Merge branch '1.0.x' of git://gitorious.org/statusnet/mainline

EVENTS.txt

@@ -742,19 +742,19 @@ EndUnsubscribe: when an unsubscribe is done
 
 StartJoinGroup: when a user is joining a group
 - $group: the group being joined
-- $user: the user joining
+- $profile: the local or remote user joining
 
 EndJoinGroup: when a user finishes joining a group
 - $group: the group being joined
-- $user: the user joining
+- $profile: the local or remote user joining
 
 StartLeaveGroup: when a user is leaving a group
 - $group: the group being left
-- $user: the user leaving
+- $profile: the local or remote user leaving
 
 EndLeaveGroup: when a user has left a group
 - $group: the group being left
-- $user: the user leaving
+- $profile: the local or remote user leaving
 
 StartShowContentLicense: Showing the default license for content
 - $action: the current action
@@ -1131,3 +1131,11 @@ StartActivityObjectOutputJson: Called at start of JSON output generation for Act
 EndActivityObjectOutputJson: Called at end of JSON output generation for ActivityObject chunks: the array has not yet been filled out.
 - $obj ActivityObject
 - &$out: array to be serialized; you're free to modify it
+
+StartNoticeWhoGets: Called at start of inbox delivery prep; plugins can schedule notices to go to particular profiles that would otherwise not have reached them. Canceling will take over the entire addressing operation. Be aware that output can be cached or used several times, so should remain idempotent.
+- $notice Notice
+- &$ni: in/out array mapping profile IDs to constants: NOTICE_INBOX_SOURCE_SUB etc
+
+EndNoticeWhoGets: Called at end of inbox delivery prep; plugins can filter out profiles from receiving inbox delivery here.  Be aware that output can be cached or used several times, so should remain idempotent.
+- $notice Notice
+- &$ni: in/out array mapping profile IDs to constants: NOTICE_INBOX_SOURCE_SUB etc

actions/apigroupjoin.php

@@ -126,10 +126,7 @@ class ApiGroupJoinAction extends ApiAuthAction
         }
 
         try {
-            if (Event::handle('StartJoinGroup', array($this->group, $this->user))) {
-                Group_member::join($this->group->id, $this->user->id);
-                Event::handle('EndJoinGroup', array($this->group, $this->user));
-            }
+            $this->user->joinGroup($this->group);
         } catch (Exception $e) {
             // TRANS: Server error displayed when joining a group failed in the database.
             // TRANS: %1$s is the joining user's nickname, $2$s is the group nickname for which the join failed.

actions/apigroupleave.php

@@ -117,10 +117,7 @@ class ApiGroupLeaveAction extends ApiAuthAction
         }
 
         try {
-            if (Event::handle('StartLeaveGroup', array($this->group,$this->user))) {
-                Group_member::leave($this->group->id, $this->user->id);
-                Event::handle('EndLeaveGroup', array($this->group, $this->user));
-            }
+            $this->user->leaveGroup($this->group);
         } catch (Exception $e) {
             // TRANS: Server error displayed when leaving a group failed in the database.
             // TRANS: %1$s is the leaving user's nickname, $2$s is the group nickname for which the leave failed.

actions/apitimelineretweetedtome.php

@@ -95,6 +95,9 @@ class ApiTimelineRetweetedToMeAction extends ApiAuthAction
         // TRANS: Title for Atom feed "repeated to me". %s is the user nickname.
         $title      = sprintf(_("Repeated to %s"), $this->auth_user->nickname);
         $subtitle   = sprintf(
+            // @todo FIXME: $profile is not defined.
+            // TRANS: Subtitle for API action that shows most recent notices that are repeats in user's inbox.
+            // TRANS: %1$s is the sitename, %2$s is a user nickname, %3$s is a user profile name.
             _('%1$s notices that were to repeated to %2$s / %3$s.'),
             $sitename, $this->user->nickname, $profile->getBestName()
         );

actions/apitimelineuser.php

@@ -322,8 +322,11 @@ class ApiTimelineUserAction extends ApiBareAuthAction
             $this->clientError(_('Atom post must not be empty.'));
         }
 
-        $dom = DOMDocument::loadXML($xml);
-        if (!$dom) {
+        $old = error_reporting(error_reporting() & ~(E_WARNING | E_NOTICE));
+        $dom = new DOMDocument();
+        $ok = $dom->loadXML($xml);
+        error_reporting($old);
+        if (!$ok) {
             // TRANS: Client error displayed attempting to post an API that is not well-formed XML.
             $this->clientError(_('Atom post must be well-formed XML.'));
         }

actions/approvegroup.php

@@ -0,0 +1,193 @@
+<?php
+/**
+ * StatusNet, the distributed open-source microblogging tool
+ *
+ * Leave a group
+ *
+ * PHP version 5
+ *
+ * LICENCE: This program is free software: you can redistribute it and/or modify
+ * it under the terms of the GNU Affero General Public License as published by
+ * the Free Software Foundation, either version 3 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU Affero General Public License for more details.
+ *
+ * You should have received a copy of the GNU Affero General Public License
+ * along with this program.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ * @category  Group
+ * @package   StatusNet
+ * @author    Evan Prodromou <evan@status.net>
+ * @copyright 2008-2009 StatusNet, Inc.
+ * @license   http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
+ * @link      http://status.net/
+ */
+
+if (!defined('STATUSNET') && !defined('LACONICA')) {
+    exit(1);
+}
+
+/**
+ * Leave a group
+ *
+ * This is the action for leaving a group. It works more or less like the subscribe action
+ * for users.
+ *
+ * @category Group
+ * @package  StatusNet
+ * @author   Evan Prodromou <evan@status.net>
+ * @license  http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
+ * @link     http://status.net/
+ */
+class ApprovegroupAction extends Action
+{
+    var $group = null;
+
+    /**
+     * Prepare to run
+     */
+    function prepare($args)
+    {
+        parent::prepare($args);
+
+        if (!common_logged_in()) {
+            // TRANS: Client error displayed when trying to leave a group while not logged in.
+            $this->clientError(_('You must be logged in to leave a group.'));
+            return false;
+        }
+
+        $nickname_arg = $this->trimmed('nickname');
+        $id = intval($this->arg('id'));
+        if ($id) {
+            $this->group = User_group::staticGet('id', $id);
+        } else if ($nickname_arg) {
+            $nickname = common_canonical_nickname($nickname_arg);
+
+            // Permanent redirect on non-canonical nickname
+
+            if ($nickname_arg != $nickname) {
+                $args = array('nickname' => $nickname);
+                common_redirect(common_local_url('leavegroup', $args), 301);
+                return false;
+            }
+
+            $local = Local_group::staticGet('nickname', $nickname);
+
+            if (!$local) {
+                // TRANS: Client error displayed when trying to leave a non-local group.
+                $this->clientError(_('No such group.'), 404);
+                return false;
+            }
+
+            $this->group = User_group::staticGet('id', $local->group_id);
+        } else {
+            // TRANS: Client error displayed when trying to leave a group without providing a group name or group ID.
+            $this->clientError(_('No nickname or ID.'), 404);
+            return false;
+        }
+
+        if (!$this->group) {
+            // TRANS: Client error displayed when trying to leave a non-existing group.
+            $this->clientError(_('No such group.'), 404);
+            return false;
+        }
+
+        $cur = common_current_user();
+        if (empty($cur)) {
+            // TRANS: Client error displayed trying to approve group membership while not logged in.
+            $this->clientError(_('Must be logged in.'), 403);
+            return false;
+        }
+        if ($this->arg('profile_id')) {
+            if ($cur->isAdmin($this->group)) {
+                $this->profile = Profile::staticGet('id', $this->arg('profile_id'));
+            } else {
+                // TRANS: Client error displayed trying to approve group membership while not a group administrator.
+                $this->clientError(_('Only group admin can approve or cancel join requests.'), 403);
+                return false;
+            }
+        } else {
+            // TRANS: Client error displayed trying to approve group membership without specifying a profile to approve.
+            $this->clientError(_('Must specify a profile.'));
+            return false;
+        }
+
+        $this->request = Group_join_queue::pkeyGet(array('profile_id' => $this->profile->id,
+                                                         'group_id' => $this->group->id));
+
+        if (empty($this->request)) {
+            // TRANS: Client error displayed trying to approve group membership for a non-existing request.
+            $this->clientError(sprintf(_('%s is not in the moderation queue for this group.'), $this->profile->nickname), 403);
+        }
+
+        $this->approve = (bool)$this->arg('approve');
+        $this->cancel = (bool)$this->arg('cancel');
+        if (!$this->approve && !$this->cancel) {
+            // TRANS: Client error displayed trying to approve/deny group membership.
+            $this->clientError(_('Internal error: received neither cancel nor abort.'));
+        }
+        if ($this->approve && $this->cancel) {
+            // TRANS: Client error displayed trying to approve/deny group membership.
+            $this->clientError(_('Internal error: received both cancel and abort.'));
+        }
+        return true;
+    }
+
+    /**
+     * Handle the request
+     *
+     * On POST, add the current user to the group
+     *
+     * @param array $args unused
+     *
+     * @return void
+     */
+    function handle($args)
+    {
+        parent::handle($args);
+
+        try {
+            if ($this->approve) {
+                $this->profile->completeJoinGroup($this->group);
+            } elseif ($this->cancel) {
+                $this->profile->cancelJoinGroup($this->group);
+            }
+        } catch (Exception $e) {
+            common_log(LOG_ERROR, "Exception canceling group sub: " . $e->getMessage());
+            // TRANS: Server error displayed when cancelling a queued group join request fails.
+            // TRANS: %1$s is the leaving user's nickname, $2$s is the group nickname for which the leave failed.
+            $this->serverError(sprintf(_('Could not cancel request for user %1$s to join group %2$s.'),
+                                       $this->profile->nickname, $this->group->nickname));
+            return;
+        }
+
+        if ($this->boolean('ajax')) {
+            $this->startHTML('text/xml;charset=utf-8');
+            $this->elementStart('head');
+            // TRANS: Title for leave group page after group join request is approved/disapproved.
+            // TRANS: %1$s is the user nickname, %2$s is the group nickname.
+            $this->element('title', null, sprintf(_m('TITLE','%1$s\'s request for %2$s'),
+                                                  $this->profile->nickname,
+                                                  $this->group->nickname));
+            $this->elementEnd('head');
+            $this->elementStart('body');
+            if ($this->approve) {
+                // TRANS: Message on page for group admin after approving a join request. 
+                $this->element('p', 'success', _('Join request approved.'));
+            } elseif ($this->cancel) {
+                // TRANS: Message on page for group admin after rejecting a join request. 
+                $this->element('p', 'success', _('Join request canceled.'));
+            }
+            $this->elementEnd('body');
+            $this->elementEnd('html');
+        } else {
+            common_redirect(common_local_url('groupmembers', array('nickname' =>
+                                                                   $this->group->nickname)),
+                            303);
+        }
+    }
+}

actions/atompubmembershipfeed.php

@@ -141,7 +141,7 @@ class AtompubmembershipfeedAction extends ApiAuthAction
 
         // TRANS: Title for group membership feed.
         // TRANS: %s is a username.
-        $feed->setTitle(sprintf(_("%s group memberships"),
+        $feed->setTitle(sprintf(_('Group memberships of %s'),
                                 $this->_profile->getBestName()));
 
         // TRANS: Subtitle for group membership feed.
@@ -237,8 +237,7 @@ class AtompubmembershipfeedAction extends ApiAuthAction
 
         if (Event::handle('StartAtomPubNewActivity', array(&$activity))) {
             if ($activity->verb != ActivityVerb::JOIN) {
-                // TRANS: Client error displayed when not using the POST verb.
-                // TRANS: Do not translate POST.
+                // TRANS: Client error displayed when not using the join verb.
                 throw new ClientException(_('Can only handle join activities.'));
                 return;
             }
@@ -275,10 +274,7 @@ class AtompubmembershipfeedAction extends ApiAuthAction
                 throw new ClientException(_('Blocked by admin.'));
             }
 
-            if (Event::handle('StartJoinGroup', array($group, $this->auth_user))) {
-                $membership = Group_member::join($group->id, $this->auth_user->id);
-                Event::handle('EndJoinGroup', array($group, $this->auth_user));
-            }
+            $this->auth_user->joinGroup($group);
 
             Event::handle('EndAtomPubNewActivity', array($activity, $membership));
         }

actions/atompubshowmembership.php

@@ -151,10 +151,7 @@ class AtompubshowmembershipAction extends ApiAuthAction
                                         " membership."), 403);
         }
 
-        if (Event::handle('StartLeaveGroup', array($this->_group, $this->auth_user))) {
-            Group_member::leave($this->_group->id, $this->auth_user->id);
-            Event::handle('EndLeaveGroup', array($this->_group, $this->auth_user));
-        }
+        $this->auth_user->leaveGroup($this->_group);
 
         return;
     }

actions/cancelgroup.php

@@ -0,0 +1,172 @@
+<?php
+/**
+ * StatusNet, the distributed open-source microblogging tool
+ *
+ * Leave a group
+ *
+ * PHP version 5
+ *
+ * LICENCE: This program is free software: you can redistribute it and/or modify
+ * it under the terms of the GNU Affero General Public License as published by
+ * the Free Software Foundation, either version 3 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU Affero General Public License for more details.
+ *
+ * You should have received a copy of the GNU Affero General Public License
+ * along with this program.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ * @category  Group
+ * @package   StatusNet
+ * @author    Evan Prodromou <evan@status.net>
+ * @copyright 2008-2009 StatusNet, Inc.
+ * @license   http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
+ * @link      http://status.net/
+ */
+
+if (!defined('STATUSNET') && !defined('LACONICA')) {
+    exit(1);
+}
+
+/**
+ * Leave a group
+ *
+ * This is the action for leaving a group. It works more or less like the subscribe action
+ * for users.
+ *
+ * @category Group
+ * @package  StatusNet
+ * @author   Evan Prodromou <evan@status.net>
+ * @license  http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
+ * @link     http://status.net/
+ */
+class CancelgroupAction extends Action
+{
+    var $group = null;
+
+    /**
+     * Prepare to run
+     */
+    function prepare($args)
+    {
+        parent::prepare($args);
+
+        if (!common_logged_in()) {
+            // TRANS: Client error displayed when trying to leave a group while not logged in.
+            $this->clientError(_('You must be logged in to leave a group.'));
+            return false;
+        }
+
+        $nickname_arg = $this->trimmed('nickname');
+        $id = intval($this->arg('id'));
+        if ($id) {
+            $this->group = User_group::staticGet('id', $id);
+        } else if ($nickname_arg) {
+            $nickname = common_canonical_nickname($nickname_arg);
+
+            // Permanent redirect on non-canonical nickname
+            if ($nickname_arg != $nickname) {
+                $args = array('nickname' => $nickname);
+                common_redirect(common_local_url('leavegroup', $args), 301);
+                return false;
+            }
+
+            $local = Local_group::staticGet('nickname', $nickname);
+
+            if (!$local) {
+                // TRANS: Client error displayed when trying to leave a non-local group.
+                $this->clientError(_('No such group.'), 404);
+                return false;
+            }
+
+            $this->group = User_group::staticGet('id', $local->group_id);
+        } else {
+            // TRANS: Client error displayed when trying to leave a group without providing a group name or group ID.
+            $this->clientError(_('No nickname or ID.'), 404);
+            return false;
+        }
+
+        if (!$this->group) {
+            // TRANS: Client error displayed when trying to leave a non-existing group.
+            $this->clientError(_('No such group.'), 404);
+            return false;
+        }
+
+        $cur = common_current_user();
+        if (empty($cur)) {
+            // TRANS: Client error displayed when trying to leave a group while not logged in.
+            $this->clientError(_('Must be logged in.'), 403);
+            return false;
+        }
+        if ($this->arg('profile_id')) {
+            if ($cur->isAdmin($this->group)) {
+                $this->profile = Profile::staticGet('id', $this->arg('profile_id'));
+            } else {
+                // TRANS: Client error displayed when trying to approve or cancel a group join request without
+                // TRANS: being a group administrator.
+                $this->clientError(_('Only group admin can approve or cancel join requests.'), 403);
+                return false;
+            }
+        } else {
+            $this->profile = $cur->getProfile();
+        }
+
+        $this->request = Group_join_queue::pkeyGet(array('profile_id' => $this->profile->id,
+                                                         'group_id' => $this->group->id));
+
+        if (empty($this->request)) {
+            // TRANS: Client error displayed when trying to approve a non-existing group join request.
+            // TRANS: %s is a user nickname.
+            $this->clientError(sprintf(_('%s is not in the moderation queue for this group.'), $this->profile->nickname), 403);
+        }
+        return true;
+    }
+
+    /**
+     * Handle the request
+     *
+     * On POST, add the current user to the group
+     *
+     * @param array $args unused
+     *
+     * @return void
+     */
+    function handle($args)
+    {
+        parent::handle($args);
+
+        try {
+            $this->profile->cancelJoinGroup($this->group);
+        } catch (Exception $e) {
+            common_log(LOG_ERROR, "Exception canceling group sub: " . $e->getMessage());
+            // TRANS: Server error displayed when cancelling a queued group join request fails.
+            // TRANS: %1$s is the leaving user's nickname, $2$s is the group nickname for which the leave failed.
+            $this->serverError(sprintf(_('Could not cancel request for user %1$s to join group %2$s.'),
+                                       $this->profile->nickname, $this->group->nickname));
+            return;
+        }
+
+        if ($this->boolean('ajax')) {
+            $this->startHTML('text/xml;charset=utf-8');
+            $this->elementStart('head');
+            // TRANS: Title for leave group page after leaving.
+            // TRANS: %s$s is the leaving user's name, %2$s is the group name.
+            $this->element('title', null, sprintf(_m('TITLE','%1$s left group %2$s'),
+                                                  $this->profile->nickname,
+                                                  $this->group->nickname));
+            $this->elementEnd('head');
+            $this->elementStart('body');
+            $jf = new JoinForm($this, $this->group);
+            $jf->show();
+            $this->elementEnd('body');
+            $this->elementEnd('html');
+        } else {
+            common_redirect(common_local_url('groupmembers', array('nickname' =>
+                                                                   $this->group->nickname)),
+                            303);
+        }
+    }
+}

actions/confirmaddress.php

@@ -118,7 +118,8 @@ class ConfirmaddressAction extends Action
 
             if (!$result) {
                 common_log_db_error($cur, 'UPDATE', __FILE__);
-                $this->serverError(_('Couldn\'t update user.'));
+                // TRANS: Server error displayed when confirming an e-mail address or IM address fails.
+                $this->serverError(_('Could not update user.'));
                 return;
             }
 
@@ -133,6 +134,7 @@ class ConfirmaddressAction extends Action
             $user_im_prefs->user_id = $cur->id;
             if ($user_im_prefs->find() && $user_im_prefs->fetch()) {
                 if($user_im_prefs->screenname == $confirm->address){
+                    // TRANS: Client error for an already confirmed IM address.
                     $this->clientError(_('That address has already been confirmed.'));
                     return;
                 }
@@ -141,7 +143,8 @@ class ConfirmaddressAction extends Action
 
                 if (!$result) {
                     common_log_db_error($user_im_prefs, 'UPDATE', __FILE__);
-                    $this->serverError(_('Couldn\'t update user im preferences.'));
+                    // TRANS: Server error displayed when updating IM preferences fails.
+                    $this->serverError(_('Could not update user IM preferences.'));
                     return;
                 }
             }else{
@@ -153,7 +156,8 @@ class ConfirmaddressAction extends Action
 
                 if (!$result) {
                     common_log_db_error($user_im_prefs, 'INSERT', __FILE__);
-                    $this->serverError(_('Couldn\'t insert user im preferences.'));
+                    // TRANS: Server error displayed when adding IM preferences fails.
+                    $this->serverError(_('Could not insert user IM preferences.'));
                     return;
                 }
             }

actions/conversationreplies.php

@@ -0,0 +1,106 @@
+<?php
+/**
+ * Display a conversation in the browser
+ *
+ * PHP version 5
+ *
+ * @category Action
+ * @package  StatusNet
+ * @author   Evan Prodromou <evan@status.net>
+ * @license  http://www.fsf.org/licensing/licenses/agpl.html AGPLv3
+ * @link     http://status.net/
+ *
+ * StatusNet - the distributed open-source microblogging tool
+ * Copyright (C) 2009, StatusNet, Inc.
+ *
+ * This program is free software: you can redistribute it and/or modify
+ * it under the terms of the GNU Affero General Public License as published by
+ * the Free Software Foundation, either version 3 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU Affero General Public License for more details.
+ *
+ * You should have received a copy of the GNU Affero General Public License
+ * along with this program.  If not, see <http://www.gnu.org/licenses/>.
+ */
+
+if (!defined('STATUSNET') && !defined('LACONICA')) {
+    exit(1);
+}
+
+// XXX: not sure how to do paging yet,
+// so set a 60-notice limit
+
+require_once INSTALLDIR.'/lib/noticelist.php';
+
+/**
+ * Conversation tree in the browser
+ *
+ * @category Action
+ * @package  StatusNet
+ * @author   Evan Prodromou <evan@status.net>
+ * @license  http://www.fsf.org/licensing/licenses/agpl.html AGPLv3
+ * @link     http://status.net/
+ */
+class ConversationRepliesAction extends ConversationAction
+{
+    function handle($args)
+    {
+        if ($this->boolean('ajax')) {
+            $this->showAjax();
+        } else {
+            parent::handle($args);
+        }
+    }
+
+    /**
+     * Show content.
+     *
+     * Display a hierarchical unordered list in the content area.
+     * Uses ConversationTree to do most of the heavy lifting.
+     *
+     * @return void
+     */
+    function showContent()
+    {
+        $notices = Notice::conversationStream($this->id, null, null);
+
+        $ct = new FullThreadedNoticeList($notices, $this);
+
+        $cnt = $ct->show();
+    }
+
+    function showAjax()
+    {
+        header('Content-Type: text/xml;charset=utf-8');
+        $this->xw->startDocument('1.0', 'UTF-8');
+        $this->elementStart('html');
+        $this->elementStart('head');
+        // TRANS: Title for conversation page.
+        $this->element('title', null, _m('TITLE','Notice'));
+        $this->elementEnd('head');
+        $this->elementStart('body');
+        $this->showContent();
+        $this->elementEnd('body');
+        $this->elementEnd('html');
+    }
+}
+
+class FullThreadedNoticeList extends ThreadedNoticeList
+{
+    function newListItem($notice)
+    {
+        return new FullThreadedNoticeListItem($notice, $this->out);
+    }
+}
+
+class FullThreadedNoticeListItem extends ThreadedNoticeListItem
+{
+    function initialItems()
+    {
+        return 1000; // @fixme
+    }
+}

actions/editgroup.php

@@ -185,6 +185,7 @@ class EditgroupAction extends GroupDesignAction
             $description = $this->trimmed('description');
             $location    = $this->trimmed('location');
             $aliasstring = $this->trimmed('aliases');
+            $join_policy = intval($this->arg('join_policy'));
 
             if ($this->nicknameExists($nickname)) {
                 // TRANS: Group edit form validation error.
@@ -265,6 +266,7 @@ class EditgroupAction extends GroupDesignAction
             $this->group->description = $description;
             $this->group->location    = $location;
             $this->group->mainpage    = common_local_url('showgroup', array('nickname' => $nickname));
+            $this->group->join_policy = $join_policy;
 
             $result = $this->group->update($orig);
 

actions/groupmembers.php

@@ -152,376 +152,3 @@ class GroupmembersAction extends GroupDesignAction
                           array('nickname' => $this->group->nickname));
     }
 }
-
-class GroupMemberList extends ProfileList
-{
-    var $group = null;
-
-    function __construct($profile, $group, $action)
-    {
-        parent::__construct($profile, $action);
-
-        $this->group = $group;
-    }
-
-    function newListItem($profile)
-    {
-        return new GroupMemberListItem($profile, $this->group, $this->action);
-    }
-}
-
-class GroupMemberListItem extends ProfileListItem
-{
-    var $group = null;
-
-    function __construct($profile, $group, $action)
-    {
-        parent::__construct($profile, $action);
-
-        $this->group = $group;
-    }
-
-    function showFullName()
-    {
-        parent::showFullName();
-        if ($this->profile->isAdmin($this->group)) {
-            $this->out->text(' '); // for separating the classes.
-            // TRANS: Indicator in group members list that this user is a group administrator.
-            $this->out->element('span', 'role', _('Admin'));
-        }
-    }
-
-    function showActions()
-    {
-        $this->startActions();
-        if (Event::handle('StartProfileListItemActionElements', array($this))) {
-            $this->showSubscribeButton();
-            $this->showMakeAdminForm();
-            $this->showGroupBlockForm();
-            Event::handle('EndProfileListItemActionElements', array($this));
-        }
-        $this->endActions();
-    }
-
-    function showMakeAdminForm()
-    {
-        $user = common_current_user();
-
-        if (!empty($user) &&
-            $user->id != $this->profile->id &&
-            ($user->isAdmin($this->group) || $user->hasRight(Right::MAKEGROUPADMIN)) &&
-            !$this->profile->isAdmin($this->group)) {
-            $this->out->elementStart('li', 'entity_make_admin');
-            $maf = new MakeAdminForm($this->out, $this->profile, $this->group,
-                                     $this->returnToArgs());
-            $maf->show();
-            $this->out->elementEnd('li');
-        }
-
-    }
-
-    function showGroupBlockForm()
-    {
-        $user = common_current_user();
-
-        if (!empty($user) && $user->id != $this->profile->id && $user->isAdmin($this->group)) {
-            $this->out->elementStart('li', 'entity_block');
-            $bf = new GroupBlockForm($this->out, $this->profile, $this->group,
-                                     $this->returnToArgs());
-            $bf->show();
-            $this->out->elementEnd('li');
-        }
-    }
-
-    function linkAttributes()
-    {
-        $aAttrs = parent::linkAttributes();
-
-        if (common_config('nofollow', 'members')) {
-            $aAttrs['rel'] .= ' nofollow';
-        }
-
-        return $aAttrs;
-    }
-
-    function homepageAttributes()
-    {
-        $aAttrs = parent::linkAttributes();
-
-        if (common_config('nofollow', 'members')) {
-            $aAttrs['rel'] = 'nofollow';
-        }
-
-        return $aAttrs;
-    }
-
-    /**
-     * Fetch necessary return-to arguments for the profile forms
-     * to return to this list when they're done.
-     *
-     * @return array
-     */
-    protected function returnToArgs()
-    {
-        $args = array('action' => 'groupmembers',
-                      'nickname' => $this->group->nickname);
-        $page = $this->out->arg('page');
-        if ($page) {
-            $args['param-page'] = $page;
-        }
-        return $args;
-    }
-}
-
-/**
- * Form for blocking a user from a group
- *
- * @category Form
- * @package  StatusNet
- * @author   Evan Prodromou <evan@status.net>
- * @author   Sarven Capadisli <csarven@status.net>
- * @license  http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
- * @link     http://status.net/
- *
- * @see      BlockForm
- */
-class GroupBlockForm extends Form
-{
-    /**
-     * Profile of user to block
-     */
-
-    var $profile = null;
-
-    /**
-     * Group to block the user from
-     */
-
-    var $group = null;
-
-    /**
-     * Return-to args
-     */
-
-    var $args = null;
-
-    /**
-     * Constructor
-     *
-     * @param HTMLOutputter $out     output channel
-     * @param Profile       $profile profile of user to block
-     * @param User_group    $group   group to block user from
-     * @param array         $args    return-to args
-     */
-    function __construct($out=null, $profile=null, $group=null, $args=null)
-    {
-        parent::__construct($out);
-
-        $this->profile = $profile;
-        $this->group   = $group;
-        $this->args    = $args;
-    }
-
-    /**
-     * ID of the form
-     *
-     * @return int ID of the form
-     */
-    function id()
-    {
-        // This should be unique for the page.
-        return 'block-' . $this->profile->id;
-    }
-
-    /**
-     * class of the form
-     *
-     * @return string class of the form
-     */
-    function formClass()
-    {
-        return 'form_group_block';
-    }
-
-    /**
-     * Action of the form
-     *
-     * @return string URL of the action
-     */
-    function action()
-    {
-        return common_local_url('groupblock');
-    }
-
-    /**
-     * Legend of the Form
-     *
-     * @return void
-     */
-    function formLegend()
-    {
-        // TRANS: Form legend for form to block user from a group.
-        $this->out->element('legend', null, _('Block user from group'));
-    }
-
-    /**
-     * Data elements of the form
-     *
-     * @return void
-     */
-    function formData()
-    {
-        $this->out->hidden('blockto-' . $this->profile->id,
-                           $this->profile->id,
-                           'blockto');
-        $this->out->hidden('blockgroup-' . $this->group->id,
-                           $this->group->id,
-                           'blockgroup');
-        if ($this->args) {
-            foreach ($this->args as $k => $v) {
-                $this->out->hidden('returnto-' . $k, $v);
-            }
-        }
-    }
-
-    /**
-     * Action elements
-     *
-     * @return void
-     */
-    function formActions()
-    {
-        $this->out->submit(
-            'submit',
-            // TRANS: Button text for the form that will block a user from a group.
-            _m('BUTTON','Block'),
-            'submit',
-            null,
-            // TRANS: Submit button title.
-            _m('TOOLTIP', 'Block this user'));
-    }
-}
-
-/**
- * Form for making a user an admin for a group
- *
- * @category Form
- * @package  StatusNet
- * @author   Evan Prodromou <evan@status.net>
- * @author   Sarven Capadisli <csarven@status.net>
- * @license  http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
- * @link     http://status.net/
- */
-class MakeAdminForm extends Form
-{
-    /**
-     * Profile of user to block
-     */
-    var $profile = null;
-
-    /**
-     * Group to block the user from
-     */
-    var $group = null;
-
-    /**
-     * Return-to args
-     */
-    var $args = null;
-
-    /**
-     * Constructor
-     *
-     * @param HTMLOutputter $out     output channel
-     * @param Profile       $profile profile of user to block
-     * @param User_group    $group   group to block user from
-     * @param array         $args    return-to args
-     */
-    function __construct($out=null, $profile=null, $group=null, $args=null)
-    {
-        parent::__construct($out);
-
-        $this->profile = $profile;
-        $this->group   = $group;
-        $this->args    = $args;
-    }
-
-    /**
-     * ID of the form
-     *
-     * @return int ID of the form
-     */
-    function id()
-    {
-        // This should be unique for the page.
-        return 'makeadmin-' . $this->profile->id;
-    }
-
-    /**
-     * class of the form
-     *
-     * @return string class of the form
-     */
-    function formClass()
-    {
-        return 'form_make_admin';
-    }
-
-    /**
-     * Action of the form
-     *
-     * @return string URL of the action
-     */
-    function action()
-    {
-        return common_local_url('makeadmin', array('nickname' => $this->group->nickname));
-    }
-
-    /**
-     * Legend of the Form
-     *
-     * @return void
-     */
-    function formLegend()
-    {
-        // TRANS: Form legend for form to make a user a group admin.
-        $this->out->element('legend', null, _('Make user an admin of the group'));
-    }
-
-    /**
-     * Data elements of the form
-     *
-     * @return void
-     */
-    function formData()
-    {
-        $this->out->hidden('profileid-' . $this->profile->id,
-                           $this->profile->id,
-                           'profileid');
-        $this->out->hidden('groupid-' . $this->group->id,
-                           $this->group->id,
-                           'groupid');
-        if ($this->args) {
-            foreach ($this->args as $k => $v) {
-                $this->out->hidden('returnto-' . $k, $v);
-            }
-        }
-    }
-
-    /**
-     * Action elements
-     *
-     * @return void
-     */
-    function formActions()
-    {
-        $this->out->submit(
-          'submit',
-          // TRANS: Button text for the form that will make a user administrator.
-          _m('BUTTON','Make Admin'),
-          'submit',
-          null,
-          // TRANS: Submit button title.
-          _m('TOOLTIP','Make this user an admin'));
-    }
-}

actions/groupqueue.php

@@ -0,0 +1,191 @@
+<?php
+/**
+ * StatusNet, the distributed open-source microblogging tool
+ *
+ * List of group members
+ *
+ * PHP version 5
+ *
+ * LICENCE: This program is free software: you can redistribute it and/or modify
+ * it under the terms of the GNU Affero General Public License as published by
+ * the Free Software Foundation, either version 3 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU Affero General Public License for more details.
+ *
+ * You should have received a copy of the GNU Affero General Public License
+ * along with this program.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ * @category  Group
+ * @package   StatusNet
+ * @author    Evan Prodromou <evan@status.net>
+ * @copyright 2008-2009 StatusNet, Inc.
+ * @license   http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
+ * @link      http://status.net/
+ */
+
+if (!defined('STATUSNET') && !defined('LACONICA')) {
+    exit(1);
+}
+
+require_once(INSTALLDIR.'/lib/profilelist.php');
+require_once INSTALLDIR.'/lib/publicgroupnav.php';
+
+/**
+ * List of group members
+ *
+ * @category Group
+ * @package  StatusNet
+ * @author   Evan Prodromou <evan@status.net>
+ * @license  http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
+ * @link     http://status.net/
+ */
+class GroupqueueAction extends GroupDesignAction
+{
+    var $page = null;
+
+    function isReadOnly($args)
+    {
+        return true;
+    }
+
+    // @todo FIXME: most of this belongs in a base class, sounds common to most group actions?
+    function prepare($args)
+    {
+        parent::prepare($args);
+        $this->page = ($this->arg('page')) ? ($this->arg('page')+0) : 1;
+
+        $nickname_arg = $this->arg('nickname');
+        $nickname = common_canonical_nickname($nickname_arg);
+
+        // Permanent redirect on non-canonical nickname
+
+        if ($nickname_arg != $nickname) {
+            $args = array('nickname' => $nickname);
+            if ($this->page != 1) {
+                $args['page'] = $this->page;
+            }
+            common_redirect(common_local_url('groupqueue', $args), 301);
+            return false;
+        }
+
+        if (!$nickname) {
+            // TRANS: Client error displayed when trying to view group members without providing a group nickname.
+            $this->clientError(_('No nickname.'), 404);
+            return false;
+        }
+
+        $local = Local_group::staticGet('nickname', $nickname);
+
+        if (!$local) {
+            // TRANS: Client error displayed when trying to view group members for a non-existing group.
+            $this->clientError(_('No such group.'), 404);
+            return false;
+        }
+
+        $this->group = User_group::staticGet('id', $local->group_id);
+
+        if (!$this->group) {
+            // TRANS: Client error displayed when trying to view group members for an object that is not a group.
+            $this->clientError(_('No such group.'), 404);
+            return false;
+        }
+
+        $cur = common_current_user();
+        if (!$cur || !$cur->isAdmin($this->group)) {
+            // TRANS: Client error displayed when trying to approve group applicants without being a group administrator.
+            $this->clientError(_('Only the group admin may approve users.'));
+            return false;
+        }
+        return true;
+    }
+
+    function title()
+    {
+        if ($this->page == 1) {
+            // TRANS: Title of the first page showing pending group members still awaiting approval to join the group.
+            // TRANS: %s is the name of the group.
+            return sprintf(_('%s group members awaiting approval'),
+                           $this->group->nickname);
+        } else {
+            // TRANS: Title of all but the first page showing pending group members still awaiting approval to join the group.
+            // TRANS: %1$s is the name of the group, %2$d is the page number of the members list.
+            return sprintf(_('%1$s group members awaiting approval, page %2$d'),
+                           $this->group->nickname,
+                           $this->page);
+        }
+    }
+
+    function handle($args)
+    {
+        parent::handle($args);
+        $this->showPage();
+    }
+
+    function showPageNotice()
+    {
+        $this->element('p', 'instructions',
+                       // TRANS: Page notice for group members page.
+                       _('A list of users awaiting approval to join this group.'));
+    }
+
+    function showObjectNav()
+    {
+        $nav = new GroupNav($this, $this->group);
+        $nav->show();
+    }
+
+    function showContent()
+    {
+        $offset = ($this->page-1) * PROFILES_PER_PAGE;
+        $limit =  PROFILES_PER_PAGE + 1;
+
+        $cnt = 0;
+
+        $members = $this->group->getRequests($offset, $limit);
+
+        if ($members) {
+            // @fixme change!
+            $member_list = new GroupQueueList($members, $this->group, $this);
+            $cnt = $member_list->show();
+        }
+
+        $members->free();
+
+        $this->pagination($this->page > 1, $cnt > PROFILES_PER_PAGE,
+                          $this->page, 'groupmembers',
+                          array('nickname' => $this->group->nickname));
+    }
+}
+
+class GroupQueueList extends GroupMemberList
+{
+    function newListItem($profile)
+    {
+        return new GroupQueueListItem($profile, $this->group, $this->action);
+    }
+}
+
+class GroupQueueListItem extends GroupMemberListItem
+{
+    function showActions()
+    {
+        $this->startActions();
+        if (Event::handle('StartProfileListItemActionElements', array($this))) {
+            $this->showApproveButtons();
+            Event::handle('EndProfileListItemActionElements', array($this));
+        }
+        $this->endActions();
+    }
+
+    function showApproveButtons()
+    {
+        $this->out->elementStart('li', 'entity_approval');
+        $form = new ApproveGroupForm($this->out, $this->group, $this->profile);
+        $form->show();
+        $this->out->elementEnd('li');
+    }
+}

