unicode('',
|
||||||
help="Execute the given command string."
|
help="Execute the given command string."
|
||||||
@ -168,13 +162,13 @@ class YAPInteractiveApp(Configurable):
|
|||||||
"""
|
"""
|
||||||
).tag(config=True)
|
).tag(config=True)
|
||||||
pylab_import_all = Bool(True,
|
pylab_import_all = Bool(True,
|
||||||
help="""If true, IPython will populate the user namespace with numpy, pylab, etc.
|
help="""If true, yap_ipython will populate the user namespace with numpy, pylab, etc.
|
||||||
and an ``import *`` is done from numpy and pylab, when using pylab mode.
|
and an ``import *`` is done from numpy and pylab, when using pylab mode.
|
||||||
|
|
||||||
When False, pylab mode should not import any names into the user namespace.
|
When False, pylab mode should not import any names into the user namespace.
|
||||||
"""
|
"""
|
||||||
).tag(config=True)
|
).tag(config=True)
|
||||||
shell = Instance('yap_ipython.core.interactiveshell.YAPInteractiveABC',
|
shell = Instance('yap_ipython.core.interactiveshell.InteractiveShellABC',
|
||||||
allow_none=True)
|
allow_none=True)
|
||||||
# whether interact-loop should start
|
# whether interact-loop should start
|
||||||
interact = Bool(True)
|
interact = Bool(True)
|
||||||
@ -234,19 +228,19 @@ class YAPInteractiveApp(Configurable):
|
|||||||
"eventloop=%s", gui)
|
"eventloop=%s", gui)
|
||||||
|
|
||||||
def init_extensions(self):
|
def init_extensions(self):
|
||||||
"""Load all IPython extensions in IPythonApp.extensions.
|
"""Load all yap_ipython extensions in IPythonApp.extensions.
|
||||||
|
|
||||||
This uses the :meth:`ExtensionManager.load_extensions` to load all
|
This uses the :meth:`ExtensionManager.load_extensions` to load all
|
||||||
the extensions listed in ``self.extensions``.
|
the extensions listed in ``self.extensions``.
|
||||||
"""
|
"""
|
||||||
try:
|
try:
|
||||||
self.log.debug("Loading IPython extensions...")
|
self.log.debug("Loading yap_ipython extensions...")
|
||||||
extensions = self.default_extensions + self.extensions
|
extensions = self.default_extensions + self.extensions
|
||||||
if self.extra_extension:
|
if self.extra_extension:
|
||||||
extensions.append(self.extra_extension)
|
extensions.append(self.extra_extension)
|
||||||
for ext in extensions:
|
for ext in extensions:
|
||||||
try:
|
try:
|
||||||
self.log.info("Loading IPython extension: %s" % ext)
|
self.log.info("Loading yap_ipython extension: %s" % ext)
|
||||||
self.shell.extension_manager.load_extension(ext)
|
self.shell.extension_manager.load_extension(ext)
|
||||||
except:
|
except:
|
||||||
if self.reraise_ipython_extension_failures:
|
if self.reraise_ipython_extension_failures:
|
||||||
|
137
packages/python/yap_kernel/yap_ipython/core/splitinput.py
Normal file
137
packages/python/yap_kernel/yap_ipython/core/splitinput.py
Normal file
@ -0,0 +1,137 @@
|
|||||||
|
# encoding: utf-8
|
||||||
|
"""
|
||||||
|
Simple utility for splitting user input. This is used by both inputsplitter and
|
||||||
|
prefilter.
|
||||||
|
|
||||||
|
Authors:
|
||||||
|
|
||||||
|
* Brian Granger
|
||||||
|
* Fernando Perez
|
||||||
|
"""
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2008-2011 The yap_ipython Development Team
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
|
# the file COPYING, distributed as part of this software.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Imports
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
import re
|
||||||
|
import sys
|
||||||
|
|
||||||
|
from yap_ipython.utils import py3compat
|
||||||
|
from yap_ipython.utils.encoding import get_stream_enc
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Main function
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
# RegExp for splitting line contents into pre-char//first word-method//rest.
|
||||||
|
# For clarity, each group in on one line.
|
||||||
|
|
||||||
|
# WARNING: update the regexp if the escapes in interactiveshell are changed, as
|
||||||
|
# they are hardwired in.
|
||||||
|
|
||||||
|
# Although it's not solely driven by the regex, note that:
|
||||||
|
# ,;/% only trigger if they are the first character on the line
|
||||||
|
# ! and !! trigger if they are first char(s) *or* follow an indent
|
||||||
|
# ? triggers as first or last char.
|
||||||
|
|
||||||
|
line_split = re.compile("""
|
||||||
|
^(\s*) # any leading space
|
||||||
|
([,;/%]|!!?|\?\??)? # escape character or characters
|
||||||
|
\s*(%{0,2}[\w\.\*]*) # function/method, possibly with leading %
|
||||||
|
# to correctly treat things like '?%magic'
|
||||||
|
(.*?$|$) # rest of line
|
||||||
|
""", re.VERBOSE)
|
||||||
|
|
||||||
|
|
||||||
|
def split_user_input(line, pattern=None):
|
||||||
|
"""Split user input into initial whitespace, escape character, function part
|
||||||
|
and the rest.
|
||||||
|
"""
|
||||||
|
# We need to ensure that the rest of this routine deals only with unicode
|
||||||
|
encoding = get_stream_enc(sys.stdin, 'utf-8')
|
||||||
|
line = py3compat.cast_unicode(line, encoding)
|
||||||
|
|
||||||
|
if pattern is None:
|
||||||
|
pattern = line_split
|
||||||
|
match = pattern.match(line)
|
||||||
|
if not match:
|
||||||
|
# print "match failed for line '%s'" % line
|
||||||
|
try:
|
||||||
|
ifun, the_rest = line.split(None,1)
|
||||||
|
except ValueError:
|
||||||
|
# print "split failed for line '%s'" % line
|
||||||
|
ifun, the_rest = line, u''
|
||||||
|
pre = re.match('^(\s*)(.*)',line).groups()[0]
|
||||||
|
esc = ""
|
||||||
|
else:
|
||||||
|
pre, esc, ifun, the_rest = match.groups()
|
||||||
|
|
||||||
|
#print 'line:<%s>' % line # dbg
|
||||||
|
#print 'pre <%s> ifun <%s> rest <%s>' % (pre,ifun.strip(),the_rest) # dbg
|
||||||
|
return pre, esc or '', ifun.strip(), the_rest.lstrip()
|
||||||
|
|
||||||
|
|
||||||
|
class LineInfo(object):
|
||||||
|
"""A single line of input and associated info.
|
||||||
|
|
||||||
|
Includes the following as properties:
|
||||||
|
|
||||||
|
line
|
||||||
|
The original, raw line
|
||||||
|
|
||||||
|
continue_prompt
|
||||||
|
Is this line a continuation in a sequence of multiline input?
|
||||||
|
|
||||||
|
pre
|
||||||
|
Any leading whitespace.
|
||||||
|
|
||||||
|
esc
|
||||||
|
The escape character(s) in pre or the empty string if there isn't one.
|
||||||
|
Note that '!!' and '??' are possible values for esc. Otherwise it will
|
||||||
|
always be a single character.
|
||||||
|
|
||||||
|
ifun
|
||||||
|
The 'function part', which is basically the maximal initial sequence
|
||||||
|
of valid python identifiers and the '.' character. This is what is
|
||||||
|
checked for alias and magic transformations, used for auto-calling,
|
||||||
|
etc. In contrast to Python identifiers, it may start with "%" and contain
|
||||||
|
"*".
|
||||||
|
|
||||||
|
the_rest
|
||||||
|
Everything else on the line.
|
||||||
|
"""
|
||||||
|
def __init__(self, line, continue_prompt=False):
|
||||||
|
self.line = line
|
||||||
|
self.continue_prompt = continue_prompt
|
||||||
|
self.pre, self.esc, self.ifun, self.the_rest = split_user_input(line)
|
||||||
|
|
||||||
|
self.pre_char = self.pre.strip()
|
||||||
|
if self.pre_char:
|
||||||
|
self.pre_whitespace = '' # No whitespace allowd before esc chars
|
||||||
|
else:
|
||||||
|
self.pre_whitespace = self.pre
|
||||||
|
|
||||||
|
def ofind(self, ip):
|
||||||
|
"""Do a full, attribute-walking lookup of the ifun in the various
|
||||||
|
namespaces for the given yap_ipython InteractiveShell instance.
|
||||||
|
|
||||||
|
Return a dict with keys: {found, obj, ospace, ismagic}
|
||||||
|
|
||||||
|
Note: can cause state changes because of calling getattr, but should
|
||||||
|
only be run if autocall is on and if the line hasn't matched any
|
||||||
|
other, less dangerous handlers.
|
||||||
|
|
||||||
|
Does cache the results of the call, so can be called multiple times
|
||||||
|
without worrying about *further* damaging state.
|
||||||
|
"""
|
||||||
|
return ip._ofind(self.ifun)
|
||||||
|
|
||||||
|
def __str__(self):
|
||||||
|
return "LineInfo [%s|%s|%s|%s]" %(self.pre, self.esc, self.ifun, self.the_rest)
|
1461
packages/python/yap_kernel/yap_ipython/core/ultratb.py
Normal file
1461
packages/python/yap_kernel/yap_ipython/core/ultratb.py
Normal file
File diff suppressed because it is too large
Load Diff
348
packages/python/yap_kernel/yap_ipython/core/usage.py
Normal file
348
packages/python/yap_kernel/yap_ipython/core/usage.py
Normal file
@ -0,0 +1,348 @@
|
|||||||
|
# -*- coding: utf-8 -*-
|
||||||
|
"""Usage information for the main yap_ipython applications.
|
||||||
|
"""
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2008-2011 The yap_ipython Development Team
|
||||||
|
# Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu>
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
|
# the file COPYING, distributed as part of this software.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
import sys
|
||||||
|
from yap_ipython.core import release
|
||||||
|
|
||||||
|
cl_usage = """\
|
||||||
|
=========
|
||||||
|
yap_ipython
|
||||||
|
=========
|
||||||
|
|
||||||
|
Tools for Interactive Computing in Python
|
||||||
|
=========================================
|
||||||
|
|
||||||
|
A Python shell with automatic history (input and output), dynamic object
|
||||||
|
introspection, easier configuration, command completion, access to the
|
||||||
|
system shell and more. yap_ipython can also be embedded in running programs.
|
||||||
|
|
||||||
|
|
||||||
|
Usage
|
||||||
|
|
||||||
|
ipython [subcommand] [options] [-c cmd | -m mod | file] [--] [arg] ...
|
||||||
|
|
||||||
|
If invoked with no options, it executes the file and exits, passing the
|
||||||
|
remaining arguments to the script, just as if you had specified the same
|
||||||
|
command with python. You may need to specify `--` before args to be passed
|
||||||
|
to the script, to prevent yap_ipython from attempting to parse them. If you
|
||||||
|
specify the option `-i` before the filename, it will enter an interactive
|
||||||
|
yap_ipython session after running the script, rather than exiting. Files ending
|
||||||
|
in .py will be treated as normal Python, but files ending in .ipy can
|
||||||
|
contain special yap_ipython syntax (magic commands, shell expansions, etc.).
|
||||||
|
|
||||||
|
Almost all configuration in yap_ipython is available via the command-line. Do
|
||||||
|
`ipython --help-all` to see all available options. For persistent
|
||||||
|
configuration, look into your `ipython_config.py` configuration file for
|
||||||
|
details.
|
||||||
|
|
||||||
|
This file is typically installed in the `IPYTHONDIR` directory, and there
|
||||||
|
is a separate configuration directory for each profile. The default profile
|
||||||
|
directory will be located in $IPYTHONDIR/profile_default. IPYTHONDIR
|
||||||
|
defaults to to `$HOME/.ipython`. For Windows users, $HOME resolves to
|
||||||
|
C:\\Users\\YourUserName in most instances.