actions/imsettings.php

@@ -111,8 +111,8 @@ class ImsettingsAction extends SettingsAction
             if ($user_im_prefs = User_im_prefs::pkeyGet( array('transport' => $transport, 'user_id' => $user->id) )) {
                 $user_im_prefs_by_transport[$transport] = $user_im_prefs;
                 $this->element('p', 'form_confirmed', $user_im_prefs->screenname);
-                // TRANS: Form note in IM settings form.
                 $this->element('p', 'form_note',
+                               // TRANS: Form note in IM settings form. %s is the type of IM address that was confirmed.
                                sprintf(_('Current confirmed %s address.'),$transport_info['display']));
                 $this->hidden('screenname', $user_im_prefs->screenname);
                 // TRANS: Button label to remove a confirmed IM address.
@@ -124,11 +124,11 @@ class ImsettingsAction extends SettingsAction
                     // TRANS: Form note in IM settings form.
                     $this->element('p', 'form_note',
                                    // TRANS: Form note in IM settings form.
-                                   // TRANS: %s is the IM address set for the site.
+                                   // TRANS: %s is the IM service name, %2$s is the IM address set.
                                    sprintf(_('Awaiting confirmation on this address. '.
-                                             'Check your %s account for a '.
+                                             'Check your %1$s account for a '.
                                              'message with further instructions. '.
-                                             '(Did you add %s to your buddy list?)'),
+                                             '(Did you add %2$s to your buddy list?)'),
                                              $transport_info['display'],
                                              $transport_info['daemonScreenname']));
                     $this->hidden('screenname', $confirm->address);
@@ -137,8 +137,10 @@ class ImsettingsAction extends SettingsAction
                 } else {
                     $this->elementStart('ul', 'form_data');
                     $this->elementStart('li');
+                    // TRANS: Field label for IM address.
                     $this->input('screenname', _('IM address'),
                                  ($this->arg('screenname')) ? $this->arg('screenname') : null,
+                                 // TRANS: Field title for IM address. %s is the IM service name.
                                  sprintf(_('%s screenname.'),
                                          $transport_info['display']));
                     $this->elementEnd('li');
@@ -288,7 +290,7 @@ class ImsettingsAction extends SettingsAction
                 if ($result === false) {
                     common_log_db_error($user, 'UPDATE', __FILE__);
                     // TRANS: Server error thrown on database error updating IM preferences.
-                    $this->serverError(_('Couldn\'t update IM preferences.'));
+                    $this->serverError(_('Could not update IM preferences.'));
                     return;
                 }
             }while($user_im_prefs->fetch());
@@ -322,6 +324,7 @@ class ImsettingsAction extends SettingsAction
         }
 
         if (!$transport) {
+            // TRANS: Form validation error when no transport is available setting an IM address.
             $this->showForm(_('No transport.'));
             return;
         }
@@ -330,14 +333,14 @@ class ImsettingsAction extends SettingsAction
 
         if (!$screenname) {
             // TRANS: Message given saving IM address that cannot be normalised.
-            $this->showForm(_('Cannot normalize that screenname'));
+            $this->showForm(_('Cannot normalize that screenname.'));
             return;
         }
         $valid = false;
         Event::handle('ValidateImScreenname', array($transport, $screenname, &$valid));
         if (!$valid) {
             // TRANS: Message given saving IM address that not valid.
-            $this->showForm(_('Not a valid screenname'));
+            $this->showForm(_('Not a valid screenname.'));
             return;
         } else if ($this->screennameExists($transport, $screenname)) {
             // TRANS: Message given saving IM address that is already set for another user.
@@ -402,7 +405,7 @@ class ImsettingsAction extends SettingsAction
         if (!$result) {
             common_log_db_error($confirm, 'DELETE', __FILE__);
             // TRANS: Server error thrown on database error canceling IM address confirmation.
-            $this->serverError(_('Couldn\'t delete confirmation.'));
+            $this->serverError(_('Could not delete confirmation.'));
             return;
         }
 
@@ -440,8 +443,7 @@ class ImsettingsAction extends SettingsAction
         if (!$result) {
             common_log_db_error($user, 'UPDATE', __FILE__);
             // TRANS: Server error thrown on database error removing a registered IM address.
-            $this->serverError(_('Couldn\'t update user im prefs.'));
-            $this->serverError(_('Couldn\'t update user.'));
+            $this->serverError(_('Could not update user IM preferences.'));
             return;
         }
 

actions/invite.php

@@ -54,7 +54,7 @@ class InviteAction extends CurrentUserDesignAction
 
     function sendInvitations()
     {
-        # CSRF protection
+        // CSRF protection
         $token = $this->trimmed('token');
         if (!$token || $token != common_session_token()) {
             $this->showForm(_('There was a problem with your session token. Try again, please.'));

actions/joingroup.php

@@ -129,10 +129,7 @@ class JoingroupAction extends Action
         $cur = common_current_user();
 
         try {
-            if (Event::handle('StartJoinGroup', array($this->group, $cur))) {
-                Group_member::join($this->group->id, $cur->id);
-                Event::handle('EndJoinGroup', array($this->group, $cur));
-            }
+            $result = $cur->joinGroup($this->group);
         } catch (Exception $e) {
             // TRANS: Server error displayed when joining a group failed in the database.
             // TRANS: %1$s is the joining user's nickname, $2$s is the group nickname for which the join failed.
@@ -150,8 +147,17 @@ class JoingroupAction extends Action
                                                   $this->group->nickname));
             $this->elementEnd('head');
             $this->elementStart('body');
-            $lf = new LeaveForm($this, $this->group);
-            $lf->show();
+
+            if ($result instanceof Group_member) {
+                $form = new LeaveForm($this, $this->group);
+            } else if ($result instanceof Group_join_queue) {
+                $form = new CancelGroupForm($this, $this->group);
+            } else {
+                // wtf?
+                // TRANS: Exception thrown when there is an unknown error joining a group.
+                throw new Exception(_("Unknown error joining group."));
+            }
+            $form->show();
             $this->elementEnd('body');
             $this->elementEnd('html');
         } else {

actions/leavegroup.php

@@ -123,10 +123,7 @@ class LeavegroupAction extends Action
         $cur = common_current_user();
 
         try {
-            if (Event::handle('StartLeaveGroup', array($this->group, $cur))) {
-                Group_member::leave($this->group->id, $cur->id);
-                Event::handle('EndLeaveGroup', array($this->group, $cur));
-            }
+            $cur->leaveGroup($this->group);
         } catch (Exception $e) {
             // TRANS: Server error displayed when leaving a group failed in the database.
             // TRANS: %1$s is the leaving user's nickname, $2$s is the group nickname for which the leave failed.

actions/login.php

@@ -301,4 +301,8 @@ class LoginAction extends Action
     function showNoticeForm()
     {
     }
+
+    function showProfileBlock()
+    {
+    }
 }

actions/newapplication.php

@@ -294,6 +294,7 @@ class NewApplicationAction extends OwnerDesignAction
             $app->uploadLogo();
         } catch (Exception $e) {
             $app->query('ROLLBACK');
+            // TRANS: Form validation error on New application page when providing an invalid image upload.
             $this->showForm(_('Invalid image.'));
 	    return;
 	}

actions/newgroup.php

@@ -131,6 +131,7 @@ class NewgroupAction extends Action
             $description = $this->trimmed('description');
             $location    = $this->trimmed('location');
             $aliasstring = $this->trimmed('aliases');
+            $join_policy = intval($this->arg('join_policy'));
 
             if ($this->nicknameExists($nickname)) {
                 // TRANS: Group create form validation error.
@@ -215,6 +216,7 @@ class NewgroupAction extends Action
                                                 'location' => $location,
                                                 'aliases'  => $aliases,
                                                 'userid'   => $cur->id,
+                                                'join_policy' => $join_policy,
                                                 'local'    => true));
 
             $this->group = $group;

actions/newnotice.php

@@ -344,7 +344,9 @@ class NewnoticeAction extends Action
             $inreplyto = null;
         }
 
-        $notice_form = new NoticeForm($this, '', $content, null, $inreplyto);
+        $notice_form = new NoticeForm($this, array('content' => $content, 
+                                                   'inreplyto' => $inreplyto));
+
         $notice_form->show();
     }
 

actions/noticesearch.php

@@ -138,11 +138,14 @@ class NoticesearchAction extends SearchAction
             $this->elementEnd('div');
             return;
         }
+        if (Event::handle('StartNoticeSearchShowResults', array($this, $q, $notice))) {
             $terms = preg_split('/[\s,]+/', $q);
             $nl = new SearchNoticeList($notice, $this, $terms);
             $cnt = $nl->show();
             $this->pagination($page > 1, $cnt > NOTICES_PER_PAGE,
                               $page, 'noticesearch', array('q' => $q));
+            Event::handle('EndNoticeSearchShowResults', array($this, $q, $notice));
+        }
     }
 
     function showScripts()

actions/passwordsettings.php

@@ -156,14 +156,15 @@ class PasswordsettingsAction extends SettingsAction
         $newpassword = $this->arg('newpassword');
         $confirm     = $this->arg('confirm');
 
-        # Some validation
+        // Some validation
 
         if (strlen($newpassword) < 6) {
             // TRANS: Form validation error on page where to change password.
             $this->showForm(_('Password must be 6 or more characters.'));
             return;
         } else if (0 != strcmp($newpassword, $confirm)) {
-            $this->showForm(_('Passwords don\'t match.'));
+            // TRANS: Form validation error on password change when password confirmation does not match.
+            $this->showForm(_('Passwords do not match.'));
             return;
         }
 

actions/pathsadminpanel.php

@@ -485,8 +485,8 @@ class PathsAdminPanelForm extends AdminForm
                       // TRANS: Drop down option in Paths admin panel (option for "When to use SSL").
                      'always' => _('Always'));
 
-        // TRANS: Drop down label in Paths admin panel.
         $this->out->dropdown('site-ssl',
+                             // TRANS: Drop down label in Paths admin panel.
                              _('Use SSL'),
                              // TRANS: Tooltip for field label in Paths admin panel.
                              $ssl, _('When to use SSL.'),

actions/publictagcloud.php

@@ -100,7 +100,7 @@ class PublictagcloudAction extends Action
 
     function showContent()
     {
-        # This should probably be cached rather than recalculated
+        // This should probably be cached rather than recalculated
         $tags = new Notice_tag();
 
         #Need to clear the selection and then only re-add the field

actions/recoverpassword.php

@@ -19,7 +19,7 @@
 
 if (!defined('STATUSNET') && !defined('LACONICA')) { exit(1); }
 
-# You have 24 hours to claim your password
+// You have 24 hours to claim your password
 
 define('MAX_RECOVERY_TIME', 24 * 60 * 60);
 
@@ -81,7 +81,7 @@ class RecoverpasswordAction extends Action
         $touched = strtotime($confirm->modified);
         $email = $confirm->address;
 
-        # Burn this code
+        // Burn this code
 
         $result = $confirm->delete();
 
@@ -92,8 +92,8 @@ class RecoverpasswordAction extends Action
             return;
         }
 
-        # These should be reaped, but for now we just check mod time
-        # Note: it's still deleted; let's avoid a second attempt!
+        // These should be reaped, but for now we just check mod time
+        // Note: it's still deleted; let's avoid a second attempt!
 
         if ((time() - $touched) > MAX_RECOVERY_TIME) {
             common_log(LOG_WARNING,
@@ -105,8 +105,8 @@ class RecoverpasswordAction extends Action
             return;
         }
 
-        # If we used an outstanding confirmation to send the email,
-        # it's been confirmed at this point.
+        // If we used an outstanding confirmation to send the email,
+        // it's been confirmed at this point.
 
         if (!$user->email) {
             $orig = clone($user);
@@ -120,7 +120,7 @@ class RecoverpasswordAction extends Action
             }
         }
 
-        # Success!
+        // Success!
 
         $this->setTempUser($user);
         $this->showPasswordForm();
@@ -162,8 +162,8 @@ class RecoverpasswordAction extends Action
                                  ' the email address you have stored' .
                                  ' in your account.'));
             } else if ($this->mode == 'reset') {
-                // TRANS: Page notice for password change page.
                 $this->element('p', null,
+                               // TRANS: Page notice for password change page.
                                _('You have been identified. Enter a' .
                                  ' new password below.'));
             }
@@ -289,7 +289,7 @@ class RecoverpasswordAction extends Action
             }
         }
 
-        # See if it's an unconfirmed email address
+        // See if it's an unconfirmed email address
 
         if (!$user) {
             // Warning: it may actually be legit to have multiple folks
@@ -314,7 +314,7 @@ class RecoverpasswordAction extends Action
             return;
         }
 
-        # Try to get an unconfirmed email address if they used a user name
+        // Try to get an unconfirmed email address if they used a user name
 
         if (!$user->email && !$confirm_email) {
             $confirm_email = new Confirm_address();
@@ -332,7 +332,7 @@ class RecoverpasswordAction extends Action
             return;
         }
 
-        # Success! We have a valid user and a confirmed or unconfirmed email address
+        // Success! We have a valid user and a confirmed or unconfirmed email address
 
         $confirm = new Confirm_address();
         $confirm->code = common_confirmation_code(128);
@@ -380,7 +380,7 @@ class RecoverpasswordAction extends Action
 
     function resetPassword()
     {
-        # CSRF protection
+        // CSRF protection
         $token = $this->trimmed('token');
         if (!$token || $token != common_session_token()) {
             // TRANS: Form validation error message.
@@ -410,7 +410,7 @@ class RecoverpasswordAction extends Action
             return;
         }
 
-        # OK, we're ready to go
+        // OK, we're ready to go
 
         $original = clone($user);
 

actions/redirecturl.php

@@ -59,7 +59,6 @@ class RedirecturlAction extends Action
      *
      * @return boolean true
      */
-
     function prepare($argarray)
     {
         parent::prepare($argarray);
@@ -67,13 +66,16 @@ class RedirecturlAction extends Action
         $this->id = $this->trimmed('id');
 
         if (empty($this->id)) {
-            throw new ClientException(_('No id parameter'));
+            // TRANS: Client exception thrown when no ID parameter was provided.
+            throw new ClientException(_('No id parameter.'));
         }
 
         $this->file = File::staticGet('id', $this->id);
 
         if (empty($this->file)) {
-            throw new ClientException(sprintf(_('No such file "%d"'),
+            // TRANS: Client exception thrown when an invalid ID parameter was provided for a file.
+            // TRANS: %d is the provided ID for which the file is not present (number).
+            throw new ClientException(sprintf(_('No such file "%d".'),
                                               $this->id),
                                       404);
         }
@@ -88,7 +90,6 @@ class RedirecturlAction extends Action
      *
      * @return void
      */
-
     function handle($argarray=null)
     {
         common_redirect($this->file->url, 307);
@@ -104,7 +105,6 @@ class RedirecturlAction extends Action
      *
      * @return boolean is read only action?
      */
-
     function isReadOnly($args)
     {
         return true;
@@ -117,7 +117,6 @@ class RedirecturlAction extends Action
      *
      * @return string last modified http header
      */
-
     function lastModified()
     {
         // For comparison with If-Last-Modified
@@ -133,7 +132,6 @@ class RedirecturlAction extends Action
      *
      * @return string etag http header
      */
-
     function etag()
     {
         return 'W/"' . implode(':', array($this->arg('action'),

actions/register.php

@@ -77,6 +77,7 @@ class RegisterAction extends Action
         }
 
         if (common_config('site', 'inviteonly') && empty($this->code)) {
+            // TRANS: Client error displayed when trying to register to an invite-only site without an invitation.
             $this->clientError(_('Sorry, only invited people can register.'));
             return false;
         }
@@ -84,6 +85,7 @@ class RegisterAction extends Action
         if (!empty($this->code)) {
             $this->invite = Invitation::staticGet('code', $this->code);
             if (empty($this->invite)) {
+            // TRANS: Client error displayed when trying to register to an invite-only site without a valid invitation.
                 $this->clientError(_('Sorry, invalid invitation code.'));
                 return false;
             }
@@ -103,9 +105,11 @@ class RegisterAction extends Action
     function title()
     {
         if ($this->registered) {
+            // TRANS: Title for registration page after a succesful registration.
             return _('Registration successful');
         } else {
-            return _('Register');
+            // TRANS: Title for registration page.
+            return _m('TITLE','Register');
         }
     }
 
@@ -125,8 +129,10 @@ class RegisterAction extends Action
         parent::handle($args);
 
         if (common_config('site', 'closed')) {
+            // TRANS: Client error displayed when trying to register to a closed site.
             $this->clientError(_('Registration not allowed.'));
         } else if (common_logged_in()) {
+            // TRANS: Client error displayed when trying to register while already logged in.
             $this->clientError(_('Already logged in.'));
         } else if ($_SERVER['REQUEST_METHOD'] == 'POST') {
             $this->tryRegister();
@@ -178,6 +184,7 @@ class RegisterAction extends Action
             }
 
             if (common_config('site', 'inviteonly') && !($code && $invite)) {
+                // TRANS: Client error displayed when trying to register to an invite-only site without an invitation.
                 $this->clientError(_('Sorry, only invited people can register.'));
                 return;
             }
@@ -191,13 +198,17 @@ class RegisterAction extends Action
             $email    = common_canonical_email($email);
 
             if (!$this->boolean('license')) {
-                $this->showForm(_('You cannot register if you don\'t '.
+                // TRANS: Form validation error displayed when trying to register without agreeing to the site license.
+                $this->showForm(_('You cannot register if you do not '.
                                   'agree to the license.'));
             } else if ($email && !Validate::email($email, common_config('email', 'check_domain'))) {
+                // TRANS: Form validation error displayed when trying to register without a valid e-mail address.
                 $this->showForm(_('Not a valid email address.'));
             } else if ($this->nicknameExists($nickname)) {
+                // TRANS: Form validation error displayed when trying to register with an existing nickname.
                 $this->showForm(_('Nickname already in use. Try another one.'));
             } else if (!User::allowed_nickname($nickname)) {
+                // TRANS: Form validation error displayed when trying to register with an invalid nickname.
                 $this->showForm(_('Not a valid nickname.'));
             } else if ($this->emailExists($email)) {
                 $this->showForm(_('Email address already exists.'));
@@ -205,25 +216,32 @@ class RegisterAction extends Action
                        !Validate::uri($homepage,
                                       array('allowed_schemes' =>
                                             array('http', 'https')))) {
+                // TRANS: Form validation error displayed when trying to register with an invalid homepage URL.
                 $this->showForm(_('Homepage is not a valid URL.'));
                 return;
             } else if (!is_null($fullname) && mb_strlen($fullname) > 255) {
+                // TRANS: Form validation error displayed when trying to register with a too long full name.
                 $this->showForm(_('Full name is too long (maximum 255 characters).'));
                 return;
             } else if (Profile::bioTooLong($bio)) {
+                // TRANS: Form validation error on registration page when providing too long a bio text.
+                // TRANS: %d is the maximum number of characters for bio; used for plural.
                 $this->showForm(sprintf(_m('Bio is too long (maximum %d character).',
                                            'Bio is too long (maximum %d characters).',
                                            Profile::maxBio()),
                                         Profile::maxBio()));
                 return;
             } else if (!is_null($location) && mb_strlen($location) > 255) {
+                // TRANS: Form validation error displayed when trying to register with a too long location.
                 $this->showForm(_('Location is too long (maximum 255 characters).'));
                 return;
             } else if (strlen($password) < 6) {
+                // TRANS: Form validation error displayed when trying to register with too short a password.
                 $this->showForm(_('Password must be 6 or more characters.'));
                 return;
             } else if ($password != $confirm) {
-                $this->showForm(_('Passwords don\'t match.'));
+                // TRANS: Form validation error displayed when trying to register with non-matching passwords.
+                $this->showForm(_('Passwords do not match.'));
             } else if ($user = User::register(array('nickname' => $nickname,
                                                     'password' => $password,
                                                     'email' => $email,
@@ -233,11 +251,13 @@ class RegisterAction extends Action
                                                     'location' => $location,
                                                     'code' => $code))) {
                 if (!$user) {
+                    // TRANS: Form validation error displayed when trying to register with an invalid username or password.
                     $this->showForm(_('Invalid username or password.'));
                     return;
                 }
                 // success!
                 if (!common_set_user($user)) {
+                    // TRANS: Server error displayed when saving fails during user registration.
                     $this->serverError(_('Error setting user.'));
                     return;
                 }
@@ -255,6 +275,7 @@ class RegisterAction extends Action
 
                 $this->showSuccess();
             } else {
+                // TRANS: Form validation error displayed when trying to register with an invalid username or password.
                 $this->showForm(_('Invalid username or password.'));
             }
         }
@@ -330,6 +351,7 @@ class RegisterAction extends Action
             $this->element('p', 'error', $this->error);
         } else {
             $instr =
+              // TRANS: Page notice on registration page.
               common_markup_to_html(_('With this form you can create '.
                                       'a new account. ' .
                                       'You can then post notices and '.
@@ -389,6 +411,7 @@ class RegisterAction extends Action
         }
 
         if (common_config('site', 'inviteonly') && !($code && $invite)) {
+            // TRANS: Client error displayed when trying to register to an invite-only site without an invitation.
             $this->clientError(_('Sorry, only invited people can register.'));
             return;
         }
@@ -398,6 +421,7 @@ class RegisterAction extends Action
                                           'class' => 'form_settings',
                                           'action' => common_local_url('register')));
         $this->elementStart('fieldset');
+        // TRANS: Fieldset legend on accout registration page.
         $this->element('legend', null, 'Account settings');
         $this->hidden('token', common_session_token());
 
@@ -408,66 +432,86 @@ class RegisterAction extends Action
         $this->elementStart('ul', 'form_data');
         if (Event::handle('StartRegistrationFormData', array($this))) {
             $this->elementStart('li');
+            // TRANS: Field label on account registration page.
             $this->input('nickname', _('Nickname'), $this->trimmed('nickname'),
+                         // TRANS: Field title on account registration page.
                          _('1-64 lowercase letters or numbers, no punctuation or spaces.'));
             $this->elementEnd('li');
             $this->elementStart('li');
+            // TRANS: Field label on account registration page.
             $this->password('password', _('Password'),
+                            // TRANS: Field title on account registration page.
                             _('6 or more characters.'));
             $this->elementEnd('li');
             $this->elementStart('li');
-            $this->password('confirm', _('Confirm'),
+            // TRANS: Field label on account registration page. In this field the password has to be entered a second time.
+            $this->password('confirm', _m('PASSWORD','Confirm'),
+                         // TRANS: Field title on account registration page.
                          _('Same as password above.'));
             $this->elementEnd('li');
             $this->elementStart('li');
             if ($this->invite && $this->invite->address_type == 'email') {
-                $this->input('email', _('Email'), $this->invite->address,
+                // TRANS: Field label on account registration page.
+                $this->input('email', _m('LABEL','Email'), $this->invite->address,
+                             // TRANS: Field title on account registration page.
                              _('Used only for updates, announcements, '.
                                'and password recovery.'));
             } else {
-                $this->input('email', _('Email'), $this->trimmed('email'),
+                // TRANS: Field label on account registration page.
+                $this->input('email', _m('LABEL','Email'), $this->trimmed('email'),
+                             // TRANS: Field title on account registration page.
                              _('Used only for updates, announcements, '.
                                'and password recovery.'));
             }
             $this->elementEnd('li');
             $this->elementStart('li');
+            // TRANS: Field label on account registration page.
             $this->input('fullname', _('Full name'),
                          $this->trimmed('fullname'),
+                     // TRANS: Field title on account registration page.
                      _('Longer name, preferably your "real" name.'));
             $this->elementEnd('li');
             $this->elementStart('li');
+            // TRANS: Field label on account registration page.
             $this->input('homepage', _('Homepage'),
                          $this->trimmed('homepage'),
+                         // TRANS: Field title on account registration page.
                          _('URL of your homepage, blog, '.
                            'or profile on another site.'));
             $this->elementEnd('li');
             $this->elementStart('li');
             $maxBio = Profile::maxBio();
             if ($maxBio > 0) {
-                // TRANS: Tooltip for field label in form for profile settings. Plural
+                // TRANS: Text area title in form for account registration. Plural
                 // TRANS: is decided by the number of characters available for the
                 // TRANS: biography (%d).
-                $bioInstr = sprintf(_m('Describe yourself and your interests in %d character',
-                                       'Describe yourself and your interests in %d characters',
+                $bioInstr = sprintf(_m('Describe yourself and your interests in %d character.',
+                                       'Describe yourself and your interests in %d characters.',
                                        $maxBio),
                                     $maxBio);
             } else {
-                $bioInstr = _('Describe yourself and your interests');
+                // TRANS: Text area title on account registration page.
+                $bioInstr = _('Describe yourself and your interests.');
             }
+            // TRANS: Text area label on account registration page.
             $this->textarea('bio', _('Bio'),
                             $this->trimmed('bio'),
                             $bioInstr);
             $this->elementEnd('li');
             $this->elementStart('li');
+            // TRANS: Field label on account registration page.
             $this->input('location', _('Location'),
                          $this->trimmed('location'),
+                         // TRANS: Field title on account registration page.
                          _('Where you are, like "City, '.
                            'State (or Region), Country".'));
             $this->elementEnd('li');
             Event::handle('EndRegistrationFormData', array($this));
             $this->elementStart('li', array('id' => 'settings_rememberme'));
+            // TRANS: Checkbox label on account registration page.
             $this->checkbox('rememberme', _('Remember me'),
                             $this->boolean('rememberme'),
+                            // TRANS: Checkbox title on account registration page.
                             _('Automatically login in the future; '.
                               'not for shared computers!'));
             $this->elementEnd('li');
@@ -487,7 +531,8 @@ class RegisterAction extends Action
             $this->elementEnd('li');
         }
         $this->elementEnd('ul');
-        $this->submit('submit', _('Register'));
+        // TRANS: Field label on account registration page.
+        $this->submit('submit', _m('BUTTON','Register'));
         $this->elementEnd('fieldset');
         $this->elementEnd('form');
     }
@@ -497,9 +542,9 @@ class RegisterAction extends Action
         $out = '';
         switch (common_config('license', 'type')) {
         case 'private':
+            $out .= htmlspecialchars(sprintf(
                 // TRANS: Copyright checkbox label in registration dialog, for private sites.
                 // TRANS: %1$s is the StatusNet sitename.
-            $out .= htmlspecialchars(sprintf(
                 _('I understand that content and data of %1$s are private and confidential.'),
                 common_config('site', 'name')));
             // fall through
@@ -508,8 +553,9 @@ class RegisterAction extends Action
                 $out .= ' ';
             }
             if (common_config('license', 'owner')) {
-                // TRANS: Copyright checkbox label in registration dialog, for all rights reserved with a specified copyright owner.
                 $out .= htmlspecialchars(sprintf(
+                    // TRANS: Copyright checkbox label in registration dialog, for all rights reserved with a specified copyright owner.
+                    // TRANS: %1$s is the license owner.
                     _('My text and files are copyright by %1$s.'),
                     common_config('license', 'owner')));
             } else {
@@ -563,6 +609,10 @@ class RegisterAction extends Action
                                        array('nickname' => $nickname));
 
         $this->elementStart('div', 'success');
+        // TRANS: Text displayed after successful account registration.
+        // TRANS: %1$s is the registered nickname, %2$s is the profile URL.
+        // TRANS: This message contains Markdown links in the form [link text](link)
+        // TRANS: and variables in the form %%%%variable%%%%. Please mind the syntax.
         $instr = sprintf(_('Congratulations, %1$s! And welcome to %%%%site.name%%%%. '.
                            'From here, you may want to...'. "\n\n" .
                            '* Go to [your profile](%2$s) '.
@@ -587,6 +637,7 @@ class RegisterAction extends Action
 
         $have_email = $this->trimmed('email');
         if ($have_email) {
+            // TRANS: Instruction text on how to deal with the e-mail address confirmation e-mail.
             $emailinstr = _('(You should receive a message by email '.
                             'momentarily, with ' .
                             'instructions on how to confirm '.
@@ -610,4 +661,8 @@ class RegisterAction extends Action
     function showNoticeForm()
     {
     }
+
+    function showProfileBlock()
+    {
+    }
 }

actions/remotesubscribe.php

@@ -55,6 +55,7 @@ class RemotesubscribeAction extends Action
         parent::prepare($args);
 
         if (common_logged_in()) {
+            // TRANS: Client error displayed when using remote subscribe for a local entity.
             $this->clientError(_('You can use the local subscription!'));
             return false;
         }
@@ -94,6 +95,8 @@ class RemotesubscribeAction extends Action
         if ($this->err) {
             $this->element('div', 'error', $this->err);
         } else {
+            // TRANS: Page notice for remote subscribe. This message contains Markdown links.
+            // TRANS: Ensure to keep the correct markup of [link description](link).
             $inst = _('To subscribe, you can [login](%%action.login%%),' .
                       ' or [register](%%action.register%%) a new ' .
                       ' account. If you already have an account ' .
@@ -108,6 +111,7 @@ class RemotesubscribeAction extends Action
 
     function title()
     {
+        // TRANS: Page title for Remote subscribe.
         return _('Remote subscribe');
     }
 
@@ -120,20 +124,26 @@ class RemotesubscribeAction extends Action
                                           'class' => 'form_settings',
                                           'action' => common_local_url('remotesubscribe')));
         $this->elementStart('fieldset');
+        // TRANS: Field legend on page for remote subscribe.
         $this->element('legend', _('Subscribe to a remote user'));
         $this->hidden('token', common_session_token());
 
         $this->elementStart('ul', 'form_data');
         $this->elementStart('li');
+        // TRANS: Field label on page for remote subscribe.
         $this->input('nickname', _('User nickname'), $this->nickname,
+                     // TRANS: Field title on page for remote subscribe.
                      _('Nickname of the user you want to follow.'));
         $this->elementEnd('li');
         $this->elementStart('li');
+        // TRANS: Field label on page for remote subscribe.
         $this->input('profile_url', _('Profile URL'), $this->profile_url,
+                     // TRANS: Field title on page for remote subscribe.
                      _('URL of your profile on another compatible microblogging service.'));
         $this->elementEnd('li');
         $this->elementEnd('ul');
-        $this->submit('submit', _('Subscribe'));
+        // TRANS: Button text on page for remote subscribe.
+        $this->submit('submit', _m('BUTTON','Subscribe'));
         $this->elementEnd('fieldset');
         $this->elementEnd('form');
     }
@@ -141,6 +151,7 @@ class RemotesubscribeAction extends Action
     function remoteSubscription()
     {
         if (!$this->nickname) {
+            // TRANS: Form validation error on page for remote subscribe when no user was provided.
             $this->showForm(_('No such user.'));
             return;
         }
@@ -150,11 +161,13 @@ class RemotesubscribeAction extends Action
         $this->profile_url = $this->trimmed('profile_url');
 
         if (!$this->profile_url) {
+            // TRANS: Form validation error on page for remote subscribe when no user profile was found.
             $this->showForm(_('No such user.'));
             return;
         }
 
         if (!common_valid_http_url($this->profile_url)) {
+            // TRANS: Form validation error on page for remote subscribe when an invalid profile URL was provided.
             $this->showForm(_('Invalid profile URL (bad format).'));
             return;
         }
@@ -164,6 +177,8 @@ class RemotesubscribeAction extends Action
                                                 common_root_url(),
                                                 omb_oauth_datastore());
         } catch (OMB_InvalidYadisException $e) {
+            // TRANS: Form validation error on page for remote subscribe when no the provided profile URL
+            // TRANS: does not contain expected data.
             $this->showForm(_('Not a valid profile URL (no YADIS document or ' .
                               'invalid XRDS defined).'));
             return;
@@ -172,6 +187,7 @@ class RemotesubscribeAction extends Action
         if ($service->getServiceURI(OAUTH_ENDPOINT_REQUEST) ==
             common_local_url('requesttoken') ||
             User::staticGet('uri', $service->getRemoteUserURI())) {
+            // TRANS: Form validation error on page for remote subscribe.
             $this->showForm(_('That is a local profile! Login to subscribe.'));
             return;
         }
@@ -179,6 +195,7 @@ class RemotesubscribeAction extends Action
         try {
             $service->requestToken();
         } catch (OMB_RemoteServiceException $e) {
+            // TRANS: Form validation error on page for remote subscribe when the remote service is not providing a request token.
             $this->showForm(_('Could not get a request token.'));
             return;
         }
@@ -187,6 +204,7 @@ class RemotesubscribeAction extends Action
         $profile = $user->getProfile();
         if (!$profile) {
             common_log_db_error($user, 'SELECT', __FILE__);
+            // TRANS: Server error displayed on page for remote subscribe when user does not have a matching profile.
             $this->serverError(_('User without matching profile.'));
             return;
         }

actions/repeat.php

@@ -1,5 +1,4 @@
 <?php
-
 /**
  * Repeat action.
  *
@@ -53,6 +52,7 @@ class RepeatAction extends Action
         $this->user = common_current_user();
 
         if (empty($this->user)) {
+            // TRANS: Client error displayed when trying to repeat a notice while not logged in.
             $this->clientError(_('Only logged-in users can repeat notices.'));
             return false;
         }
@@ -60,6 +60,7 @@ class RepeatAction extends Action
         $id = $this->trimmed('notice');
 
         if (empty($id)) {
+            // TRANS: Client error displayed when trying to repeat a notice while not providing a notice ID.
             $this->clientError(_('No notice specified.'));
             return false;
         }
@@ -67,11 +68,13 @@ class RepeatAction extends Action
         $this->notice = Notice::staticGet('id', $id);
 
         if (empty($this->notice)) {
+            // TRANS: Client error displayed when trying to repeat a non-existing notice.
             $this->clientError(_('No notice specified.'));
             return false;
         }
 
         if ($this->user->id == $this->notice->profile_id) {
+            // TRANS: Client error displayed when trying to repeat an own notice.
             $this->clientError(_('You cannot repeat your own notice.'));
             return false;
         }
@@ -86,6 +89,7 @@ class RepeatAction extends Action
         $profile = $this->user->getProfile();
 
         if ($profile->hasRepeated($id)) {
+            // TRANS: Client error displayed when trying to repeat an already repeated notice.
             $this->clientError(_('You already repeated that notice.'));
             return false;
         }
@@ -104,21 +108,21 @@ class RepeatAction extends Action
     {
         $repeat = $this->notice->repeat($this->user->id, 'web');
 
-
-
         if ($this->boolean('ajax')) {
             $this->startHTML('text/xml;charset=utf-8');
             $this->elementStart('head');
+            // TRANS: Title after repeating a notice.
             $this->element('title', null, _('Repeated'));
             $this->elementEnd('head');
             $this->elementStart('body');
             $this->element('p', array('id' => 'repeat_response',
                                       'class' => 'repeated'),
+                                // TRANS: Confirmation text after repeating a notice.
                                 _('Repeated!'));
             $this->elementEnd('body');
             $this->elementEnd('html');
         } else {
-            // FIXME!
+            // @todo FIXME!
         }
     }
 }

actions/replies.php

@@ -44,7 +44,6 @@ require_once INSTALLDIR.'/lib/feedlist.php';
  * @license  http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
  * @link     http://status.net/
  */
-
 class RepliesAction extends OwnerDesignAction
 {
     var $page = null;
@@ -60,7 +59,6 @@ class RepliesAction extends OwnerDesignAction
      *
      * @return boolean success flag
      */
-
     function prepare($args)
     {
         parent::prepare($args);
@@ -70,6 +68,7 @@ class RepliesAction extends OwnerDesignAction
         $this->user = User::staticGet('nickname', $nickname);
 
         if (!$this->user) {
+            // TRANS: Client error displayed when trying to reply to a non-exsting user.
             $this->clientError(_('No such user.'));
             return false;
         }
@@ -77,6 +76,7 @@ class RepliesAction extends OwnerDesignAction
         $profile = $this->user->getProfile();
 
         if (!$profile) {
+            // TRANS: Server error displayed when trying to reply to a user without a profile.
             $this->serverError(_('User has no profile.'));
             return false;
         }
@@ -105,7 +105,6 @@ class RepliesAction extends OwnerDesignAction
      *
      * @return void
      */
-
     function handle($args)
     {
         parent::handle($args);
@@ -119,12 +118,15 @@ class RepliesAction extends OwnerDesignAction
      *
      * @return string title of page
      */
-
     function title()
     {
         if ($this->page == 1) {
+            // TRANS: Title for first page of replies for a user.
+            // TRANS: %s is a user nickname.
             return sprintf(_("Replies to %s"), $this->user->nickname);
         } else {
+            // TRANS: Title for all but the first page of replies for a user.
+            // TRANS: %1$s is a user nickname, %2$d is a page number.
             return sprintf(_('Replies to %1$s, page %2$d'),
                            $this->user->nickname,
                            $this->page);
@@ -136,12 +138,13 @@ class RepliesAction extends OwnerDesignAction
      *
      * @return void
      */
-
     function getFeeds()
     {
         return array(new Feed(Feed::RSS1,
                               common_local_url('repliesrss',
                                                array('nickname' => $this->user->nickname)),
+                              // TRANS: Link for feed with replies for a user.
+                              // TRANS: %s is a user nickname.
                               sprintf(_('Replies feed for %s (RSS 1.0)'),
                                       $this->user->nickname)),
                      new Feed(Feed::RSS2,
@@ -149,6 +152,8 @@ class RepliesAction extends OwnerDesignAction
                                                array(
                                                     'id' => $this->user->nickname,
                                                     'format' => 'rss')),
+                              // TRANS: Link for feed with replies for a user.
+                              // TRANS: %s is a user nickname.
                               sprintf(_('Replies feed for %s (RSS 2.0)'),
                                       $this->user->nickname)),
                      new Feed(Feed::ATOM,
@@ -156,6 +161,8 @@ class RepliesAction extends OwnerDesignAction
                                                array(
                                                     'id' => $this->user->nickname,
                                                     'format' => 'atom')),
+                              // TRANS: Link for feed with replies for a user.
+                              // TRANS: %s is a user nickname.
                               sprintf(_('Replies feed for %s (Atom)'),
                                     $this->user->nickname)));
     }
@@ -167,7 +174,6 @@ class RepliesAction extends OwnerDesignAction
      *
      * @return void
      */
-
     function showContent()
     {
         $nl = new NoticeList($this->notice, $this);
@@ -184,17 +190,27 @@ class RepliesAction extends OwnerDesignAction
 
     function showEmptyListMessage()
     {
-        $message = sprintf(_('This is the timeline showing replies to %1$s but %2$s hasn\'t received a notice to them yet.'), $this->user->nickname, $this->user->nickname) . ' ';
+        // TRANS: Empty list message for page with replies for a user.
+        // TRANS: %1$s and %s$s are the user nickname.
+        $message = sprintf(_('This is the timeline showing replies to %1$s but %2$s hasn\'t received a notice to them yet.'),
+                           $this->user->nickname,
+                           $this->user->nickname) . ' ';
 
         if (common_logged_in()) {
             $current_user = common_current_user();
             if ($this->user->id === $current_user->id) {
+                // TRANS: Empty list message for page with replies for a user for the logged in user.
+                // TRANS: This message contains a Markdown link in the form [link text](link).
                 $message .= _('You can engage other users in a conversation, subscribe to more people or [join groups](%%action.groups%%).');
             } else {
+                // TRANS: Empty list message for page with replies for a user for all logged in users but the user themselves.
+                // TRANS: %1$s, %2$s and %3$s are a user nickname. This message contains a Markdown link in the form [link text](link).
                 $message .= sprintf(_('You can try to [nudge %1$s](../%2$s) or [post something to them](%%%%action.newnotice%%%%?status_textarea=%3$s).'), $this->user->nickname, $this->user->nickname, '@' . $this->user->nickname);
             }
         }
         else {
+            // TRANS: Empty list message for page with replies for a user for not logged in users.
+            // TRANS: %1$s is a user nickname. This message contains a Markdown link in the form [link text](link).
             $message .= sprintf(_('Why not [register an account](%%%%action.register%%%%) and then nudge %s or post a notice to them.'), $this->user->nickname);
         }
 

actions/revokerole.php

@@ -40,7 +40,6 @@ if (!defined('STATUSNET')) {
  * @license  http://www.fsf.org/licensing/licenses/agpl.html AGPLv3
  * @link     http://status.net/
  */
-
 class RevokeRoleAction extends ProfileFormAction
 {
     /**
@@ -50,7 +49,6 @@ class RevokeRoleAction extends ProfileFormAction
      *
      * @return boolean success flag
      */
-
     function prepare($args)
     {
         if (!parent::prepare($args)) {
@@ -59,10 +57,12 @@ class RevokeRoleAction extends ProfileFormAction
 
         $this->role = $this->arg('role');
         if (!Profile_role::isValid($this->role)) {
+            // TRANS: Client error displayed when trying to revoke an invalid role.
             $this->clientError(_('Invalid role.'));
             return false;
         }
         if (!Profile_role::isSettable($this->role)) {
+            // TRANS: Client error displayed when trying to revoke a reserved role.
             $this->clientError(_('This role is reserved and cannot be set.'));
             return false;
         }
@@ -72,6 +72,7 @@ class RevokeRoleAction extends ProfileFormAction
         assert(!empty($cur)); // checked by parent
 
         if (!$cur->hasRight(Right::REVOKEROLE)) {
+            // TRANS: Client error displayed when trying to revoke a role without having the right to do that.
             $this->clientError(_('You cannot revoke user roles on this site.'));
             return false;
         }
@@ -79,7 +80,8 @@ class RevokeRoleAction extends ProfileFormAction
         assert(!empty($this->profile)); // checked by parent
 
         if (!$this->profile->hasRole($this->role)) {
-            $this->clientError(_("User doesn't have this role."));
+            // TRANS: Client error displayed when trying to revoke a role that is not set.
+            $this->clientError(_('User does not have this role.'));
             return false;
         }
 
@@ -91,7 +93,6 @@ class RevokeRoleAction extends ProfileFormAction
      *
      * @return void
      */
-
     function handlePost()
     {
         $this->profile->revokeRole($this->role);

actions/rsd.php

@@ -110,6 +110,7 @@ class RsdAction extends Action
             $this->user = User::staticGet('nickname', $nickname);
 
             if (empty($this->user)) {
+                // TRANS: Client error.
                 $this->clientError(_('No such user.'), 404);
                 return false;
             }
@@ -139,6 +140,7 @@ class RsdAction extends Action
         $this->elementStart('rsd', array('version' => '1.0',
                                          'xmlns' => $rsdNS));
         $this->elementStart('service');
+        // TRANS: Engine name for RSD.
         $this->element('engineName', null, _('StatusNet'));
         $this->element('engineLink', null, 'http://status.net/');
         $this->elementStart('apis');

actions/sandbox.php

@@ -40,7 +40,6 @@ if (!defined('STATUSNET')) {
  * @license  http://www.fsf.org/licensing/licenses/agpl.html AGPLv3
  * @link     http://status.net/
  */
-
 class SandboxAction extends ProfileFormAction
 {
     /**
@@ -50,7 +49,6 @@ class SandboxAction extends ProfileFormAction
      *
      * @return boolean success flag
      */
-
     function prepare($args)
     {
         if (!parent::prepare($args)) {
@@ -62,6 +60,7 @@ class SandboxAction extends ProfileFormAction
         assert(!empty($cur)); // checked by parent
 
         if (!$cur->hasRight(Right::SANDBOXUSER)) {
+            // TRANS: Client error displayed trying to sandbox users on a site where the feature is not enabled.
             $this->clientError(_('You cannot sandbox users on this site.'));
             return false;
         }
@@ -69,6 +68,7 @@ class SandboxAction extends ProfileFormAction
         assert(!empty($this->profile)); // checked by parent
 
         if ($this->profile->isSandboxed()) {
+            // TRANS: Client error displayed trying to sandbox an already sandboxed user.
             $this->clientError(_('User is already sandboxed.'));
             return false;
         }
@@ -81,7 +81,6 @@ class SandboxAction extends ProfileFormAction
      *
      * @return void
      */
-
     function handlePost()
     {
         $this->profile->sandbox();

actions/sessionsadminpanel.php

@@ -40,7 +40,6 @@ if (!defined('STATUSNET')) {
  * @license  http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
  * @link     http://status.net/
  */
-
 class SessionsadminpanelAction extends AdminPanelAction
 {
     /**
@@ -48,10 +47,10 @@ class SessionsadminpanelAction extends AdminPanelAction
      *
      * @return string page title
      */
-
     function title()
     {
-        return _('Sessions');
+        // TRANS: Title for the sessions administration panel.
+        return _m('TITLE','Sessions');
     }
 
     /**
@@ -59,9 +58,9 @@ class SessionsadminpanelAction extends AdminPanelAction
      *
      * @return string instructions
      */
-
     function getInstructions()
     {
+        // TRANS: Instructions for the sessions administration panel.
         return _('Session settings for this StatusNet site');
     }
 
@@ -70,7 +69,6 @@ class SessionsadminpanelAction extends AdminPanelAction
      *
      * @return void
      */
-
     function showForm()
     {
         $form = new SessionsAdminPanelForm($this);
@@ -83,7 +81,6 @@ class SessionsadminpanelAction extends AdminPanelAction
      *
      * @return void
      */
-
     function saveSettings()
     {
         static $booleans = array('sessions' => array('handle', 'debug'));
@@ -123,6 +120,7 @@ class SessionsadminpanelAction extends AdminPanelAction
     }
 }
 
+// @todo FIXME: Class documentation missing.
 class SessionsAdminPanelForm extends AdminForm
 {
     /**
@@ -130,7 +128,6 @@ class SessionsAdminPanelForm extends AdminForm
      *
      * @return int ID of the form
      */
-
     function id()
     {
         return 'sessionsadminpanel';
@@ -141,7 +138,6 @@ class SessionsAdminPanelForm extends AdminForm
      *
      * @return string class of the form
      */
-
     function formClass()
     {
         return 'form_settings';
@@ -152,7 +148,6 @@ class SessionsAdminPanelForm extends AdminForm
      *
      * @return string URL of the action
      */
-
     function action()
     {
         return common_local_url('sessionsadminpanel');
@@ -163,24 +158,31 @@ class SessionsAdminPanelForm extends AdminForm
      *
      * @return void
      */
-
     function formData()
     {
         $this->out->elementStart('fieldset', array('id' => 'settings_user_sessions'));
-        $this->out->element('legend', null, _('Sessions'));
+        // TRANS: Fieldset legend on the sessions administration panel.
+        $this->out->element('legend', null, _m('LEGEND','Sessions'));
 
         $this->out->elementStart('ul', 'form_data');
 
         $this->li();
+        // TRANS: Checkbox title on the sessions administration panel.
+        // TRANS: Indicates if StatusNet should handle session administration.
         $this->out->checkbox('handle', _('Handle sessions'),
                               (bool) $this->value('handle', 'sessions'),
-                              _('Whether to handle sessions ourselves.'));
+                              // TRANS: Checkbox title on the sessions administration panel.
+                              // TRANS: Indicates if StatusNet should handle session administration.
+                              _('Handle sessions ourselves.'));
         $this->unli();
 
         $this->li();
+        // TRANS: Checkbox label on the sessions administration panel.
+        // TRANS: Indicates if StatusNet should write session debugging output.
         $this->out->checkbox('debug', _('Session debugging'),
                               (bool) $this->value('debug', 'sessions'),
-                              _('Turn on debugging output for sessions.'));
+                              // TRANS: Checkbox title on the sessions administration panel.
+                              _('Enable debugging output for sessions.'));
         $this->unli();
 
         $this->out->elementEnd('ul');
@@ -193,9 +195,14 @@ class SessionsAdminPanelForm extends AdminForm
      *
      * @return void
      */
-
     function formActions()
     {
-        $this->out->submit('submit', _('Save'), 'submit', null, _('Save site settings'));
+        $this->out->submit('submit',
+                           // TRANS: Submit button text on the sessions administration panel.
+                           _m('BUTTON','Save'),
+                           'submit',
+                           null,
+                           // TRANS: Title for submit button on the sessions administration panel.
+                           _('Save session settings'));
     }
 }

actions/showapplication.php

@@ -75,11 +75,13 @@ class ShowApplicationAction extends OwnerDesignAction
         $this->owner        = User::staticGet($this->application->owner);
 
         if (!common_logged_in()) {
+            // TRANS: Client error displayed trying to display an OAuth application while not logged in.
             $this->clientError(_('You must be logged in to view an application.'));
             return false;
         }
 
         if (empty($this->application)) {
+            // TRANS: Client error displayed trying to display a non-existing OAuth application.
             $this->clientError(_('No such application.'), 404);
             return false;
         }
@@ -87,6 +89,7 @@ class ShowApplicationAction extends OwnerDesignAction
         $cur = common_current_user();
 
         if ($cur->id != $this->owner->id) {
+            // TRANS: Client error displayed trying to display an OAuth application for which the logged in user is not the owner.
             $this->clientError(_('You are not the owner of this application.'), 401);
             return false;
         }
@@ -148,6 +151,7 @@ class ShowApplicationAction extends OwnerDesignAction
         $consumer = $this->application->getConsumer();
 
         $this->elementStart('div', 'entity_profile vcard');
+        // TRANS: Header on the OAuth application page.
         $this->element('h2', null, _('Application profile'));
         if (!empty($this->application->icon)) {
             $this->element('img', array('src' => $this->application->icon,
@@ -176,7 +180,12 @@ class ShowApplicationAction extends OwnerDesignAction
         $userCnt = $appUsers->count();
 
         $this->raw(sprintf(
-            _('Created by %1$s - %2$s access by default - %3$d users'),
+            // TRANS: Information output on an OAuth application page.
+            // TRANS: %1$s is the application creator, %2$s is "read-only" or "read-write",
+            // TRANS: %3$d is the number of users using the OAuth application.
+            _m('Created by %1$s - %2$s access by default - %3$d user',
+               'Created by %1$s - %2$s access by default - %3$d users',
+               $userCnt),
               $profile->getBestName(),
               $defaultAccess,
               $userCnt
@@ -186,13 +195,15 @@ class ShowApplicationAction extends OwnerDesignAction
         $this->elementEnd('div');
 
         $this->elementStart('div', 'entity_actions');
+        // TRANS: Header on the OAuth application page.
         $this->element('h2', null, _('Application actions'));
         $this->elementStart('ul');
         $this->elementStart('li', 'entity_edit');
         $this->element('a',
                        array('href' => common_local_url('editapplication',
                                                         array('id' => $this->application->id))),
-                       'Edit');
+                       // TRANS: Link text to edit application on the OAuth application page.
+                       _m('EDITAPP','Edit'));
         $this->elementEnd('li');
 
         $this->elementStart('li', 'entity_reset_keysecret');
@@ -209,6 +220,8 @@ class ShowApplicationAction extends OwnerDesignAction
                                       'id' => 'reset',
                                       'name' => 'reset',
                                       'class' => 'submit',
+                                      // TRANS: Button text on the OAuth application page.
+                                      // TRANS: Resets the OAuth consumer key and secret.
                                       'value' => _('Reset key & secret'),
                                       'onClick' => 'return confirmReset()'));
         $this->elementEnd('fieldset');
@@ -225,7 +238,8 @@ class ShowApplicationAction extends OwnerDesignAction
 
         $this->elementStart('fieldset');
         $this->hidden('token', common_session_token());
-        $this->submit('delete', _('Delete'));
+        // TRANS: Submit button text the OAuth application page to delete an application.
+        $this->submit('delete', _m('BUTTON','Delete'));
         $this->elementEnd('fieldset');
         $this->elementEnd('form');
         $this->elementEnd('li');
@@ -234,6 +248,7 @@ class ShowApplicationAction extends OwnerDesignAction
         $this->elementEnd('div');
 
         $this->elementStart('div', 'entity_data');
+        // TRANS: Header on the OAuth application page.
         $this->element('h2', null, _('Application info'));
         $this->element('div',
                        'entity_consumer_key',
@@ -252,7 +267,8 @@ class ShowApplicationAction extends OwnerDesignAction
         $this->element('div', 'entity_authorize_url', common_local_url('ApiOauthAuthorize'));
 
         $this->element('p', 'note',
-            _('Note: We support HMAC-SHA1 signatures. We do not support the plaintext signature method.'));
+            // TRANS: Note on the OAuth application page about signature support.
+            _('Note: HMAC-SHA1 signatures are supported. The plaintext signature method is not supported.'));
         $this->elementEnd('div');
 
         $this->elementStart('p', array('id' => 'application_action'));
@@ -272,6 +288,7 @@ class ShowApplicationAction extends OwnerDesignAction
     {
         parent::showScripts();
 
+        // TRANS: Text in confirmation dialog to reset consumer key and secret for an OAuth application.
         $msg = _('Are you sure you want to reset your consumer key and secret?');
 
         $js  = 'function confirmReset() { ';

actions/showgroup.php

@@ -180,8 +180,6 @@ class ShowgroupAction extends GroupDesignAction
      */
     function showContent()
     {
-        $this->showGroupProfile();
-        $this->showGroupActions();
         $this->showGroupNotices();
     }
 
@@ -205,121 +203,6 @@ class ShowgroupAction extends GroupDesignAction
                           array('nickname' => $this->group->nickname));
     }
 
-    /**
-     * Show the group profile
-     *
-     * Information about the group
-     *
-     * @return void
-     */
-    function showGroupProfile()
-    {
-        $this->elementStart('div', array('id' => 'i',
-                                         'class' => 'entity_profile vcard author'));
-
-        $logo = ($this->group->homepage_logo) ?
-          $this->group->homepage_logo : User_group::defaultLogo(AVATAR_PROFILE_SIZE);
-
-        $this->element('img', array('src' => $logo,
-                                    'class' => 'photo avatar entity_depiction',
-                                    'width' => AVATAR_PROFILE_SIZE,
-                                    'height' => AVATAR_PROFILE_SIZE,
-                                    'alt' => $this->group->nickname));
-
-        $hasFN = ($this->group->fullname) ? 'entity_nickname nickname url uid' :
-            'entity_nickname fn org nickname url uid';
-        $this->element('a', array('href' => $this->group->homeUrl(),
-                                  'rel' => 'me', 'class' => $hasFN),
-                            $this->group->nickname);
-
-        if ($this->group->fullname) {
-            $this->element('div', 'entity_fn fn org', $this->group->fullname);
-        }
-
-        if ($this->group->location) {
-            $this->element('div', 'entity_location label', $this->group->location);
-        }
-
-        if ($this->group->homepage) {
-            $this->element('a', array('href' => $this->group->homepage,
-                                      'rel' => 'me',
-                                      'class' => 'url entity_url'),
-                           $this->group->homepage);
-        }
-
-        if ($this->group->description) {
-            $this->element('div', 'note entity_note', $this->group->description);
-        }
-
-        if (common_config('group', 'maxaliases') > 0) {
-            $aliases = $this->group->getAliases();
-
-            if (!empty($aliases)) {
-                $this->element('div',
-                               'aliases entity_aliases',
-                               implode(' ', $aliases));
-            }
-
-            if ($this->group->description) {
-                $this->elementStart('dl', 'entity_note');
-                // TRANS: Label for group description or group note (dt). Text hidden by default.
-                $this->element('dt', null, _('Note'));
-                $this->element('dd', 'note', $this->group->description);
-                $this->elementEnd('dl');
-            }
-
-            if (common_config('group', 'maxaliases') > 0) {
-                $aliases = $this->group->getAliases();
-
-                if (!empty($aliases)) {
-                    $this->elementStart('dl', 'entity_aliases');
-                    // TRANS: Label for group aliases (dt). Text hidden by default.
-                    $this->element('dt', null, _('Aliases'));
-                    $this->element('dd', 'aliases', implode(' ', $aliases));
-                    $this->elementEnd('dl');
-                }
-            }
-
-            Event::handle('EndGroupProfileElements', array($this, $this->group));
-        }
-
-        $this->elementEnd('div');
-    }
-
-    function showGroupActions()
-    {
-        $cur = common_current_user();
-        $this->elementStart('div', 'entity_actions');
-        // TRANS: Group actions header (h2). Text hidden by default.
-        $this->element('h2', null, _('Group actions'));
-        $this->elementStart('ul');
-        if (Event::handle('StartGroupActionsList', array($this, $this->group))) {
-            $this->elementStart('li', 'entity_subscribe');
-            if (Event::handle('StartGroupSubscribe', array($this, $this->group))) {
-                if ($cur) {
-                    if ($cur->isMember($this->group)) {
-                        $lf = new LeaveForm($this, $this->group);
-                        $lf->show();
-                    } else if (!Group_block::isBlocked($this->group, $cur->getProfile())) {
-                        $jf = new JoinForm($this, $this->group);
-                        $jf->show();
-                    }
-                }
-                Event::handle('EndGroupSubscribe', array($this, $this->group));
-            }
-            $this->elementEnd('li');
-            if ($cur && $cur->hasRight(Right::DELETEGROUP)) {
-                $this->elementStart('li', 'entity_delete');
-                $df = new DeleteGroupForm($this, $this->group);
-                $df->show();
-                $this->elementEnd('li');
-            }
-            Event::handle('EndGroupActionsList', array($this, $this->group));
-        }
-        $this->elementEnd('ul');
-        $this->elementEnd('div');
-    }
-
     /**
      * Get a list of the feeds for this page
      *
@@ -440,7 +323,9 @@ class ShowgroupAction extends GroupDesignAction
         // TRANS: Header for group statistics on a group page (h2).
         $this->element('h2', null, _('Statistics'));
 
-        $this->elementEnd('dl');
+        $this->elementStart('dl');
+
+        // TRANS: Label for group creation date.
         $this->element('dt', null, _m('LABEL','Created'));
         $this->element('dd', 'entity_created', date('j M Y',
                                                  strtotime($this->group->created)));
@@ -499,8 +384,8 @@ class GroupAdminSection extends ProfileSection
 
     function title()
     {
-        // TRANS: Header for list of group administrators on a group page (h2).
-        return _('Admins');
+        // TRANS: Title for list of group administrators on a group page.
+        return _m('TITLE','Admins');
     }
 
     function divId()

actions/shownotice.php

@@ -44,25 +44,21 @@ require_once INSTALLDIR.'/lib/feedlist.php';
  * @license  http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
  * @link     http://status.net/
  */
-
 class ShownoticeAction extends OwnerDesignAction
 {
     /**
      * Notice object to show
      */
-
     var $notice = null;
 
     /**
      * Profile of the notice object
      */
-
     var $profile = null;
 
     /**
      * Avatar of the profile of the notice object
      */
-
     var $avatar = null;
 
     /**
@@ -74,7 +70,6 @@ class ShownoticeAction extends OwnerDesignAction
      *
      * @return success flag
      */
-
     function prepare($args)
     {
         parent::prepare($args);
@@ -90,8 +85,10 @@ class ShownoticeAction extends OwnerDesignAction
             // Did we used to have it, and it got deleted?
             $deleted = Deleted_notice::staticGet($id);
             if (!empty($deleted)) {
+                // TRANS: Client error displayed trying to show a deleted notice.
                 $this->clientError(_('Notice deleted.'), 410);
             } else {
+                // TRANS: Client error displayed trying to show a non-existing notice.
                 $this->clientError(_('No such notice.'), 404);
             }
             return false;
@@ -100,6 +97,7 @@ class ShownoticeAction extends OwnerDesignAction
         $this->profile = $this->notice->getProfile();
 
         if (empty($this->profile)) {
+            // TRANS: Server error displayed trying to show a notice without a connected profile.
             $this->serverError(_('Notice has no profile.'), 500);
             return false;
         }
@@ -116,7 +114,6 @@ class ShownoticeAction extends OwnerDesignAction
      *
      * @return boolean true
      */
-
     function isReadOnly($args)
     {
         return true;
@@ -130,7 +127,6 @@ class ShownoticeAction extends OwnerDesignAction
      *
      * @return int last-modified date as unix timestamp
      */
-
     function lastModified()
     {
         return max(strtotime($this->notice->modified),
@@ -147,7 +143,6 @@ class ShownoticeAction extends OwnerDesignAction
      *
      * @return string etag
      */
-
     function etag()
     {
         $avtime = ($this->avatar) ?
@@ -167,11 +162,12 @@ class ShownoticeAction extends OwnerDesignAction
      *
      * @return string title of the page
      */
-
     function title()
     {
         $base = $this->profile->getFancyName();
 
+        // TRANS: Title of the page that shows a notice.
+        // TRANS: %1$s is a user name, %2$s is the notice creation date/time.
         return sprintf(_('%1$s\'s status on %2$s'),
                        $base,
                        common_exact_date($this->notice->created));
@@ -186,7 +182,6 @@ class ShownoticeAction extends OwnerDesignAction
      *
      * @return void
      */
-
     function handle($args)
     {
         parent::handle($args);
@@ -218,7 +213,6 @@ class ShownoticeAction extends OwnerDesignAction
      *
      * @return void
      */
-
     function showLocalNavBlock()
     {
     }
@@ -230,7 +224,6 @@ class ShownoticeAction extends OwnerDesignAction
      *
      * @return void
      */
-
     function showContent()
     {
         $this->elementStart('ol', array('class' => 'notices xoxo'));
@@ -245,7 +238,8 @@ class ShownoticeAction extends OwnerDesignAction
         $this->xw->startDocument('1.0', 'UTF-8');
         $this->elementStart('html');
         $this->elementStart('head');
-        $this->element('title', null, _('Notice'));
+        // TRANS: Title for page that shows a notice.
+        $this->element('title', null, _m('TITLE','Notice'));
         $this->elementEnd('head');
         $this->elementStart('body');
         $nli = new NoticeListItem($this->notice, $this);
@@ -259,7 +253,6 @@ class ShownoticeAction extends OwnerDesignAction
      *
      * @return void
      */
-
     function showPageNoticeBlock()
     {
     }
@@ -269,7 +262,6 @@ class ShownoticeAction extends OwnerDesignAction
      *
      * @return void
      */
-
     function showAside() {
     }
 
@@ -280,7 +272,6 @@ class ShownoticeAction extends OwnerDesignAction
      *
      * @return void
      */
-
     function extraHead()
     {
         $user = User::staticGet($this->profile->id);
@@ -323,16 +314,16 @@ class ShownoticeAction extends OwnerDesignAction
     }
 }
 
+// @todo FIXME: Class documentation missing.
 class SingleNoticeItem extends DoFollowListItem
 {
     /**
-     * recipe function for displaying a single notice.
+     * Recipe function for displaying a single notice.
      *
      * We overload to show attachments.
      *
      * @return void
      */
-
     function show()
     {
         $this->showStart();
@@ -363,7 +354,6 @@ class SingleNoticeItem extends DoFollowListItem
      *
      * @return void
      */
-
     function showAvatar()
     {
 	$avatar_size = AVATAR_PROFILE_SIZE;

actions/showstream.php

@@ -33,7 +33,6 @@ if (!defined('STATUSNET') && !defined('LACONICA')) {
 }
 
 require_once INSTALLDIR.'/lib/personalgroupnav.php';
-require_once INSTALLDIR.'/lib/userprofile.php';
 require_once INSTALLDIR.'/lib/noticelist.php';
 require_once INSTALLDIR.'/lib/profileminilist.php';
 require_once INSTALLDIR.'/lib/groupminilist.php';
@@ -66,7 +65,8 @@ class ShowstreamAction extends ProfileAction
         $base = $this->profile->getFancyName();
         if (!empty($this->tag)) {
             if ($this->page == 1) {
-                // TRANS: Page title showing tagged notices in one user's stream. %1$s is the username, %2$s is the hash tag.
+                // TRANS: Page title showing tagged notices in one user's stream.
+                // TRANS: %1$s is the username, %2$s is the hash tag.
                 return sprintf(_('%1$s tagged %2$s'), $base, $this->tag);
             } else {
                 // TRANS: Page title showing tagged notices in one user's stream.
@@ -100,7 +100,6 @@ class ShowstreamAction extends ProfileAction
 
     function showContent()
     {
-        $this->showProfile();
         $this->showNotices();
     }
 
@@ -110,6 +109,12 @@ class ShowstreamAction extends ProfileAction
         $nav->show();
     }
 
+    function showProfileBlock()
+    {
+        $block = new AccountProfileBlock($this, $this->profile);
+        $block->show();
+    }
+
     function showPageNoticeBlock()
     {
         return;
@@ -149,6 +154,8 @@ class ShowstreamAction extends ProfileAction
                                                array(
                                                     'id' => $this->user->id,
                                                     'format' => 'atom')),
+                              // TRANS: Title for link to notice feed.
+                              // TRANS: %s is a user nickname.
                               sprintf(_('Notice feed for %s (Atom)'),
                                       $this->user->nickname)),
                      new Feed(Feed::FOAF,
@@ -193,12 +200,6 @@ class ShowstreamAction extends ProfileAction
                                      'href' => $rsd));
     }
 
-    function showProfile()
-    {
-        $profile = new UserProfile($this, $this->user, $this->profile);
-        $profile->show();
-    }
-
     function showEmptyListMessage()
     {
         // TRANS: First sentence of empty list message for a stream. $1%s is a user nickname.
@@ -281,6 +282,18 @@ class ShowstreamAction extends ProfileAction
 
 // We don't show the author for a profile, since we already know who it is!
 