|
||||||
|
|
||||||
|
To initialize a profile with the default configuration file, do::
|
||||||
|
|
||||||
|
$> ipython profile create
|
||||||
|
|
||||||
|
and start editing `IPYTHONDIR/profile_default/ipython_config.py`
|
||||||
|
|
||||||
|
In yap_ipython's documentation, we will refer to this directory as
|
||||||
|
`IPYTHONDIR`, you can change its default location by creating an
|
||||||
|
environment variable with this name and setting it to the desired path.
|
||||||
|
|
||||||
|
For more information, see the manual available in HTML and PDF in your
|
||||||
|
installation, or online at http://ipython.org/documentation.html.
|
||||||
|
"""
|
||||||
|
|
||||||
|
interactive_usage = """
|
||||||
|
yap_ipython -- An enhanced Interactive Python
|
||||||
|
=========================================
|
||||||
|
|
||||||
|
yap_ipython offers a fully compatible replacement for the standard Python
|
||||||
|
interpreter, with convenient shell features, special commands, command
|
||||||
|
history mechanism and output results caching.
|
||||||
|
|
||||||
|
At your system command line, type 'ipython -h' to see the command line
|
||||||
|
options available. This document only describes interactive features.
|
||||||
|
|
||||||
|
GETTING HELP
|
||||||
|
------------
|
||||||
|
|
||||||
|
Within yap_ipython you have various way to access help:
|
||||||
|
|
||||||
|
? -> Introduction and overview of yap_ipython's features (this screen).
|
||||||
|
object? -> Details about 'object'.
|
||||||
|
object?? -> More detailed, verbose information about 'object'.
|
||||||
|
%quickref -> Quick reference of all yap_ipython specific syntax and magics.
|
||||||
|
help -> Access Python's own help system.
|
||||||
|
|
||||||
|
If you are in terminal yap_ipython you can quit this screen by pressing `q`.
|
||||||
|
|
||||||
|
|
||||||
|
MAIN FEATURES
|
||||||
|
-------------
|
||||||
|
|
||||||
|
* Access to the standard Python help with object docstrings and the Python
|
||||||
|
manuals. Simply type 'help' (no quotes) to invoke it.
|
||||||
|
|
||||||
|
* Magic commands: type %magic for information on the magic subsystem.
|
||||||
|
|
||||||
|
* System command aliases, via the %alias command or the configuration file(s).
|
||||||
|
|
||||||
|
* Dynamic object information:
|
||||||
|
|
||||||
|
Typing ?word or word? prints detailed information about an object. Certain
|
||||||
|
long strings (code, etc.) get snipped in the center for brevity.
|
||||||
|
|
||||||
|
Typing ??word or word?? gives access to the full information without
|
||||||
|
snipping long strings. Strings that are longer than the screen are printed
|
||||||
|
through the less pager.
|
||||||
|
|
||||||
|
The ?/?? system gives access to the full source code for any object (if
|
||||||
|
available), shows function prototypes and other useful information.
|
||||||
|
|
||||||
|
If you just want to see an object's docstring, type '%pdoc object' (without
|
||||||
|
quotes, and without % if you have automagic on).
|
||||||
|
|
||||||
|
* Tab completion in the local namespace:
|
||||||
|
|
||||||
|
At any time, hitting tab will complete any available python commands or
|
||||||
|
variable names, and show you a list of the possible completions if there's
|
||||||
|
no unambiguous one. It will also complete filenames in the current directory.
|
||||||
|
|
||||||
|
* Search previous command history in multiple ways:
|
||||||
|
|
||||||
|
- Start typing, and then use arrow keys up/down or (Ctrl-p/Ctrl-n) to search
|
||||||
|
through the history items that match what you've typed so far.
|
||||||
|
|
||||||
|
- Hit Ctrl-r: opens a search prompt. Begin typing and the system searches
|
||||||
|
your history for lines that match what you've typed so far, completing as
|
||||||
|
much as it can.
|
||||||
|
|
||||||
|
- %hist: search history by index.
|
||||||
|
|
||||||
|
* Persistent command history across sessions.
|
||||||
|
|
||||||
|
* Logging of input with the ability to save and restore a working session.
|
||||||
|
|
||||||
|
* System shell with !. Typing !ls will run 'ls' in the current directory.
|
||||||
|
|
||||||
|
* The reload command does a 'deep' reload of a module: changes made to the
|
||||||
|
module since you imported will actually be available without having to exit.
|
||||||
|
|
||||||
|
* Verbose and colored exception traceback printouts. See the magic xmode and
|
||||||
|
xcolor functions for details (just type %magic).
|
||||||
|
|
||||||
|
* Input caching system:
|
||||||
|
|
||||||
|
yap_ipython offers numbered prompts (In/Out) with input and output caching. All
|
||||||
|
input is saved and can be retrieved as variables (besides the usual arrow
|
||||||
|
key recall).
|
||||||
|
|
||||||
|
The following GLOBAL variables always exist (so don't overwrite them!):
|
||||||
|
_i: stores previous input.
|
||||||
|
_ii: next previous.
|
||||||
|
_iii: next-next previous.
|
||||||
|
_ih : a list of all input _ih[n] is the input from line n.
|
||||||
|
|
||||||
|
Additionally, global variables named _i<n> are dynamically created (<n>
|
||||||
|
being the prompt counter), such that _i<n> == _ih[<n>]
|
||||||
|
|
||||||
|
For example, what you typed at prompt 14 is available as _i14 and _ih[14].
|
||||||
|
|
||||||
|
You can create macros which contain multiple input lines from this history,
|
||||||
|
for later re-execution, with the %macro function.
|
||||||
|
|
||||||
|
The history function %hist allows you to see any part of your input history
|
||||||
|
by printing a range of the _i variables. Note that inputs which contain
|
||||||
|
magic functions (%) appear in the history with a prepended comment. This is
|
||||||
|
because they aren't really valid Python code, so you can't exec them.
|
||||||
|
|
||||||
|
* Output caching system:
|
||||||
|
|
||||||
|
For output that is returned from actions, a system similar to the input
|
||||||
|
cache exists but using _ instead of _i. Only actions that produce a result
|
||||||
|
(NOT assignments, for example) are cached. If you are familiar with
|
||||||
|
Mathematica, yap_ipython's _ variables behave exactly like Mathematica's %
|
||||||
|
variables.
|
||||||
|
|
||||||
|
The following GLOBAL variables always exist (so don't overwrite them!):
|
||||||
|
_ (one underscore): previous output.
|
||||||
|
__ (two underscores): next previous.
|
||||||
|
___ (three underscores): next-next previous.
|
||||||
|
|
||||||
|
Global variables named _<n> are dynamically created (<n> being the prompt
|
||||||
|
counter), such that the result of output <n> is always available as _<n>.
|
||||||
|
|
||||||
|
Finally, a global dictionary named _oh exists with entries for all lines
|
||||||
|
which generated output.
|
||||||
|
|
||||||
|
* Directory history:
|
||||||
|
|
||||||
|
Your history of visited directories is kept in the global list _dh, and the
|
||||||
|
magic %cd command can be used to go to any entry in that list.
|
||||||
|
|
||||||
|
* Auto-parentheses and auto-quotes (adapted from Nathan Gray's LazyPython)
|
||||||
|
|
||||||
|
1. Auto-parentheses
|
||||||
|
|
||||||
|
Callable objects (i.e. functions, methods, etc) can be invoked like
|
||||||
|
this (notice the commas between the arguments)::
|
||||||
|
|
||||||
|
In [1]: callable_ob arg1, arg2, arg3
|
||||||
|
|
||||||
|
and the input will be translated to this::
|
||||||
|
|
||||||
|
callable_ob(arg1, arg2, arg3)
|
||||||
|
|
||||||
|
This feature is off by default (in rare cases it can produce
|
||||||
|
undesirable side-effects), but you can activate it at the command-line
|
||||||
|
by starting yap_ipython with `--autocall 1`, set it permanently in your
|
||||||
|
configuration file, or turn on at runtime with `%autocall 1`.
|
||||||
|
|
||||||
|
You can force auto-parentheses by using '/' as the first character
|
||||||
|
of a line. For example::
|
||||||
|
|
||||||
|
In [1]: /globals # becomes 'globals()'
|
||||||
|
|
||||||
|
Note that the '/' MUST be the first character on the line! This
|
||||||
|
won't work::
|
||||||
|
|
||||||
|
In [2]: print /globals # syntax error
|
||||||
|
|
||||||
|
In most cases the automatic algorithm should work, so you should
|
||||||
|
rarely need to explicitly invoke /. One notable exception is if you
|
||||||
|
are trying to call a function with a list of tuples as arguments (the
|
||||||
|
parenthesis will confuse yap_ipython)::
|
||||||
|
|
||||||
|
In [1]: zip (1,2,3),(4,5,6) # won't work
|
||||||
|
|
||||||
|
but this will work::
|
||||||
|
|
||||||
|
In [2]: /zip (1,2,3),(4,5,6)
|
||||||
|
------> zip ((1,2,3),(4,5,6))
|
||||||
|
Out[2]= [(1, 4), (2, 5), (3, 6)]
|
||||||
|
|
||||||
|
yap_ipython tells you that it has altered your command line by
|
||||||
|
displaying the new command line preceded by -->. e.g.::
|
||||||
|
|
||||||
|
In [18]: callable list
|
||||||
|
-------> callable (list)
|
||||||
|
|
||||||
|
2. Auto-Quoting
|
||||||
|
|
||||||
|
You can force auto-quoting of a function's arguments by using ',' as
|
||||||
|
the first character of a line. For example::
|
||||||
|
|
||||||
|
In [1]: ,my_function /home/me # becomes my_function("/home/me")
|
||||||
|
|
||||||
|
If you use ';' instead, the whole argument is quoted as a single
|
||||||
|
string (while ',' splits on whitespace)::
|
||||||
|
|
||||||
|
In [2]: ,my_function a b c # becomes my_function("a","b","c")
|
||||||
|
In [3]: ;my_function a b c # becomes my_function("a b c")
|
||||||
|
|
||||||
|
Note that the ',' MUST be the first character on the line! This
|
||||||
|
won't work::
|
||||||
|
|
||||||
|
In [4]: x = ,my_function /home/me # syntax error
|
||||||
|
"""
|
||||||
|
|
||||||
|
interactive_usage_min = """\
|
||||||
|
An enhanced console for Python.
|
||||||
|
Some of its features are:
|
||||||
|
- Tab completion in the local namespace.
|
||||||
|
- Logging of input, see command-line options.
|
||||||
|
- System shell escape via ! , eg !ls.
|
||||||
|
- Magic commands, starting with a % (like %ls, %pwd, %cd, etc.)
|
||||||
|
- Keeps track of locally defined variables via %who, %whos.
|
||||||
|
- Show object information with a ? eg ?x or x? (use ?? for more info).
|
||||||
|
"""
|
||||||
|
|
||||||
|
quick_reference = r"""
|
||||||
|
yap_ipython -- An enhanced Interactive Python - Quick Reference Card
|
||||||
|
================================================================
|
||||||
|
|
||||||
|
obj?, obj?? : Get help, or more help for object (also works as
|
||||||
|
?obj, ??obj).
|
||||||
|
?foo.*abc* : List names in 'foo' containing 'abc' in them.
|
||||||
|
%magic : Information about yap_ipython's 'magic' % functions.
|
||||||
|
|
||||||
|
Magic functions are prefixed by % or %%, and typically take their arguments
|
||||||
|
without parentheses, quotes or even commas for convenience. Line magics take a
|
||||||
|
single % and cell magics are prefixed with two %%.
|
||||||
|
|
||||||
|
Example magic function calls:
|
||||||
|
|
||||||
|
%alias d ls -F : 'd' is now an alias for 'ls -F'
|
||||||
|
alias d ls -F : Works if 'alias' not a python name
|
||||||
|
alist = %alias : Get list of aliases to 'alist'
|
||||||
|
cd /usr/share : Obvious. cd -<tab> to choose from visited dirs.
|
||||||
|
%cd?? : See help AND source for magic %cd
|
||||||
|
%timeit x=10 : time the 'x=10' statement with high precision.
|
||||||
|
%%timeit x=2**100
|
||||||
|
x**100 : time 'x**100' with a setup of 'x=2**100'; setup code is not
|
||||||
|
counted. This is an example of a cell magic.
|
||||||
|
|
||||||
|
System commands:
|
||||||
|
|
||||||
|
!cp a.txt b/ : System command escape, calls os.system()
|
||||||
|
cp a.txt b/ : after %rehashx, most system commands work without !
|
||||||
|
cp ${f}.txt $bar : Variable expansion in magics and system commands
|
||||||
|
files = !ls /usr : Capture system command output
|
||||||
|
files.s, files.l, files.n: "a b c", ['a','b','c'], 'a\nb\nc'
|
||||||
|
|
||||||
|
History:
|
||||||
|
|
||||||
|
_i, _ii, _iii : Previous, next previous, next next previous input
|
||||||
|
_i4, _ih[2:5] : Input history line 4, lines 2-4
|
||||||
|
exec _i81 : Execute input history line #81 again
|
||||||
|
%rep 81 : Edit input history line #81
|
||||||
|
_, __, ___ : previous, next previous, next next previous output
|
||||||
|
_dh : Directory history
|
||||||
|
_oh : Output history
|
||||||
|
%hist : Command history of current session.
|
||||||
|
%hist -g foo : Search command history of (almost) all sessions for 'foo'.
|
||||||
|
%hist -g : Command history of (almost) all sessions.
|
||||||
|
%hist 1/2-8 : Command history containing lines 2-8 of session 1.
|
||||||
|
%hist 1/ ~2/ : Command history of session 1 and 2 sessions before current.
|
||||||
|
%hist ~8/1-~6/5 : Command history from line 1 of 8 sessions ago to
|
||||||
|
line 5 of 6 sessions ago.
|
||||||
|
%edit 0/ : Open editor to execute code with history of current session.
|
||||||
|
|
||||||
|
Autocall:
|
||||||
|
|
||||||
|
f 1,2 : f(1,2) # Off by default, enable with %autocall magic.
|
||||||
|
/f 1,2 : f(1,2) (forced autoparen)
|
||||||
|
,f 1 2 : f("1","2")
|
||||||
|
;f 1 2 : f("1 2")
|
||||||
|
|
||||||
|
Remember: TAB completion works in many contexts, not just file names
|
||||||
|
or python names.
|
||||||
|
|
||||||
|
The following magic functions are currently available:
|
||||||
|
|
||||||
|
"""
|
||||||
|
|
||||||
|
default_banner_parts = ["Python %s\n"%sys.version.split("\n")[0],
|
||||||
|
"Type 'copyright', 'credits' or 'license' for more information\n" ,
|
||||||
|
"yap_ipython {version} -- An enhanced Interactive Python. Type '?' for help.\n".format(version=release.version),
|
||||||
|
]
|
||||||
|
|
||||||
|
default_banner = ''.join(default_banner_parts)
|
||||||
|
|
||||||
|
# deprecated GUI banner
|
||||||
|
|
||||||
|
default_gui_banner = '\n'.join([
|
||||||
|
'DEPRECATED: yap_ipython.core.usage.default_gui_banner is deprecated and will be removed',
|
||||||
|
default_banner,
|
||||||
|
])
|
@ -1,8 +1,8 @@
|
|||||||
"""Public API for display tools in IPython.
|
"""Public API for display tools in yap_ipython.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
#-----------------------------------------------------------------------------
|
#-----------------------------------------------------------------------------
|
||||||
# Copyright (C) 2012 The IPython Development Team
|
# Copyright (C) 2012 The yap_ipython Development Team
|
||||||
#
|
#
|
||||||
# Distributed under the terms of the BSD License. The full license is in
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
# the file COPYING, distributed as part of this software.
|
# the file COPYING, distributed as part of this software.
|
||||||
@ -12,5 +12,5 @@
|
|||||||
# Imports
|
# Imports
|
||||||
#-----------------------------------------------------------------------------
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
from IPython.core.display import *
|
from yap_ipython.core.display import *
|
||||||
from IPython.lib.display import *
|
from yap_ipython.lib.display import *
|
||||||
|
@ -0,0 +1,2 @@
|
|||||||
|
# -*- coding: utf-8 -*-
|
||||||
|
"""This directory is meant for yap_ipython extensions."""
|
524
packages/python/yap_kernel/yap_ipython/extensions/autoreload.py
Normal file
524
packages/python/yap_kernel/yap_ipython/extensions/autoreload.py
Normal file
@ -0,0 +1,524 @@
|
|||||||
|
"""yap_ipython extension to reload modules before executing user code.
|
||||||
|
|
||||||
|
``autoreload`` reloads modules automatically before entering the execution of
|
||||||
|
code typed at the yap_ipython prompt.
|
||||||
|
|
||||||
|
This makes for example the following workflow possible:
|
||||||
|
|
||||||
|
.. sourcecode:: ipython
|
||||||
|
|
||||||
|
In [1]: %load_ext autoreload
|
||||||
|
|
||||||
|
In [2]: %autoreload 2
|
||||||
|
|
||||||
|
In [3]: from foo import some_function
|
||||||
|
|
||||||
|
In [4]: some_function()
|
||||||
|
Out[4]: 42
|
||||||
|
|
||||||
|
In [5]: # open foo.py in an editor and change some_function to return 43
|
||||||
|
|
||||||
|
In [6]: some_function()
|
||||||
|
Out[6]: 43
|
||||||
|
|
||||||
|
The module was reloaded without reloading it explicitly, and the object
|
||||||
|
imported with ``from foo import ...`` was also updated.
|
||||||
|
|
||||||
|
Usage
|
||||||
|
=====
|
||||||
|
|
||||||
|
The following magic commands are provided:
|
||||||
|
|
||||||
|
``%autoreload``
|
||||||
|
|
||||||
|
Reload all modules (except those excluded by ``%aimport``)
|
||||||
|
automatically now.
|
||||||
|
|
||||||
|
``%autoreload 0``
|
||||||
|
|
||||||
|
Disable automatic reloading.
|
||||||
|
|
||||||
|
``%autoreload 1``
|
||||||
|
|
||||||
|
Reload all modules imported with ``%aimport`` every time before
|
||||||
|
executing the Python code typed.
|
||||||
|
|
||||||
|
``%autoreload 2``
|
||||||
|
|
||||||
|
Reload all modules (except those excluded by ``%aimport``) every
|
||||||
|
time before executing the Python code typed.
|
||||||
|
|
||||||
|
``%aimport``
|
||||||
|
|
||||||
|
List modules which are to be automatically imported or not to be imported.
|
||||||
|
|
||||||
|
``%aimport foo``
|
||||||
|
|
||||||
|
Import module 'foo' and mark it to be autoreloaded for ``%autoreload 1``
|
||||||
|
|
||||||
|
``%aimport foo, bar``
|
||||||
|
|
||||||
|
Import modules 'foo', 'bar' and mark them to be autoreloaded for ``%autoreload 1``
|
||||||
|
|
||||||
|
``%aimport -foo``
|
||||||
|
|
||||||
|
Mark module 'foo' to not be autoreloaded.
|
||||||
|
|
||||||
|
Caveats
|
||||||
|
=======
|
||||||
|
|
||||||
|
Reloading Python modules in a reliable way is in general difficult,
|
||||||
|
and unexpected things may occur. ``%autoreload`` tries to work around
|
||||||
|
common pitfalls by replacing function code objects and parts of
|
||||||
|
classes previously in the module with new versions. This makes the
|
||||||
|
following things to work:
|
||||||
|
|
||||||
|
- Functions and classes imported via 'from xxx import foo' are upgraded
|
||||||
|
to new versions when 'xxx' is reloaded.
|
||||||
|
|
||||||
|
- Methods and properties of classes are upgraded on reload, so that
|
||||||
|
calling 'c.foo()' on an object 'c' created before the reload causes
|
||||||
|
the new code for 'foo' to be executed.
|
||||||
|
|
||||||
|
Some of the known remaining caveats are:
|
||||||
|
|
||||||
|
- Replacing code objects does not always succeed: changing a @property
|
||||||
|
in a class to an ordinary method or a method to a member variable
|
||||||
|
can cause problems (but in old objects only).
|
||||||
|
|
||||||
|
- Functions that are removed (eg. via monkey-patching) from a module
|
||||||
|
before it is reloaded are not upgraded.
|
||||||
|
|
||||||
|
- C extension modules cannot be reloaded, and so cannot be autoreloaded.
|
||||||
|
"""
|
||||||
|
|
||||||
|
skip_doctest = True
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2000 Thomas Heller
|
||||||
|
# Copyright (C) 2008 Pauli Virtanen <pav@iki.fi>
|
||||||
|
# Copyright (C) 2012 The yap_ipython Development Team
|
||||||
|
#
|
||||||
|
# Distributed under the terms of the BSD License. The full license is in
|
||||||
|
# the file COPYING, distributed as part of this software.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
#
|
||||||
|
# This yap_ipython module is written by Pauli Virtanen, based on the autoreload
|
||||||
|
# code by Thomas Heller.
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Imports
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
import os
|
||||||
|
import sys
|
||||||
|
import traceback
|
||||||
|
import types
|
||||||
|
import weakref
|
||||||
|
from importlib import import_module
|
||||||
|
from imp import reload
|
||||||
|
|
||||||
|
from yap_ipython.utils import openpy
|
||||||
|
|
||||||
|
#------------------------------------------------------------------------------
|
||||||
|
# Autoreload functionality
|
||||||
|
#------------------------------------------------------------------------------
|
||||||
|
|
||||||
|
class ModuleReloader(object):
|
||||||
|
enabled = False
|
||||||
|
"""Whether this reloader is enabled"""
|
||||||
|
|
||||||
|
check_all = True
|
||||||
|
"""Autoreload all modules, not just those listed in 'modules'"""
|
||||||
|
|
||||||
|
def __init__(self):
|
||||||
|
# Modules that failed to reload: {module: mtime-on-failed-reload, ...}
|
||||||
|
self.failed = {}
|
||||||
|
# Modules specially marked as autoreloadable.
|
||||||
|
self.modules = {}
|
||||||
|
# Modules specially marked as not autoreloadable.
|
||||||
|
self.skip_modules = {}
|
||||||
|
# (module-name, name) -> weakref, for replacing old code objects
|
||||||
|
self.old_objects = {}
|
||||||
|
# Module modification timestamps
|
||||||
|
self.modules_mtimes = {}
|
||||||
|
|
||||||
|
# Cache module modification times
|
||||||
|
self.check(check_all=True, do_reload=False)
|
||||||
|
|
||||||
|
def mark_module_skipped(self, module_name):
|
||||||
|
"""Skip reloading the named module in the future"""
|
||||||
|
try:
|
||||||
|
del self.modules[module_name]
|
||||||
|
except KeyError:
|
||||||
|
pass
|
||||||
|
self.skip_modules[module_name] = True
|
||||||
|
|
||||||
|
def mark_module_reloadable(self, module_name):
|
||||||
|
"""Reload the named module in the future (if it is imported)"""
|
||||||
|
try:
|
||||||
|
del self.skip_modules[module_name]
|
||||||
|
except KeyError:
|
||||||
|
pass
|
||||||
|
self.modules[module_name] = True
|
||||||
|
|
||||||
|
def aimport_module(self, module_name):
|
||||||
|
"""Import a module, and mark it reloadable
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
top_module : module
|
||||||
|
The imported module if it is top-level, or the top-level
|
||||||
|
top_name : module
|
||||||
|
Name of top_module
|
||||||
|
|
||||||
|
"""
|
||||||
|
self.mark_module_reloadable(module_name)
|
||||||
|
|
||||||
|
import_module(module_name)
|
||||||
|
top_name = module_name.split('.')[0]
|
||||||
|
top_module = sys.modules[top_name]
|
||||||
|
return top_module, top_name
|
||||||
|
|
||||||
|
def filename_and_mtime(self, module):
|
||||||
|
if not hasattr(module, '__file__') or module.__file__ is None:
|
||||||
|
return None, None
|
||||||
|
|
||||||
|
if getattr(module, '__name__', None) in [None, '__mp_main__', '__main__']:
|
||||||
|
# we cannot reload(__main__) or reload(__mp_main__)
|
||||||
|
return None, None
|
||||||
|
|
||||||
|
filename = module.__file__
|
||||||
|
path, ext = os.path.splitext(filename)
|
||||||
|
|
||||||
|
if ext.lower() == '.py':
|
||||||
|
py_filename = filename
|
||||||
|
else:
|
||||||
|
try:
|
||||||
|
py_filename = openpy.source_from_cache(filename)
|
||||||
|
except ValueError:
|
||||||
|
return None, None
|
||||||
|
|
||||||
|
try:
|
||||||
|
pymtime = os.stat(py_filename).st_mtime
|
||||||
|
except OSError:
|
||||||
|
return None, None
|
||||||
|
|
||||||
|
return py_filename, pymtime
|
||||||
|
|
||||||
|
def check(self, check_all=False, do_reload=True):
|
||||||
|
"""Check whether some modules need to be reloaded."""