+/**
+ * Slightly modified from standard list; the author & avatar are hidden
+ * in CSS. We used to remove them here too, but as it turns out that
+ * confuses the inline reply code... and we hide them in CSS anyway
+ * since realtime updates come through in original form.
+ *
+ * Remaining customization right now is for the repeat marker, where
+ * it'll list who the original poster was instead of who did the repeat
+ * (since the repeater is you, and the repeatee isn't shown!)
+ * This will remain inconsistent if realtime updates come through,
+ * since those'll get rendered as a regular NoticeListItem.
+ */
 class ProfileNoticeList extends NoticeList
 {
     function newListItem($notice)
@@ -291,11 +304,6 @@ class ProfileNoticeList extends NoticeList
 
 class ProfileNoticeListItem extends DoFollowListItem
 {
-    function showAuthor()
-    {
-        return;
-    }
-
     /**
      * show a link to the author of repeat
      *

actions/silence.php

@@ -40,7 +40,6 @@ if (!defined('STATUSNET')) {
  * @license  http://www.fsf.org/licensing/licenses/agpl.html AGPLv3
  * @link     http://status.net/
  */
-
 class SilenceAction extends ProfileFormAction
 {
     /**
@@ -50,7 +49,6 @@ class SilenceAction extends ProfileFormAction
      *
      * @return boolean success flag
      */
-
     function prepare($args)
     {
         if (!parent::prepare($args)) {
@@ -62,6 +60,7 @@ class SilenceAction extends ProfileFormAction
         assert(!empty($cur)); // checked by parent
 
         if (!$cur->hasRight(Right::SILENCEUSER)) {
+            // TRANS: Client error displayed trying to silence a user on a site where the feature is not enabled.
             $this->clientError(_('You cannot silence users on this site.'));
             return false;
         }
@@ -69,6 +68,7 @@ class SilenceAction extends ProfileFormAction
         assert(!empty($this->profile)); // checked by parent
 
         if ($this->profile->isSilenced()) {
+            // TRANS: Client error displayed trying to silence an already silenced user.
             $this->clientError(_('User is already silenced.'));
             return false;
         }
@@ -81,7 +81,6 @@ class SilenceAction extends ProfileFormAction
      *
      * @return void
      */
-
     function handlePost()
     {
         $this->profile->silence();

actions/siteadminpanel.php

@@ -44,7 +44,6 @@ if (!defined('STATUSNET')) {
  * @license  http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
  * @link     http://status.net/
  */
-
 class SiteadminpanelAction extends AdminPanelAction
 {
     /**
@@ -52,10 +51,10 @@ class SiteadminpanelAction extends AdminPanelAction
      *
      * @return string page title
      */
-
     function title()
     {
-        return _('Site');
+        // TRANS: Title for site administration panel.
+        return _m('TITLE','Site');
     }
 
     /**
@@ -63,9 +62,9 @@ class SiteadminpanelAction extends AdminPanelAction
      *
      * @return string instructions
      */
-
     function getInstructions()
     {
+        // TRANS: Instructions for site administration panel.
         return _('Basic settings for this StatusNet site');
     }
 
@@ -74,7 +73,6 @@ class SiteadminpanelAction extends AdminPanelAction
      *
      * @return void
      */
-
     function showForm()
     {
         $form = new SiteAdminPanelForm($this);
@@ -87,7 +85,6 @@ class SiteadminpanelAction extends AdminPanelAction
      *
      * @return void
      */
-
     function saveSettings()
     {
         static $settings = array(
@@ -130,6 +127,7 @@ class SiteadminpanelAction extends AdminPanelAction
         // Validate site name
 
         if (empty($values['site']['name'])) {
+            // TRANS: Client error displayed trying to save an empty site name.
             $this->clientError(_('Site name must have non-zero length.'));
         }
 
@@ -138,9 +136,11 @@ class SiteadminpanelAction extends AdminPanelAction
         $values['site']['email'] = common_canonical_email($values['site']['email']);
 
         if (empty($values['site']['email'])) {
+            // TRANS: Client error displayed trying to save site settings without a contact address.
             $this->clientError(_('You must have a valid contact email address.'));
         }
         if (!Validate::email($values['site']['email'], common_config('email', 'check_domain'))) {
+            // TRANS: Client error displayed trying to save site settings without a valid contact address.
             $this->clientError(_('Not a valid email address.'));
         }
 
@@ -148,6 +148,7 @@ class SiteadminpanelAction extends AdminPanelAction
 
         if (is_null($values['site']['timezone']) ||
             !in_array($values['site']['timezone'], DateTimeZone::listIdentifiers())) {
+            // TRANS: Client error displayed trying to save site settings without a timezone.
             $this->clientError(_('Timezone not selected.'));
             return;
         }
@@ -156,24 +157,28 @@ class SiteadminpanelAction extends AdminPanelAction
 
         if (!is_null($values['site']['language']) &&
             !in_array($values['site']['language'], array_keys(get_nice_language_list()))) {
+            // TRANS: Client error displayed trying to save site settings with an invalid language code.
+            // TRANS: %s is the invalid language code.
             $this->clientError(sprintf(_('Unknown language "%s".'), $values['site']['language']));
         }
 
         // Validate text limit
 
         if (!Validate::number($values['site']['textlimit'], array('min' => 0))) {
-            $this->clientError(_("Minimum text limit is 0 (unlimited)."));
+            // TRANS: Client error displayed trying to save site settings with a text limit below 0.
+            $this->clientError(_('Minimum text limit is 0 (unlimited).'));
         }
 
         // Validate dupe limit
 
         if (!Validate::number($values['site']['dupelimit'], array('min' => 1))) {
+            // TRANS: Client error displayed trying to save site settings with a text limit below 1.
             $this->clientError(_("Dupe limit must be one or more seconds."));
         }
-
     }
 }
 
+// @todo FIXME: Class documentation missing.
 class SiteAdminPanelForm extends AdminForm
 {
     /**
@@ -181,7 +186,6 @@ class SiteAdminPanelForm extends AdminForm
      *
      * @return int ID of the form
      */
-
     function id()
     {
         return 'form_site_admin_panel';
@@ -192,7 +196,6 @@ class SiteAdminPanelForm extends AdminForm
      *
      * @return string class of the form
      */
-
     function formClass()
     {
         return 'form_settings';
@@ -203,7 +206,6 @@ class SiteAdminPanelForm extends AdminForm
      *
      * @return string URL of the action
      */
-
     function action()
     {
         return common_local_url('siteadminpanel');
@@ -214,35 +216,44 @@ class SiteAdminPanelForm extends AdminForm
      *
      * @return void
      */
-
     function formData()
     {
         $this->out->elementStart('fieldset', array('id' => 'settings_admin_general'));
-        $this->out->element('legend', null, _('General'));
+        // TRANS: Fieldset legend on site settings panel.
+        $this->out->element('legend', null, _m('LEGEND','General'));
         $this->out->elementStart('ul', 'form_data');
         $this->li();
-        $this->input('name', _('Site name'),
-                     _('The name of your site, like "Yourcompany Microblog"'));
+        // TRANS: Field label on site settings panel.
+        $this->input('name', _m('LABEL','Site name'),
+                     // TRANS: Field title on site settings panel.
+                     _('The name of your site, like "Yourcompany Microblog".'));
         $this->unli();
 
         $this->li();
+        // TRANS: Field label on site settings panel.
         $this->input('broughtby', _('Brought by'),
-                     _('Text used for credits link in footer of each page'));
+                     // TRANS: Field title on site settings panel.
+                     _('Text used for credits link in footer of each page.'));
         $this->unli();
 
         $this->li();
+        // TRANS: Field label on site settings panel.
         $this->input('broughtbyurl', _('Brought by URL'),
-                     _('URL used for credits link in footer of each page'));
+                     // TRANS: Field title on site settings panel.
+                     _('URL used for credits link in footer of each page.'));
         $this->unli();
         $this->li();
+        // TRANS: Field label on site settings panel.
         $this->input('email', _('Email'),
-                     _('Contact email address for your site'));
+                     // TRANS: Field title on site settings panel.
+                     _('Contact email address for your site.'));
         $this->unli();
         $this->out->elementEnd('ul');
         $this->out->elementEnd('fieldset');
 
         $this->out->elementStart('fieldset', array('id' => 'settings_admin_local'));
-        $this->out->element('legend', null, _('Local'));
+        // TRANS: Fieldset legend on site settings panel.
+        $this->out->element('legend', null, _m('LEGEND','Local'));
         $this->out->elementStart('ul', 'form_data');
         $timezones = array();
 
@@ -253,14 +264,20 @@ class SiteAdminPanelForm extends AdminForm
         asort($timezones);
 
         $this->li();
+        // TRANS: Dropdown label on site settings panel.
         $this->out->dropdown('timezone', _('Default timezone'),
+                             // TRANS: Dropdown title on site settings panel.
                              $timezones, _('Default timezone for the site; usually UTC.'),
                              true, $this->value('timezone'));
         $this->unli();
 
         $this->li();
-        $this->out->dropdown('language', _('Default language'),
-                             get_nice_language_list(), _('Site language when autodetection from browser settings is not available'),
+        $this->out->dropdown('language',
+                             // TRANS: Dropdown label on site settings panel.
+                             _('Default language'),
+                             get_nice_language_list(),
+                             // TRANS: Dropdown title on site settings panel.
+                             _('Site language when autodetection from browser settings is not available'),
                              false, $this->value('language'));
         $this->unli();
 
@@ -268,14 +285,23 @@ class SiteAdminPanelForm extends AdminForm
         $this->out->elementEnd('fieldset');
 
         $this->out->elementStart('fieldset', array('id' => 'settings_admin_limits'));
-        $this->out->element('legend', null, _('Limits'));
+        // TRANS: Fieldset legend on site settings panel.
+        $this->out->element('legend', null, _m('LEGEND','Limits'));
         $this->out->elementStart('ul', 'form_data');
         $this->li();
-        $this->input('textlimit', _('Text limit'), _('Maximum number of characters for notices.'));
+        $this->input('textlimit',
+                     // TRANS: Field label on site settings panel.
+                     _('Text limit'),
+                     // TRANS: Field title on site settings panel.
+                     _('Maximum number of characters for notices.'));
         $this->unli();
 
         $this->li();
-        $this->input('dupelimit', _('Dupe limit'), _('How long users must wait (in seconds) to post the same thing again.'));
+        $this->input('dupelimit',
+                     // TRANS: Field label on site settings panel.
+                     _('Dupe limit'),
+                     // TRANS: Field title on site settings panel.
+                     _('How long users must wait (in seconds) to post the same thing again.'));
         $this->unli();
         $this->out->elementEnd('ul');
         $this->out->elementEnd('fieldset');
@@ -286,9 +312,14 @@ class SiteAdminPanelForm extends AdminForm
      *
      * @return void
      */
-
     function formActions()
     {
-        $this->out->submit('submit', _('Save'), 'submit', null, _('Save site settings'));
+        $this->out->submit('submit',
+                           // TRANS: Button text for saving site settings.
+                           _m('BUTTON','Save'),
+                           'submit',
+                           null,
+                           // TRANS: Button title for saving site settings.
+                           _('Save site settings'));
     }
 }

actions/smssettings.php

@@ -409,7 +409,7 @@ class SmssettingsAction extends SettingsAction
         if (!$result) {
             common_log_db_error($confirm, 'DELETE', __FILE__);
             // TRANS: Server error thrown on database error canceling SMS phone number confirmation.
-            $this->serverError(_('Could not delete email confirmation.'));
+            $this->serverError(_('Could not delete SMS confirmation.'));
             return;
         }
 

actions/sup.php

@@ -61,8 +61,8 @@ class SupAction extends Action
     {
         $notice = new Notice();
 
-        # XXX: cache this. Depends on how big this protocol becomes;
-        # Re-doing this query every 15 seconds isn't the end of the world.
+        // XXX: cache this. Depends on how big this protocol becomes;
+        // Re-doing this query every 15 seconds isn't the end of the world.
 
         $divider = common_sql_date(time() - $seconds);
 

actions/tagother.php

@@ -21,6 +21,7 @@ if (!defined('STATUSNET') && !defined('LACONICA')) { exit(1); }
 
 require_once(INSTALLDIR.'/lib/settingsaction.php');
 
+// @todo FIXME: documentation missing.
 class TagotherAction extends Action
 {
     var $profile = null;
@@ -127,10 +128,10 @@ class TagotherAction extends Action
         $this->elementStart('li');
         $this->input('tags', _('Tags'),
                      ($this->arg('tags')) ? $this->arg('tags') : implode(' ', Profile_tag::getTags($user->id, $this->profile->id)),
-                     _('Tags for this user (letters, numbers, -, ., and _), comma- or space- separated'));
+                     _('Tags for this user (letters, numbers, -, ., and _), separated by commas or spaces.'));
         $this->elementEnd('li');
         $this->elementEnd('ul');
-        $this->submit('save', _('Save'));
+        $this->submit('save', _m('BUTTON','Save'));
         $this->elementEnd('fieldset');
         $this->elementEnd('form');
     }
@@ -154,7 +155,9 @@ class TagotherAction extends Action
 
             foreach ($tags as $tag) {
                 if (!common_valid_profile_tag($tag)) {
-                    $this->showForm(sprintf(_('Invalid tag: "%s"'), $tag));
+                    // TRANS: Form validation error when entering an invalid tag.
+                    // TRANS: %s is the invalid tag.
+                    $this->showForm(sprintf(_('Invalid tag: "%s".'), $tag));
                     return;
                 }
             }
@@ -217,4 +220,3 @@ class TagotherAction extends Action
         }
     }
 }
-

actions/userauthorization.php

@@ -142,6 +142,7 @@ class UserauthorizationAction extends Action
                                         'alt' => $nickname));
         }
 
+        // TRANS: Label for nickname on user authorisation page.
         $this->element('div', 'entity_nickname', _('Nickname'));
 
         $hasFN = ($fullname !== '') ? 'nickname' : 'fn nickname';
@@ -196,12 +197,14 @@ class UserauthorizationAction extends Action
                                                          'userauthorization')));
         $this->hidden('token', common_session_token());
 
+        $this->submit('accept',
                       // TRANS: Button text on Authorise Subscription page.
-        $this->submit('accept', _m('BUTTON','Accept'), 'submit accept', null,
+                      _m('BUTTON','Accept'), 'submit accept', null,
                       // TRANS: Title for button on Authorise Subscription page.
                       _('Subscribe to this user.'));
+        $this->submit('reject',
                       // TRANS: Button text on Authorise Subscription page.
-        $this->submit('reject', _m('BUTTON','Reject'), 'submit reject', null,
+                      _m('BUTTON','Reject'), 'submit reject', null,
                       // TRANS: Title for button on Authorise Subscription page.
                       _('Reject this subscription.'));
         $this->elementEnd('form');

actions/userdesignsettings.php

@@ -71,6 +71,7 @@ class UserDesignSettingsAction extends DesignSettingsAction
      */
     function title()
     {
+        // TRANS: Title for profile design page.
         return _('Profile design');
     }
 
@@ -81,6 +82,7 @@ class UserDesignSettingsAction extends DesignSettingsAction
      */
     function getInstructions()
     {
+        // TRANS: Instructions for Profile design page.
         return _('Customize the way your profile looks ' .
         'with a background image and a colour palette of your choice.');
     }
@@ -193,6 +195,7 @@ class UserDesignSettingsAction extends DesignSettingsAction
 
             if ($result === false) {
                 common_log_db_error($design, 'UPDATE', __FILE__);
+                // TRANS: Form validation error on Profile design page when updating design settings has failed.
                 $this->showForm(_('Could not update your design.'));
                 return;
             }
@@ -215,6 +218,7 @@ class UserDesignSettingsAction extends DesignSettingsAction
 
             if (empty($id)) {
                 common_log_db_error($id, 'INSERT', __FILE__);
+                // TRANS: Form validation error on Profile design page when saving design settings has failed.
                 $this->showForm(_('Unable to save your design settings.'));
                 return;
             }
@@ -225,6 +229,7 @@ class UserDesignSettingsAction extends DesignSettingsAction
 
             if (empty($result)) {
                 common_log_db_error($original, 'UPDATE', __FILE__);
+                // TRANS: Form validation error on Profile design page when saving design settings has failed.
                 $this->showForm(_('Unable to save your design settings.'));
                 $user->query('ROLLBACK');
                 return;
@@ -236,6 +241,7 @@ class UserDesignSettingsAction extends DesignSettingsAction
 
         $this->saveBackgroundImage($design);
 
+        // TRANS: Confirmation message on Profile design page when saving design settings has succeeded.
         $this->showForm(_('Design preferences saved.'), true);
     }
 
@@ -246,7 +252,6 @@ class UserDesignSettingsAction extends DesignSettingsAction
      */
     function sethd()
     {
-
         $user   = common_current_user();
         $design = $user->getDesign();
 
@@ -267,6 +272,7 @@ class UserDesignSettingsAction extends DesignSettingsAction
 
         if (empty($id)) {
             common_log_db_error($id, 'INSERT', __FILE__);
+            // TRANS: Form validation error on Profile design page when saving design settings has failed.
             $this->showForm(_('Unable to save your design settings.'));
             return;
         }
@@ -277,6 +283,7 @@ class UserDesignSettingsAction extends DesignSettingsAction
 
         if (empty($result)) {
             common_log_db_error($original, 'UPDATE', __FILE__);
+            // TRANS: Form validation error on Profile design page when updating design settings has failed.
             $this->showForm(_('Unable to save your design settings.'));
             $user->query('ROLLBACK');
             return;
@@ -286,6 +293,7 @@ class UserDesignSettingsAction extends DesignSettingsAction
 
         $this->saveBackgroundImage($design);
 
+        // TRANS: Succes message on Profile design page when finding an easter egg.
         $this->showForm(_('Enjoy your hotdog!'), true);
     }
 
@@ -303,7 +311,8 @@ class UserDesignSettingsAction extends DesignSettingsAction
 
         if ($result === false) {
             common_log_db_error($user, 'UPDATE', __FILE__);
-            throw new ServerException(_('Couldn\'t update user.'));
+            // TRANS: Server exception thrown on Profile design page when updating design settings fails.
+            throw new ServerException(_('Could not update user.'));
         }
     }
 }
@@ -322,6 +331,7 @@ class UserDesignForm extends DesignForm
      */
     function formLegend()
     {
+        // TRANS: Form legend on Profile design page.
         $this->out->element('legend', null, _('Design settings'));
     }
 
@@ -337,7 +347,9 @@ class UserDesignForm extends DesignForm
 
         $this->out->elementStart('ul', 'form_data');
         $this->out->elementStart('li');
+        // TRANS: Checkbox label on Profile design page.
         $this->out->checkbox('viewdesigns', _('View profile designs'),
+                                                  // TRANS: Title for checkbox on Profile design page.
                          -                        $user->viewdesigns, _('Show or hide profile designs.'));
         $this->out->elementEnd('li');
         $this->out->elementEnd('ul');
@@ -345,6 +357,7 @@ class UserDesignForm extends DesignForm
         $this->out->elementEnd('fieldset');
 
         $this->out->elementStart('fieldset');
+        // TRANS: Form legend on Profile design page for form to choose a background image.
         $this->out->element('legend', null, _('Background file'));
 
         parent::formData();

actions/usergroups.php

@@ -45,7 +45,6 @@ require_once INSTALLDIR.'/lib/grouplist.php';
  * @license  http://www.fsf.org/licensing/licenses/agpl-3.0.html GNU Affero General Public License version 3.0
  * @link     http://status.net/
  */
-
 class UsergroupsAction extends OwnerDesignAction
 {
     var $page = null;
@@ -59,10 +58,12 @@ class UsergroupsAction extends OwnerDesignAction
     function title()
     {
         if ($this->page == 1) {
-            // TRANS: Message is used as a page title. %s is a nick name.
+            // TRANS: Page title for first page of groups for a user.
+            // TRANS: %s is a nickname.
             return sprintf(_('%s groups'), $this->user->nickname);
         } else {
-            // TRANS: Message is used as a page title. %1$s is a nick name, %2$d is a page number.
+            // TRANS: Page title for all but the first page of groups for a user.
+            // TRANS: %1$s is a nickname, %2$d is a page number.
             return sprintf(_('%1$s groups, page %2$d'),
                            $this->user->nickname,
                            $this->page);
@@ -90,6 +91,7 @@ class UsergroupsAction extends OwnerDesignAction
         $this->user = User::staticGet('nickname', $nickname);
 
         if (!$this->user) {
+            // TRANS: Client error displayed requesting groups for a non-existing user.
             $this->clientError(_('No such user.'), 404);
             return false;
         }
@@ -97,6 +99,7 @@ class UsergroupsAction extends OwnerDesignAction
         $this->profile = $this->user->getProfile();
 
         if (!$this->profile) {
+            // TRANS: Server error displayed requesting groups for a user without a profile.
             $this->serverError(_('User has no profile.'));
             return false;
         }
@@ -123,12 +126,14 @@ class UsergroupsAction extends OwnerDesignAction
         $this->elementStart('p', array('id' => 'new_group'));
         $this->element('a', array('href' => common_local_url('newgroup'),
                                   'class' => 'more'),
+                       // TRANS: Link text on group page to create a new group.
                        _('Create a new group'));
         $this->elementEnd('p');
 
         $this->elementStart('p', array('id' => 'group_search'));
         $this->element('a', array('href' => common_local_url('groupsearch'),
                                   'class' => 'more'),
+                       // TRANS: Link text on group page to search for groups.
                        _('Search for more groups'));
         $this->elementEnd('p');
 
@@ -156,11 +161,15 @@ class UsergroupsAction extends OwnerDesignAction
 
     function showEmptyListMessage()
     {
+        // TRANS: Text on group page for a user that is not a member of any group.
+        // TRANS: %s is a user nickname.
         $message = sprintf(_('%s is not a member of any group.'), $this->user->nickname) . ' ';
 
         if (common_logged_in()) {
             $current_user = common_current_user();
             if ($this->user->id === $current_user->id) {
+                // TRANS: Text on group page for a user that is not a member of any group. This message contains
+                // TRANS: a Markdown link in the form [link text](link) and a variable that should not be changed.
                 $message .= _('Try [searching for groups](%%action.groupsearch%%) and joining them.');
             }
         }
@@ -168,4 +177,10 @@ class UsergroupsAction extends OwnerDesignAction
         $this->raw(common_markup_to_html($message));
         $this->elementEnd('div');
     }
+
+    function showProfileBlock()
+    {
+        $block = new AccountProfileBlock($this, $this->profile);
+        $block->show();
+    }
 }

actions/userrss.php

@@ -112,7 +112,7 @@ class UserrssAction extends Rss10Action
         return ($avatar) ? $avatar->url : null;
     }
 
-    # override parent to add X-SUP-ID URL
+    // override parent to add X-SUP-ID URL
 
     function initRss($limit=0)
     {

actions/version.php

@@ -46,7 +46,6 @@ if (!defined('STATUSNET')) {
  * @license  http://www.fsf.org/licensing/licenses/agpl-3.0.html AGPLv3
  * @link     http://status.net/
  */
-
 class VersionAction extends Action
 {
     var $pluginVersions = array();
@@ -58,7 +57,6 @@ class VersionAction extends Action
      *
      * @return boolean is read only action?
      */
-
     function isReadOnly($args)
     {
         return true;
@@ -69,9 +67,9 @@ class VersionAction extends Action
      *
      * @return string page title
      */
-
     function title()
     {
+        // TRANS: Title for version page. %s is the StatusNet version.
         return sprintf(_("StatusNet %s"), STATUSNET_VERSION);
     }
 
@@ -85,7 +83,6 @@ class VersionAction extends Action
      *
      * @return boolean true
      */
-
     function prepare($args)
     {
         parent::prepare($args);
@@ -105,7 +102,6 @@ class VersionAction extends Action
      *
      * @return void
      */
-
     function handle($args)
     {
         parent::handle($args);
@@ -131,7 +127,6 @@ class VersionAction extends Action
          $this->elementEnd('div');
      }
 
-
     /*
     * Overrride to add entry-title class
     *
@@ -147,38 +142,46 @@ class VersionAction extends Action
      *
      * @return void
      */
-
     function showContent()
     {
         $this->elementStart('p');
 
+        // TRANS: Content part of StatusNet version page.
+        // TRANS: %1$s is the engine name (StatusNet) and %2$s is the StatusNet version.
         $this->raw(sprintf(_('This site is powered by %1$s version %2$s, '.
                              'Copyright 2008-2010 StatusNet, Inc. '.
                              'and contributors.'),
                            XMLStringer::estring('a', array('href' => 'http://status.net/'),
+                                                // TRANS: Engine name.
                                                 _('StatusNet')),
                            STATUSNET_VERSION));
         $this->elementEnd('p');
 
+        // TRANS: Header for StatusNet contributors section on the version page.
         $this->element('h2', null, _('Contributors'));
 
         $this->element('p', null, implode(', ', $this->contributors));
 
+        // TRANS: Header for StatusNet license section on the version page.
         $this->element('h2', null, _('License'));
 
         $this->element('p', null,
+                       // TRANS: Content part of StatusNet version page.
                        _('StatusNet is free software: you can redistribute it and/or modify '.
                          'it under the terms of the GNU Affero General Public License as published by '.
                          'the Free Software Foundation, either version 3 of the License, or '.
                          '(at your option) any later version. '));
 
         $this->element('p', null,
+                       // TRANS: Content part of StatusNet version page.
                        _('This program is distributed in the hope that it will be useful, '.
                          'but WITHOUT ANY WARRANTY; without even the implied warranty of '.
                          'MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the '.
                          'GNU Affero General Public License for more details. '));
 
         $this->elementStart('p');
+        // TRANS: Content part of StatusNet version page.
+        // TRANS: %s is a link to the AGPL license with link description "http://www.gnu.org/licenses/agpl.html".
         $this->raw(sprintf(_('You should have received a copy of the GNU Affero General Public License '.
                              'along with this program.  If not, see %s.'),
                            XMLStringer::estring('a', array('href' => 'http://www.gnu.org/licenses/agpl.html'),
@@ -188,16 +191,21 @@ class VersionAction extends Action
         // XXX: Theme information?
 
         if (count($this->pluginVersions)) {
+            // TRANS: Header for StatusNet plugins section on the version page.
             $this->element('h2', null, _('Plugins'));
 
             $this->elementStart('table', array('id' => 'plugins_enabled'));
 
             $this->elementStart('thead');
             $this->elementStart('tr');
-            $this->element('th', array('id' => 'plugin_name'), _('Name'));
-            $this->element('th', array('id' => 'plugin_version'), _('Version'));
-            $this->element('th', array('id' => 'plugin_authors'), _('Author(s)'));
-            $this->element('th', array('id' => 'plugin_description'), _('Description'));
+            // TRANS: Column header for plugins table on version page.
+            $this->element('th', array('id' => 'plugin_name'), _m('HEADER','Name'));
+            // TRANS: Column header for plugins table on version page.
+            $this->element('th', array('id' => 'plugin_version'), _m('HEADER','Version'));
+            // TRANS: Column header for plugins table on version page.
+            $this->element('th', array('id' => 'plugin_authors'), _m('HEADER','Author(s)'));
+            // TRANS: Column header for plugins table on version page.
+            $this->element('th', array('id' => 'plugin_description'), _m('HEADER','Description'));
             $this->elementEnd('tr');
             $this->elementEnd('thead');
 
@@ -269,5 +277,6 @@ class VersionAction extends Action
                               'mEDI',
                               'Brett Taylor',
                               'Brigitte Schuster',
-                              'Brion Vibber');
+                              'Brion Vibber',
+                              'Siebrand Mazeland');
 }

classes/Avatar.php

@@ -27,7 +27,7 @@ class Avatar extends Memcached_DataObject
     /* the code above is auto generated do not remove the tag below */
     ###END_AUTOCODE
 
-    # We clean up the file, too
+    // We clean up the file, too
 
     function delete()
     {

classes/Fave.php

@@ -44,6 +44,7 @@ class Fave extends Memcached_DataObject
                 common_log_db_error($fave, 'INSERT', __FILE__);
                 return false;
             }
+            self::blow('fave:by_notice:%d', $fave->notice_id);
 
             Event::handle('EndFavorNotice', array($profile, $notice));
         }
@@ -61,6 +62,7 @@ class Fave extends Memcached_DataObject
         if (Event::handle('StartDisfavorNotice', array($profile, $notice, &$result))) {
 
             $result = parent::delete();
+            self::blow('fave:by_notice:%d', $this->notice_id);
 
             if ($result) {
                 Event::handle('EndDisfavorNotice', array($profile, $notice));
@@ -77,70 +79,16 @@ class Fave extends Memcached_DataObject
 
     function stream($user_id, $offset=0, $limit=NOTICES_PER_PAGE, $own=false, $since_id=0, $max_id=0)
     {
-        $ids = Notice::stream(array('Fave', '_streamDirect'),
-                              array($user_id, $own),
-                              ($own) ? 'fave:ids_by_user_own:'.$user_id :
-                              'fave:ids_by_user:'.$user_id,
-                              $offset, $limit, $since_id, $max_id);
-        return $ids;
+        $stream = new FaveNoticeStream($user_id, $own);
+
+        return $stream->getNotices($offset, $limit, $since_id, $max_id);
     }
 
-    /**
-     * Note that the sorting for this is by order of *fave* not order of *notice*.
-     *
-     * @fixme add since_id, max_id support?
-     *
-     * @param <type> $user_id
-     * @param <type> $own
-     * @param <type> $offset
-     * @param <type> $limit
-     * @param <type> $since_id
-     * @param <type> $max_id
-     * @return <type>
-     */
-    function _streamDirect($user_id, $own, $offset, $limit, $since_id, $max_id)
+    function idStream($user_id, $offset=0, $limit=NOTICES_PER_PAGE, $own=false, $since_id=0, $max_id=0)
     {
-        $fav = new Fave();
-        $qry = null;
+        $stream = new FaveNoticeStream($user_id, $own);
 
-        if ($own) {
-            $qry  = 'SELECT fave.* FROM fave ';
-            $qry .= 'WHERE fave.user_id = ' . $user_id . ' ';
-        } else {
-             $qry =  'SELECT fave.* FROM fave ';
-             $qry .= 'INNER JOIN notice ON fave.notice_id = notice.id ';
-             $qry .= 'WHERE fave.user_id = ' . $user_id . ' ';
-             $qry .= 'AND notice.is_local != ' . Notice::GATEWAY . ' ';
-        }
-
-        if ($since_id != 0) {
-            $qry .= 'AND notice_id > ' . $since_id . ' ';
-        }
-
-        if ($max_id != 0) {
-            $qry .= 'AND notice_id <= ' . $max_id . ' ';
-        }
-
-        // NOTE: we sort by fave time, not by notice time!
-
-        $qry .= 'ORDER BY modified DESC ';
-
-        if (!is_null($offset)) {
-            $qry .= "LIMIT $limit OFFSET $offset";
-        }
-
-        $fav->query($qry);
-
-        $ids = array();
-
-        while ($fav->fetch()) {
-            $ids[] = $fav->notice_id;
-        }
-
-        $fav->free();
-        unset($fav);
-
-        return $ids;
+        return $stream->getNoticeIds($offset, $limit, $since_id, $max_id);
     }
 
     function asActivity()
@@ -208,4 +156,31 @@ class Fave extends Memcached_DataObject
 
         return $fav;
     }
+
+    /**
+     * Grab a list of profile who have favored this notice.
+     *
+     * @return ArrayWrapper masquerading as a Fave
+     */
+    static function byNotice($noticeId)
+    {
+        $c = self::memcache();
+        $key = Cache::key('fave:by_notice:' . $noticeId);
+
+        $wrapper = $c->get($key);
+        if (!$wrapper) {
+            // @fixme caching & scalability!
+            $fave = new Fave();
+            $fave->notice_id = $noticeId;
+            $fave->find();
+
+            $list = array();
+            while ($fave->fetch()) {
+                $list[] = clone($fave);
+            }
+            $wrapper = new ArrayWrapper($list);
+            $c->set($key, $wrapper);
+        }
+        return $wrapper;
+    }
 }

classes/File.php

@@ -449,52 +449,8 @@ class File extends Memcached_DataObject
 
     function stream($offset=0, $limit=NOTICES_PER_PAGE, $since_id=0, $max_id=0)
     {
-        $ids = Notice::stream(array($this, '_streamDirect'),
-                              array(),
-                              'file:notice-ids:'.$this->url,
-                              $offset, $limit, $since_id, $max_id);
-
-        return Notice::getStreamByIds($ids);
-    }
-
-    /**
-     * Stream of notices linking to this URL
-     *
-     * @param integer $offset   Offset to show; default is 0
-     * @param integer $limit    Limit of notices to show
-     * @param integer $since_id Since this notice
-     * @param integer $max_id   Before this notice
-     *
-     * @return array ids of notices that link to this file
-     */
-
-    function _streamDirect($offset, $limit, $since_id, $max_id)
-    {
-        $f2p = new File_to_post();
-
-        $f2p->selectAdd();
-        $f2p->selectAdd('post_id');
-
-        $f2p->file_id = $this->id;
-
-        Notice::addWhereSinceId($f2p, $since_id, 'post_id', 'modified');
-        Notice::addWhereMaxId($f2p, $max_id, 'post_id', 'modified');
-
-        $f2p->orderBy('modified DESC, post_id DESC');
-
-        if (!is_null($offset)) {
-            $f2p->limit($offset, $limit);
-        }
-
-        $ids = array();
-
-        if ($f2p->find()) {
-            while ($f2p->fetch()) {
-                $ids[] = $f2p->post_id;
-            }
-        }
-
-        return $ids;
+        $stream = new FileNoticeStream($this);
+        return $stream->getNotices($offset, $limit, $since_id, $max_id);
     }
 
     function noticeCount()

classes/Foreign_link.php

@@ -91,7 +91,7 @@ class Foreign_link extends Memcached_DataObject
         $this->profilesync = 0;
     }
 
-    # Convenience methods
+    // Convenience methods
     function getForeignUser()
     {
         $fuser = new Foreign_user();

classes/Foreign_user.php

@@ -65,7 +65,7 @@ class Foreign_user extends Memcached_DataObject
             }
         }
         if (count($parts) == 0) {
-            # No changes
+            // No changes
             return true;
         }
         $toupdate = implode(', ', $parts);

classes/Group_join_queue.php

@@ -0,0 +1,69 @@
+<?php
+/**
+ * Table Definition for request_queue
+ */
+require_once INSTALLDIR.'/classes/Memcached_DataObject.php';
+
+class Group_join_queue extends Managed_DataObject
+{
+    ###START_AUTOCODE
+    /* the code below is auto generated do not remove the above tag */
+
+    public $__table = 'group_join_queue';       // table name
+    public $profile_id;
+    public $group_id;
+    public $created;
+
+    /* Static get */
+    function staticGet($k,$v=null)
+    { return Memcached_DataObject::staticGet('Group_join_queue',$k,$v); }
+
+    /* Pkey get */
+    function pkeyGet($k)
+    { return Memcached_DataObject::pkeyGet('Group_join_queue',$k); }
+
+    /* the code above is auto generated do not remove the tag below */
+    ###END_AUTOCODE
+
+    public static function schemaDef()
+    {
+        return array(
+            'description' => 'Holder for group join requests awaiting moderation.',
+            'fields' => array(
+                'profile_id' => array('type' => 'int', 'not null' => true, 'description' => 'remote or local profile making the request'),
+                'group_id' => array('type' => 'int', 'description' => 'remote or local group to join, if any'),
+                'created' => array('type' => 'datetime', 'not null' => true, 'description' => 'date this record was created'),
+            ),
+            'primary key' => array('profile_id', 'group_id'),
+            'indexes' => array(
+                'group_join_queue_profile_id_created_idx' => array('profile_id', 'created'),
+                'group_join_queue_group_id_created_idx' => array('group_id', 'created'),
+            ),
+            'foreign keys' => array(
+                'group_join_queue_profile_id_fkey' => array('profile', array('profile_id' => 'id')),
+                'group_join_queue_group_id_fkey' => array('user_group', array('group_id' => 'id')),
+            )
+        );
+    }
+
+    public static function saveNew(Profile $profile, User_group $group)
+    {
+        $rq = new Group_join_queue();
+        $rq->profile_id = $profile->id;
+        $rq->group_id = $group->id;
+        $rq->created = common_sql_now();
+        $rq->insert();
+        return $rq;
+    }
+
+    /**
+     * Send notifications via email etc to group administrators about
+     * this exciting new pending moderation queue item!
+     */
+    public function notify()
+    {
+        $joiner = Profile::staticGet('id', $this->profile_id);
+        $group = User_group::staticGet('id', $this->group_id);
+        mail_notify_group_join_pending($group, $joiner);
+    }
+}

classes/Group_member.php

@@ -28,6 +28,7 @@ class Group_member extends Memcached_DataObject
 
     /**
      * Method to add a user to a group.
+     * In most cases, you should call Profile->joinGroup() instead.
      *
      * @param integer $group_id   Group to add to
      * @param integer $profile_id Profile being added
@@ -161,4 +162,13 @@ class Group_member extends Memcached_DataObject
 
         return $act;
     }
+
+    /**
+     * Send notifications via email etc to group administrators about
+     * this exciting new membership!
+     */
+    public function notify()
+    {
+        mail_notify_group_join($this->getGroup(), $this->getMember());
+    }
 }

classes/Inbox.php

@@ -233,7 +233,7 @@ class Inbox extends Memcached_DataObject
         // Do a bulk lookup for the first $limit items
         // Fast path when nothing's deleted.
         $firstChunk = array_slice($ids, 0, $offset + $limit);
-        $notices = Notice::getStreamByIds($firstChunk);
+        $notices = NoticeStream::getStreamByIds($firstChunk);
 
         assert($notices instanceof ArrayWrapper);
         $items = $notices->_items;
@@ -292,7 +292,7 @@ class Inbox extends Memcached_DataObject
         // Do a bulk lookup for the first $limit items
         // Fast path when nothing's deleted.
         $firstChunk = array_slice($ids, 0, $limit);
-        $notices = Notice::getStreamByIds($firstChunk);
+        $notices = NoticeStream::getStreamByIds($firstChunk);
 
         $wanted = count($firstChunk); // raw entry count in the inbox up to our $limit
         if ($notices->N >= $wanted) {

classes/Managed_DataObject.php

@@ -93,6 +93,7 @@ abstract class Managed_DataObject extends Memcached_DataObject
     function keyTypes()
     {
         $table = call_user_func(array(get_class($this), 'schemaDef'));
+        $keys = array();
 
         if (!empty($table['unique keys'])) {
             foreach ($table['unique keys'] as $idx => $fields) {

classes/Memcached_DataObject.php

@@ -34,7 +34,7 @@ class Memcached_DataObject extends Safe_DataObject
     {
         if (is_null($v)) {
             $v = $k;
-            # XXX: HACK!
+            // XXX: HACK!
             $i = new $cls;
             $keys = $i->keys();
             $k = $keys[0];

classes/Notice.php

@@ -45,7 +45,7 @@ require_once INSTALLDIR.'/classes/Memcached_DataObject.php';
 /* We keep 200 notices, the max number of notices available per API request,
  * in the memcached cache. */
 
-define('NOTICE_CACHE_WINDOW', 200);
+define('NOTICE_CACHE_WINDOW', CachingNoticeStream::CACHE_WINDOW);
 
 define('MAX_BOXCARS', 128);
 
@@ -312,7 +312,7 @@ class Notice extends Memcached_DataObject
 
         $autosource = common_config('public', 'autosource');
 
-        # Sandboxed are non-false, but not 1, either
+        // Sandboxed are non-false, but not 1, either
 
         if (!$profile->hasRight(Right::PUBLICNOTICE) ||
             ($source && $autosource && in_array($source, $autosource))) {
@@ -410,8 +410,8 @@ class Notice extends Memcached_DataObject
 
         }
 
-        # Clear the cache for subscribed users, so they'll update at next request
-        # XXX: someone clever could prepend instead of clearing the cache
+        // Clear the cache for subscribed users, so they'll update at next request
+        // XXX: someone clever could prepend instead of clearing the cache
 
         $notice->blowOnInsert();
 