|
||||||
|
|
||||||
|
if not self.enabled and not check_all:
|
||||||
|
return
|
||||||
|
|
||||||
|
if check_all or self.check_all:
|
||||||
|
modules = list(sys.modules.keys())
|
||||||
|
else:
|
||||||
|
modules = list(self.modules.keys())
|
||||||
|
|
||||||
|
for modname in modules:
|
||||||
|
m = sys.modules.get(modname, None)
|
||||||
|
|
||||||
|
if modname in self.skip_modules:
|
||||||
|
continue
|
||||||
|
|
||||||
|
py_filename, pymtime = self.filename_and_mtime(m)
|
||||||
|
if py_filename is None:
|
||||||
|
continue
|
||||||
|
|
||||||
|
try:
|
||||||
|
if pymtime <= self.modules_mtimes[modname]:
|
||||||
|
continue
|
||||||
|
except KeyError:
|
||||||
|
self.modules_mtimes[modname] = pymtime
|
||||||
|
continue
|
||||||
|
else:
|
||||||
|
if self.failed.get(py_filename, None) == pymtime:
|
||||||
|
continue
|
||||||
|
|
||||||
|
self.modules_mtimes[modname] = pymtime
|
||||||
|
|
||||||
|
# If we've reached this point, we should try to reload the module
|
||||||
|
if do_reload:
|
||||||
|
try:
|
||||||
|
superreload(m, reload, self.old_objects)
|
||||||
|
if py_filename in self.failed:
|
||||||
|
del self.failed[py_filename]
|
||||||
|
except:
|
||||||
|
print("[autoreload of %s failed: %s]" % (
|
||||||
|
modname, traceback.format_exc(10)), file=sys.stderr)
|
||||||
|
self.failed[py_filename] = pymtime
|
||||||
|
|
||||||
|
#------------------------------------------------------------------------------
|
||||||
|
# superreload
|
||||||
|
#------------------------------------------------------------------------------
|
||||||
|
|
||||||
|
|
||||||
|
func_attrs = ['__code__', '__defaults__', '__doc__',
|
||||||
|
'__closure__', '__globals__', '__dict__']
|
||||||
|
|
||||||
|
|
||||||
|
def update_function(old, new):
|
||||||
|
"""Upgrade the code object of a function"""
|
||||||
|
for name in func_attrs:
|
||||||
|
try:
|
||||||
|
setattr(old, name, getattr(new, name))
|
||||||
|
except (AttributeError, TypeError):
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
|
def update_class(old, new):
|
||||||
|
"""Replace stuff in the __dict__ of a class, and upgrade
|
||||||
|
method code objects"""
|
||||||
|
for key in list(old.__dict__.keys()):
|
||||||
|
old_obj = getattr(old, key)
|
||||||
|
try:
|
||||||
|
new_obj = getattr(new, key)
|
||||||
|
if old_obj == new_obj:
|
||||||
|
continue
|
||||||
|
except AttributeError:
|
||||||
|
# obsolete attribute: remove it
|
||||||
|
try:
|
||||||
|
delattr(old, key)
|
||||||
|
except (AttributeError, TypeError):
|
||||||
|
pass
|
||||||
|
continue
|
||||||
|
|
||||||
|
if update_generic(old_obj, new_obj): continue
|
||||||
|
|
||||||
|
try:
|
||||||
|
setattr(old, key, getattr(new, key))
|
||||||
|
except (AttributeError, TypeError):
|
||||||
|
pass # skip non-writable attributes
|
||||||
|
|
||||||
|
|
||||||
|
def update_property(old, new):
|
||||||
|
"""Replace get/set/del functions of a property"""
|
||||||
|
update_generic(old.fdel, new.fdel)
|
||||||
|
update_generic(old.fget, new.fget)
|
||||||
|
update_generic(old.fset, new.fset)
|
||||||
|
|
||||||
|
|
||||||
|
def isinstance2(a, b, typ):
|
||||||
|
return isinstance(a, typ) and isinstance(b, typ)
|
||||||
|
|
||||||
|
|
||||||
|
UPDATE_RULES = [
|
||||||
|
(lambda a, b: isinstance2(a, b, type),
|
||||||
|
update_class),
|
||||||
|
(lambda a, b: isinstance2(a, b, types.FunctionType),
|
||||||
|
update_function),
|
||||||
|
(lambda a, b: isinstance2(a, b, property),
|
||||||
|
update_property),
|
||||||
|
]
|
||||||
|
UPDATE_RULES.extend([(lambda a, b: isinstance2(a, b, types.MethodType),
|
||||||
|
lambda a, b: update_function(a.__func__, b.__func__)),
|
||||||
|
])
|
||||||
|
|
||||||
|
|
||||||
|
def update_generic(a, b):
|
||||||
|
for type_check, update in UPDATE_RULES:
|
||||||
|
if type_check(a, b):
|
||||||
|
update(a, b)
|
||||||
|
return True
|
||||||
|
return False
|
||||||
|
|
||||||
|
|
||||||
|
class StrongRef(object):
|
||||||
|
def __init__(self, obj):
|
||||||
|
self.obj = obj
|
||||||
|
def __call__(self):
|
||||||
|
return self.obj
|
||||||
|
|
||||||
|
|
||||||
|
def superreload(module, reload=reload, old_objects={}):
|
||||||
|
"""Enhanced version of the builtin reload function.
|
||||||
|
|
||||||
|
superreload remembers objects previously in the module, and
|
||||||
|
|
||||||
|
- upgrades the class dictionary of every old class in the module
|
||||||
|
- upgrades the code object of every old function and method
|
||||||
|
- clears the module's namespace before reloading
|
||||||
|
|
||||||
|
"""
|
||||||
|
|
||||||
|
# collect old objects in the module
|
||||||
|
for name, obj in list(module.__dict__.items()):
|
||||||
|
if not hasattr(obj, '__module__') or obj.__module__ != module.__name__:
|
||||||
|
continue
|
||||||
|
key = (module.__name__, name)
|
||||||
|
try:
|
||||||
|
old_objects.setdefault(key, []).append(weakref.ref(obj))
|
||||||
|
except TypeError:
|
||||||
|
pass
|
||||||
|
|
||||||
|
# reload module
|
||||||
|
try:
|
||||||
|
# clear namespace first from old cruft
|
||||||
|
old_dict = module.__dict__.copy()
|
||||||
|
old_name = module.__name__
|
||||||
|
module.__dict__.clear()
|
||||||
|
module.__dict__['__name__'] = old_name
|
||||||
|
module.__dict__['__loader__'] = old_dict['__loader__']
|
||||||
|
except (TypeError, AttributeError, KeyError):
|
||||||
|
pass
|
||||||
|
|
||||||
|
try:
|
||||||
|
module = reload(module)
|
||||||
|
except:
|
||||||
|
# restore module dictionary on failed reload
|
||||||
|
module.__dict__.update(old_dict)
|
||||||
|
raise
|
||||||
|
|
||||||
|
# iterate over all objects and update functions & classes
|
||||||
|
for name, new_obj in list(module.__dict__.items()):
|
||||||
|
key = (module.__name__, name)
|
||||||
|
if key not in old_objects: continue
|
||||||
|
|
||||||
|
new_refs = []
|
||||||
|
for old_ref in old_objects[key]:
|
||||||
|
old_obj = old_ref()
|
||||||
|
if old_obj is None: continue
|
||||||
|
new_refs.append(old_ref)
|
||||||
|
update_generic(old_obj, new_obj)
|
||||||
|
|
||||||
|
if new_refs:
|
||||||
|
old_objects[key] = new_refs
|
||||||
|
else:
|
||||||
|
del old_objects[key]
|
||||||
|
|
||||||
|
return module
|
||||||
|
|
||||||
|
#------------------------------------------------------------------------------
|
||||||
|
# yap_ipython connectivity
|
||||||
|
#------------------------------------------------------------------------------
|
||||||
|
|
||||||
|
from yap_ipython.core.magic import Magics, magics_class, line_magic
|
||||||
|
|
||||||
|
@magics_class
|
||||||
|
class AutoreloadMagics(Magics):
|
||||||
|
def __init__(self, *a, **kw):
|
||||||
|
super(AutoreloadMagics, self).__init__(*a, **kw)
|
||||||
|
self._reloader = ModuleReloader()
|
||||||
|
self._reloader.check_all = False
|
||||||
|
self.loaded_modules = set(sys.modules)
|
||||||
|
|
||||||
|
@line_magic
|
||||||
|
def autoreload(self, parameter_s=''):
|
||||||
|
r"""%autoreload => Reload modules automatically
|
||||||
|
|
||||||
|
%autoreload
|
||||||
|
Reload all modules (except those excluded by %aimport) automatically
|
||||||
|
now.
|
||||||
|
|
||||||
|
%autoreload 0
|
||||||
|
Disable automatic reloading.
|
||||||
|
|
||||||
|
%autoreload 1
|
||||||
|
Reload all modules imported with %aimport every time before executing
|
||||||
|
the Python code typed.
|
||||||
|
|
||||||
|
%autoreload 2
|
||||||
|
Reload all modules (except those excluded by %aimport) every time
|
||||||
|
before executing the Python code typed.
|
||||||
|
|
||||||
|
Reloading Python modules in a reliable way is in general
|
||||||
|
difficult, and unexpected things may occur. %autoreload tries to
|
||||||
|
work around common pitfalls by replacing function code objects and
|
||||||
|
parts of classes previously in the module with new versions. This
|
||||||
|
makes the following things to work:
|
||||||
|
|
||||||
|
- Functions and classes imported via 'from xxx import foo' are upgraded
|
||||||
|
to new versions when 'xxx' is reloaded.
|
||||||
|
|
||||||
|
- Methods and properties of classes are upgraded on reload, so that
|
||||||
|
calling 'c.foo()' on an object 'c' created before the reload causes
|
||||||
|
the new code for 'foo' to be executed.
|
||||||
|
|
||||||
|
Some of the known remaining caveats are:
|
||||||
|
|
||||||
|
- Replacing code objects does not always succeed: changing a @property
|
||||||
|
in a class to an ordinary method or a method to a member variable
|
||||||
|
can cause problems (but in old objects only).
|
||||||
|
|
||||||
|
- Functions that are removed (eg. via monkey-patching) from a module
|
||||||
|
before it is reloaded are not upgraded.
|
||||||
|
|
||||||
|
- C extension modules cannot be reloaded, and so cannot be
|
||||||
|
autoreloaded.
|
||||||
|
|
||||||
|
"""
|
||||||
|
if parameter_s == '':
|
||||||
|
self._reloader.check(True)
|
||||||
|
elif parameter_s == '0':
|
||||||
|
self._reloader.enabled = False
|
||||||
|
elif parameter_s == '1':
|
||||||
|
self._reloader.check_all = False
|
||||||
|
self._reloader.enabled = True
|
||||||
|
elif parameter_s == '2':
|
||||||
|
self._reloader.check_all = True
|
||||||
|
self._reloader.enabled = True
|
||||||
|
|
||||||
|
@line_magic
|
||||||
|
def aimport(self, parameter_s='', stream=None):
|
||||||
|
"""%aimport => Import modules for automatic reloading.
|
||||||
|
|
||||||
|
%aimport
|
||||||
|
List modules to automatically import and not to import.
|
||||||
|
|
||||||
|
%aimport foo
|
||||||
|
Import module 'foo' and mark it to be autoreloaded for %autoreload 1
|
||||||
|
|
||||||
|
%aimport foo, bar
|
||||||
|
Import modules 'foo', 'bar' and mark them to be autoreloaded for %autoreload 1
|
||||||
|
|
||||||
|
%aimport -foo
|
||||||
|
Mark module 'foo' to not be autoreloaded for %autoreload 1
|
||||||
|
"""
|
||||||
|
modname = parameter_s
|
||||||
|
if not modname:
|
||||||
|
to_reload = sorted(self._reloader.modules.keys())
|
||||||
|
to_skip = sorted(self._reloader.skip_modules.keys())
|
||||||
|
if stream is None:
|
||||||
|
stream = sys.stdout
|
||||||
|
if self._reloader.check_all:
|
||||||
|
stream.write("Modules to reload:\nall-except-skipped\n")
|
||||||
|
else:
|
||||||
|
stream.write("Modules to reload:\n%s\n" % ' '.join(to_reload))
|
||||||
|
stream.write("\nModules to skip:\n%s\n" % ' '.join(to_skip))
|
||||||
|
elif modname.startswith('-'):
|
||||||
|
modname = modname[1:]
|
||||||
|
self._reloader.mark_module_skipped(modname)
|
||||||
|
else:
|
||||||
|
for _module in ([_.strip() for _ in modname.split(',')]):
|
||||||
|
top_module, top_name = self._reloader.aimport_module(_module)
|
||||||
|
|
||||||
|
# Inject module to user namespace
|
||||||
|
self.shell.push({top_name: top_module})
|
||||||
|
|
||||||
|
def pre_run_cell(self):
|
||||||
|
if self._reloader.enabled:
|
||||||
|
try:
|
||||||
|
self._reloader.check()
|
||||||
|
except:
|
||||||
|
pass
|
||||||
|
|
||||||
|
def post_execute_hook(self):
|
||||||
|
"""Cache the modification times of any modules imported in this execution
|
||||||
|
"""
|
||||||
|
newly_loaded_modules = set(sys.modules) - self.loaded_modules
|
||||||
|
for modname in newly_loaded_modules:
|
||||||
|
_, pymtime = self._reloader.filename_and_mtime(sys.modules[modname])
|
||||||
|
if pymtime is not None:
|
||||||
|
self._reloader.modules_mtimes[modname] = pymtime
|
||||||
|
|
||||||
|
self.loaded_modules.update(newly_loaded_modules)
|
||||||
|
|
||||||
|
|
||||||
|
def load_ipython_extension(ip):
|
||||||
|
"""Load the extension in yap_ipython."""
|
||||||
|
auto_reload = AutoreloadMagics(ip)
|
||||||
|
ip.register_magics(auto_reload)
|
||||||
|
ip.events.register('pre_run_cell', auto_reload.pre_run_cell)
|
||||||
|
ip.events.register('post_execute', auto_reload.post_execute_hook)
|
@ -0,0 +1,21 @@
|
|||||||
|
# -*- coding: utf-8 -*-
|
||||||
|
"""
|
||||||
|
**DEPRECATED**
|
||||||
|
|
||||||
|
The cython magic has been integrated into Cython itself,
|
||||||
|
which is now released in version 0.21.
|
||||||
|
|
||||||
|
cf github `Cython` organisation, `Cython` repo, under the
|
||||||
|
file `Cython/Build/IpythonMagic.py`
|
||||||
|
"""
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2010-2011, yap_ipython Development Team.
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
import warnings
|
||||||
|
|
||||||
|
## still load the magic in yap_ipython 3.x, remove completely in future versions.
|
||||||
|
def load_ipython_extension(ip):
|
||||||
|
"""Load the extension in yap_ipython."""
|
||||||
|
|
||||||
|
warnings.warn("""The Cython magic has been moved to the Cython package""")
|
12
packages/python/yap_kernel/yap_ipython/extensions/rmagic.py
Normal file
12
packages/python/yap_kernel/yap_ipython/extensions/rmagic.py
Normal file
@ -0,0 +1,12 @@
|
|||||||
|
# -*- coding: utf-8 -*-
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2012 The yap_ipython Development Team
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
import warnings
|
||||||
|
|
||||||
|
def load_ipython_extension(ip):
|
||||||
|
"""Load the extension in yap_ipython."""
|
||||||
|
warnings.warn("The rmagic extension in yap_ipython has moved to "
|
||||||
|
"`rpy2.ipython`, please see `rpy2` documentation.")
|
226
packages/python/yap_kernel/yap_ipython/extensions/storemagic.py
Normal file
226
packages/python/yap_kernel/yap_ipython/extensions/storemagic.py
Normal file
@ -0,0 +1,226 @@
|
|||||||
|
# -*- coding: utf-8 -*-
|
||||||
|
"""
|
||||||
|
%store magic for lightweight persistence.
|
||||||
|
|
||||||
|
Stores variables, aliases and macros in yap_ipython's database.
|
||||||
|
|
||||||
|
To automatically restore stored variables at startup, add this to your
|
||||||
|
:file:`ipython_config.py` file::
|
||||||
|
|
||||||
|
c.StoreMagics.autorestore = True
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
import inspect, os, sys, textwrap
|
||||||
|
|
||||||
|
from yap_ipython.core.error import UsageError
|
||||||
|
from yap_ipython.core.magic import Magics, magics_class, line_magic
|
||||||
|
from traitlets import Bool
|
||||||
|
|
||||||
|
|
||||||
|
def restore_aliases(ip):
|
||||||
|
staliases = ip.db.get('stored_aliases', {})
|
||||||
|
for k,v in staliases.items():
|
||||||
|
#print "restore alias",k,v # dbg
|
||||||
|
#self.alias_table[k] = v
|
||||||
|
ip.alias_manager.define_alias(k,v)
|
||||||
|
|
||||||
|
|
||||||
|
def refresh_variables(ip):
|
||||||
|
db = ip.db
|
||||||
|
for key in db.keys('autorestore/*'):
|
||||||
|
# strip autorestore
|
||||||
|
justkey = os.path.basename(key)
|
||||||
|
try:
|
||||||
|
obj = db[key]
|
||||||
|
except KeyError:
|
||||||
|
print("Unable to restore variable '%s', ignoring (use %%store -d to forget!)" % justkey)
|
||||||
|
print("The error was:", sys.exc_info()[0])
|
||||||
|
else:
|
||||||
|
#print "restored",justkey,"=",obj #dbg
|
||||||
|
ip.user_ns[justkey] = obj
|
||||||
|
|
||||||
|
|
||||||
|
def restore_dhist(ip):
|
||||||
|
ip.user_ns['_dh'] = ip.db.get('dhist',[])
|
||||||
|
|
||||||
|
|
||||||
|
def restore_data(ip):
|
||||||
|
refresh_variables(ip)
|
||||||
|
restore_aliases(ip)
|
||||||
|
restore_dhist(ip)
|
||||||
|
|
||||||
|
|
||||||
|
@magics_class
|
||||||
|
class StoreMagics(Magics):
|
||||||
|
"""Lightweight persistence for python variables.
|
||||||
|
|
||||||
|
Provides the %store magic."""
|
||||||
|
|
||||||
|
autorestore = Bool(False, help=
|
||||||
|
"""If True, any %store-d variables will be automatically restored
|
||||||
|
when yap_ipython starts.
|
||||||
|
"""
|
||||||
|
).tag(config=True)
|
||||||
|
|
||||||
|
def __init__(self, shell):
|
||||||
|
super(StoreMagics, self).__init__(shell=shell)
|
||||||
|
self.shell.configurables.append(self)
|
||||||
|
if self.autorestore:
|
||||||
|
restore_data(self.shell)
|
||||||
|
|
||||||
|
@line_magic
|
||||||
|
def store(self, parameter_s=''):
|
||||||
|
"""Lightweight persistence for python variables.
|
||||||
|
|
||||||
|
Example::
|
||||||
|
|
||||||
|
In [1]: l = ['hello',10,'world']
|
||||||
|
In [2]: %store l
|
||||||
|
In [3]: exit
|
||||||
|
|
||||||
|
(yap_ipython session is closed and started again...)
|
||||||
|
|
||||||
|
ville@badger:~$ ipython
|
||||||
|
In [1]: l
|
||||||
|
NameError: name 'l' is not defined
|
||||||
|
In [2]: %store -r
|
||||||
|
In [3]: l
|
||||||
|
Out[3]: ['hello', 10, 'world']
|
||||||
|
|
||||||
|
Usage:
|
||||||
|
|
||||||
|
* ``%store`` - Show list of all variables and their current
|
||||||
|
values
|
||||||
|
* ``%store spam`` - Store the *current* value of the variable spam
|
||||||
|
to disk
|
||||||
|
* ``%store -d spam`` - Remove the variable and its value from storage
|
||||||
|
* ``%store -z`` - Remove all variables from storage
|
||||||
|
* ``%store -r`` - Refresh all variables from store (overwrite
|
||||||
|
current vals)
|
||||||
|
* ``%store -r spam bar`` - Refresh specified variables from store
|
||||||
|
(delete current val)
|
||||||
|
* ``%store foo >a.txt`` - Store value of foo to new file a.txt
|
||||||
|
* ``%store foo >>a.txt`` - Append value of foo to file a.txt
|
||||||
|
|
||||||
|
It should be noted that if you change the value of a variable, you
|
||||||
|
need to %store it again if you want to persist the new value.
|
||||||
|
|
||||||
|
Note also that the variables will need to be pickleable; most basic
|
||||||
|
python types can be safely %store'd.
|
||||||
|
|
||||||
|
Also aliases can be %store'd across sessions.