@@ -496,6 +496,13 @@ class Notice extends Memcached_DataObject
         if ($this->isPublic()) {
             self::blow('public;last');
         }
+
+        self::blow('fave:by_notice', $this->id);
+
+        if ($this->conversation) {
+            // In case we're the first, will need to calc a new root.
+            self::blow('notice:conversation_root:%d', $this->conversation);
+        }
     }
 
     /** save all urls in the notice to the db
@@ -541,7 +548,7 @@ class Notice extends Memcached_DataObject
         if (empty($profile)) {
             return false;
         }
-        $notice = $profile->getNotices(0, NOTICE_CACHE_WINDOW);
+        $notice = $profile->getNotices(0, CachingNoticeStream::CACHE_WINDOW);
         if (!empty($notice)) {
             $last = 0;
             while ($notice->fetch()) {
@@ -552,8 +559,8 @@ class Notice extends Memcached_DataObject
                 }
             }
         }
-        # If we get here, oldest item in cache window is not
-        # old enough for dupe limit; do direct check against DB
+        // If we get here, oldest item in cache window is not
+        // old enough for dupe limit; do direct check against DB
         $notice = new Notice();
         $notice->profile_id = $profile_id;
         $notice->content = $content;
@@ -569,16 +576,16 @@ class Notice extends Memcached_DataObject
         if (empty($profile)) {
             return false;
         }
-        # Get the Nth notice
+        // Get the Nth notice
         $notice = $profile->getNotices(common_config('throttle', 'count') - 1, 1);
         if ($notice && $notice->fetch()) {
-            # If the Nth notice was posted less than timespan seconds ago
+            // If the Nth notice was posted less than timespan seconds ago
             if (time() - strtotime($notice->created) <= common_config('throttle', 'timespan')) {
-                # Then we throttle
+                // Then we throttle
                 return false;
             }
         }
-        # Either not N notices in the stream, OR the Nth was not posted within timespan seconds
+        // Either not N notices in the stream, OR the Nth was not posted within timespan seconds
         return true;
     }
 
@@ -622,134 +629,19 @@ class Notice extends Memcached_DataObject
         return $att;
     }
 
-    function getStreamByIds($ids)
-    {
-        $cache = Cache::instance();
-
-        if (!empty($cache)) {
-            $notices = array();
-            foreach ($ids as $id) {
-                $n = Notice::staticGet('id', $id);
-                if (!empty($n)) {
-                    $notices[] = $n;
-                }
-            }
-            return new ArrayWrapper($notices);
-        } else {
-            $notice = new Notice();
-            if (empty($ids)) {
-                //if no IDs requested, just return the notice object
-                return $notice;
-            }
-            $notice->whereAdd('id in (' . implode(', ', $ids) . ')');
-
-            $notice->find();
-
-            $temp = array();
-
-            while ($notice->fetch()) {
-                $temp[$notice->id] = clone($notice);
-            }
-
-            $wrapped = array();
-
-            foreach ($ids as $id) {
-                if (array_key_exists($id, $temp)) {
-                    $wrapped[] = $temp[$id];
-                }
-            }
-
-            return new ArrayWrapper($wrapped);
-        }
-    }
 
     function publicStream($offset=0, $limit=20, $since_id=0, $max_id=0)
     {
-        $ids = Notice::stream(array('Notice', '_publicStreamDirect'),
-                              array(),
-                              'public',
-                              $offset, $limit, $since_id, $max_id);
-        return Notice::getStreamByIds($ids);
+        $stream = new PublicNoticeStream();
+        return $stream->getNotices($offset, $limit, $since_id, $max_id);
     }
 
-    function _publicStreamDirect($offset=0, $limit=20, $since_id=0, $max_id=0)
-    {
-        $notice = new Notice();
-
-        $notice->selectAdd(); // clears it
-        $notice->selectAdd('id');
-
-        $notice->orderBy('created DESC, id DESC');
-
-        if (!is_null($offset)) {
-            $notice->limit($offset, $limit);
-        }
-
-        if (common_config('public', 'localonly')) {
-            $notice->whereAdd('is_local = ' . Notice::LOCAL_PUBLIC);
-        } else {
-            # -1 == blacklisted, -2 == gateway (i.e. Twitter)
-            $notice->whereAdd('is_local !='. Notice::LOCAL_NONPUBLIC);
-            $notice->whereAdd('is_local !='. Notice::GATEWAY);
-        }
-
-        Notice::addWhereSinceId($notice, $since_id);
-        Notice::addWhereMaxId($notice, $max_id);
-
-        $ids = array();
-
-        if ($notice->find()) {
-            while ($notice->fetch()) {
-                $ids[] = $notice->id;
-            }
-        }
-
-        $notice->free();
-        $notice = NULL;
-
-        return $ids;
-    }
 
     function conversationStream($id, $offset=0, $limit=20, $since_id=0, $max_id=0)
     {
-        $ids = Notice::stream(array('Notice', '_conversationStreamDirect'),
-                              array($id),
-                              'notice:conversation_ids:'.$id,
-                              $offset, $limit, $since_id, $max_id);
+        $stream = new ConversationNoticeStream($id);
 
-        return Notice::getStreamByIds($ids);
-    }
-
-    function _conversationStreamDirect($id, $offset=0, $limit=20, $since_id=0, $max_id=0)
-    {
-        $notice = new Notice();
-
-        $notice->selectAdd(); // clears it
-        $notice->selectAdd('id');
-
-        $notice->conversation = $id;
-
-        $notice->orderBy('created DESC, id DESC');
-
-        if (!is_null($offset)) {
-            $notice->limit($offset, $limit);
-        }
-
-        Notice::addWhereSinceId($notice, $since_id);
-        Notice::addWhereMaxId($notice, $max_id);
-
-        $ids = array();
-
-        if ($notice->find()) {
-            while ($notice->fetch()) {
-                $ids[] = $notice->id;
-            }
-        }
-
-        $notice->free();
-        $notice = NULL;
-
-        return $ids;
+        return $stream->getNotices($offset, $limit, $since_id, $max_id);
     }
 
     /**
@@ -774,6 +666,35 @@ class Notice extends Memcached_DataObject
         return false;
     }
 
+    /**
+     * Grab the earliest notice from this conversation.
+     *
+     * @return Notice or null
+     */
+    function conversationRoot()
+    {
+        if (!empty($this->conversation)) {
+            $c = self::memcache();
+
+            $key = Cache::key('notice:conversation_root:' . $this->conversation);
+            $notice = $c->get($key);
+            if ($notice) {
+                return $notice;
+            }
+
+            $notice = new Notice();
+            $notice->conversation = $this->conversation;
+            $notice->orderBy('CREATED');
+            $notice->limit(1);
+            $notice->find(true);
+
+            if ($notice->N) {
+                $c->set($key, $notice);
+                return $notice;
+            }
+        }
+        return null;
+    }
     /**
      * Pull up a full list of local recipients who will be getting
      * this notice in their inbox. Results will be cached, so don't
@@ -812,6 +733,9 @@ class Notice extends Memcached_DataObject
 
         $ni = array();
 
+        // Give plugins a chance to add folks in at start...
+        if (Event::handle('StartNoticeWhoGets', array($this, &$ni))) {
+
             foreach ($users as $id) {
                 $ni[$id] = NOTICE_INBOX_SOURCE_SUB;
             }
@@ -849,6 +773,10 @@ class Notice extends Memcached_DataObject
                 }
             }
 
+            // Give plugins a chance to filter out...
+            Event::handle('EndNoticeWhoGets', array($this, &$ni));
+        }
+
         if (!empty($c)) {
             // XXX: pack this data better
             $c->set(Cache::key('notice:who_gets:'.$this->id), $ni);
@@ -1497,61 +1425,6 @@ class Notice extends Memcached_DataObject
         }
     }
 
-    function stream($fn, $args, $cachekey, $offset=0, $limit=20, $since_id=0, $max_id=0)
-    {
-        $cache = Cache::instance();
-
-        if (empty($cache) ||
-            $since_id != 0 || $max_id != 0 ||
-            is_null($limit) ||
-            ($offset + $limit) > NOTICE_CACHE_WINDOW) {
-            return call_user_func_array($fn, array_merge($args, array($offset, $limit, $since_id,
-                                                                      $max_id)));
-        }
-
-        $idkey = Cache::key($cachekey);
-
-        $idstr = $cache->get($idkey);
-
-        if ($idstr !== false) {
-            // Cache hit! Woohoo!
-            $window = explode(',', $idstr);
-            $ids = array_slice($window, $offset, $limit);
-            return $ids;
-        }
-
-        $laststr = $cache->get($idkey.';last');
-
-        if ($laststr !== false) {
-            $window = explode(',', $laststr);
-            $last_id = $window[0];
-            $new_ids = call_user_func_array($fn, array_merge($args, array(0, NOTICE_CACHE_WINDOW,
-                                                                          $last_id, 0, null)));
-
-            $new_window = array_merge($new_ids, $window);
-
-            $new_windowstr = implode(',', $new_window);
-
-            $result = $cache->set($idkey, $new_windowstr);
-            $result = $cache->set($idkey . ';last', $new_windowstr);
-
-            $ids = array_slice($new_window, $offset, $limit);
-
-            return $ids;
-        }
-
-        $window = call_user_func_array($fn, array_merge($args, array(0, NOTICE_CACHE_WINDOW,
-                                                                     0, 0, null)));
-
-        $windowstr = implode(',', $window);
-
-        $result = $cache->set($idkey, $windowstr);
-        $result = $cache->set($idkey . ';last', $windowstr);
-
-        $ids = array_slice($window, $offset, $limit);
-
-        return $ids;
-    }
 
     /**
      * Determine which notice, if any, a new notice is in reply to.
@@ -1709,7 +1582,7 @@ class Notice extends Memcached_DataObject
             }
         }
 
-        return Notice::getStreamByIds($ids);
+        return NoticeStream::getStreamByIds($ids);
     }
 
     function _repeatStreamDirect($limit)
@@ -1999,6 +1872,11 @@ class Notice extends Memcached_DataObject
                 $this->is_local == Notice::LOCAL_NONPUBLIC);
     }
 
+    /**
+     * Get the list of hash tags saved with this notice.
+     *
+     * @return array of strings
+     */
     public function getTags()
     {
         $tags = array();

classes/Notice_tag.php

@@ -36,43 +36,11 @@ class Notice_tag extends Memcached_DataObject
     /* the code above is auto generated do not remove the tag below */
     ###END_AUTOCODE
 
-    static function getStream($tag, $offset=0, $limit=20) {
-
-        $ids = Notice::stream(array('Notice_tag', '_streamDirect'),
-                              array($tag),
-                              'notice_tag:notice_ids:' . Cache::keyize($tag),
-                              $offset, $limit);
-
-        return Notice::getStreamByIds($ids);
-    }
-
-    function _streamDirect($tag, $offset, $limit, $since_id, $max_id)
+    static function getStream($tag, $offset=0, $limit=20, $sinceId=0, $maxId=0)
     {
-        $nt = new Notice_tag();
+        $stream = new TagNoticeStream($tag);
         
-        $nt->tag = $tag;
-
-        $nt->selectAdd();
-        $nt->selectAdd('notice_id');
-
-        Notice::addWhereSinceId($nt, $since_id, 'notice_id');
-        Notice::addWhereMaxId($nt, $max_id, 'notice_id');
-
-        $nt->orderBy('created DESC, notice_id DESC');
-
-        if (!is_null($offset)) {
-            $nt->limit($offset, $limit);
-        }
-
-        $ids = array();
-
-        if ($nt->find()) {
-            while ($nt->fetch()) {
-                $ids[] = $nt->notice_id;
-            }
-        }
-
-        return $ids;
+        return $stream->getNotices($offset, $limit, $sinceId, $maxId);
     }
 
     function blowCache($blowLast=false)

classes/Oauth_application_user.php

@@ -51,7 +51,7 @@ class Oauth_application_user extends Memcached_DataObject
             }
         }
         if (count($parts) == 0) {
-            # No changes
+            // No changes
             return true;
         }
         $toupdate = implode(', ', $parts);

classes/Profile.php

@@ -93,7 +93,7 @@ class Profile extends Memcached_DataObject
         $avatar->url = Avatar::url($filename);
         $avatar->created = DB_DataObject_Cast::dateTime(); # current time
 
-        # XXX: start a transaction here
+        // XXX: start a transaction here
 
         if (!$this->delete_avatars() || !$avatar->insert()) {
             @unlink(Avatar::path($filename));
@@ -101,7 +101,7 @@ class Profile extends Memcached_DataObject
         }
 
         foreach (array(AVATAR_PROFILE_SIZE, AVATAR_STREAM_SIZE, AVATAR_MINI_SIZE) as $size) {
-            # We don't do a scaled one if original is our scaled size
+            // We don't do a scaled one if original is our scaled size
             if (!($avatar->width == $size && $avatar->height == $size)) {
                 $scaled_filename = $imagefile->resize($size);
 
@@ -198,90 +198,16 @@ class Profile extends Memcached_DataObject
 
     function getTaggedNotices($tag, $offset=0, $limit=NOTICES_PER_PAGE, $since_id=0, $max_id=0)
     {
-        $ids = Notice::stream(array($this, '_streamTaggedDirect'),
-                              array($tag),
-                              'profile:notice_ids_tagged:' . $this->id . ':' . $tag,
-                              $offset, $limit, $since_id, $max_id);
-        return Notice::getStreamByIds($ids);
+        $stream = new TaggedProfileNoticeStream($this, $tag);
+
+        return $stream->getNotices($offset, $limit, $since_id, $max_id);
     }
 
     function getNotices($offset=0, $limit=NOTICES_PER_PAGE, $since_id=0, $max_id=0)
     {
-        // XXX: I'm not sure this is going to be any faster. It probably isn't.
-        $ids = Notice::stream(array($this, '_streamDirect'),
-                              array(),
-                              'profile:notice_ids:' . $this->id,
-                              $offset, $limit, $since_id, $max_id);
+        $stream = new ProfileNoticeStream($this);
 
-        return Notice::getStreamByIds($ids);
-    }
-
-    function _streamTaggedDirect($tag, $offset, $limit, $since_id, $max_id)
-    {
-        // XXX It would be nice to do this without a join
-        // (necessary to do it efficiently on accounts with long history)
-
-        $notice = new Notice();
-
-        $query =
-          "select id from notice join notice_tag on id=notice_id where tag='".
-          $notice->escape($tag) .
-          "' and profile_id=" . intval($this->id);
-
-        $since = Notice::whereSinceId($since_id, 'id', 'notice.created');
-        if ($since) {
-            $query .= " and ($since)";
-        }
-
-        $max = Notice::whereMaxId($max_id, 'id', 'notice.created');
-        if ($max) {
-            $query .= " and ($max)";
-        }
-
-        $query .= ' order by notice.created DESC, id DESC';
-
-        if (!is_null($offset)) {
-            $query .= " LIMIT " . intval($limit) . " OFFSET " . intval($offset);
-        }
-
-        $notice->query($query);
-
-        $ids = array();
-
-        while ($notice->fetch()) {
-            $ids[] = $notice->id;
-        }
-
-        return $ids;
-    }
-
-    function _streamDirect($offset, $limit, $since_id, $max_id)
-    {
-        $notice = new Notice();
-
-        $notice->profile_id = $this->id;
-
-        $notice->selectAdd();
-        $notice->selectAdd('id');
-
-        Notice::addWhereSinceId($notice, $since_id);
-        Notice::addWhereMaxId($notice, $max_id);
-
-        $notice->orderBy('created DESC, id DESC');
-
-        if (!is_null($offset)) {
-            $notice->limit($offset, $limit);
-        }
-
-        $notice->find();
-
-        $ids = array();
-
-        while ($notice->fetch()) {
-            $ids[] = $notice->id;
-        }
-
-        return $ids;
+        return $stream->getNotices($offset, $limit, $since_id, $max_id);
     }
 
     function isMember($group)
@@ -313,6 +239,13 @@ class Profile extends Memcached_DataObject
         }
     }
 
+    function isPendingMember($group)
+    {
+        $request = Group_join_queue::pkeyGet(array('profile_id' => $this->id,
+                                                   'group_id' => $group->id));
+        return !empty($request);
+    }
+
     function getGroups($offset=0, $limit=null)
     {
         $qry =
@@ -339,6 +272,87 @@ class Profile extends Memcached_DataObject
         return $groups;
     }
 
+    /**
+     * Request to join the given group.
+     * May throw exceptions on failure.
+     *
+     * @param User_group $group
+     * @return mixed: Group_member on success, Group_join_queue if pending approval, null on some cancels?
+     */
+    function joinGroup(User_group $group)
+    {
+        $join = null;
+        if ($group->join_policy == User_group::JOIN_POLICY_MODERATE) {
+            $join = Group_join_queue::saveNew($this, $group);
+        } else {
+            if (Event::handle('StartJoinGroup', array($group, $this))) {
+                $join = Group_member::join($group->id, $this->id);
+                Event::handle('EndJoinGroup', array($group, $this));
+            }
+        }
+        if ($join) {
+            // Send any applicable notifications...
+            $join->notify();
+        }
+        return $join;
+    }
+
+    /**
+     * Cancel a pending group join...
+     *
+     * @param User_group $group
+     */
+    function cancelJoinGroup(User_group $group)
+    {
+        $request = Group_join_queue::pkeyGet(array('profile_id' => $this->id,
+                                                   'group_id' => $group->id));
+        if ($request) {
+            if (Event::handle('StartCancelJoinGroup', array($group, $this))) {
+                $request->delete();
+                Event::handle('EndCancelJoinGroup', array($group, $this));
+            }
+        }
+    }
+
+    /**
+     * Complete a pending group join on our end...
+     *
+     * @param User_group $group
+     */
+    function completeJoinGroup(User_group $group)
+    {
+        $join = null;
+        $request = Group_join_queue::pkeyGet(array('profile_id' => $this->id,
+                                                   'group_id' => $group->id));
+        if ($request) {
+            if (Event::handle('StartJoinGroup', array($group, $this))) {
+                $join = Group_member::join($group->id, $this->id);
+                $request->delete();
+                Event::handle('EndJoinGroup', array($group, $this));
+            }
+        } else {
+            // TRANS: Exception thrown trying to approve a non-existing group join request.
+            throw new Exception(_('Invalid group join approval: not pending.'));
+        }
+        if ($join) {
+            $join->notify();
+        }
+        return $join;
+    }
+
+    /**
+     * Leave a group that this profile is a member of.
+     *
+     * @param User_group $group
+     */
+    function leaveGroup(User_group $group)
+    {
+        if (Event::handle('StartLeaveGroup', array($group, $this))) {
+            Group_member::leave($group->id, $this->id);
+            Event::handle('EndLeaveGroup', array($group, $this));
+        }
+    }
+
     function avatarUrl($size=AVATAR_PROFILE_SIZE)
     {
         $avatar = $this->getAvatar($size);
@@ -465,7 +479,7 @@ class Profile extends Memcached_DataObject
             // This is the stream of favorite notices, in rev chron
             // order. This forces it into cache.
 
-            $ids = Fave::stream($this->id, 0, NOTICE_CACHE_WINDOW);
+            $ids = Fave::idStream($this->id, 0, CachingNoticeStream::CACHE_WINDOW);
 
             // If it's in the list, then it's a fave
 
@@ -477,7 +491,7 @@ class Profile extends Memcached_DataObject
             // then the cache has all available faves, so this one
             // is not a fave.
 
-            if (count($ids) < NOTICE_CACHE_WINDOW) {
+            if (count($ids) < CachingNoticeStream::CACHE_WINDOW) {
                 return false;
             }
 

classes/Profile_tag.php

@@ -25,7 +25,7 @@ class Profile_tag extends Memcached_DataObject
     static function getTags($tagger, $tagged) {
         $tags = array();
 
-        # XXX: store this in memcached
+        // XXX: store this in memcached
 
         $profile_tag = new Profile_tag();
         $profile_tag->tagger = $tagger;
@@ -46,11 +46,11 @@ class Profile_tag extends Memcached_DataObject
         $newtags = array_unique($newtags);
         $oldtags = Profile_tag::getTags($tagger, $tagged);
 
-        # Delete stuff that's old that not in new
+        // Delete stuff that's old that not in new
 
         $to_delete = array_diff($oldtags, $newtags);
 
-        # Insert stuff that's in new and not in old
+        // Insert stuff that's in new and not in old
 
         $to_insert = array_diff($newtags, $oldtags);
 
@@ -84,7 +84,7 @@ class Profile_tag extends Memcached_DataObject
         return true;
     }
 
-    # Return profiles with a given tag
+    // Return profiles with a given tag
     static function getTagged($tagger, $tag) {
         $profile = new Profile();
         $profile->query('SELECT profile.* ' .

classes/Queue_item.php

@@ -46,9 +46,9 @@ class Queue_item extends Memcached_DataObject
         $cnt = $qi->find(true);
 
         if ($cnt) {
-            # XXX: potential race condition
-            # can we force it to only update if claimed is still null
-            # (or old)?
+            // XXX: potential race condition
+            // can we force it to only update if claimed is still null
+            // (or old)?
             common_log(LOG_INFO, 'claiming queue item id = ' . $qi->id .
                 ' for transport ' . $qi->transport);
             $orig = clone($qi);

classes/Reply.php

@@ -38,35 +38,8 @@ class Reply extends Memcached_DataObject
 
     function stream($user_id, $offset=0, $limit=NOTICES_PER_PAGE, $since_id=0, $max_id=0)
     {
-        $ids = Notice::stream(array('Reply', '_streamDirect'),
-                              array($user_id),
-                              'reply:stream:' . $user_id,
-                              $offset, $limit, $since_id, $max_id);
-        return $ids;
-    }
+        $stream = new ReplyNoticeStream($user_id);
 
-    function _streamDirect($user_id, $offset=0, $limit=NOTICES_PER_PAGE, $since_id=0, $max_id=0)
-    {
-        $reply = new Reply();
-        $reply->profile_id = $user_id;
-
-        Notice::addWhereSinceId($reply, $since_id, 'notice_id', 'modified');
-        Notice::addWhereMaxId($reply, $max_id, 'notice_id', 'modified');
-
-        $reply->orderBy('modified DESC, notice_id DESC');
-
-        if (!is_null($offset)) {
-            $reply->limit($offset, $limit);
-        }
-
-        $ids = array();
-
-        if ($reply->find()) {
-            while ($reply->fetch()) {
-                $ids[] = $reply->notice_id;
-            }
-        }
-
-        return $ids;
+        return $stream->getNotices($offset, $limit, $since_id, $max_id);
     }
 }

classes/Subscription.php

@@ -146,9 +146,9 @@ class Subscription extends Memcached_DataObject
 
     function notify()
     {
-        # XXX: add other notifications (Jabber, SMS) here
-        # XXX: queue this and handle it offline
-        # XXX: Whatever happens, do it in Twitter-like API, too
+        // XXX: add other notifications (Jabber, SMS) here
+        // XXX: queue this and handle it offline
+        // XXX: Whatever happens, do it in Twitter-like API, too
 
         $this->notifyEmail();
     }

classes/User.php

@@ -68,6 +68,9 @@ class User extends Memcached_DataObject
     /* the code above is auto generated do not remove the tag below */
     ###END_AUTOCODE
 
+    /**
+     * @return Profile
+     */
     function getProfile()
     {
         $profile = Profile::staticGet('id', $this->id);
@@ -445,8 +448,7 @@ class User extends Memcached_DataObject
 
     function getReplies($offset=0, $limit=NOTICES_PER_PAGE, $since_id=0, $before_id=0)
     {
-        $ids = Reply::stream($this->id, $offset, $limit, $since_id, $before_id);
-        return Notice::getStreamByIds($ids);
+        return Reply::stream($this->id, $offset, $limit, $since_id, $before_id);
     }
 
     function getTaggedNotices($tag, $offset=0, $limit=NOTICES_PER_PAGE, $since_id=0, $before_id=0) {
@@ -462,8 +464,7 @@ class User extends Memcached_DataObject
 
     function favoriteNotices($own=false, $offset=0, $limit=NOTICES_PER_PAGE, $since_id=0, $max_id=0)
     {
-        $ids = Fave::stream($this->id, $offset, $limit, $own, $since_id, $max_id);
-        return Notice::getStreamByIds($ids);
+        return Fave::stream($this->id, $offset, $limit, $own, $since_id, $max_id);
     }
 
     function noticesWithFriends($offset=0, $limit=NOTICES_PER_PAGE, $since_id=0, $before_id=0)
@@ -596,6 +597,30 @@ class User extends Memcached_DataObject
         return $profile->getGroups($offset, $limit);
     }
 
+    /**
+     * Request to join the given group.
+     * May throw exceptions on failure.
+     *
+     * @param User_group $group
+     * @return Group_member
+     */
+    function joinGroup(User_group $group)
+    {
+        $profile = $this->getProfile();
+        return $profile->joinGroup($group);
+    }
+
+    /**
+     * Leave a group that this user is a member of.
+     *
+     * @param User_group $group
+     */
+    function leaveGroup(User_group $group)
+    {
+        $profile = $this->getProfile();
+        return $profile->leaveGroup($group);
+    }
+
     function getSubscriptions($offset=0, $limit=null)
     {
         $profile = $this->getProfile();
@@ -742,95 +767,18 @@ class User extends Memcached_DataObject
 
     function repeatedByMe($offset=0, $limit=20, $since_id=null, $max_id=null)
     {
-        $ids = Notice::stream(array($this, '_repeatedByMeDirect'),
-                              array(),
-                              'user:repeated_by_me:'.$this->id,
-                              $offset, $limit, $since_id, $max_id, null);
-
-        return Notice::getStreamByIds($ids);
+        $stream = new RepeatedByMeNoticeStream($this);
+        return $stream->getNotices($offset, $limit, $since_id, $max_id);
     }
 
-    function _repeatedByMeDirect($offset, $limit, $since_id, $max_id)
-    {
-        $notice = new Notice();
-
-        $notice->selectAdd(); // clears it
-        $notice->selectAdd('id');
-
-        $notice->profile_id = $this->id;
-        $notice->whereAdd('repeat_of IS NOT NULL');
-
-        $notice->orderBy('created DESC, id DESC');
-
-        if (!is_null($offset)) {
-            $notice->limit($offset, $limit);
-        }
-
-        Notice::addWhereSinceId($notice, $since_id);
-        Notice::addWhereMaxId($notice, $max_id);
-
-        $ids = array();
-
-        if ($notice->find()) {
-            while ($notice->fetch()) {
-                $ids[] = $notice->id;
-            }
-        }
-
-        $notice->free();
-        $notice = NULL;
-
-        return $ids;
-    }
 
     function repeatsOfMe($offset=0, $limit=20, $since_id=null, $max_id=null)
     {
-        $ids = Notice::stream(array($this, '_repeatsOfMeDirect'),
-                              array(),
-                              'user:repeats_of_me:'.$this->id,
-                              $offset, $limit, $since_id, $max_id);
+        $stream = new RepeatsOfMeNoticeStream($this);
 
-        return Notice::getStreamByIds($ids);
+        return $stream->getNotices($offset, $limit, $since_id, $max_id);
     }
 
-    function _repeatsOfMeDirect($offset, $limit, $since_id, $max_id)
-    {
-        $qry =
-          'SELECT DISTINCT original.id AS id ' .
-          'FROM notice original JOIN notice rept ON original.id = rept.repeat_of ' .
-          'WHERE original.profile_id = ' . $this->id . ' ';
-
-        $since = Notice::whereSinceId($since_id, 'original.id', 'original.created');
-        if ($since) {
-            $qry .= "AND ($since) ";
-        }
-
-        $max = Notice::whereMaxId($max_id, 'original.id', 'original.created');
-        if ($max) {
-            $qry .= "AND ($max) ";
-        }
-
-        $qry .= 'ORDER BY original.created, original.id DESC ';
-
-        if (!is_null($offset)) {
-            $qry .= "LIMIT $limit OFFSET $offset";
-        }
-
-        $ids = array();
-
-        $notice = new Notice();
-
-        $notice->query($qry);
-
-        while ($notice->fetch()) {
-            $ids[] = $notice->id;
-        }
-
-        $notice->free();
-        $notice = NULL;
-
-        return $ids;
-    }
 
     function repeatedToMe($offset=0, $limit=20, $since_id=null, $max_id=null)
     {

classes/User_group.php

@@ -5,6 +5,9 @@
 
 class User_group extends Memcached_DataObject
 {
+    const JOIN_POLICY_OPEN = 0;
+    const JOIN_POLICY_MODERATE = 1;
+
     ###START_AUTOCODE
     /* the code below is auto generated do not remove the above tag */
 
@@ -24,6 +27,7 @@ class User_group extends Memcached_DataObject
     public $modified;                        // timestamp   not_null default_CURRENT_TIMESTAMP
     public $uri;                             // varchar(255)  unique_key
     public $mainpage;                        // varchar(255)
+    public $join_policy;                     // tinyint
 
     /* Static get */
     function staticGet($k,$v=NULL) { return DB_DataObject::staticGet('User_group',$k,$v); }
@@ -83,42 +87,11 @@ class User_group extends Memcached_DataObject
 
     function getNotices($offset, $limit, $since_id=null, $max_id=null)
     {
-        $ids = Notice::stream(array($this, '_streamDirect'),
-                              array(),
-                              'user_group:notice_ids:' . $this->id,
-                              $offset, $limit, $since_id, $max_id);
+        $stream = new GroupNoticeStream($this);
 
-        return Notice::getStreamByIds($ids);
+        return $stream->getNotices($offset, $limit, $since_id, $max_id);
     }
 
-    function _streamDirect($offset, $limit, $since_id, $max_id)
-    {
-        $inbox = new Group_inbox();
-
-        $inbox->group_id = $this->id;
-
-        $inbox->selectAdd();
-        $inbox->selectAdd('notice_id');
-
-        Notice::addWhereSinceId($inbox, $since_id, 'notice_id');
-        Notice::addWhereMaxId($inbox, $max_id, 'notice_id');
-
-        $inbox->orderBy('created DESC, notice_id DESC');
-
-        if (!is_null($offset)) {
-            $inbox->limit($offset, $limit);
-        }
-
-        $ids = array();
-
-        if ($inbox->find()) {
-            while ($inbox->fetch()) {
-                $ids[] = $inbox->notice_id;
-            }
-        }
-
-        return $ids;
-    }
 
     function allowedNickname($nickname)
     {
@@ -149,6 +122,36 @@ class User_group extends Memcached_DataObject
         return $members;
     }
 
+    /**
+     * Get pending members, who have not yet been approved.
+     *
+     * @param int $offset
+     * @param int $limit
+     * @return Profile
+     */
+    function getRequests($offset=0, $limit=null)
+    {
+        $qry =
+          'SELECT profile.* ' .
+          'FROM profile JOIN group_join_queue '.
+          'ON profile.id = group_join_queue.profile_id ' .
+          'WHERE group_join_queue.group_id = %d ' .
+          'ORDER BY group_join_queue.created DESC ';
+
+        if ($limit != null) {
+            if (common_config('db','type') == 'pgsql') {
+                $qry .= ' LIMIT ' . $limit . ' OFFSET ' . $offset;
+            } else {
+                $qry .= ' LIMIT ' . $offset . ', ' . $limit;
+            }
+        }
+
+        $members = new Profile();
+
+        $members->query(sprintf($qry, $this->id));
+        return $members;
+    }
+
     function getMemberCount()
     {
         // XXX: WORM cache this
@@ -272,11 +275,11 @@ class User_group extends Memcached_DataObject
 
         $oldaliases = $this->getAliases();
 
-        # Delete stuff that's old that not in new
+        // Delete stuff that's old that not in new
 
         $to_delete = array_diff($oldaliases, $newaliases);
 
-        # Insert stuff that's in new and not in old
+        // Insert stuff that's in new and not in old
 
         $to_insert = array_diff($newaliases, $oldaliases);
 
@@ -511,6 +514,11 @@ class User_group extends Memcached_DataObject
         $group->uri         = $uri;
         $group->mainpage    = $mainpage;
         $group->created     = common_sql_now();
+        if (isset($fields['join_policy'])) {
+            $group->join_policy = intval($fields['join_policy']);
+        } else {
+            $group->join_policy = 0;
+        }
 
         if (Event::handle('StartGroupSave', array(&$group))) {
 

classes/statusnet.ini

@@ -621,6 +621,7 @@ created = 142
 modified = 384
 uri = 2
 mainpage = 2
+join_policy = 1
 
 [user_group__keys]
 id = N

db/core.php

@@ -649,6 +649,7 @@ $schema['user_group'] = array(
 
         'uri' => array('type' => 'varchar', 'length' => 255, 'description' => 'universal identifier'),
         'mainpage' => array('type' => 'varchar', 'length' => 255, 'description' => 'page for group info to link to'),
+        'join_policy' => array('type' => 'int', 'size' => 'tiny', 'description' => '0=open; 1=requires admin approval'),
     ),
     'primary key' => array('id'),
     'unique keys' => array(
@@ -1025,3 +1026,5 @@ $schema['schema_version'] = array(
     ),
     'primary key' => array('table_name'),
 );
+
+$schema['group_join_queue'] = Group_join_queue::schemaDef();

extlib/Console/Getopt.php

@@ -1,32 +1,40 @@
 <?php
 /* vim: set expandtab tabstop=4 shiftwidth=4: */
-// +----------------------------------------------------------------------+
-// | PHP Version 5                                                        |
-// +----------------------------------------------------------------------+
-// | Copyright (c) 1997-2004 The PHP Group                                |
-// +----------------------------------------------------------------------+
-// | This source file is subject to version 3.0 of the PHP license,       |
-// | that is bundled with this package in the file LICENSE, and is        |
-// | available through the world-wide-web at the following url:           |
-// | http://www.php.net/license/3_0.txt.                                  |
-// | If you did not receive a copy of the PHP license and are unable to   |
-// | obtain it through the world-wide-web, please send a note to          |
-// | license@php.net so we can mail you a copy immediately.               |
-// +----------------------------------------------------------------------+
-// | Author: Andrei Zmievski <andrei@php.net>                             |
-// +----------------------------------------------------------------------+
-//
-// $Id: Getopt.php,v 1.4 2007/06/12 14:58:56 cellog Exp $
+/**
+ * PHP Version 5
+ *
+ * Copyright (c) 1997-2004 The PHP Group
+ *
+ * This source file is subject to version 3.0 of the PHP license,
+ * that is bundled with this package in the file LICENSE, and is
+ * available through the world-wide-web at the following url:
+ * http://www.php.net/license/3_0.txt.
+ * If you did not receive a copy of the PHP license and are unable to
+ * obtain it through the world-wide-web, please send a note to
+ * license@php.net so we can mail you a copy immediately.
+ *
+ * @category Console
+ * @package  Console_Getopt
+ * @author   Andrei Zmievski <andrei@php.net>
+ * @license  http://www.php.net/license/3_0.txt PHP 3.0
+ * @version  CVS: $Id: Getopt.php 306067 2010-12-08 00:13:31Z dufuz $
+ * @link     http://pear.php.net/package/Console_Getopt
+ */
 
 require_once 'PEAR.php';
 
 /**
  * Command-line options parsing class.
  *
+ * @category Console
+ * @package  Console_Getopt
  * @author   Andrei Zmievski <andrei@php.net>
- *
+ * @license  http://www.php.net/license/3_0.txt PHP 3.0
+ * @link     http://pear.php.net/package/Console_Getopt
  */
-class Console_Getopt {
+class Console_Getopt
+{
+
     /**
      * Parses the command-line options.
      *
@@ -56,42 +64,57 @@ class Console_Getopt {
      * @param array  $args          an array of command-line arguments
      * @param string $short_options specifies the list of allowed short options
      * @param array  $long_options  specifies the list of allowed long options
+     * @param boolean $skip_unknown suppresses Console_Getopt: unrecognized option
      *
      * @return array two-element array containing the list of parsed options and
      * the non-option arguments
-     *
      * @access public
-     *
      */
-    function getopt2($args, $short_options, $long_options = null)
+    function getopt2($args, $short_options, $long_options = null, $skip_unknown = false)
     {
-        return Console_Getopt::doGetopt(2, $args, $short_options, $long_options);
+        return Console_Getopt::doGetopt(2, $args, $short_options, $long_options, $skip_unknown);
     }
 
     /**
      * This function expects $args to start with the script name (POSIX-style).
      * Preserved for backwards compatibility.
+     *
+     * @param array  $args          an array of command-line arguments
+     * @param string $short_options specifies the list of allowed short options
+     * @param array  $long_options  specifies the list of allowed long options
+     *
      * @see getopt2()
+     * @return array two-element array containing the list of parsed options and
+     * the non-option arguments
      */
-    function getopt($args, $short_options, $long_options = null)
+    function getopt($args, $short_options, $long_options = null, $skip_unknown = false)
     {
-        return Console_Getopt::doGetopt(1, $args, $short_options, $long_options);
+        return Console_Getopt::doGetopt(1, $args, $short_options, $long_options, $skip_unknown);
     }
 
     /**
      * The actual implementation of the argument parsing code.
+     *
+     * @param int    $version       Version to use
+     * @param array  $args          an array of command-line arguments
+     * @param string $short_options specifies the list of allowed short options
+     * @param array  $long_options  specifies the list of allowed long options
+     * @param boolean $skip_unknown suppresses Console_Getopt: unrecognized option
+     *
+     * @return array
      */
-    function doGetopt($version, $args, $short_options, $long_options = null)
+    function doGetopt($version, $args, $short_options, $long_options = null, $skip_unknown = false)
     {
         // in case you pass directly readPHPArgv() as the first arg
         if (PEAR::isError($args)) {
             return $args;
         }
+
         if (empty($args)) {
             return array(array(), array());
         }
-        $opts     = array();
-        $non_opts = array();
+
+        $non_opts = $opts = array();
 
         settype($args, 'array');
 
@@ -111,7 +134,6 @@ class Console_Getopt {
 
         reset($args);
         while (list($i, $arg) = each($args)) {
-
             /* The special element '--' means explicit end of
                options. Treat the rest of the arguments as non-options
                and end the loop. */
@@ -124,37 +146,59 @@ class Console_Getopt {
                 $non_opts = array_merge($non_opts, array_slice($args, $i));
                 break;
             } elseif (strlen($arg) > 1 && $arg{1} == '-') {
-                $error = Console_Getopt::_parseLongOption(substr($arg, 2), $long_options, $opts, $args);
-                if (PEAR::isError($error))
+                $error = Console_Getopt::_parseLongOption(substr($arg, 2),
+                                                          $long_options,
+                                                          $opts,
+                                                          $args,
+                                                          $skip_unknown);
+                if (PEAR::isError($error)) {
                     return $error;
+                }
             } elseif ($arg == '-') {
                 // - is stdin
                 $non_opts = array_merge($non_opts, array_slice($args, $i));
                 break;
             } else {
-                $error = Console_Getopt::_parseShortOption(substr($arg, 1), $short_options, $opts, $args);
-                if (PEAR::isError($error))
+                $error = Console_Getopt::_parseShortOption(substr($arg, 1),
+                                                           $short_options,
+                                                           $opts,
+                                                           $args,
+                                                           $skip_unknown);
+                if (PEAR::isError($error)) {
                     return $error;
                 }
             }
+        }
 
         return array($opts, $non_opts);
     }
 
     /**
-     * @access private
+     * Parse short option
      *
+     * @param string     $arg           Argument
+     * @param string[]   $short_options Available short options
+     * @param string[][] &$opts
+     * @param string[]   &$args
+     * @param boolean    $skip_unknown suppresses Console_Getopt: unrecognized option
+     *
+     * @access private
+     * @return void
      */
-    function _parseShortOption($arg, $short_options, &$opts, &$args)
+    function _parseShortOption($arg, $short_options, &$opts, &$args, $skip_unknown)
     {
         for ($i = 0; $i < strlen($arg); $i++) {
             $opt     = $arg{$i};
             $opt_arg = null;
 
             /* Try to find the short option in the specifier string. */
-            if (($spec = strstr($short_options, $opt)) === false || $arg{$i} == ':')
-            {
-                return PEAR::raiseError("Console_Getopt: unrecognized option -- $opt");
+            if (($spec = strstr($short_options, $opt)) === false || $arg{$i} == ':') {
+                if ($skip_unknown === true) {
+                    break;
+                }
+
+                $msg = "Console_Getopt: unrecognized option -- $opt";
+                return PEAR::raiseError($msg);
             }
 
             if (strlen($spec) > 1 && $spec{1} == ':') {
@@ -173,11 +217,14 @@ class Console_Getopt {
                         break;
                     } else if (list(, $opt_arg) = each($args)) {
                         /* Else use the next argument. */;
-                        if (Console_Getopt::_isShortOpt($opt_arg) || Console_Getopt::_isLongOpt($opt_arg)) {
-                            return PEAR::raiseError("Console_Getopt: option requires an argument -- $opt");
+                        if (Console_Getopt::_isShortOpt($opt_arg)
+                            || Console_Getopt::_isLongOpt($opt_arg)) {
+                            $msg = "option requires an argument --$opt";
+                            return PEAR::raiseError("Console_Getopt:" . $msg);
                         }
                     } else {
-                        return PEAR::raiseError("Console_Getopt: option requires an argument -- $opt");
+                        $msg = "option requires an argument --$opt";
+                        return PEAR::raiseError("Console_Getopt:" . $msg);
                     }
                 }
             }
@@ -187,17 +234,26 @@ class Console_Getopt {
     }
 
     /**
-     * @access private
+     * Checks if an argument is a short option
      *
+     * @param string $arg Argument to check
+     *
+     * @access private
+     * @return bool
      */
     function _isShortOpt($arg)
     {
-        return strlen($arg) == 2 && $arg[0] == '-' && preg_match('/[a-zA-Z]/', $arg[1]);
+        return strlen($arg) == 2 && $arg[0] == '-'
+               && preg_match('/[a-zA-Z]/', $arg[1]);
     }
 
     /**
-     * @access private
+     * Checks if an argument is a long option
      *
+     * @param string $arg Argument to check
+     *
+     * @access private
+     * @return bool
      */
     function _isLongOpt($arg)
     {
@@ -206,17 +262,26 @@ class Console_Getopt {
     }
 
     /**
-     * @access private
+     * Parse long option
      *
+     * @param string     $arg          Argument
+     * @param string[]   $long_options Available long options
+     * @param string[][] &$opts
+     * @param string[]   &$args
+     *
+     * @access private
+     * @return void|PEAR_Error
      */
-    function _parseLongOption($arg, $long_options, &$opts, &$args)
+    function _parseLongOption($arg, $long_options, &$opts, &$args, $skip_unknown)
     {
         @list($opt, $opt_arg) = explode('=', $arg, 2);
+
         $opt_len = strlen($opt);
 
         for ($i = 0; $i < count($long_options); $i++) {
             $long_opt  = $long_options[$i];
             $opt_start = substr($long_opt, 0, $opt_len);
+
             $long_opt_name = str_replace('=', '', $long_opt);
 
             /* Option doesn't match. Go on to the next one. */
@@ -233,12 +298,15 @@ class Console_Getopt {
             } else {
                 $next_option_rest = '';
             }
+
             if ($opt_rest != '' && $opt{0} != '=' &&
                 $i + 1 < count($long_options) &&
                 $opt == substr($long_options[$i+1], 0, $opt_len) &&
                 $next_option_rest != '' &&
                 $next_option_rest{0} != '=') {
-                return PEAR::raiseError("Console_Getopt: option --$opt is ambiguous");
+
+                $msg = "Console_Getopt: option --$opt is ambiguous";
+                return PEAR::raiseError($msg);
             }
 
             if (substr($long_opt, -1) == '=') {
@@ -246,20 +314,29 @@ class Console_Getopt {
                     /* Long option requires an argument.
                        Take the next argument if one wasn't specified. */;
                     if (!strlen($opt_arg) && !(list(, $opt_arg) = each($args))) {
-                        return PEAR::raiseError("Console_Getopt: option --$opt requires an argument");
+                        $msg = "Console_Getopt: option requires an argument --$opt";
+                        return PEAR::raiseError($msg);
                     }
-                    if (Console_Getopt::_isShortOpt($opt_arg) || Console_Getopt::_isLongOpt($opt_arg)) {
-                        return PEAR::raiseError("Console_Getopt: option requires an argument --$opt");
+
+                    if (Console_Getopt::_isShortOpt($opt_arg)
+                        || Console_Getopt::_isLongOpt($opt_arg)) {
+                        $msg = "Console_Getopt: option requires an argument --$opt";
+                        return PEAR::raiseError($msg);
                     }
                 }
             } else if ($opt_arg) {
-                return PEAR::raiseError("Console_Getopt: option --$opt doesn't allow an argument");
+                $msg = "Console_Getopt: option --$opt doesn't allow an argument";
+                return PEAR::raiseError($msg);
             }
 
             $opts[] = array('--' . $opt, $opt_arg);
             return;
         }
 
+        if ($skip_unknown === true) {
+            return;
+        }
+
         return PEAR::raiseError("Console_Getopt: unrecognized option --$opt");
     }
 
@@ -276,7 +353,8 @@ class Console_Getopt {
         if (!is_array($argv)) {
             if (!@is_array($_SERVER['argv'])) {
                 if (!@is_array($GLOBALS['HTTP_SERVER_VARS']['argv'])) {
-                    return PEAR::raiseError("Console_Getopt: Could not read cmd args (register_argc_argv=Off?)");
+                    $msg = "Could not read cmd args (register_argc_argv=Off?)";
+                    return PEAR::raiseError("Console_Getopt: " . $msg);
                 }
                 return $GLOBALS['HTTP_SERVER_VARS']['argv'];
             }
@@ -286,5 +364,3 @@ class Console_Getopt {
     }
 
 }
-
-?>

extlib/DB/DataObject.php

@@ -15,7 +15,7 @@
  * @author     Alan Knowles <alan@akbkhome.com>
  * @copyright  1997-2006 The PHP Group
  * @license    http://www.php.net/license/3_01.txt  PHP License 3.01
- * @version    CVS: $Id: DataObject.php 291349 2009-11-27 09:15:18Z alan_k $
+ * @version    CVS: $Id: DataObject.php 301030 2010-07-07 02:26:31Z alan_k $
  * @link       http://pear.php.net/package/DB_DataObject
  */
   
@@ -235,7 +235,7 @@ class DB_DataObject extends DB_DataObject_Overload
     * @access   private
     * @var      string
     */
-    var $_DB_DataObject_version = "1.9.0";
+    var $_DB_DataObject_version = "1.9.5";
 
     /**
      * The Database table (used by table extends)
@@ -369,6 +369,32 @@ class DB_DataObject extends DB_DataObject_Overload
         return $_DB_DATAOBJECT['CACHE'][$lclass][$key];
     }
 
+    /**
+     * build the basic select query.
+     * 
+     * @access private
+     */
+    
+    function _build_select()
+    {
+        global $_DB_DATAOBJECT;
+        $quoteIdentifiers = !empty($_DB_DATAOBJECT['CONFIG']['quote_identifiers']);
+        if ($quoteIdentifiers) {
+            $this->_connect();
+            $DB = &$_DB_DATAOBJECT['CONNECTIONS'][$this->_database_dsn_md5];
+        }
+        $sql = 'SELECT ' .
+            $this->_query['data_select'] . " \n" .
+            ' FROM ' . ($quoteIdentifiers ? $DB->quoteIdentifier($this->__table) : $this->__table) . " \n" .
+            $this->_join . " \n" .
+            $this->_query['condition'] . " \n" .
+            $this->_query['group_by'] . " \n" .
+            $this->_query['having'] . " \n";
+                 
+        return $sql;
+    }
+
+     
     /**
      * find results, either normal or crosstable
      *
@@ -411,20 +437,21 @@ class DB_DataObject extends DB_DataObject_Overload
         $query_before = $this->_query;
         $this->_build_condition($this->table()) ;
         
-        $quoteIdentifiers = !empty($_DB_DATAOBJECT['CONFIG']['quote_identifiers']);
+       
         $this->_connect();
         $DB = &$_DB_DATAOBJECT['CONNECTIONS'][$this->_database_dsn_md5];
        
-        /* We are checking for method modifyLimitQuery as it is PEAR DB specific */
-        $sql = 'SELECT ' .
-            $this->_query['data_select'] . " \n" .
-            ' FROM ' . ($quoteIdentifiers ? $DB->quoteIdentifier($this->__table) : $this->__table) . " \n" .
-            $this->_join . " \n" .
-            $this->_query['condition'] . " \n" .
-            $this->_query['group_by']  . " \n" .
-            $this->_query['having']    . " \n" .
-            $this->_query['order_by']  . " \n";
         
+        $sql = $this->_build_select();
+        
+        foreach ($this->_query['unions'] as $union_ar) {  
+            $sql .=   $union_ar[1] .   $union_ar[0]->_build_select() . " \n";
+        }
+        
+        $sql .=  $this->_query['order_by']  . " \n";
+        
+        
+        /* We are checking for method modifyLimitQuery as it is PEAR DB specific */
         if ((!isset($_DB_DATAOBJECT['CONFIG']['db_driver'])) || 
             ($_DB_DATAOBJECT['CONFIG']['db_driver'] == 'DB')) {
             /* PEAR DB specific */
@@ -578,6 +605,85 @@ class DB_DataObject extends DB_DataObject_Overload
         return true;
     }
 
+    
+     /**
+     * fetches all results as an array,
+     *
+     * return format is dependant on args.
+     * if selectAdd() has not been called on the object, then it will add the correct columns to the query.
+     * 
+     * A) Array of values (eg. a list of 'id')
+     *
+     * $x = DB_DataObject::factory('mytable');
+     * $x->whereAdd('something = 1')
+     * $ar = $x->fetchAll('id');
+     * -- returns array(1,2,3,4,5)
+     *
+     * B) Array of values (not from table)
+     *
+     * $x = DB_DataObject::factory('mytable');
+     * $x->whereAdd('something = 1');
+     * $x->selectAdd();
+     * $x->selectAdd('distinct(group_id) as group_id');
+     * $ar = $x->fetchAll('group_id');
+     * -- returns array(1,2,3,4,5)
+     *     *
+     * C) A key=>value associative array
+     *
+     * $x = DB_DataObject::factory('mytable');
+     * $x->whereAdd('something = 1')
+     * $ar = $x->fetchAll('id','name');
+     * -- returns array(1=>'fred',2=>'blogs',3=> .......
+     *
+     * D) array of objects
+     * $x = DB_DataObject::factory('mytable');
+     * $x->whereAdd('something = 1');
+     * $ar = $x->fetchAll();
+     *
+     * E) array of arrays (for example)
+     * $x = DB_DataObject::factory('mytable');
+     * $x->whereAdd('something = 1');
+     * $ar = $x->fetchAll(false,false,'toArray');
+     *
+     *
+     * @param    string|false  $k key
+     * @param    string|false  $v value
+     * @param    string|false  $method method to call on each result to get array value (eg. 'toArray')
+     * @access  public
+     * @return  array  format dependant on arguments, may be empty
+     */
+    function fetchAll($k= false, $v = false, $method = false)  
+    {
+        // should it even do this!!!?!?
+        if ($k !== false && 
+                (   // only do this is we have not been explicit..
+                    empty($this->_query['data_select']) || 
+                    ($this->_query['data_select'] == '*')
+                )
+            ) {
+            $this->selectAdd();
+            $this->selectAdd($k);
+            if ($v !== false) {
+                $this->selectAdd($v);
+            }
+        }
+        
+        $this->find();
+        $ret = array();
+        while ($this->fetch()) {
+            if ($v !== false) {
+                $ret[$this->$k] = $this->$v;
+                continue;
+            }
+            $ret[] = $k === false ? 
+                ($method == false ? clone($this)  : $this->$method())
+                : $this->$k;
+        }
+        return $ret;
+         
+    }
+    
+    
     /**
      * Adds a condition to the WHERE statement, defaults to AND
      *
@@ -622,6 +728,47 @@ class DB_DataObject extends DB_DataObject_Overload
         return $r;
     }
 
+    /**
+    * Adds a 'IN' condition to the WHERE statement
+    *
+    * $object->whereAddIn('id', $array, 'int'); //minimal usage
+    * $object->whereAddIn('price', $array, 'float', 'OR');  // cast to float, and call whereAdd with 'OR'
+    * $object->whereAddIn('name', $array, 'string');  // quote strings
+    *
+    * @param    string  $key  key column to match
+    * @param    array  $list  list of values to match
+    * @param    string  $type  string|int|integer|float|bool  cast to type. 
+    * @param    string  $logic optional logic to call whereAdd with eg. "OR" (defaults to "AND")
+    * @access   public
+    * @return   string|PEAR::Error - previous condition or Error when invalid args found
+    */
+    function whereAddIn($key, $list, $type, $logic = 'AND') 
+    {
+        $not = '';
+        if ($key[0] == '!') {
+            $not = 'NOT ';
+            $key = substr($key, 1);
+        }
+        // fix type for short entry. 
+        $type = $type == 'int' ? 'integer' : $type; 
+
+        if ($type == 'string') {
+            $this->_connect();
+        }
+
+        $ar = array();
+        foreach($list as $k) {
+            settype($k, $type);
+            $ar[] = $type =='string' ? $this->_quote($k) : $k;
+        }
+        if (!$ar) {
+            return $not ? $this->_query['condition'] : $this->whereAdd("1=0");
+        }
+        return $this->whereAdd("$key $not IN (". implode(',', $ar). ')', $logic );    
+    }
+
+    
+    
     /**
      * Adds a order by condition
      *
@@ -1175,7 +1322,7 @@ class DB_DataObject extends DB_DataObject_Overload
         $seq    = $this->sequenceKey();
         if ($seq[0] !== false) {
             $keys = array($seq[0]);
-            if (empty($this->{$keys[0]}) && $dataObject !== true) {
+            if (!isset($this->{$keys[0]}) && $dataObject !== true) {
                 $this->raiseError("update: trying to perform an update without 
                         the key set, and argument to update is not 
                         DB_DATAOBJECT_WHEREADD_ONLY
@@ -1670,6 +1817,7 @@ class DB_DataObject extends DB_DataObject_Overload
         'limit_start' => '', // the LIMIT condition
         'limit_count' => '', // the LIMIT condition
         'data_select' => '*', // the columns to be SELECTed
+        'unions'      => array(), // the added unions
     );
         
     
@@ -2032,9 +2180,9 @@ class DB_DataObject extends DB_DataObject_Overload
         $seqname = false;
         
         if (!empty($_DB_DATAOBJECT['CONFIG']['sequence_'.$this->__table])) {
-            $usekey = $_DB_DATAOBJECT['CONFIG']['sequence_'.$this->__table];
-            if (strpos($usekey,':') !== false) {
-                list($usekey,$seqname) = explode(':',$usekey);
+            $seqname = $_DB_DATAOBJECT['CONFIG']['sequence_'.$this->__table];
+            if (strpos($seqname,':') !== false) {
+                list($usekey,$seqname) = explode(':',$seqname);
             }
         }  
         
@@ -3068,9 +3216,9 @@ class DB_DataObject extends DB_DataObject_Overload
     }
 
     /**
-     * IS THIS SUPPORTED/USED ANYMORE???? 
-     *return a list of options for a linked table
-     *
+     * getLinkArray
+     * Fetch an array of related objects. This should be used in conjunction with a <dbname>.links.ini file configuration (see the introduction on linking for details on this).
+     * You may also use this with all parameters to specify, the column and related table.
      * This is highly dependant on naming columns 'correctly' :)
      * using colname = xxxxx_yyyyyy
      * xxxxxx = related table; (yyyyy = user defined..)
@@ -3078,7 +3226,21 @@ class DB_DataObject extends DB_DataObject_Overload
      * stores it in $this->_xxxxx_yyyyy
      *
      * @access public
-     * @return array of results (empty array on failure)
+     * @param string $column - either column or column.xxxxx
+     * @param string $table - name of table to look up value in
+     * @return array - array of results (empty array on failure)
+     * 
+     * Example - Getting the related objects
+     * 
+     * $person = new DataObjects_Person;
+     * $person->get(12);
+     * $children = $person->getLinkArray('children');
+     * 
+     * echo 'There are ', count($children), ' descendant(s):<br />';
+     * foreach ($children as $child) {
+     *     echo $child->name, '<br />';
+     * }
+     * 
      */
     function &getLinkArray($row, $table = null)
     {
@@ -3123,6 +3285,46 @@ class DB_DataObject extends DB_DataObject_Overload
         return $ret;
     }
 
+     /**
+     * unionAdd - adds another dataobject to this, building a unioned query.
+     *
+     * usage:  
+     * $doTable1 = DB_DataObject::factory("table1");
+     * $doTable2 = DB_DataObject::factory("table2");
+     * 
+     * $doTable1->selectAdd();
+     * $doTable1->selectAdd("col1,col2");
+     * $doTable1->whereAdd("col1 > 100");
+     * $doTable1->orderBy("col1");
+     *
+     * $doTable2->selectAdd();
+     * $doTable2->selectAdd("col1, col2");
+     * $doTable2->whereAdd("col2 = 'v'");
+     * 
+     * $doTable1->unionAdd($doTable2);
+     * $doTable1->find();
+      * 
+     * Note: this model may be a better way to implement joinAdd?, eg. do the building in find?
+     * 
+     * 
+     * @param             $obj       object|false the union object or false to reset
+     * @param    optional $is_all    string 'ALL' to do all.
+     * @returns           $obj       object|array the added object, or old list if reset.
+     */
+    
+    function unionAdd($obj,$is_all= '')
+    {
+        if ($obj === false) {
+            $ret = $this->_query['unions'];
+            $this->_query['unions'] = array();
+            return $ret;
+        }
+        $this->_query['unions'][] = array($obj, 'UNION ' . $is_all . ' ') ;
+        return $obj;
+    }
+
+    
+    
     /**
      * The JOIN condition
      *
@@ -3248,7 +3450,19 @@ class DB_DataObject extends DB_DataObject_Overload
         /* otherwise see if there are any links from this table to the obj. */
         //print_r($this->links());
         if (($ofield === false) && ($links = $this->links())) {
-            foreach ($links as $k => $v) {
+            // this enables for support for arrays of links in ini file.
+            // link contains this_column[] =  linked_table:linked_column
+            // or standard way.
+            // link contains this_column =  linked_table:linked_column
+            foreach ($links as $k => $linkVar) {
+            
+                if (!is_array($linkVar)) {
+                    $linkVar  = array($linkVar);
+                }
+                foreach($linkVar as $v) {
+
+                    
+                    
                     /* link contains {this column} = {linked table}:{linked column} */
                     $ar = explode(':', $v);
                     // Feature Request #4266 - Allow joins with multiple keys
@@ -3259,20 +3473,23 @@ class DB_DataObject extends DB_DataObject_Overload
                         $ar[1] = explode(',', $ar[1]);
                     }
 
-                if ($ar[0] == $obj->__table) {
-                    if ($joinCol !== false) {
-                        if ($k == $joinCol) {
-                            $tfield = $k;
-                            $ofield = $ar[1];
-                            break;
-                        } else {
+                    if ($ar[0] != $obj->__table) {
                         continue;
                     }
-                    } else {
+                    if ($joinCol !== false) {
+                        if ($k == $joinCol) {
+                            // got it!?
                             $tfield = $k;
                             $ofield = $ar[1];
                             break;
                         } 
+                        continue;
+                        
+                    } 
+                    $tfield = $k;
+                    $ofield = $ar[1];
+                    break;
+                        
                 }
             }
         }
@@ -3280,12 +3497,17 @@ class DB_DataObject extends DB_DataObject_Overload
         //print_r($obj->links());
         if (!$ofield && ($olinks = $obj->links())) {
             
-            foreach ($olinks as $k => $v) {
+            foreach ($olinks as $k => $linkVar) {
+                /* link contains {this column} = array ( {linked table}:{linked column} )*/
+                if (!is_array($linkVar)) {
+                    $linkVar  = array($linkVar);
+                }
+                foreach($linkVar as $v) {
+                    
                     /* link contains {this column} = {linked table}:{linked column} */
                     $ar = explode(':', $v);
                     
                     // Feature Request #4266 - Allow joins with multiple keys
-                
                     $links_key_array = strpos($k,',');
                     if ($links_key_array !== false) {
                         $k = explode(',', $k);
@@ -3296,7 +3518,9 @@ class DB_DataObject extends DB_DataObject_Overload
                         $ar[1] = explode(',', $ar[1]);
                     }
                  
-                if ($ar[0] == $this->__table) {
+                    if ($ar[0] != $this->__table) {
+                        continue;
+                    }
                     
                     // you have explictly specified the column
                     // and the col is listed here..
@@ -3315,6 +3539,7 @@ class DB_DataObject extends DB_DataObject_Overload
                     $ofield = $k;
                     $tfield = $ar[1];
                     break;
+                    
                 }
             }
         }
@@ -3573,7 +3798,14 @@ class DB_DataObject extends DB_DataObject_Overload
             if (!$k) {
                 continue; // ignore empty keys!!! what
             }
-            if (is_object($from) && isset($from->{sprintf($format,$k)})) {
+            
+            $chk = is_object($from) &&  
+                (version_compare(phpversion(), "5.1.0" , ">=") ? 
+                    property_exists($from, sprintf($format,$k)) :  // php5.1
+                    array_key_exists( sprintf($format,$k), get_class_vars($from)) //older
+                );
+            // if from has property ($format($k)      
+            if ($chk) {
                 $kk = (strtolower($k) == 'from') ? '_from' : $k;
                 if (method_exists($this,'set'.$kk)) {
                     $ret = $this->{'set'.$kk}($from->{sprintf($format,$k)});

extlib/DB/DataObject/Generator.php

@@ -15,7 +15,7 @@
  * @author     Alan Knowles <alan@akbkhome.com>
  * @copyright  1997-2006 The PHP Group
  * @license    http://www.php.net/license/3_01.txt  PHP License 3.01
- * @version    CVS: $Id: Generator.php 289384 2009-10-09 00:17:26Z alan_k $
+ * @version    CVS: $Id: Generator.php 298560 2010-04-25 23:01:51Z alan_k $
  * @link       http://pear.php.net/package/DB_DataObject
  */
  
@@ -383,8 +383,8 @@ class DB_DataObject_Generator extends DB_DataObject
             return false;
         }
         $__DB = &$GLOBALS['_DB_DATAOBJECT']['CONNECTIONS'][$this->_database_dsn_md5];
-        if (!in_array($__DB->phptype, array('mysql','mysqli'))) {
-            echo "WARNING: cant handle non-mysql introspection for defaults.";
+        if (!in_array($__DB->phptype, array('mysql', 'mysqli', 'pgsql'))) {
+            echo "WARNING: cant handle non-mysql and pgsql introspection for defaults.";
             return; // cant handle non-mysql introspection for defaults.
         }
 
@@ -392,6 +392,44 @@ class DB_DataObject_Generator extends DB_DataObject
 
         $fk = array();
 
+
+        switch ($DB->phptype) {
+
+
+            case 'pgsql':
+                foreach($this->tables as $this->table) {
+                    $quotedTable = !empty($options['quote_identifiers_tableinfo']) ?  $DB->quoteIdentifier($table)  : $this->table;
+                    $res =& $DB->query("SELECT
+                                pg_catalog.pg_get_constraintdef(r.oid, true) AS condef
+                            FROM pg_catalog.pg_constraint r,
+                                 pg_catalog.pg_class c
+                            WHERE c.oid=r.conrelid
+                                  AND r.contype = 'f'
+                                  AND c.relname = '" . $quotedTable . "'");
+                    if (PEAR::isError($res)) {
+                        die($res->getMessage());
+                    }
+
+                    while ($row = $res->fetchRow(DB_FETCHMODE_ASSOC)) {
+                        $treffer = array();
+                        // this only picks up one of these.. see this for why: http://pear.php.net/bugs/bug.php?id=17049
+                        preg_match(
+                            "/FOREIGN KEY \((\w*)\) REFERENCES (\w*)\((\w*)\)/i",
+                            $row['condef'],
+                            $treffer);
+                        if (!count($treffer)) {
+                            continue;
+                        }
+                        $fk[$this->table][$treffer[1]] = $treffer[2] . ":" . $treffer[3];
+                    }
+                }
+                break;
+ 
+ 
+            case 'mysql':
+            case 'mysqli':
+            default: 
+
                 foreach($this->tables as $this->table) {
                     $quotedTable = !empty($options['quote_identifiers_tableinfo']) ?  $DB->quoteIdentifier($table)  : $this->table;
                     
@@ -410,15 +448,16 @@ class DB_DataObject_Generator extends DB_DataObject
                         $treffer, 
                         PREG_SET_ORDER);
 
-            if (count($treffer) < 1) {
+                    if (!count($treffer)) {
                         continue;
                     }
-            for ($i = 0; $i < count($treffer); $i++) {
-                $fk[$this->table][$treffer[$i][1]] = $treffer[$i][2] . ":" . $treffer[$i][3];
+                    foreach($treffer as $i=> $tref) {
+                        $fk[$this->table][$tref[1]] = $tref[2] . ":" . $tref[3];
                     }
                     
                 }
 
+        }
         $links_ini = "";
 
         foreach($fk as $table => $details) {
@@ -861,10 +900,8 @@ class DB_DataObject_Generator extends DB_DataObject
         $body =  "\n    ###START_AUTOCODE\n";
         $body .= "    /* the code below is auto generated do not remove the above tag */\n\n";
         // table
-        $padding = (30 - strlen($this->table));
-        $padding  = ($padding < 2) ? 2 : $padding;
 
-        $p =  str_repeat(' ',$padding) ;
+        $p = str_repeat(' ',max(2, (18 - strlen($this->table)))) ;
         
         $options = &PEAR::getStaticProperty('DB_DataObject','options');
         
@@ -887,6 +924,7 @@ class DB_DataObject_Generator extends DB_DataObject
          // Only include the $_database property if the omit_database_var is unset or false
         
         if (isset($options["database_{$this->_database}"]) && empty($GLOBALS['_DB_DATAOBJECT']['CONFIG']['generator_omit_database_var'])) {
+            $p = str_repeat(' ',   max(2, (16 - strlen($this->table))));
             $body .= "    {$var} \$_database = '{$this->_database}';  {$p}// database name (used with database_{*} config)\n";
         }
         
@@ -900,6 +938,7 @@ class DB_DataObject_Generator extends DB_DataObject
         // show nice information!
         $connections = array();
         $sets = array();
+
         foreach($defs as $t) {
             if (!strlen(trim($t->name))) {
                 continue;
@@ -915,10 +954,7 @@ class DB_DataObject_Generator extends DB_DataObject
                 continue;
             }
             
-            
-            $padding = (30 - strlen($t->name));
-            if ($padding < 2) $padding =2;
-            $p =  str_repeat(' ',$padding) ;
+            $p = str_repeat(' ',max(2,  (30 - strlen($t->name))));
 
             $length = empty($t->len) ? '' : '('.$t->len.')';
             $body .="    {$var} \${$t->name};  {$p}// {$t->type}$length  {$t->flags}\n";
@@ -926,9 +962,11 @@ class DB_DataObject_Generator extends DB_DataObject
             // can not do set as PEAR::DB table info doesnt support it.
             //if (substr($t->Type,0,3) == "set")
             //    $sets[$t->Field] = "array".substr($t->Type,3);
-            $body .= $this->derivedHookVar($t,$padding);
+            $body .= $this->derivedHookVar($t,strlen($p));
         }
          
+        $body .= $this->derivedHookPostVar($defs);
+
         // THIS IS TOTALLY BORKED old FC creation
         // IT WILL BE REMOVED!!!!! in DataObjects 1.6
         // grep -r __clone * to find all it's uses
@@ -1078,7 +1116,21 @@ class DB_DataObject_Generator extends DB_DataObject
         // It MUST NOT be changed here!!!
         return "";
     }
-
+    /**
+     * hook for after var lines (
+     * called at the end of the output of var line have generated, override to add extra var
+     * lines
+     *
+     * @param array cols containing array of objects with type,len,flags etc. from tableInfo call
+     * @access   public
+     * @return  string added to class eg. functions.
+     */
+    function derivedHookPostVar($t)
+    {
+        // This is so derived generator classes can generate variabels
+        // It MUST NOT be changed here!!!
+        return "";
+    }
     /**
      * hook to add extra page-level (in terms of phpDocumentor) DocBlock
      *

extlib/PEAR.php

@@ -6,21 +6,15 @@
  *
  * PHP versions 4 and 5
  *
- * LICENSE: This source file is subject to version 3.0 of the PHP license
- * that is available through the world-wide-web at the following URI:
- * http://www.php.net/license/3_0.txt.  If you did not receive a copy of
- * the PHP License and are unable to obtain it through the web, please
- * send a note to license@php.net so we can mail you a copy immediately.
- *
  * @category   pear
  * @package    PEAR
  * @author     Sterling Hughes <sterling@php.net>
  * @author     Stig Bakken <ssb@php.net>
  * @author     Tomas V.V.Cox <cox@idecnet.com>
  * @author     Greg Beaver <cellog@php.net>
- * @copyright  1997-2008 The PHP Group
- * @license    http://www.php.net/license/3_0.txt  PHP License 3.0
- * @version    CVS: $Id: PEAR.php,v 1.104 2008/01/03 20:26:34 cellog Exp $
+ * @copyright  1997-2010 The Authors
+ * @license    http://opensource.org/licenses/bsd-license.php New BSD License
+ * @version    CVS: $Id: PEAR.php 307683 2011-01-23 21:56:12Z dufuz $
  * @link       http://pear.php.net/package/PEAR
  * @since      File available since Release 0.1
  */
@@ -52,15 +46,6 @@ if (substr(PHP_OS, 0, 3) == 'WIN') {
     define('PEAR_OS',    'Unix'); // blatant assumption
 }
 
-// instant backwards compatibility
-if (!defined('PATH_SEPARATOR')) {
-    if (OS_WINDOWS) {
-        define('PATH_SEPARATOR', ';');
-    } else {
-        define('PATH_SEPARATOR', ':');
-    }
-}
-
 $GLOBALS['_PEAR_default_error_mode']     = PEAR_ERROR_RETURN;
 $GLOBALS['_PEAR_default_error_options']  = E_USER_NOTICE;
 $GLOBALS['_PEAR_destructor_object_list'] = array();
@@ -92,8 +77,8 @@ $GLOBALS['_PEAR_error_handler_stack']    = array();
  * @author     Tomas V.V. Cox <cox@idecnet.com>
  * @author     Greg Beaver <cellog@php.net>
  * @copyright  1997-2006 The PHP Group
- * @license    http://www.php.net/license/3_0.txt  PHP License 3.0
- * @version    Release: 1.7.2
+ * @license    http://opensource.org/licenses/bsd-license.php New BSD License
+ * @version    Release: 1.9.2
  * @link       http://pear.php.net/package/PEAR
  * @see        PEAR_Error
  * @since      Class available since PHP 4.0.2
@@ -101,8 +86,6 @@ $GLOBALS['_PEAR_error_handler_stack']    = array();
  */
 class PEAR
 {
-    // {{{ properties
-
     /**
      * Whether to enable internal debug messages.
      *
@@ -153,10 +136,6 @@ class PEAR
      */
     var $_expected_errors = array();
 