|
||||||
|
"""
|
||||||
|
|
||||||
|
opts,argsl = self.parse_options(parameter_s,'drz',mode='string')
|
||||||
|
args = argsl.split(None,1)
|
||||||
|
ip = self.shell
|
||||||
|
db = ip.db
|
||||||
|
# delete
|
||||||
|
if 'd' in opts:
|
||||||
|
try:
|
||||||
|
todel = args[0]
|
||||||
|
except IndexError:
|
||||||
|
raise UsageError('You must provide the variable to forget')
|
||||||
|
else:
|
||||||
|
try:
|
||||||
|
del db['autorestore/' + todel]
|
||||||
|
except:
|
||||||
|
raise UsageError("Can't delete variable '%s'" % todel)
|
||||||
|
# reset
|
||||||
|
elif 'z' in opts:
|
||||||
|
for k in db.keys('autorestore/*'):
|
||||||
|
del db[k]
|
||||||
|
|
||||||
|
elif 'r' in opts:
|
||||||
|
if args:
|
||||||
|
for arg in args:
|
||||||
|
try:
|
||||||
|
obj = db['autorestore/' + arg]
|
||||||
|
except KeyError:
|
||||||
|
print("no stored variable %s" % arg)
|
||||||
|
else:
|
||||||
|
ip.user_ns[arg] = obj
|
||||||
|
else:
|
||||||
|
restore_data(ip)
|
||||||
|
|
||||||
|
# run without arguments -> list variables & values
|
||||||
|
elif not args:
|
||||||
|
vars = db.keys('autorestore/*')
|
||||||
|
vars.sort()
|
||||||
|
if vars:
|
||||||
|
size = max(map(len, vars))
|
||||||
|
else:
|
||||||
|
size = 0
|
||||||
|
|
||||||
|
print('Stored variables and their in-db values:')
|
||||||
|
fmt = '%-'+str(size)+'s -> %s'
|
||||||
|
get = db.get
|
||||||
|
for var in vars:
|
||||||
|
justkey = os.path.basename(var)
|
||||||
|
# print 30 first characters from every var
|
||||||
|
print(fmt % (justkey, repr(get(var, '<unavailable>'))[:50]))
|
||||||
|
|
||||||
|
# default action - store the variable
|
||||||
|
else:
|
||||||
|
# %store foo >file.txt or >>file.txt
|
||||||
|
if len(args) > 1 and args[1].startswith('>'):
|
||||||
|
fnam = os.path.expanduser(args[1].lstrip('>').lstrip())
|
||||||
|
if args[1].startswith('>>'):
|
||||||
|
fil = open(fnam, 'a')
|
||||||
|
else:
|
||||||
|
fil = open(fnam, 'w')
|
||||||
|
obj = ip.ev(args[0])
|
||||||
|
print("Writing '%s' (%s) to file '%s'." % (args[0],
|
||||||
|
obj.__class__.__name__, fnam))
|
||||||
|
|
||||||
|
|
||||||
|
if not isinstance (obj, str):
|
||||||
|
from pprint import pprint
|
||||||
|
pprint(obj, fil)
|
||||||
|
else:
|
||||||
|
fil.write(obj)
|
||||||
|
if not obj.endswith('\n'):
|
||||||
|
fil.write('\n')
|
||||||
|
|
||||||
|
fil.close()
|
||||||
|
return
|
||||||
|
|
||||||
|
# %store foo
|
||||||
|
try:
|
||||||
|
obj = ip.user_ns[args[0]]
|
||||||
|
except KeyError:
|
||||||
|
# it might be an alias
|
||||||
|
name = args[0]
|
||||||
|
try:
|
||||||
|
cmd = ip.alias_manager.retrieve_alias(name)
|
||||||
|
except ValueError:
|
||||||
|
raise UsageError("Unknown variable '%s'" % name)
|
||||||
|
|
||||||
|
staliases = db.get('stored_aliases',{})
|
||||||
|
staliases[name] = cmd
|
||||||
|
db['stored_aliases'] = staliases
|
||||||
|
print("Alias stored: %s (%s)" % (name, cmd))
|
||||||
|
return
|
||||||
|
|
||||||
|
else:
|
||||||
|
modname = getattr(inspect.getmodule(obj), '__name__', '')
|
||||||
|
if modname == '__main__':
|
||||||
|
print(textwrap.dedent("""\
|
||||||
|
Warning:%s is %s
|
||||||
|
Proper storage of interactively declared classes (or instances
|
||||||
|
of those classes) is not possible! Only instances
|
||||||
|
of classes in real modules on file system can be %%store'd.
|
||||||
|
""" % (args[0], obj) ))
|
||||||
|
return
|
||||||
|
#pickled = pickle.dumps(obj)
|
||||||
|
db[ 'autorestore/' + args[0] ] = obj
|
||||||
|
print("Stored '%s' (%s)" % (args[0], obj.__class__.__name__))
|
||||||
|
|
||||||
|
|
||||||
|
def load_ipython_extension(ip):
|
||||||
|
"""Load the extension in yap_ipython."""
|
||||||
|
ip.register_magics(StoreMagics)
|
||||||
|
|
@ -0,0 +1,32 @@
|
|||||||
|
"""
|
||||||
|
**DEPRECATED**
|
||||||
|
|
||||||
|
A print function that pretty prints sympy Basic objects.
|
||||||
|
|
||||||
|
:moduleauthor: Brian Granger
|
||||||
|
|
||||||
|
Usage
|
||||||
|
=====
|
||||||
|
|
||||||
|
Once the extension is loaded, Sympy Basic objects are automatically
|
||||||
|
pretty-printed.
|
||||||
|
|
||||||
|
As of SymPy 0.7.2, maintenance of this extension has moved to SymPy under
|
||||||
|
sympy.interactive.ipythonprinting, any modifications to account for changes to
|
||||||
|
SymPy should be submitted to SymPy rather than changed here. This module is
|
||||||
|
maintained here for backwards compatablitiy with old SymPy versions.
|
||||||
|
|
||||||
|
"""
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Copyright (C) 2008 The yap_ipython Development Team
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
# Imports
|
||||||
|
#-----------------------------------------------------------------------------
|
||||||
|
|
||||||
|
import warnings
|
||||||
|
|
||||||
|
def load_ipython_extension(ip):
|
||||||
|
warnings.warn("The sympyprinting extension has moved to `sympy`, "
|
||||||
|
"use `from sympy import init_printing; init_printing()`")
|
5
packages/python/yap_kernel/yap_ipython/external/__init__.py
vendored
Normal file
5
packages/python/yap_kernel/yap_ipython/external/__init__.py
vendored
Normal file
@ -0,0 +1,5 @@
|
|||||||
|
"""
|
||||||
|
This package contains all third-party modules bundled with yap_ipython.
|
||||||
|
"""
|
||||||
|
|
||||||
|
__all__ = ["simplegeneric"]
|
13
packages/python/yap_kernel/yap_ipython/external/mathjax.py
vendored
Normal file
13
packages/python/yap_kernel/yap_ipython/external/mathjax.py
vendored
Normal file
@ -0,0 +1,13 @@
|
|||||||
|
#!/usr/bin/python
|
||||||
|
"""
|
||||||
|
`yap_ipython.external.mathjax` is deprecated with yap_ipython 4.0+
|
||||||
|
|
||||||
|
mathjax is now install by default with the notebook package
|
||||||
|
|
||||||
|
"""
|
||||||
|
|
||||||
|
import sys
|
||||||
|
|
||||||
|
if __name__ == '__main__' :
|
||||||
|
sys.exit("yap_ipython.external.mathjax is deprecated, Mathjax is now installed by default with the notebook package")
|
||||||
|
|
95
packages/python/yap_kernel/yap_ipython/external/qt_for_kernel.py
vendored
Normal file
95
packages/python/yap_kernel/yap_ipython/external/qt_for_kernel.py
vendored
Normal file
@ -0,0 +1,95 @@
|
|||||||
|
""" Import Qt in a manner suitable for an yap_ipython kernel.
|
||||||
|
|
||||||
|
This is the import used for the `gui=qt` or `matplotlib=qt` initialization.
|
||||||
|
|
||||||
|
Import Priority:
|
||||||
|
|
||||||
|
if Qt has been imported anywhere else:
|
||||||
|
use that
|
||||||
|
|
||||||
|
if matplotlib has been imported and doesn't support v2 (<= 1.0.1):
|
||||||
|
use PyQt4 @v1
|
||||||
|
|
||||||
|
Next, ask QT_API env variable
|
||||||
|
|
||||||
|
if QT_API not set:
|
||||||
|
ask matplotlib what it's using. If Qt4Agg or Qt5Agg, then use the
|
||||||
|
version matplotlib is configured with
|
||||||
|
|
||||||
|
else: (matplotlib said nothing)
|
||||||
|
# this is the default path - nobody told us anything
|
||||||
|
try in this order:
|
||||||
|
PyQt default version, PySide, PyQt5
|
||||||
|
else:
|
||||||
|
use what QT_API says
|
||||||
|
|
||||||
|
"""
|
||||||
|
# NOTE: This is no longer an external, third-party module, and should be
|
||||||
|
# considered part of yap_ipython. For compatibility however, it is being kept in
|
||||||
|
# yap_ipython/external.
|
||||||
|
|
||||||
|
import os
|
||||||
|
import sys
|
||||||
|
|
||||||
|
from yap_ipython.utils.version import check_version
|
||||||
|
from yap_ipython.external.qt_loaders import (load_qt, loaded_api, QT_API_PYSIDE,
|
||||||
|
QT_API_PYSIDE2, QT_API_PYQT, QT_API_PYQT5,
|
||||||
|
QT_API_PYQTv1, QT_API_PYQT_DEFAULT)
|
||||||
|
|
||||||
|
_qt_apis = (QT_API_PYSIDE, QT_API_PYSIDE2, QT_API_PYQT, QT_API_PYQT5, QT_API_PYQTv1,
|
||||||
|
QT_API_PYQT_DEFAULT)
|
||||||
|
|
||||||
|
#Constraints placed on an imported matplotlib
|
||||||
|
def matplotlib_options(mpl):
|
||||||
|
if mpl is None:
|
||||||
|
return
|
||||||
|
backend = mpl.rcParams.get('backend', None)
|
||||||
|
if backend == 'Qt4Agg':
|
||||||
|
mpqt = mpl.rcParams.get('backend.qt4', None)
|
||||||
|
if mpqt is None:
|
||||||
|
return None
|
||||||
|
if mpqt.lower() == 'pyside':
|
||||||
|
return [QT_API_PYSIDE]
|
||||||
|
elif mpqt.lower() == 'pyqt4':
|
||||||
|
return [QT_API_PYQT_DEFAULT]
|
||||||
|
elif mpqt.lower() == 'pyqt4v2':
|
||||||
|
return [QT_API_PYQT]
|
||||||
|
raise ImportError("unhandled value for backend.qt4 from matplotlib: %r" %
|
||||||
|
mpqt)
|
||||||
|
elif backend == 'Qt5Agg':
|
||||||
|
mpqt = mpl.rcParams.get('backend.qt5', None)
|
||||||
|
if mpqt is None:
|
||||||
|
return None
|
||||||
|
if mpqt.lower() == 'pyqt5':
|
||||||
|
return [QT_API_PYQT5]
|
||||||
|
raise ImportError("unhandled value for backend.qt5 from matplotlib: %r" %
|
||||||
|
mpqt)
|
||||||
|
|
||||||
|
def get_options():
|
||||||
|
"""Return a list of acceptable QT APIs, in decreasing order of
|
||||||
|
preference
|
||||||
|
"""
|
||||||
|
#already imported Qt somewhere. Use that
|
||||||
|
loaded = loaded_api()
|
||||||
|
if loaded is not None:
|
||||||
|
return [loaded]
|
||||||
|
|
||||||
|
mpl = sys.modules.get('matplotlib', None)
|
||||||
|
|
||||||
|
if mpl is not None and not check_version(mpl.__version__, '1.0.2'):
|
||||||
|
#1.0.1 only supports PyQt4 v1
|
||||||
|
return [QT_API_PYQT_DEFAULT]
|
||||||
|
|
||||||
|
qt_api = os.environ.get('QT_API', None)
|
||||||
|
if qt_api is None:
|
||||||
|
#no ETS variable. Ask mpl, then use default fallback path
|
||||||
|
return matplotlib_options(mpl) or [QT_API_PYQT_DEFAULT, QT_API_PYSIDE,
|
||||||
|
QT_API_PYQT5, QT_API_PYSIDE2]
|
||||||
|
elif qt_api not in _qt_apis:
|
||||||
|
raise RuntimeError("Invalid Qt API %r, valid values are: %r" %
|
||||||
|
(qt_api, ', '.join(_qt_apis)))
|
||||||
|
else:
|
||||||
|
return [qt_api]
|
||||||
|
|
||||||
|
api_opts = get_options()
|
||||||
|
QtCore, QtGui, QtSvg, QT_API = load_qt(api_opts)
|
373
packages/python/yap_kernel/yap_ipython/external/qt_loaders.py
vendored
Normal file
373
packages/python/yap_kernel/yap_ipython/external/qt_loaders.py
vendored
Normal file
@ -0,0 +1,373 @@
|
|||||||
|
"""
|
||||||
|
This module contains factory functions that attempt
|
||||||
|
to return Qt submodules from the various python Qt bindings.