-    // }}}
-
-    // {{{ constructor
-
     /**
      * Constructor.  Registers this object in
      * $_PEAR_destructor_object_list for destructor emulation if a
@@ -173,9 +152,11 @@ class PEAR
         if ($this->_debug) {
             print "PEAR constructor called, class=$classname\n";
         }
+
         if ($error_class !== null) {
             $this->_error_class = $error_class;
         }
+
         while ($classname && strcasecmp($classname, "pear")) {
             $destructor = "_$classname";
             if (method_exists($this, $destructor)) {
@@ -192,9 +173,6 @@ class PEAR
         }
     }
 
-    // }}}
-    // {{{ destructor
-
     /**
      * Destructor (the emulated type of...).  Does nothing right now,
      * but is included for forward compatibility, so subclass
@@ -212,9 +190,6 @@ class PEAR
         }
     }
 
-    // }}}
-    // {{{ getStaticProperty()
-
     /**
     * If you have a class that's mostly/entirely static, and you need static
     * properties, you can use this method to simulate them. Eg. in your method(s)
@@ -233,15 +208,14 @@ class PEAR
         if (!isset($properties[$class])) {
             $properties[$class] = array();
         }
+
         if (!array_key_exists($var, $properties[$class])) {
             $properties[$class][$var] = null;
         }
+
         return $properties[$class][$var];
     }
 
-    // }}}
-    // {{{ registerShutdownFunc()
-
     /**
     * Use this function to register a shutdown method for static
     * classes.
@@ -262,9 +236,6 @@ class PEAR
         $GLOBALS['_PEAR_shutdown_funcs'][] = array($func, $args);
     }
 
-    // }}}
-    // {{{ isError()
-
     /**
      * Tell whether a value is a PEAR error.
      *
@@ -278,20 +249,18 @@ class PEAR
      */
     function isError($data, $code = null)
     {
-        if (is_a($data, 'PEAR_Error')) {
+        if (!is_a($data, 'PEAR_Error')) {
+            return false;
+        }
+
         if (is_null($code)) {
             return true;
         } elseif (is_string($code)) {
             return $data->getMessage() == $code;
-            } else {
-                return $data->getCode() == $code;
-            }
-        }
-        return false;
         }
 
-    // }}}
-    // {{{ setErrorHandling()
+        return $data->getCode() == $code;
+    }
 
     /**
      * Sets how errors generated by this object should be handled.
@@ -331,7 +300,6 @@ class PEAR
      *
      * @since PHP 4.0.5
      */
-
     function setErrorHandling($mode = null, $options = null)
     {
         if (isset($this) && is_a($this, 'PEAR')) {
@@ -369,9 +337,6 @@ class PEAR
         }
     }
 
-    // }}}
-    // {{{ expectError()
-
     /**
      * This method is used to tell which errors you expect to get.
      * Expected errors are always returned with error mode
@@ -394,12 +359,9 @@ class PEAR
         } else {
             array_push($this->_expected_errors, array($code));
         }
-        return sizeof($this->_expected_errors);
+        return count($this->_expected_errors);
     }
 
-    // }}}
-    // {{{ popExpect()
-
     /**
      * This method pops one element off the expected error codes
      * stack.
@@ -411,9 +373,6 @@ class PEAR
         return array_pop($this->_expected_errors);
     }
 
-    // }}}
-    // {{{ _checkDelExpect()
-
     /**
      * This method checks unsets an error code if available
      *
@@ -425,8 +384,7 @@ class PEAR
     function _checkDelExpect($error_code)
     {
         $deleted = false;
-
-        foreach ($this->_expected_errors AS $key => $error_array) {
+        foreach ($this->_expected_errors as $key => $error_array) {
             if (in_array($error_code, $error_array)) {
                 unset($this->_expected_errors[$key][array_search($error_code, $error_array)]);
                 $deleted = true;
@@ -437,12 +395,10 @@ class PEAR
                 unset($this->_expected_errors[$key]);
             }
         }
+
         return $deleted;
     }
 
-    // }}}
-    // {{{ delExpect()
-
     /**
      * This method deletes all occurences of the specified element from
      * the expected error codes stack.
@@ -455,34 +411,26 @@ class PEAR
     function delExpect($error_code)
     {
         $deleted = false;
-
         if ((is_array($error_code) && (0 != count($error_code)))) {
-            // $error_code is a non-empty array here;
-            // we walk through it trying to unset all
-            // values
-            foreach($error_code as $key => $error) {
-                if ($this->_checkDelExpect($error)) {
-                    $deleted =  true;
-                } else {
-                    $deleted = false;
-                }
+            // $error_code is a non-empty array here; we walk through it trying
+            // to unset all values
+            foreach ($error_code as $key => $error) {
+                $deleted =  $this->_checkDelExpect($error) ? true : false;
             }
+
             return $deleted ? true : PEAR::raiseError("The expected error you submitted does not exist"); // IMPROVE ME
         } elseif (!empty($error_code)) {
             // $error_code comes alone, trying to unset it
             if ($this->_checkDelExpect($error_code)) {
                 return true;
-            } else {
+            }
+
             return PEAR::raiseError("The expected error you submitted does not exist"); // IMPROVE ME
         }
-        } else {
+
         // $error_code is empty
         return PEAR::raiseError("The expected error you submitted is empty"); // IMPROVE ME
     }
-    }
-
-    // }}}
-    // {{{ raiseError()
 
     /**
      * This method is a wrapper that returns an instance of the
@@ -538,13 +486,20 @@ class PEAR
             $message     = $message->getMessage();
         }
 
-        if (isset($this) && isset($this->_expected_errors) && sizeof($this->_expected_errors) > 0 && sizeof($exp = end($this->_expected_errors))) {
+        if (
+            isset($this) &&
+            isset($this->_expected_errors) &&
+            count($this->_expected_errors) > 0 &&
+            count($exp = end($this->_expected_errors))
+        ) {
             if ($exp[0] == "*" ||
                 (is_int(reset($exp)) && in_array($code, $exp)) ||
-                (is_string(reset($exp)) && in_array($message, $exp))) {
+                (is_string(reset($exp)) && in_array($message, $exp))
+            ) {
                 $mode = PEAR_ERROR_RETURN;
             }
         }
+
         // No mode given, try global ones
         if ($mode === null) {
             // Class error handler
@@ -565,43 +520,49 @@ class PEAR
         } else {
             $ec = 'PEAR_Error';
         }
+
         if (intval(PHP_VERSION) < 5) {
             // little non-eval hack to fix bug #12147
             include 'PEAR/FixPHP5PEARWarnings.php';
             return $a;
         }
+
         if ($skipmsg) {
             $a = new $ec($code, $mode, $options, $userinfo);
         } else {
             $a = new $ec($message, $code, $mode, $options, $userinfo);
         }
+
         return $a;
     }
 
-    // }}}
-    // {{{ throwError()
-
     /**
      * Simpler form of raiseError with fewer options.  In most cases
      * message, code and userinfo are enough.
      *
-     * @param string $message
+     * @param mixed $message a text error message or a PEAR error object
      *
+     * @param int $code      a numeric error code (it is up to your class
+     *                  to define these if you want to use codes)
+     *
+     * @param string $userinfo If you need to pass along for example debug
+     *                  information, this parameter is meant for that.
+     *
+     * @access public
+     * @return object   a PEAR error object
+     * @see PEAR::raiseError
      */
-    function &throwError($message = null,
-                         $code = null,
-                         $userinfo = null)
+    function &throwError($message = null, $code = null, $userinfo = null)
     {
         if (isset($this) && is_a($this, 'PEAR')) {
             $a = &$this->raiseError($message, $code, null, null, $userinfo);
             return $a;
-        } else {
+        }
+
         $a = &PEAR::raiseError($message, $code, null, null, $userinfo);
         return $a;
     }
-    }
 
-    // }}}
     function staticPushErrorHandling($mode, $options = null)
     {
         $stack       = &$GLOBALS['_PEAR_error_handler_stack'];
@@ -673,8 +634,6 @@ class PEAR
         return true;
     }
 
-    // {{{ pushErrorHandling()
-
     /**
      * Push a new error handler on top of the error handler options stack. With this
      * you can easily override the actual error handler for some code and restore
@@ -708,9 +667,6 @@ class PEAR
         return true;
     }
 
-    // }}}
-    // {{{ popErrorHandling()
-
     /**
     * Pop the last error handler used
     *
@@ -732,9 +688,6 @@ class PEAR
         return true;
     }
 
-    // }}}
-    // {{{ loadExtension()
-
     /**
     * OS independant PHP extension load. Remember to take care
     * on the correct extension name for case sensitive OSes.
@@ -744,11 +697,19 @@ class PEAR
     */
     function loadExtension($ext)
     {
-        if (!extension_loaded($ext)) {
+        if (extension_loaded($ext)) {
+            return true;
+        }
+
         // if either returns true dl() will produce a FATAL error, stop that
-            if ((ini_get('enable_dl') != 1) || (ini_get('safe_mode') == 1)) {
+        if (
+            function_exists('dl') === false ||
+            ini_get('enable_dl') != 1 ||
+            ini_get('safe_mode') == 1
+        ) {
             return false;
         }
+
         if (OS_WINDOWS) {
             $suffix = '.dll';
         } elseif (PHP_OS == 'HP-UX') {
@@ -760,15 +721,14 @@ class PEAR
         } else {
             $suffix = '.so';
         }
+
         return @dl('php_'.$ext.$suffix) || @dl($ext.$suffix);
     }
-        return true;
-    }
-
-    // }}}
 }
 
-// {{{ _PEAR_call_destructors()
+if (PEAR_ZE2) {
+    include_once 'PEAR5.php';
+}
 
 function _PEAR_call_destructors()
 {
@@ -777,9 +737,16 @@ function _PEAR_call_destructors()
         sizeof($_PEAR_destructor_object_list))
     {
         reset($_PEAR_destructor_object_list);
-        if (PEAR::getStaticProperty('PEAR', 'destructlifo')) {
+        if (PEAR_ZE2) {
+            $destructLifoExists = PEAR5::getStaticProperty('PEAR', 'destructlifo');
+        } else {
+            $destructLifoExists = PEAR::getStaticProperty('PEAR', 'destructlifo');
+        }
+
+        if ($destructLifoExists) {
             $_PEAR_destructor_object_list = array_reverse($_PEAR_destructor_object_list);
         }
+
         while (list($k, $objref) = each($_PEAR_destructor_object_list)) {
             $classname = get_class($objref);
             while ($classname) {
@@ -798,14 +765,17 @@ function _PEAR_call_destructors()
     }
 
     // Now call the shutdown functions
-    if (is_array($GLOBALS['_PEAR_shutdown_funcs']) AND !empty($GLOBALS['_PEAR_shutdown_funcs'])) {
+    if (
+        isset($GLOBALS['_PEAR_shutdown_funcs']) &&
+        is_array($GLOBALS['_PEAR_shutdown_funcs']) &&
+        !empty($GLOBALS['_PEAR_shutdown_funcs'])
+    ) {
         foreach ($GLOBALS['_PEAR_shutdown_funcs'] as $value) {
             call_user_func_array($value[0], $value[1]);
         }
     }
 }
 
-// }}}
 /**
  * Standard PEAR error class for PHP 4
  *
@@ -817,16 +787,14 @@ function _PEAR_call_destructors()
  * @author     Tomas V.V. Cox <cox@idecnet.com>
  * @author     Gregory Beaver <cellog@php.net>
  * @copyright  1997-2006 The PHP Group
- * @license    http://www.php.net/license/3_0.txt  PHP License 3.0
- * @version    Release: 1.7.2
+ * @license    http://opensource.org/licenses/bsd-license.php New BSD License
+ * @version    Release: 1.9.2
  * @link       http://pear.php.net/manual/en/core.pear.pear-error.php
  * @see        PEAR::raiseError(), PEAR::throwError()
  * @since      Class available since PHP 4.0.2
  */
 class PEAR_Error
 {
-    // {{{ properties
-
     var $error_message_prefix = '';
     var $mode                 = PEAR_ERROR_RETURN;
     var $level                = E_USER_NOTICE;
@@ -835,9 +803,6 @@ class PEAR_Error
     var $userinfo             = '';
     var $backtrace            = null;
 
-    // }}}
-    // {{{ constructor
-
     /**
      * PEAR_Error constructor
      *
@@ -868,12 +833,20 @@ class PEAR_Error
         $this->code      = $code;
         $this->mode      = $mode;
         $this->userinfo  = $userinfo;
-        if (!PEAR::getStaticProperty('PEAR_Error', 'skiptrace')) {
+
+        if (PEAR_ZE2) {
+            $skiptrace = PEAR5::getStaticProperty('PEAR_Error', 'skiptrace');
+        } else {
+            $skiptrace = PEAR::getStaticProperty('PEAR_Error', 'skiptrace');
+        }
+
+        if (!$skiptrace) {
             $this->backtrace = debug_backtrace();
             if (isset($this->backtrace[0]) && isset($this->backtrace[0]['object'])) {
                 unset($this->backtrace[0]['object']);
             }
         }
+
         if ($mode & PEAR_ERROR_CALLBACK) {
             $this->level = E_USER_NOTICE;
             $this->callback = $options;
@@ -881,20 +854,25 @@ class PEAR_Error
             if ($options === null) {
                 $options = E_USER_NOTICE;
             }
+
             $this->level = $options;
             $this->callback = null;
         }
+
         if ($this->mode & PEAR_ERROR_PRINT) {
             if (is_null($options) || is_int($options)) {
                 $format = "%s";
             } else {
                 $format = $options;
             }
+
             printf($format, $this->getMessage());
         }
+
         if ($this->mode & PEAR_ERROR_TRIGGER) {
             trigger_error($this->getMessage(), $this->level);
         }
+
         if ($this->mode & PEAR_ERROR_DIE) {
             $msg = $this->getMessage();
             if (is_null($options) || is_int($options)) {
@@ -907,47 +885,39 @@ class PEAR_Error
             }
             die(sprintf($format, $msg));
         }
-        if ($this->mode & PEAR_ERROR_CALLBACK) {
-            if (is_callable($this->callback)) {
+
+        if ($this->mode & PEAR_ERROR_CALLBACK && is_callable($this->callback)) {
             call_user_func($this->callback, $this);
         }
-        }
+
         if ($this->mode & PEAR_ERROR_EXCEPTION) {
             trigger_error("PEAR_ERROR_EXCEPTION is obsolete, use class PEAR_Exception for exceptions", E_USER_WARNING);
             eval('$e = new Exception($this->message, $this->code);throw($e);');
         }
     }
 
-    // }}}
-    // {{{ getMode()
-
     /**
      * Get the error mode from an error object.
      *
      * @return int error mode
      * @access public
      */
-    function getMode() {
+    function getMode()
+    {
         return $this->mode;
     }
 
-    // }}}
-    // {{{ getCallback()
-
     /**
      * Get the callback function/method from an error object.
      *
      * @return mixed callback function or object/method array
      * @access public
      */
-    function getCallback() {
+    function getCallback()
+    {
         return $this->callback;
     }
 
-    // }}}
-    // {{{ getMessage()
-
-
     /**
      * Get the error message from an error object.
      *
@@ -959,10 +929,6 @@ class PEAR_Error
         return ($this->error_message_prefix . $this->message);
     }
 
-
-    // }}}
-    // {{{ getCode()
-
     /**
      * Get error code from an error object
      *
@@ -974,9 +940,6 @@ class PEAR_Error
         return $this->code;
      }
 
-    // }}}
-    // {{{ getType()
-
     /**
      * Get the name of this error/exception.
      *
@@ -988,9 +951,6 @@ class PEAR_Error
         return get_class($this);
     }
 
-    // }}}
-    // {{{ getUserInfo()
-
     /**
      * Get additional user-supplied information.
      *
@@ -1002,9 +962,6 @@ class PEAR_Error
         return $this->userinfo;
     }
 
-    // }}}
-    // {{{ getDebugInfo()
-
     /**
      * Get additional debug information supplied by the application.
      *
@@ -1016,9 +973,6 @@ class PEAR_Error
         return $this->getUserInfo();
     }
 
-    // }}}
-    // {{{ getBacktrace()
-
     /**
      * Get the call backtrace from where the error was generated.
      * Supported with PHP 4.3.0 or newer.
@@ -1038,9 +992,6 @@ class PEAR_Error
         return $this->backtrace[$frame];
     }
 
-    // }}}
-    // {{{ addUserInfo()
-
     function addUserInfo($info)
     {
         if (empty($this->userinfo)) {
@@ -1050,14 +1001,10 @@ class PEAR_Error
         }
     }
 
-    // }}}
-    // {{{ toString()
     function __toString()
     {
         return $this->getMessage();
     }
-    // }}}
-    // {{{ toString()
 
     /**
      * Make a string representation of this object.
@@ -1065,7 +1012,8 @@ class PEAR_Error
      * @return string a string with an object summary
      * @access public
      */
-    function toString() {
+    function toString()
+    {
         $modes = array();
         $levels = array(E_USER_NOTICE  => 'notice',
                         E_USER_WARNING => 'warning',
@@ -1104,8 +1052,6 @@ class PEAR_Error
                        $this->error_message_prefix,
                        $this->userinfo);
     }
-
-    // }}}
 }
 
 /*
@@ -1115,4 +1061,3 @@ class PEAR_Error
  * c-basic-offset: 4
  * End:
  */
-?>

extlib/PEAR/ErrorStack.php

@@ -0,0 +1,985 @@
+<?php
+/**
+ * Error Stack Implementation
+ * 
+ * This is an incredibly simple implementation of a very complex error handling
+ * facility.  It contains the ability
+ * to track multiple errors from multiple packages simultaneously.  In addition,
+ * it can track errors of many levels, save data along with the error, context
+ * information such as the exact file, line number, class and function that
+ * generated the error, and if necessary, it can raise a traditional PEAR_Error.
+ * It has built-in support for PEAR::Log, to log errors as they occur
+ * 
+ * Since version 0.2alpha, it is also possible to selectively ignore errors,
+ * through the use of an error callback, see {@link pushCallback()}
+ * 
+ * Since version 0.3alpha, it is possible to specify the exception class
+ * returned from {@link push()}
+ *
+ * Since version PEAR1.3.2, ErrorStack no longer instantiates an exception class.  This can
+ * still be done quite handily in an error callback or by manipulating the returned array
+ * @category   Debugging
+ * @package    PEAR_ErrorStack
+ * @author     Greg Beaver <cellog@php.net>
+ * @copyright  2004-2008 Greg Beaver
+ * @license    http://opensource.org/licenses/bsd-license.php New BSD License
+ * @version    CVS: $Id: ErrorStack.php 307683 2011-01-23 21:56:12Z dufuz $
+ * @link       http://pear.php.net/package/PEAR_ErrorStack
+ */
+
+/**
+ * Singleton storage
+ * 
+ * Format:
+ * <pre>
+ * array(
+ *  'package1' => PEAR_ErrorStack object,
+ *  'package2' => PEAR_ErrorStack object,
+ *  ...
+ * )
+ * </pre>
+ * @access private
+ * @global array $GLOBALS['_PEAR_ERRORSTACK_SINGLETON']
+ */
+$GLOBALS['_PEAR_ERRORSTACK_SINGLETON'] = array();
+
+/**
+ * Global error callback (default)
+ * 
+ * This is only used if set to non-false.  * is the default callback for
+ * all packages, whereas specific packages may set a default callback
+ * for all instances, regardless of whether they are a singleton or not.
+ *
+ * To exclude non-singletons, only set the local callback for the singleton
+ * @see PEAR_ErrorStack::setDefaultCallback()
+ * @access private
+ * @global array $GLOBALS['_PEAR_ERRORSTACK_DEFAULT_CALLBACK']
+ */
+$GLOBALS['_PEAR_ERRORSTACK_DEFAULT_CALLBACK'] = array(
+    '*' => false,
+);
+
+/**
+ * Global Log object (default)
+ * 
+ * This is only used if set to non-false.  Use to set a default log object for
+ * all stacks, regardless of instantiation order or location
+ * @see PEAR_ErrorStack::setDefaultLogger()
+ * @access private
+ * @global array $GLOBALS['_PEAR_ERRORSTACK_DEFAULT_LOGGER']
+ */
+$GLOBALS['_PEAR_ERRORSTACK_DEFAULT_LOGGER'] = false;
+
+/**
+ * Global Overriding Callback
+ * 
+ * This callback will override any error callbacks that specific loggers have set.
+ * Use with EXTREME caution
+ * @see PEAR_ErrorStack::staticPushCallback()
+ * @access private
+ * @global array $GLOBALS['_PEAR_ERRORSTACK_DEFAULT_LOGGER']
+ */
+$GLOBALS['_PEAR_ERRORSTACK_OVERRIDE_CALLBACK'] = array();
+
+/**#@+
+ * One of four possible return values from the error Callback
+ * @see PEAR_ErrorStack::_errorCallback()
+ */
+/**
+ * If this is returned, then the error will be both pushed onto the stack
+ * and logged.
+ */
+define('PEAR_ERRORSTACK_PUSHANDLOG', 1);
+/**
+ * If this is returned, then the error will only be pushed onto the stack,
+ * and not logged.
+ */
+define('PEAR_ERRORSTACK_PUSH', 2);
+/**
+ * If this is returned, then the error will only be logged, but not pushed
+ * onto the error stack.
+ */
+define('PEAR_ERRORSTACK_LOG', 3);
+/**
+ * If this is returned, then the error is completely ignored.
+ */
+define('PEAR_ERRORSTACK_IGNORE', 4);
+/**
+ * If this is returned, then the error is logged and die() is called.
+ */
+define('PEAR_ERRORSTACK_DIE', 5);
+/**#@-*/
+
+/**
+ * Error code for an attempt to instantiate a non-class as a PEAR_ErrorStack in
+ * the singleton method.
+ */
+define('PEAR_ERRORSTACK_ERR_NONCLASS', 1);
+
+/**
+ * Error code for an attempt to pass an object into {@link PEAR_ErrorStack::getMessage()}
+ * that has no __toString() method
+ */
+define('PEAR_ERRORSTACK_ERR_OBJTOSTRING', 2);
+/**
+ * Error Stack Implementation
+ *
+ * Usage:
+ * <code>
+ * // global error stack
+ * $global_stack = &PEAR_ErrorStack::singleton('MyPackage');
+ * // local error stack
+ * $local_stack = new PEAR_ErrorStack('MyPackage');
+ * </code>
+ * @author     Greg Beaver <cellog@php.net>
+ * @version    1.9.2
+ * @package    PEAR_ErrorStack
+ * @category   Debugging
+ * @copyright  2004-2008 Greg Beaver
+ * @license    http://opensource.org/licenses/bsd-license.php New BSD License
+ * @version    CVS: $Id: ErrorStack.php 307683 2011-01-23 21:56:12Z dufuz $
+ * @link       http://pear.php.net/package/PEAR_ErrorStack
+ */
+class PEAR_ErrorStack {
+    /**
+     * Errors are stored in the order that they are pushed on the stack.
+     * @since 0.4alpha Errors are no longer organized by error level.
+     * This renders pop() nearly unusable, and levels could be more easily
+     * handled in a callback anyway
+     * @var array
+     * @access private
+     */
+    var $_errors = array();
+
+    /**
+     * Storage of errors by level.
+     *
+     * Allows easy retrieval and deletion of only errors from a particular level
+     * @since PEAR 1.4.0dev
+     * @var array
+     * @access private
+     */
+    var $_errorsByLevel = array();
+
+    /**
+     * Package name this error stack represents
+     * @var string
+     * @access protected
+     */
+    var $_package;
+    
+    /**
+     * Determines whether a PEAR_Error is thrown upon every error addition
+     * @var boolean
+     * @access private
+     */
+    var $_compat = false;
+    
+    /**
+     * If set to a valid callback, this will be used to generate the error
+     * message from the error code, otherwise the message passed in will be
+     * used
+     * @var false|string|array
+     * @access private
+     */
+    var $_msgCallback = false;
+    
+    /**
+     * If set to a valid callback, this will be used to generate the error
+     * context for an error.  For PHP-related errors, this will be a file
+     * and line number as retrieved from debug_backtrace(), but can be
+     * customized for other purposes.  The error might actually be in a separate
+     * configuration file, or in a database query.
+     * @var false|string|array
+     * @access protected
+     */
+    var $_contextCallback = false;
+    
+    /**
+     * If set to a valid callback, this will be called every time an error
+     * is pushed onto the stack.  The return value will be used to determine
+     * whether to allow an error to be pushed or logged.
+     * 
+     * The return value must be one an PEAR_ERRORSTACK_* constant
+     * @see PEAR_ERRORSTACK_PUSHANDLOG, PEAR_ERRORSTACK_PUSH, PEAR_ERRORSTACK_LOG
+     * @var false|string|array
+     * @access protected
+     */
+    var $_errorCallback = array();
+    
+    /**
+     * PEAR::Log object for logging errors
+     * @var false|Log
+     * @access protected
+     */
+    var $_logger = false;
+    
+    /**
+     * Error messages - designed to be overridden
+     * @var array
+     * @abstract
+     */
+    var $_errorMsgs = array();
+    
+    /**
+     * Set up a new error stack
+     * 
+     * @param string   $package name of the package this error stack represents
+     * @param callback $msgCallback callback used for error message generation
+     * @param callback $contextCallback callback used for context generation,
+     *                 defaults to {@link getFileLine()}
+     * @param boolean  $throwPEAR_Error
+     */
+    function PEAR_ErrorStack($package, $msgCallback = false, $contextCallback = false,
+                         $throwPEAR_Error = false)
+    {
+        $this->_package = $package;
+        $this->setMessageCallback($msgCallback);
+        $this->setContextCallback($contextCallback);
+        $this->_compat = $throwPEAR_Error;
+    }
+    
+    /**
+     * Return a single error stack for this package.
+     * 
+     * Note that all parameters are ignored if the stack for package $package
+     * has already been instantiated
+     * @param string   $package name of the package this error stack represents
+     * @param callback $msgCallback callback used for error message generation
+     * @param callback $contextCallback callback used for context generation,
+     *                 defaults to {@link getFileLine()}
+     * @param boolean  $throwPEAR_Error
+     * @param string   $stackClass class to instantiate
+     * @static
+     * @return PEAR_ErrorStack
+     */
+    function &singleton($package, $msgCallback = false, $contextCallback = false,
+                         $throwPEAR_Error = false, $stackClass = 'PEAR_ErrorStack')
+    {
+        if (isset($GLOBALS['_PEAR_ERRORSTACK_SINGLETON'][$package])) {
+            return $GLOBALS['_PEAR_ERRORSTACK_SINGLETON'][$package];
+        }
+        if (!class_exists($stackClass)) {
+            if (function_exists('debug_backtrace')) {
+                $trace = debug_backtrace();
+            }
+            PEAR_ErrorStack::staticPush('PEAR_ErrorStack', PEAR_ERRORSTACK_ERR_NONCLASS,
+                'exception', array('stackclass' => $stackClass),
+                'stack class "%stackclass%" is not a valid class name (should be like PEAR_ErrorStack)',
+                false, $trace);
+        }
+        $GLOBALS['_PEAR_ERRORSTACK_SINGLETON'][$package] =
+            new $stackClass($package, $msgCallback, $contextCallback, $throwPEAR_Error);
+
+        return $GLOBALS['_PEAR_ERRORSTACK_SINGLETON'][$package];
+    }
+
+    /**
+     * Internal error handler for PEAR_ErrorStack class
+     * 
+     * Dies if the error is an exception (and would have died anyway)
+     * @access private
+     */
+    function _handleError($err)
+    {
+        if ($err['level'] == 'exception') {
+            $message = $err['message'];
+            if (isset($_SERVER['REQUEST_URI'])) {
+                echo '<br />';
+            } else {
+                echo "\n";
+            }
+            var_dump($err['context']);
+            die($message);
+        }
+    }
+    
+    /**
+     * Set up a PEAR::Log object for all error stacks that don't have one
+     * @param Log $log 
+     * @static
+     */
+    function setDefaultLogger(&$log)
+    {
+        if (is_object($log) && method_exists($log, 'log') ) {
+            $GLOBALS['_PEAR_ERRORSTACK_DEFAULT_LOGGER'] = &$log;
+        } elseif (is_callable($log)) {
+            $GLOBALS['_PEAR_ERRORSTACK_DEFAULT_LOGGER'] = &$log;
+	}
+    }
+    
+    /**
+     * Set up a PEAR::Log object for this error stack
+     * @param Log $log 
+     */
+    function setLogger(&$log)
+    {
+        if (is_object($log) && method_exists($log, 'log') ) {
+            $this->_logger = &$log;
+        } elseif (is_callable($log)) {
+            $this->_logger = &$log;
+        }
+    }
+    
+    /**
+     * Set an error code => error message mapping callback
+     * 
+     * This method sets the callback that can be used to generate error
+     * messages for any instance
+     * @param array|string Callback function/method
+     */
+    function setMessageCallback($msgCallback)
+    {
+        if (!$msgCallback) {
+            $this->_msgCallback = array(&$this, 'getErrorMessage');
+        } else {
+            if (is_callable($msgCallback)) {
+                $this->_msgCallback = $msgCallback;
+            }
+        }
+    }
+    
+    /**
+     * Get an error code => error message mapping callback
+     * 
+     * This method returns the current callback that can be used to generate error
+     * messages
+     * @return array|string|false Callback function/method or false if none
+     */
+    function getMessageCallback()
+    {
+        return $this->_msgCallback;
+    }
+    
+    /**
+     * Sets a default callback to be used by all error stacks
+     * 
+     * This method sets the callback that can be used to generate error
+     * messages for a singleton
+     * @param array|string Callback function/method
+     * @param string Package name, or false for all packages
+     * @static
+     */
+    function setDefaultCallback($callback = false, $package = false)
+    {
+        if (!is_callable($callback)) {
+            $callback = false;
+        }
+        $package = $package ? $package : '*';
+        $GLOBALS['_PEAR_ERRORSTACK_DEFAULT_CALLBACK'][$package] = $callback;
+    }
+    
+    /**
+     * Set a callback that generates context information (location of error) for an error stack
+     * 
+     * This method sets the callback that can be used to generate context
+     * information for an error.  Passing in NULL will disable context generation
+     * and remove the expensive call to debug_backtrace()
+     * @param array|string|null Callback function/method
+     */
+    function setContextCallback($contextCallback)
+    {
+        if ($contextCallback === null) {
+            return $this->_contextCallback = false;
+        }
+        if (!$contextCallback) {
+            $this->_contextCallback = array(&$this, 'getFileLine');
+        } else {
+            if (is_callable($contextCallback)) {
+                $this->_contextCallback = $contextCallback;
+            }
+        }
+    }
+    
+    /**
+     * Set an error Callback
+     * If set to a valid callback, this will be called every time an error
+     * is pushed onto the stack.  The return value will be used to determine
+     * whether to allow an error to be pushed or logged.
+     * 
+     * The return value must be one of the ERRORSTACK_* constants.
+     * 
+     * This functionality can be used to emulate PEAR's pushErrorHandling, and
+     * the PEAR_ERROR_CALLBACK mode, without affecting the integrity of
+     * the error stack or logging
+     * @see PEAR_ERRORSTACK_PUSHANDLOG, PEAR_ERRORSTACK_PUSH, PEAR_ERRORSTACK_LOG
+     * @see popCallback()
+     * @param string|array $cb
+     */
+    function pushCallback($cb)
+    {
+        array_push($this->_errorCallback, $cb);
+    }
+    
+    /**
+     * Remove a callback from the error callback stack
+     * @see pushCallback()
+     * @return array|string|false
+     */
+    function popCallback()
+    {
+        if (!count($this->_errorCallback)) {
+            return false;
+        }
+        return array_pop($this->_errorCallback);
+    }
+    
+    /**
+     * Set a temporary overriding error callback for every package error stack
+     *
+     * Use this to temporarily disable all existing callbacks (can be used
+     * to emulate the @ operator, for instance)
+     * @see PEAR_ERRORSTACK_PUSHANDLOG, PEAR_ERRORSTACK_PUSH, PEAR_ERRORSTACK_LOG
+     * @see staticPopCallback(), pushCallback()
+     * @param string|array $cb
+     * @static
+     */
+    function staticPushCallback($cb)
+    {
+        array_push($GLOBALS['_PEAR_ERRORSTACK_OVERRIDE_CALLBACK'], $cb);
+    }
+    
+    /**
+     * Remove a temporary overriding error callback
+     * @see staticPushCallback()
+     * @return array|string|false
+     * @static
+     */
+    function staticPopCallback()
+    {
+        $ret = array_pop($GLOBALS['_PEAR_ERRORSTACK_OVERRIDE_CALLBACK']);
+        if (!is_array($GLOBALS['_PEAR_ERRORSTACK_OVERRIDE_CALLBACK'])) {
+            $GLOBALS['_PEAR_ERRORSTACK_OVERRIDE_CALLBACK'] = array();
+        }
+        return $ret;
+    }
+    
+    /**
+     * Add an error to the stack
+     * 
+     * If the message generator exists, it is called with 2 parameters.
+     *  - the current Error Stack object
+     *  - an array that is in the same format as an error.  Available indices
+     *    are 'code', 'package', 'time', 'params', 'level', and 'context'
+     * 
+     * Next, if the error should contain context information, this is
+     * handled by the context grabbing method.
+     * Finally, the error is pushed onto the proper error stack
+     * @param int    $code      Package-specific error code
+     * @param string $level     Error level.  This is NOT spell-checked
+     * @param array  $params    associative array of error parameters
+     * @param string $msg       Error message, or a portion of it if the message
+     *                          is to be generated
+     * @param array  $repackage If this error re-packages an error pushed by
+     *                          another package, place the array returned from
+     *                          {@link pop()} in this parameter
+     * @param array  $backtrace Protected parameter: use this to pass in the
+     *                          {@link debug_backtrace()} that should be used
+     *                          to find error context
+     * @return PEAR_Error|array if compatibility mode is on, a PEAR_Error is also
+     * thrown.  If a PEAR_Error is returned, the userinfo
+     * property is set to the following array:
+     * 
+     * <code>
+     * array(
+     *    'code' => $code,
+     *    'params' => $params,
+     *    'package' => $this->_package,
+     *    'level' => $level,
+     *    'time' => time(),
+     *    'context' => $context,
+     *    'message' => $msg,
+     * //['repackage' => $err] repackaged error array/Exception class
+     * );
+     * </code>
+     * 
+     * Normally, the previous array is returned.
+     */
+    function push($code, $level = 'error', $params = array(), $msg = false,
+                  $repackage = false, $backtrace = false)
+    {
+        $context = false;
+        // grab error context
+        if ($this->_contextCallback) {
+            if (!$backtrace) {
+                $backtrace = debug_backtrace();
+            }
+            $context = call_user_func($this->_contextCallback, $code, $params, $backtrace);
+        }
+        
+        // save error
+        $time = explode(' ', microtime());
+        $time = $time[1] + $time[0];
+        $err = array(
+                'code' => $code,
+                'params' => $params,
+                'package' => $this->_package,
+                'level' => $level,
+                'time' => $time,
+                'context' => $context,
+                'message' => $msg,
+               );
+
+        if ($repackage) {
+            $err['repackage'] = $repackage;
+        }
+
+        // set up the error message, if necessary
+        if ($this->_msgCallback) {
+            $msg = call_user_func_array($this->_msgCallback,
+                                        array(&$this, $err));
+            $err['message'] = $msg;
+        }        
+        $push = $log = true;
+        $die = false;
+        // try the overriding callback first
+        $callback = $this->staticPopCallback();
+        if ($callback) {
+            $this->staticPushCallback($callback);
+        }
+        if (!is_callable($callback)) {
+            // try the local callback next
+            $callback = $this->popCallback();
+            if (is_callable($callback)) {
+                $this->pushCallback($callback);
+            } else {
+                // try the default callback
+                $callback = isset($GLOBALS['_PEAR_ERRORSTACK_DEFAULT_CALLBACK'][$this->_package]) ?
+                    $GLOBALS['_PEAR_ERRORSTACK_DEFAULT_CALLBACK'][$this->_package] :
+                    $GLOBALS['_PEAR_ERRORSTACK_DEFAULT_CALLBACK']['*'];
+            }
+        }
+        if (is_callable($callback)) {
+            switch(call_user_func($callback, $err)){
+            	case PEAR_ERRORSTACK_IGNORE: 
+            		return $err;
+        		break;
+            	case PEAR_ERRORSTACK_PUSH: 
+            		$log = false;
+        		break;
+            	case PEAR_ERRORSTACK_LOG: 
+            		$push = false;
+        		break;
+            	case PEAR_ERRORSTACK_DIE: 
+            		$die = true;
+        		break;
+                // anything else returned has the same effect as pushandlog
+            }
+        }
+        if ($push) {
+            array_unshift($this->_errors, $err);
+            if (!isset($this->_errorsByLevel[$err['level']])) {
+                $this->_errorsByLevel[$err['level']] = array();
+            }
+            $this->_errorsByLevel[$err['level']][] = &$this->_errors[0];
+        }
+        if ($log) {
+            if ($this->_logger || $GLOBALS['_PEAR_ERRORSTACK_DEFAULT_LOGGER']) {
+                $this->_log($err);
+            }
+        }
+        if ($die) {
+            die();
+        }
+        if ($this->_compat && $push) {
+            return $this->raiseError($msg, $code, null, null, $err);
+        }
+        return $err;
+    }
+    
+    /**
+     * Static version of {@link push()}
+     * 
+     * @param string $package   Package name this error belongs to
+     * @param int    $code      Package-specific error code
+     * @param string $level     Error level.  This is NOT spell-checked
+     * @param array  $params    associative array of error parameters
+     * @param string $msg       Error message, or a portion of it if the message
+     *                          is to be generated
+     * @param array  $repackage If this error re-packages an error pushed by
+     *                          another package, place the array returned from
+     *                          {@link pop()} in this parameter
+     * @param array  $backtrace Protected parameter: use this to pass in the
+     *                          {@link debug_backtrace()} that should be used
+     *                          to find error context
+     * @return PEAR_Error|array if compatibility mode is on, a PEAR_Error is also
+     *                          thrown.  see docs for {@link push()}
+     * @static
+     */
+    function staticPush($package, $code, $level = 'error', $params = array(),
+                        $msg = false, $repackage = false, $backtrace = false)
+    {
+        $s = &PEAR_ErrorStack::singleton($package);
+        if ($s->_contextCallback) {
+            if (!$backtrace) {
+                if (function_exists('debug_backtrace')) {
+                    $backtrace = debug_backtrace();
+                }
+            }
+        }
+        return $s->push($code, $level, $params, $msg, $repackage, $backtrace);
+    }
+    
+    /**
+     * Log an error using PEAR::Log
+     * @param array $err Error array
+     * @param array $levels Error level => Log constant map
+     * @access protected
+     */
+    function _log($err)
+    {
+        if ($this->_logger) {
+            $logger = &$this->_logger;
+        } else {
+            $logger = &$GLOBALS['_PEAR_ERRORSTACK_DEFAULT_LOGGER'];
+        }
+        if (is_a($logger, 'Log')) {
+            $levels = array(
+                'exception' => PEAR_LOG_CRIT,
+                'alert' => PEAR_LOG_ALERT,
+                'critical' => PEAR_LOG_CRIT,
+                'error' => PEAR_LOG_ERR,
+                'warning' => PEAR_LOG_WARNING,
+                'notice' => PEAR_LOG_NOTICE,
+                'info' => PEAR_LOG_INFO,
+                'debug' => PEAR_LOG_DEBUG);
+            if (isset($levels[$err['level']])) {
+                $level = $levels[$err['level']];
+            } else {
+                $level = PEAR_LOG_INFO;
+            }
+            $logger->log($err['message'], $level, $err);
+        } else { // support non-standard logs
+            call_user_func($logger, $err);
+        }
+    }
+
+    
+    /**
+     * Pop an error off of the error stack
+     * 
+     * @return false|array
+     * @since 0.4alpha it is no longer possible to specify a specific error
+     * level to return - the last error pushed will be returned, instead
+     */
+    function pop()
+    {
+        $err = @array_shift($this->_errors);
+        if (!is_null($err)) {
+            @array_pop($this->_errorsByLevel[$err['level']]);
+            if (!count($this->_errorsByLevel[$err['level']])) {
+                unset($this->_errorsByLevel[$err['level']]);
+            }
+        }
+        return $err;
+    }
+
+    /**
+     * Pop an error off of the error stack, static method
+     *
+     * @param string package name
+     * @return boolean
+     * @since PEAR1.5.0a1
+     */
+    function staticPop($package)
+    {
+        if ($package) {
+            if (!isset($GLOBALS['_PEAR_ERRORSTACK_SINGLETON'][$package])) {
+                return false;
+            }
+            return $GLOBALS['_PEAR_ERRORSTACK_SINGLETON'][$package]->pop();
+        }
+    }
+
+    /**
+     * Determine whether there are any errors on the stack
+     * @param string|array Level name.  Use to determine if any errors
+     * of level (string), or levels (array) have been pushed
+     * @return boolean
+     */
+    function hasErrors($level = false)
+    {
+        if ($level) {
+            return isset($this->_errorsByLevel[$level]);
+        }
+        return count($this->_errors);
+    }
+    
+    /**
+     * Retrieve all errors since last purge
+     * 
+     * @param boolean set in order to empty the error stack
+     * @param string level name, to return only errors of a particular severity
+     * @return array
+     */
+    function getErrors($purge = false, $level = false)
+    {
+        if (!$purge) {
+            if ($level) {
+                if (!isset($this->_errorsByLevel[$level])) {
+                    return array();
+                } else {
+                    return $this->_errorsByLevel[$level];
+                }
+            } else {
+                return $this->_errors;
+            }
+        }
+        if ($level) {
+            $ret = $this->_errorsByLevel[$level];
+            foreach ($this->_errorsByLevel[$level] as $i => $unused) {
+                // entries are references to the $_errors array
+                $this->_errorsByLevel[$level][$i] = false;
+            }
+            // array_filter removes all entries === false
+            $this->_errors = array_filter($this->_errors);
+            unset($this->_errorsByLevel[$level]);
+            return $ret;
+        }
+        $ret = $this->_errors;
+        $this->_errors = array();
+        $this->_errorsByLevel = array();
+        return $ret;
+    }
+    
+    /**
+     * Determine whether there are any errors on a single error stack, or on any error stack
+     *
+     * The optional parameter can be used to test the existence of any errors without the need of
+     * singleton instantiation
+     * @param string|false Package name to check for errors
+     * @param string Level name to check for a particular severity
+     * @return boolean
+     * @static
+     */
+    function staticHasErrors($package = false, $level = false)
+    {
+        if ($package) {
+            if (!isset($GLOBALS['_PEAR_ERRORSTACK_SINGLETON'][$package])) {
+                return false;
+            }
+            return $GLOBALS['_PEAR_ERRORSTACK_SINGLETON'][$package]->hasErrors($level);
+        }
+        foreach ($GLOBALS['_PEAR_ERRORSTACK_SINGLETON'] as $package => $obj) {
+            if ($obj->hasErrors($level)) {
+                return true;
+            }
+        }
+        return false;
+    }
+    
+    /**
+     * Get a list of all errors since last purge, organized by package
+     * @since PEAR 1.4.0dev BC break! $level is now in the place $merge used to be
+     * @param boolean $purge Set to purge the error stack of existing errors
+     * @param string  $level Set to a level name in order to retrieve only errors of a particular level
+     * @param boolean $merge Set to return a flat array, not organized by package
+     * @param array   $sortfunc Function used to sort a merged array - default
+     *        sorts by time, and should be good for most cases
+     * @static
+     * @return array 
+     */
+    function staticGetErrors($purge = false, $level = false, $merge = false,
+                             $sortfunc = array('PEAR_ErrorStack', '_sortErrors'))
+    {
+        $ret = array();
+        if (!is_callable($sortfunc)) {
+            $sortfunc = array('PEAR_ErrorStack', '_sortErrors');
+        }
+        foreach ($GLOBALS['_PEAR_ERRORSTACK_SINGLETON'] as $package => $obj) {
+            $test = $GLOBALS['_PEAR_ERRORSTACK_SINGLETON'][$package]->getErrors($purge, $level);
+            if ($test) {
+                if ($merge) {
+                    $ret = array_merge($ret, $test);
+                } else {
+                    $ret[$package] = $test;
+                }
+            }
+        }
+        if ($merge) {
+            usort($ret, $sortfunc);
+        }
+        return $ret;
+    }
+    
+    /**
+     * Error sorting function, sorts by time
+     * @access private
+     */
+    function _sortErrors($a, $b)
+    {
+        if ($a['time'] == $b['time']) {
+            return 0;
+        }
+        if ($a['time'] < $b['time']) {
+            return 1;
+        }
+        return -1;
+    }
+
+    /**
+     * Standard file/line number/function/class context callback
+     *
+     * This function uses a backtrace generated from {@link debug_backtrace()}
+     * and so will not work at all in PHP < 4.3.0.  The frame should
+     * reference the frame that contains the source of the error.
+     * @return array|false either array('file' => file, 'line' => line,
+     *         'function' => function name, 'class' => class name) or
+     *         if this doesn't work, then false
+     * @param unused
+     * @param integer backtrace frame.
+     * @param array Results of debug_backtrace()
+     * @static
+     */
+    function getFileLine($code, $params, $backtrace = null)
+    {
+        if ($backtrace === null) {
+            return false;
+        }
+        $frame = 0;
+        $functionframe = 1;
+        if (!isset($backtrace[1])) {
+            $functionframe = 0;
+        } else {
+            while (isset($backtrace[$functionframe]['function']) &&
+                  $backtrace[$functionframe]['function'] == 'eval' &&
+                  isset($backtrace[$functionframe + 1])) {
+                $functionframe++;
+            }
+        }
+        if (isset($backtrace[$frame])) {
+            if (!isset($backtrace[$frame]['file'])) {
+                $frame++;
+            }
+            $funcbacktrace = $backtrace[$functionframe];
+            $filebacktrace = $backtrace[$frame];
+            $ret = array('file' => $filebacktrace['file'],
+                         'line' => $filebacktrace['line']);
+            // rearrange for eval'd code or create function errors
+            if (strpos($filebacktrace['file'], '(') && 
+            	  preg_match(';^(.*?)\((\d+)\) : (.*?)\\z;', $filebacktrace['file'],
+                  $matches)) {
+                $ret['file'] = $matches[1];
+                $ret['line'] = $matches[2] + 0;
+            }
+            if (isset($funcbacktrace['function']) && isset($backtrace[1])) {
+                if ($funcbacktrace['function'] != 'eval') {
+                    if ($funcbacktrace['function'] == '__lambda_func') {
+                        $ret['function'] = 'create_function() code';
+                    } else {
+                        $ret['function'] = $funcbacktrace['function'];
+                    }
+                }
+            }
+            if (isset($funcbacktrace['class']) && isset($backtrace[1])) {
+                $ret['class'] = $funcbacktrace['class'];
+            }
+            return $ret;
+        }
+        return false;
+    }
+    
+    /**
+     * Standard error message generation callback
+     * 
+     * This method may also be called by a custom error message generator
+     * to fill in template values from the params array, simply
+     * set the third parameter to the error message template string to use
+     * 
+     * The special variable %__msg% is reserved: use it only to specify
+     * where a message passed in by the user should be placed in the template,
+     * like so:
+     * 
+     * Error message: %msg% - internal error
+     * 
+     * If the message passed like so:
+     * 
+     * <code>
+     * $stack->push(ERROR_CODE, 'error', array(), 'server error 500');
+     * </code>
+     * 
+     * The returned error message will be "Error message: server error 500 -
+     * internal error"
+     * @param PEAR_ErrorStack
+     * @param array
+     * @param string|false Pre-generated error message template
+     * @static
+     * @return string
+     */
+    function getErrorMessage(&$stack, $err, $template = false)
+    {
+        if ($template) {
+            $mainmsg = $template;
+        } else {
+            $mainmsg = $stack->getErrorMessageTemplate($err['code']);
+        }
+        $mainmsg = str_replace('%__msg%', $err['message'], $mainmsg);
+        if (is_array($err['params']) && count($err['params'])) {
+            foreach ($err['params'] as $name => $val) {
+                if (is_array($val)) {
+                    // @ is needed in case $val is a multi-dimensional array
+                    $val = @implode(', ', $val);
+                }
+                if (is_object($val)) {
+                    if (method_exists($val, '__toString')) {
+                        $val = $val->__toString();
+                    } else {
+                        PEAR_ErrorStack::staticPush('PEAR_ErrorStack', PEAR_ERRORSTACK_ERR_OBJTOSTRING,
+                            'warning', array('obj' => get_class($val)),
+                            'object %obj% passed into getErrorMessage, but has no __toString() method');
+                        $val = 'Object';
+                    }
+                }
+                $mainmsg = str_replace('%' . $name . '%', $val, $mainmsg);
+            }
+        }
+        return $mainmsg;
+    }
+    
+    /**
+     * Standard Error Message Template generator from code
+     * @return string
+     */
+    function getErrorMessageTemplate($code)
+    {
+        if (!isset($this->_errorMsgs[$code])) {
+            return '%__msg%';
+        }
+        return $this->_errorMsgs[$code];
+    }
+    
+    /**
+     * Set the Error Message Template array
+     * 
+     * The array format must be:
+     * <pre>
+     * array(error code => 'message template',...)
+     * </pre>
+     * 
+     * Error message parameters passed into {@link push()} will be used as input
+     * for the error message.  If the template is 'message %foo% was %bar%', and the
+     * parameters are array('foo' => 'one', 'bar' => 'six'), the error message returned will
+     * be 'message one was six'
+     * @return string
+     */
+    function setErrorMessageTemplate($template)
+    {
+        $this->_errorMsgs = $template;
+    }
+    
+    
+    /**
+     * emulate PEAR::raiseError()
+     * 
+     * @return PEAR_Error
+     */
+    function raiseError()
+    {
+        require_once 'PEAR.php';
+        $args = func_get_args();
+        return call_user_func_array(array('PEAR', 'raiseError'), $args);
+    }
+}
+$stack = &PEAR_ErrorStack::singleton('PEAR_ErrorStack');
+$stack->pushCallback(array('PEAR_ErrorStack', '_handleError'));
+?>