|
||||||
|
|
||||||
|
It also protects against double-importing Qt with different
|
||||||
|
bindings, which is unstable and likely to crash
|
||||||
|
|
||||||
|
This is used primarily by qt and qt_for_kernel, and shouldn't
|
||||||
|
be accessed directly from the outside
|
||||||
|
"""
|
||||||
|
import sys
|
||||||
|
import types
|
||||||
|
from functools import partial
|
||||||
|
from importlib import import_module
|
||||||
|
|
||||||
|
from yap_ipython.utils.version import check_version
|
||||||
|
|
||||||
|
# Available APIs.
|
||||||
|
QT_API_PYQT = 'pyqt' # Force version 2
|
||||||
|
QT_API_PYQT5 = 'pyqt5'
|
||||||
|
QT_API_PYQTv1 = 'pyqtv1' # Force version 2
|
||||||
|
QT_API_PYQT_DEFAULT = 'pyqtdefault' # use system default for version 1 vs. 2
|
||||||
|
QT_API_PYSIDE = 'pyside'
|
||||||
|
QT_API_PYSIDE2 = 'pyside2'
|
||||||
|
|
||||||
|
api_to_module = {QT_API_PYSIDE2: 'PySide2',
|
||||||
|
QT_API_PYSIDE: 'PySide',
|
||||||
|
QT_API_PYQT: 'PyQt4',
|
||||||
|
QT_API_PYQTv1: 'PyQt4',
|
||||||
|
QT_API_PYQT5: 'PyQt5',
|
||||||
|
QT_API_PYQT_DEFAULT: 'PyQt4',
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
class ImportDenier(object):
|
||||||
|
"""Import Hook that will guard against bad Qt imports
|
||||||
|
once yap_ipython commits to a specific binding
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self):
|
||||||
|
self.__forbidden = set()
|
||||||
|
|
||||||
|
def forbid(self, module_name):
|
||||||
|
sys.modules.pop(module_name, None)
|
||||||
|
self.__forbidden.add(module_name)
|
||||||
|
|
||||||
|
def find_module(self, fullname, path=None):
|
||||||
|
if path:
|
||||||
|
return
|
||||||
|
if fullname in self.__forbidden:
|
||||||
|
return self
|
||||||
|
|
||||||
|
def load_module(self, fullname):
|
||||||
|
raise ImportError("""
|
||||||
|
Importing %s disabled by yap_ipython, which has
|
||||||
|
already imported an Incompatible QT Binding: %s
|
||||||
|
""" % (fullname, loaded_api()))
|
||||||
|
|
||||||
|
ID = ImportDenier()
|
||||||
|
sys.meta_path.insert(0, ID)
|
||||||
|
|
||||||
|
|
||||||
|
def commit_api(api):
|
||||||
|
"""Commit to a particular API, and trigger ImportErrors on subsequent
|
||||||
|
dangerous imports"""
|
||||||
|
|
||||||
|
if api == QT_API_PYSIDE2:
|
||||||
|
ID.forbid('PySide')
|
||||||
|
ID.forbid('PyQt4')
|
||||||
|
ID.forbid('PyQt5')
|
||||||
|
if api == QT_API_PYSIDE:
|
||||||
|
ID.forbid('PySide2')
|
||||||
|
ID.forbid('PyQt4')
|
||||||
|
ID.forbid('PyQt5')
|
||||||
|
elif api == QT_API_PYQT5:
|
||||||
|
ID.forbid('PySide2')
|
||||||
|
ID.forbid('PySide')
|
||||||
|
ID.forbid('PyQt4')
|
||||||
|
else: # There are three other possibilities, all representing PyQt4
|
||||||
|
ID.forbid('PyQt5')
|
||||||
|
ID.forbid('PySide2')
|
||||||
|
ID.forbid('PySide')
|
||||||
|
|
||||||
|
|
||||||
|
def loaded_api():
|
||||||
|
"""Return which API is loaded, if any
|
||||||
|
|
||||||
|
If this returns anything besides None,
|
||||||
|
importing any other Qt binding is unsafe.
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
None, 'pyside2', 'pyside', 'pyqt', 'pyqt5', or 'pyqtv1'
|
||||||
|
"""
|
||||||
|
if 'PyQt4.QtCore' in sys.modules:
|
||||||
|
if qtapi_version() == 2:
|
||||||
|
return QT_API_PYQT
|
||||||
|
else:
|
||||||
|
return QT_API_PYQTv1
|
||||||
|
elif 'PySide.QtCore' in sys.modules:
|
||||||
|
return QT_API_PYSIDE
|
||||||
|
elif 'PySide2.QtCore' in sys.modules:
|
||||||
|
return QT_API_PYSIDE2
|
||||||
|
elif 'PyQt5.QtCore' in sys.modules:
|
||||||
|
return QT_API_PYQT5
|
||||||
|
return None
|
||||||
|
|
||||||
|
|
||||||
|
def has_binding(api):
|
||||||
|
"""Safely check for PyQt4/5, PySide or PySide2, without importing submodules
|
||||||
|
|
||||||
|
Supports Python <= 3.3
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
api : str [ 'pyqtv1' | 'pyqt' | 'pyqt5' | 'pyside' | 'pyside2' | 'pyqtdefault']
|
||||||
|
Which module to check for
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
True if the relevant module appears to be importable
|
||||||
|
"""
|
||||||
|
# we can't import an incomplete pyside and pyqt4
|
||||||
|
# this will cause a crash in sip (#1431)
|
||||||
|
# check for complete presence before importing
|
||||||
|
module_name = api_to_module[api]
|
||||||
|
|
||||||
|
import imp
|
||||||
|
try:
|
||||||
|
#importing top level PyQt4/PySide module is ok...
|
||||||
|
mod = import_module(module_name)
|
||||||
|
#...importing submodules is not
|
||||||
|
imp.find_module('QtCore', mod.__path__)
|
||||||
|
imp.find_module('QtGui', mod.__path__)
|
||||||
|
imp.find_module('QtSvg', mod.__path__)
|
||||||
|
if api in (QT_API_PYQT5, QT_API_PYSIDE2):
|
||||||
|
# QT5 requires QtWidgets too
|
||||||
|
imp.find_module('QtWidgets', mod.__path__)
|
||||||
|
|
||||||
|
#we can also safely check PySide version
|
||||||
|
if api == QT_API_PYSIDE:
|
||||||
|
return check_version(mod.__version__, '1.0.3')
|
||||||
|
else:
|
||||||
|
return True
|
||||||
|
except ImportError:
|
||||||
|
return False
|
||||||
|
|
||||||
|
def has_binding_new(api):
|
||||||
|
"""Safely check for PyQt4/5, PySide or PySide2, without importing submodules
|
||||||
|
|
||||||
|
Supports Python >= 3.4
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
api : str [ 'pyqtv1' | 'pyqt' | 'pyqt5' | 'pyside' | 'pyside2' | 'pyqtdefault']
|
||||||
|
Which module to check for
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
True if the relevant module appears to be importable
|
||||||
|
"""
|
||||||
|
module_name = api_to_module[api]
|
||||||
|
from importlib.util import find_spec
|
||||||
|
|
||||||
|
required = ['QtCore', 'QtGui', 'QtSvg']
|
||||||
|
if api in (QT_API_PYQT5, QT_API_PYSIDE2):
|
||||||
|
# QT5 requires QtWidgets too
|
||||||
|
required.append('QtWidgets')
|
||||||
|
|
||||||
|
for submod in required:
|
||||||
|
try:
|
||||||
|
spec = find_spec('%s.%s' % (module_name, submod))
|
||||||
|
except ImportError:
|
||||||
|
# Package (e.g. PyQt5) not found
|
||||||
|
return False
|
||||||
|
else:
|
||||||
|
if spec is None:
|
||||||
|
# Submodule (e.g. PyQt5.QtCore) not found
|
||||||
|
return False
|
||||||
|
|
||||||
|
if api == QT_API_PYSIDE:
|
||||||
|
# We can also safely check PySide version
|
||||||
|
import PySide
|
||||||
|
return check_version(PySide.__version__, '1.0.3')
|
||||||
|
|
||||||
|
return True
|
||||||
|
|
||||||
|
if sys.version_info >= (3, 4):
|
||||||
|
has_binding = has_binding_new
|
||||||
|
|
||||||
|
def qtapi_version():
|
||||||
|
"""Return which QString API has been set, if any
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
The QString API version (1 or 2), or None if not set
|
||||||
|
"""
|
||||||
|
try:
|
||||||
|
import sip
|
||||||
|
except ImportError:
|
||||||
|
return
|
||||||
|
try:
|
||||||
|
return sip.getapi('QString')
|
||||||
|
except ValueError:
|
||||||
|
return
|
||||||
|
|
||||||
|
|
||||||
|
def can_import(api):
|
||||||
|
"""Safely query whether an API is importable, without importing it"""
|
||||||
|
if not has_binding(api):
|
||||||
|
return False
|
||||||
|
|
||||||
|
current = loaded_api()
|
||||||
|
if api == QT_API_PYQT_DEFAULT:
|
||||||
|
return current in [QT_API_PYQT, QT_API_PYQTv1, None]
|
||||||
|
else:
|
||||||
|
return current in [api, None]
|
||||||
|
|
||||||
|
|
||||||
|
def import_pyqt4(version=2):
|
||||||
|
"""
|
||||||
|
Import PyQt4
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
version : 1, 2, or None
|
||||||
|
Which QString/QVariant API to use. Set to None to use the system
|
||||||
|
default
|
||||||
|
|
||||||
|
ImportErrors rasied within this function are non-recoverable
|
||||||
|
"""
|
||||||
|
# The new-style string API (version=2) automatically
|
||||||
|
# converts QStrings to Unicode Python strings. Also, automatically unpacks
|
||||||
|
# QVariants to their underlying objects.
|
||||||
|
import sip
|
||||||
|
|
||||||
|
if version is not None:
|
||||||
|
sip.setapi('QString', version)
|
||||||
|
sip.setapi('QVariant', version)
|
||||||
|
|
||||||
|
from PyQt4 import QtGui, QtCore, QtSvg
|
||||||
|
|
||||||
|
if not check_version(QtCore.PYQT_VERSION_STR, '4.7'):
|
||||||
|
raise ImportError("yap_ipython requires PyQt4 >= 4.7, found %s" %
|
||||||
|
QtCore.PYQT_VERSION_STR)
|
||||||
|
|
||||||
|
# Alias PyQt-specific functions for PySide compatibility.
|
||||||
|
QtCore.Signal = QtCore.pyqtSignal
|
||||||
|
QtCore.Slot = QtCore.pyqtSlot
|
||||||
|
|
||||||
|
# query for the API version (in case version == None)
|
||||||
|
version = sip.getapi('QString')
|
||||||
|
api = QT_API_PYQTv1 if version == 1 else QT_API_PYQT
|
||||||
|
return QtCore, QtGui, QtSvg, api
|
||||||
|
|
||||||
|
|
||||||
|
def import_pyqt5():
|
||||||
|
"""
|
||||||
|
Import PyQt5
|
||||||
|
|
||||||
|
ImportErrors rasied within this function are non-recoverable
|
||||||
|
"""
|
||||||
|
import sip
|
||||||
|
|
||||||
|
from PyQt5 import QtCore, QtSvg, QtWidgets, QtGui
|
||||||
|
|
||||||
|
# Alias PyQt-specific functions for PySide compatibility.
|
||||||
|
QtCore.Signal = QtCore.pyqtSignal
|
||||||
|
QtCore.Slot = QtCore.pyqtSlot
|
||||||
|
|
||||||
|
# Join QtGui and QtWidgets for Qt4 compatibility.
|
||||||
|
QtGuiCompat = types.ModuleType('QtGuiCompat')
|
||||||
|
QtGuiCompat.__dict__.update(QtGui.__dict__)
|
||||||
|
QtGuiCompat.__dict__.update(QtWidgets.__dict__)
|
||||||
|
|
||||||
|
api = QT_API_PYQT5
|
||||||
|
return QtCore, QtGuiCompat, QtSvg, api
|
||||||
|
|
||||||
|
|
||||||
|
def import_pyside():
|
||||||
|
"""
|
||||||
|
Import PySide
|
||||||
|
|
||||||
|
ImportErrors raised within this function are non-recoverable
|
||||||
|
"""
|
||||||
|
from PySide import QtGui, QtCore, QtSvg
|
||||||
|
return QtCore, QtGui, QtSvg, QT_API_PYSIDE
|
||||||
|
|
||||||
|
def import_pyside2():
|
||||||
|
"""
|
||||||
|
Import PySide2
|
||||||
|
|
||||||
|
ImportErrors raised within this function are non-recoverable
|
||||||
|
"""
|
||||||
|
from PySide2 import QtGui, QtCore, QtSvg, QtWidgets, QtPrintSupport
|
||||||
|
|
||||||
|
# Join QtGui and QtWidgets for Qt4 compatibility.
|
||||||
|
QtGuiCompat = types.ModuleType('QtGuiCompat')
|
||||||
|
QtGuiCompat.__dict__.update(QtGui.__dict__)
|
||||||
|
QtGuiCompat.__dict__.update(QtWidgets.__dict__)
|
||||||
|
QtGuiCompat.__dict__.update(QtPrintSupport.__dict__)
|
||||||
|
|
||||||
|
return QtCore, QtGuiCompat, QtSvg, QT_API_PYSIDE2
|
||||||
|
|
||||||
|
|
||||||
|
def load_qt(api_options):
|
||||||
|
"""
|
||||||
|
Attempt to import Qt, given a preference list
|
||||||
|
of permissible bindings
|
||||||
|
|
||||||
|
It is safe to call this function multiple times.
|
||||||
|
|
||||||
|
Parameters
|
||||||
|
----------
|
||||||
|
api_options: List of strings
|
||||||
|
The order of APIs to try. Valid items are 'pyside', 'pyside2',
|
||||||
|
'pyqt', 'pyqt5', 'pyqtv1' and 'pyqtdefault'
|
||||||
|
|
||||||
|
Returns
|
||||||
|
-------
|
||||||
|
|
||||||
|
A tuple of QtCore, QtGui, QtSvg, QT_API
|
||||||
|
The first three are the Qt modules. The last is the
|
||||||
|
string indicating which module was loaded.
|
||||||
|
|
||||||
|
Raises
|
||||||
|
------
|
||||||
|
ImportError, if it isn't possible to import any requested
|
||||||
|
bindings (either becaues they aren't installed, or because
|
||||||
|
an incompatible library has already been installed)
|
||||||
|
"""
|
||||||
|
loaders = {
|
||||||
|
QT_API_PYSIDE2: import_pyside2,
|
||||||
|
QT_API_PYSIDE: import_pyside,
|
||||||
|
QT_API_PYQT: import_pyqt4,
|
||||||
|
QT_API_PYQT5: import_pyqt5,
|
||||||
|
QT_API_PYQTv1: partial(import_pyqt4, version=1),
|
||||||
|
QT_API_PYQT_DEFAULT: partial(import_pyqt4, version=None)
|
||||||
|
}
|
||||||
|
|
||||||
|
for api in api_options:
|
||||||
|
|
||||||
|
if api not in loaders:
|
||||||
|
raise RuntimeError(
|
||||||
|
"Invalid Qt API %r, valid values are: %s" %
|
||||||
|
(api, ", ".join(["%r" % k for k in loaders.keys()])))
|
||||||
|
|
||||||
|
if not can_import(api):
|
||||||
|
continue
|
||||||
|
|
||||||
|
#cannot safely recover from an ImportError during this
|
||||||
|
result = loaders[api]()
|
||||||
|
api = result[-1] # changed if api = QT_API_PYQT_DEFAULT
|
||||||
|
commit_api(api)
|
||||||
|
return result
|
||||||
|
else:
|
||||||
|
raise ImportError("""
|
||||||
|
Could not load requested Qt binding. Please ensure that
|
||||||
|
PyQt4 >= 4.7, PyQt5, PySide >= 1.0.3 or PySide2 is available,
|
||||||
|
and only one is imported per session.
|
||||||
|
|
||||||
|
Currently-imported Qt library: %r
|
||||||
|
PyQt4 available (requires QtCore, QtGui, QtSvg): %s
|
||||||
|
PyQt5 available (requires QtCore, QtGui, QtSvg, QtWidgets): %s
|
||||||
|
PySide >= 1.0.3 installed: %s
|
||||||
|
PySide2 installed: %s
|
||||||
|
Tried to load: %r
|
||||||
|
""" % (loaded_api(),
|
||||||
|
has_binding(QT_API_PYQT),
|
||||||
|
has_binding(QT_API_PYQT5),
|
||||||
|
has_binding(QT_API_PYSIDE),
|
||||||
|
has_binding(QT_API_PYSIDE2),
|
||||||
|
api_options))
|
29
packages/python/yap_kernel/yap_ipython/frontend.py
Normal file
29
packages/python/yap_kernel/yap_ipython/frontend.py
Normal file
@ -0,0 +1,29 @@
|
|||||||
|
"""
|
||||||
|
Shim to maintain backwards compatibility with old frontend imports.
|
||||||
|
|
||||||
|
We have moved all contents of the old `frontend` subpackage into top-level
|
||||||
|
subpackages (`html`, `qt` and `terminal`), and flattened the notebook into
|
||||||
|
just `yap_ipython.html`, formerly `yap_ipython.frontend.html.notebook`.
|
||||||
|
|
||||||
|
This will let code that was making `from yap_ipython.frontend...` calls continue
|
||||||
|
working, though a warning will be printed.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
import sys
|
||||||
|
from warnings import warn
|
||||||
|
|
||||||
|
from yap_ipython.utils.shimmodule import ShimModule, ShimWarning
|
||||||
|
|
||||||
|
warn("The top-level `frontend` package has been deprecated since yap_ipython 1.0. "
|
||||||
|
"All its subpackages have been moved to the top `yap_ipython` level.", ShimWarning)
|
||||||
|
|
||||||
|
# Unconditionally insert the shim into sys.modules so that further import calls
|
||||||
|
# trigger the custom attribute access above
|
||||||
|
|
||||||
|
sys.modules['yap_ipython.frontend.html.notebook'] = ShimModule(
|
||||||
|
src='yap_ipython.frontend.html.notebook', mirror='yap_ipython.html')
|
||||||
|
sys.modules['yap_ipython.frontend'] = ShimModule(
|
||||||
|
src='yap_ipython.frontend', mirror='yap_ipython')
|
28
packages/python/yap_kernel/yap_ipython/html.py
Normal file
28
packages/python/yap_kernel/yap_ipython/html.py
Normal file
@ -0,0 +1,28 @@
|
|||||||
|
"""
|
||||||
|
Shim to maintain backwards compatibility with old yap_ipython.html imports.
|
||||||
|
"""
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
import sys
|
||||||
|
from warnings import warn
|
||||||
|
|
||||||
|
from yap_ipython.utils.shimmodule import ShimModule, ShimWarning
|
||||||
|
|
||||||
|
warn("The `yap_ipython.html` package has been deprecated since yap_ipython 4.0. "
|
||||||
|
"You should import from `notebook` instead. "
|
||||||
|
"`yap_ipython.html.widgets` has moved to `ipywidgets`.", ShimWarning)
|
||||||
|
|
||||||
|
_widgets = sys.modules['yap_ipython.html.widgets'] = ShimModule(
|
||||||
|
src='yap_ipython.html.widgets', mirror='ipywidgets')
|
||||||
|
|
||||||
|
_html = ShimModule(
|
||||||
|
src='yap_ipython.html', mirror='notebook')
|
||||||
|
|
||||||
|
# hook up widgets
|
||||||
|
_html.widgets = _widgets
|
||||||
|
sys.modules['yap_ipython.html'] = _html
|
||||||
|
|
||||||
|
if __name__ == '__main__':
|
||||||
|
from notebook import notebookapp as app
|
||||||
|
app.launch_new_instance()
|
35
packages/python/yap_kernel/yap_ipython/kernel/__init__.py
Normal file
35
packages/python/yap_kernel/yap_ipython/kernel/__init__.py
Normal file
@ -0,0 +1,35 @@
|
|||||||
|
"""
|
||||||
|
Shim to maintain backwards compatibility with old yap_ipython.kernel imports.
|
||||||
|
"""
|
||||||
|
# Copyright (c) yap_ipython Development Team.
|
||||||
|
# Distributed under the terms of the Modified BSD License.
|
||||||
|
|
||||||
|
import sys
|
||||||
|
from warnings import warn
|
||||||
|
|
||||||
|
from yap_ipython.utils.shimmodule import ShimModule, ShimWarning
|
||||||
|
|
||||||
|
warn("The `yap_ipython.kernel` package has been deprecated since yap_ipython 4.0."
|
||||||
|
"You should import from yap_kernel or jupyter_client instead.", ShimWarning)
|
||||||
|
|
||||||
|
|
||||||
|
# zmq subdir is gone
|
||||||
|
sys.modules['yap_ipython.kernel.zmq.session'] = ShimModule(
|
||||||
|
src='yap_ipython.kernel.zmq.session', mirror='jupyter_client.session')
|
||||||
|
sys.modules['yap_ipython.kernel.zmq'] = ShimModule(
|
||||||
|
src='yap_ipython.kernel.zmq', mirror='yap_kernel')
|
||||||
|
|
||||||
|
for pkg in ('comm', 'inprocess'):
|
||||||
|
src = 'yap_ipython.kernel.%s' % pkg
|
||||||
|
sys.modules[src] = ShimModule(src=src, mirror='yap_kernel.%s' % pkg)
|
||||||
|
|
||||||
|
for pkg in ('ioloop', 'blocking'):
|
||||||
|
src = 'yap_ipython.kernel.%s' % pkg
|
||||||
|
sys.modules[src] = ShimModule(src=src, mirror='jupyter_client.%s' % pkg)
|
||||||
|
|
||||||
|
# required for `from yap_ipython.kernel import PKG`
|
||||||
|
from yap_kernel import comm, inprocess
|
||||||
|
from jupyter_client import ioloop, blocking
|
||||||
|
# public API
|
||||||
|
from yap_kernel.connect import *
|
||||||
|
from jupyter_client import *
|
@ -0,0 +1,3 @@
|
|||||||
|
if __name__ == '__main__':
|
||||||
|
from yap_kernel import kernelapp as app
|
||||||
|
app.launch_new_instance()
|
1
packages/python/yap_kernel/yap_ipython/kernel/adapter.py
Normal file
1
packages/python/yap_kernel/yap_ipython/kernel/adapter.py
Normal file
@ -0,0 +1 @@
|
|||||||
|
from jupyter_client.adapter import *
|
@ -0,0 +1 @@
|
|||||||
|
from jupyter_client.channels import *
|
@ -0,0 +1 @@
|
|||||||
|
from jupyter_client.channelsabc import *
|
1
packages/python/yap_kernel/yap_ipython/kernel/client.py
Normal file
1
packages/python/yap_kernel/yap_ipython/kernel/client.py
Normal file
@ -0,0 +1 @@
|
|||||||
|
from jupyter_client.client import *
|
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user