extlib/PEAR/Exception.php

@@ -5,21 +5,15 @@
  *
  * PHP versions 4 and 5
  *
- * LICENSE: This source file is subject to version 3.0 of the PHP license
- * that is available through the world-wide-web at the following URI:
- * http://www.php.net/license/3_0.txt.  If you did not receive a copy of
- * the PHP License and are unable to obtain it through the web, please
- * send a note to license@php.net so we can mail you a copy immediately.
- *
  * @category   pear
  * @package    PEAR
  * @author     Tomas V. V. Cox <cox@idecnet.com>
  * @author     Hans Lellelid <hans@velum.net>
  * @author     Bertrand Mansion <bmansion@mamasam.com>
  * @author     Greg Beaver <cellog@php.net>
- * @copyright  1997-2008 The PHP Group
- * @license    http://www.php.net/license/3_0.txt  PHP License 3.0
- * @version    CVS: $Id: Exception.php,v 1.29 2008/01/03 20:26:35 cellog Exp $
+ * @copyright  1997-2009 The Authors
+ * @license    http://opensource.org/licenses/bsd-license.php New BSD License
+ * @version    CVS: $Id: Exception.php 307683 2011-01-23 21:56:12Z dufuz $
  * @link       http://pear.php.net/package/PEAR
  * @since      File available since Release 1.3.3
  */
@@ -93,9 +87,9 @@
  * @author     Hans Lellelid <hans@velum.net>
  * @author     Bertrand Mansion <bmansion@mamasam.com>
  * @author     Greg Beaver <cellog@php.net>
- * @copyright  1997-2008 The PHP Group
- * @license    http://www.php.net/license/3_0.txt  PHP License 3.0
- * @version    Release: 1.7.2
+ * @copyright  1997-2009 The Authors
+ * @license    http://opensource.org/licenses/bsd-license.php New BSD License
+ * @version    Release: 1.9.2
  * @link       http://pear.php.net/package/PEAR
  * @since      Class available since Release 1.3.3
  *
@@ -331,21 +325,21 @@ class PEAR_Exception extends Exception
         $trace = $this->getTraceSafe();
         $causes = array();
         $this->getCauseMessage($causes);
-        $html =  '<table border="1" cellspacing="0">' . "\n";
+        $html =  '<table style="border: 1px" cellspacing="0">' . "\n";
         foreach ($causes as $i => $cause) {
-            $html .= '<tr><td colspan="3" bgcolor="#ff9999">'
+            $html .= '<tr><td colspan="3" style="background: #ff9999">'
                . str_repeat('-', $i) . ' <b>' . $cause['class'] . '</b>: '
                . htmlspecialchars($cause['message']) . ' in <b>' . $cause['file'] . '</b> '
                . 'on line <b>' . $cause['line'] . '</b>'
                . "</td></tr>\n";
         }
-        $html .= '<tr><td colspan="3" bgcolor="#aaaaaa" align="center"><b>Exception trace</b></td></tr>' . "\n"
-               . '<tr><td align="center" bgcolor="#cccccc" width="20"><b>#</b></td>'
-               . '<td align="center" bgcolor="#cccccc"><b>Function</b></td>'
-               . '<td align="center" bgcolor="#cccccc"><b>Location</b></td></tr>' . "\n";
+        $html .= '<tr><td colspan="3" style="background-color: #aaaaaa; text-align: center; font-weight: bold;">Exception trace</td></tr>' . "\n"
+               . '<tr><td style="text-align: center; background: #cccccc; width:20px; font-weight: bold;">#</td>'
+               . '<td style="text-align: center; background: #cccccc; font-weight: bold;">Function</td>'
+               . '<td style="text-align: center; background: #cccccc; font-weight: bold;">Location</td></tr>' . "\n";
 
         foreach ($trace as $k => $v) {
-            $html .= '<tr><td align="center">' . $k . '</td>'
+            $html .= '<tr><td style="text-align: center;">' . $k . '</td>'
                    . '<td>';
             if (!empty($v['class'])) {
                 $html .= $v['class'] . $v['type'];
@@ -373,7 +367,7 @@ class PEAR_Exception extends Exception
                    . ':' . (isset($v['line']) ? $v['line'] : 'unknown')
                    . '</td></tr>' . "\n";
         }
-        $html .= '<tr><td align="center">' . ($k+1) . '</td>'
+        $html .= '<tr><td style="text-align: center;">' . ($k+1) . '</td>'
                . '<td>{main}</td>'
                . '<td>&nbsp;</td></tr>' . "\n"
                . '</table>';
@@ -393,5 +387,3 @@ class PEAR_Exception extends Exception
         return $causeMsg . $this->getTraceAsString();
     }
 }
-
-?>

extlib/PEAR5.php

@@ -0,0 +1,33 @@
+<?php
+/**
+ * This is only meant for PHP 5 to get rid of certain strict warning
+ * that doesn't get hidden since it's in the shutdown function
+ */
+class PEAR5
+{
+    /**
+    * If you have a class that's mostly/entirely static, and you need static
+    * properties, you can use this method to simulate them. Eg. in your method(s)
+    * do this: $myVar = &PEAR5::getStaticProperty('myclass', 'myVar');
+    * You MUST use a reference, or they will not persist!
+    *
+    * @access public
+    * @param  string $class  The calling classname, to prevent clashes
+    * @param  string $var    The variable to retrieve.
+    * @return mixed   A reference to the variable. If not set it will be
+    *                 auto initialised to NULL.
+    */
+    static function &getStaticProperty($class, $var)
+    {
+        static $properties;
+        if (!isset($properties[$class])) {
+            $properties[$class] = array();
+        }
+
+        if (!array_key_exists($var, $properties[$class])) {
+            $properties[$class][$var] = null;
+        }
+
+        return $properties[$class][$var];
+    }
+}

extlib/System.php

@@ -0,0 +1,621 @@
+<?php
+/**
+ * File/Directory manipulation
+ *
+ * PHP versions 4 and 5
+ *
+ * @category   pear
+ * @package    System
+ * @author     Tomas V.V.Cox <cox@idecnet.com>
+ * @copyright  1997-2009 The Authors
+ * @license    http://opensource.org/licenses/bsd-license.php New BSD License
+ * @version    CVS: $Id: System.php 307683 2011-01-23 21:56:12Z dufuz $
+ * @link       http://pear.php.net/package/PEAR
+ * @since      File available since Release 0.1
+ */
+
+/**
+ * base class
+ */
+require_once 'PEAR.php';
+require_once 'Console/Getopt.php';
+
+$GLOBALS['_System_temp_files'] = array();
+
+/**
+* System offers cross plattform compatible system functions
+*
+* Static functions for different operations. Should work under
+* Unix and Windows. The names and usage has been taken from its respectively
+* GNU commands. The functions will return (bool) false on error and will
+* trigger the error with the PHP trigger_error() function (you can silence
+* the error by prefixing a '@' sign after the function call, but this
+* is not recommended practice.  Instead use an error handler with
+* {@link set_error_handler()}).
+*
+* Documentation on this class you can find in:
+* http://pear.php.net/manual/
+*
+* Example usage:
+* if (!@System::rm('-r file1 dir1')) {
+*    print "could not delete file1 or dir1";
+* }
+*
+* In case you need to to pass file names with spaces,
+* pass the params as an array:
+*
+* System::rm(array('-r', $file1, $dir1));
+*
+* @category   pear
+* @package    System
+* @author     Tomas V.V. Cox <cox@idecnet.com>
+* @copyright  1997-2006 The PHP Group
+* @license    http://opensource.org/licenses/bsd-license.php New BSD License
+* @version    Release: 1.9.2
+* @link       http://pear.php.net/package/PEAR
+* @since      Class available since Release 0.1
+* @static
+*/
+class System
+{
+    /**
+     * returns the commandline arguments of a function
+     *
+     * @param    string  $argv           the commandline
+     * @param    string  $short_options  the allowed option short-tags
+     * @param    string  $long_options   the allowed option long-tags
+     * @return   array   the given options and there values
+     * @static
+     * @access private
+     */
+    function _parseArgs($argv, $short_options, $long_options = null)
+    {
+        if (!is_array($argv) && $argv !== null) {
+            $argv = preg_split('/\s+/', $argv, -1, PREG_SPLIT_NO_EMPTY);
+        }
+        return Console_Getopt::getopt2($argv, $short_options);
+    }
+
+    /**
+     * Output errors with PHP trigger_error(). You can silence the errors
+     * with prefixing a "@" sign to the function call: @System::mkdir(..);
+     *
+     * @param mixed $error a PEAR error or a string with the error message
+     * @return bool false
+     * @static
+     * @access private
+     */
+    function raiseError($error)
+    {
+        if (PEAR::isError($error)) {
+            $error = $error->getMessage();
+        }
+        trigger_error($error, E_USER_WARNING);
+        return false;
+    }
+
+    /**
+     * Creates a nested array representing the structure of a directory
+     *
+     * System::_dirToStruct('dir1', 0) =>
+     *   Array
+     *    (
+     *    [dirs] => Array
+     *        (
+     *            [0] => dir1
+     *        )
+     *
+     *    [files] => Array
+     *        (
+     *            [0] => dir1/file2
+     *            [1] => dir1/file3
+     *        )
+     *    )
+     * @param    string  $sPath      Name of the directory
+     * @param    integer $maxinst    max. deep of the lookup
+     * @param    integer $aktinst    starting deep of the lookup
+     * @param    bool    $silent     if true, do not emit errors.
+     * @return   array   the structure of the dir
+     * @static
+     * @access   private
+     */
+    function _dirToStruct($sPath, $maxinst, $aktinst = 0, $silent = false)
+    {
+        $struct = array('dirs' => array(), 'files' => array());
+        if (($dir = @opendir($sPath)) === false) {
+            if (!$silent) {
+                System::raiseError("Could not open dir $sPath");
+            }
+            return $struct; // XXX could not open error
+        }
+
+        $struct['dirs'][] = $sPath = realpath($sPath); // XXX don't add if '.' or '..' ?
+        $list = array();
+        while (false !== ($file = readdir($dir))) {
+            if ($file != '.' && $file != '..') {
+                $list[] = $file;
+            }
+        }
+
+        closedir($dir);
+        natsort($list);
+        if ($aktinst < $maxinst || $maxinst == 0) {
+            foreach ($list as $val) {
+                $path = $sPath . DIRECTORY_SEPARATOR . $val;
+                if (is_dir($path) && !is_link($path)) {
+                    $tmp    = System::_dirToStruct($path, $maxinst, $aktinst+1, $silent);
+                    $struct = array_merge_recursive($struct, $tmp);
+                } else {
+                    $struct['files'][] = $path;
+                }
+            }
+        }
+
+        return $struct;
+    }
+
+    /**
+     * Creates a nested array representing the structure of a directory and files
+     *
+     * @param    array $files Array listing files and dirs
+     * @return   array
+     * @static
+     * @see System::_dirToStruct()
+     */
+    function _multipleToStruct($files)
+    {
+        $struct = array('dirs' => array(), 'files' => array());
+        settype($files, 'array');
+        foreach ($files as $file) {
+            if (is_dir($file) && !is_link($file)) {
+                $tmp    = System::_dirToStruct($file, 0);
+                $struct = array_merge_recursive($tmp, $struct);
+            } else {
+                if (!in_array($file, $struct['files'])) {
+                    $struct['files'][] = $file;
+                }
+            }
+        }
+        return $struct;
+    }
+
+    /**
+     * The rm command for removing files.
+     * Supports multiple files and dirs and also recursive deletes
+     *
+     * @param    string  $args   the arguments for rm
+     * @return   mixed   PEAR_Error or true for success
+     * @static
+     * @access   public
+     */
+    function rm($args)
+    {
+        $opts = System::_parseArgs($args, 'rf'); // "f" does nothing but I like it :-)
+        if (PEAR::isError($opts)) {
+            return System::raiseError($opts);
+        }
+        foreach ($opts[0] as $opt) {
+            if ($opt[0] == 'r') {
+                $do_recursive = true;
+            }
+        }
+        $ret = true;
+        if (isset($do_recursive)) {
+            $struct = System::_multipleToStruct($opts[1]);
+            foreach ($struct['files'] as $file) {
+                if (!@unlink($file)) {
+                    $ret = false;
+                }
+            }
+
+            rsort($struct['dirs']);
+            foreach ($struct['dirs'] as $dir) {
+                if (!@rmdir($dir)) {
+                    $ret = false;
+                }
+            }
+        } else {
+            foreach ($opts[1] as $file) {
+                $delete = (is_dir($file)) ? 'rmdir' : 'unlink';
+                if (!@$delete($file)) {
+                    $ret = false;
+                }
+            }
+        }
+        return $ret;
+    }
+
+    /**
+     * Make directories.
+     *
+     * The -p option will create parent directories
+     * @param    string  $args    the name of the director(y|ies) to create
+     * @return   bool    True for success
+     * @static
+     * @access   public
+     */
+    function mkDir($args)
+    {
+        $opts = System::_parseArgs($args, 'pm:');
+        if (PEAR::isError($opts)) {
+            return System::raiseError($opts);
+        }
+
+        $mode = 0777; // default mode
+        foreach ($opts[0] as $opt) {
+            if ($opt[0] == 'p') {
+                $create_parents = true;
+            } elseif ($opt[0] == 'm') {
+                // if the mode is clearly an octal number (starts with 0)
+                // convert it to decimal
+                if (strlen($opt[1]) && $opt[1]{0} == '0') {
+                    $opt[1] = octdec($opt[1]);
+                } else {
+                    // convert to int
+                    $opt[1] += 0;
+                }
+                $mode = $opt[1];
+            }
+        }
+
+        $ret = true;
+        if (isset($create_parents)) {
+            foreach ($opts[1] as $dir) {
+                $dirstack = array();
+                while ((!file_exists($dir) || !is_dir($dir)) &&
+                        $dir != DIRECTORY_SEPARATOR) {
+                    array_unshift($dirstack, $dir);
+                    $dir = dirname($dir);
+                }
+
+                while ($newdir = array_shift($dirstack)) {
+                    if (!is_writeable(dirname($newdir))) {
+                        $ret = false;
+                        break;
+                    }
+
+                    if (!mkdir($newdir, $mode)) {
+                        $ret = false;
+                    }
+                }
+            }
+        } else {
+            foreach($opts[1] as $dir) {
+                if ((@file_exists($dir) || !is_dir($dir)) && !mkdir($dir, $mode)) {
+                    $ret = false;
+                }
+            }
+        }
+
+        return $ret;
+    }
+
+    /**
+     * Concatenate files
+     *
+     * Usage:
+     * 1) $var = System::cat('sample.txt test.txt');
+     * 2) System::cat('sample.txt test.txt > final.txt');
+     * 3) System::cat('sample.txt test.txt >> final.txt');
+     *
+     * Note: as the class use fopen, urls should work also (test that)
+     *
+     * @param    string  $args   the arguments
+     * @return   boolean true on success
+     * @static
+     * @access   public
+     */
+    function &cat($args)
+    {
+        $ret = null;
+        $files = array();
+        if (!is_array($args)) {
+            $args = preg_split('/\s+/', $args, -1, PREG_SPLIT_NO_EMPTY);
+        }
+
+        $count_args = count($args);
+        for ($i = 0; $i < $count_args; $i++) {
+            if ($args[$i] == '>') {
+                $mode = 'wb';
+                $outputfile = $args[$i+1];
+                break;
+            } elseif ($args[$i] == '>>') {
+                $mode = 'ab+';
+                $outputfile = $args[$i+1];
+                break;
+            } else {
+                $files[] = $args[$i];
+            }
+        }
+        $outputfd = false;
+        if (isset($mode)) {
+            if (!$outputfd = fopen($outputfile, $mode)) {
+                $err = System::raiseError("Could not open $outputfile");
+                return $err;
+            }
+            $ret = true;
+        }
+        foreach ($files as $file) {
+            if (!$fd = fopen($file, 'r')) {
+                System::raiseError("Could not open $file");
+                continue;
+            }
+            while ($cont = fread($fd, 2048)) {
+                if (is_resource($outputfd)) {
+                    fwrite($outputfd, $cont);
+                } else {
+                    $ret .= $cont;
+                }
+            }
+            fclose($fd);
+        }
+        if (is_resource($outputfd)) {
+            fclose($outputfd);
+        }
+        return $ret;
+    }
+
+    /**
+     * Creates temporary files or directories. This function will remove
+     * the created files when the scripts finish its execution.
+     *
+     * Usage:
+     *   1) $tempfile = System::mktemp("prefix");
+     *   2) $tempdir  = System::mktemp("-d prefix");
+     *   3) $tempfile = System::mktemp();
+     *   4) $tempfile = System::mktemp("-t /var/tmp prefix");
+     *
+     * prefix -> The string that will be prepended to the temp name
+     *           (defaults to "tmp").
+     * -d     -> A temporary dir will be created instead of a file.
+     * -t     -> The target dir where the temporary (file|dir) will be created. If
+     *           this param is missing by default the env vars TMP on Windows or
+     *           TMPDIR in Unix will be used. If these vars are also missing
+     *           c:\windows\temp or /tmp will be used.
+     *
+     * @param   string  $args  The arguments
+     * @return  mixed   the full path of the created (file|dir) or false
+     * @see System::tmpdir()
+     * @static
+     * @access  public
+     */
+    function mktemp($args = null)
+    {
+        static $first_time = true;
+        $opts = System::_parseArgs($args, 't:d');
+        if (PEAR::isError($opts)) {
+            return System::raiseError($opts);
+        }
+
+        foreach ($opts[0] as $opt) {
+            if ($opt[0] == 'd') {
+                $tmp_is_dir = true;
+            } elseif ($opt[0] == 't') {
+                $tmpdir = $opt[1];
+            }
+        }
+
+        $prefix = (isset($opts[1][0])) ? $opts[1][0] : 'tmp';
+        if (!isset($tmpdir)) {
+            $tmpdir = System::tmpdir();
+        }
+
+        if (!System::mkDir(array('-p', $tmpdir))) {
+            return false;
+        }
+
+        $tmp = tempnam($tmpdir, $prefix);
+        if (isset($tmp_is_dir)) {
+            unlink($tmp); // be careful possible race condition here
+            if (!mkdir($tmp, 0700)) {
+                return System::raiseError("Unable to create temporary directory $tmpdir");
+            }
+        }
+
+        $GLOBALS['_System_temp_files'][] = $tmp;
+        if (isset($tmp_is_dir)) {
+            //$GLOBALS['_System_temp_files'][] = dirname($tmp);
+        }
+
+        if ($first_time) {
+            PEAR::registerShutdownFunc(array('System', '_removeTmpFiles'));
+            $first_time = false;
+        }
+
+        return $tmp;
+    }
+
+    /**
+     * Remove temporary files created my mkTemp. This function is executed
+     * at script shutdown time
+     *
+     * @static
+     * @access private
+     */
+    function _removeTmpFiles()
+    {
+        if (count($GLOBALS['_System_temp_files'])) {
+            $delete = $GLOBALS['_System_temp_files'];
+            array_unshift($delete, '-r');
+            System::rm($delete);
+            $GLOBALS['_System_temp_files'] = array();
+        }
+    }
+
+    /**
+     * Get the path of the temporal directory set in the system
+     * by looking in its environments variables.
+     * Note: php.ini-recommended removes the "E" from the variables_order setting,
+     * making unavaible the $_ENV array, that s why we do tests with _ENV
+     *
+     * @static
+     * @return string The temporary directory on the system
+     */
+    function tmpdir()
+    {
+        if (OS_WINDOWS) {
+            if ($var = isset($_ENV['TMP']) ? $_ENV['TMP'] : getenv('TMP')) {
+                return $var;
+            }
+            if ($var = isset($_ENV['TEMP']) ? $_ENV['TEMP'] : getenv('TEMP')) {
+                return $var;
+            }
+            if ($var = isset($_ENV['USERPROFILE']) ? $_ENV['USERPROFILE'] : getenv('USERPROFILE')) {
+                return $var;
+            }
+            if ($var = isset($_ENV['windir']) ? $_ENV['windir'] : getenv('windir')) {
+                return $var;
+            }
+            return getenv('SystemRoot') . '\temp';
+        }
+        if ($var = isset($_ENV['TMPDIR']) ? $_ENV['TMPDIR'] : getenv('TMPDIR')) {
+            return $var;
+        }
+        return realpath('/tmp');
+    }
+
+    /**
+     * The "which" command (show the full path of a command)
+     *
+     * @param string $program The command to search for
+     * @param mixed  $fallback Value to return if $program is not found
+     *
+     * @return mixed A string with the full path or false if not found
+     * @static
+     * @author Stig Bakken <ssb@php.net>
+     */
+    function which($program, $fallback = false)
+    {
+        // enforce API
+        if (!is_string($program) || '' == $program) {
+            return $fallback;
+        }
+
+        // full path given
+        if (basename($program) != $program) {
+            $path_elements[] = dirname($program);
+            $program = basename($program);
+        } else {
+            // Honor safe mode
+            if (!ini_get('safe_mode') || !$path = ini_get('safe_mode_exec_dir')) {
+                $path = getenv('PATH');
+                if (!$path) {
+                    $path = getenv('Path'); // some OSes are just stupid enough to do this
+                }
+            }
+            $path_elements = explode(PATH_SEPARATOR, $path);
+        }
+
+        if (OS_WINDOWS) {
+            $exe_suffixes = getenv('PATHEXT')
+                                ? explode(PATH_SEPARATOR, getenv('PATHEXT'))
+                                : array('.exe','.bat','.cmd','.com');
+            // allow passing a command.exe param
+            if (strpos($program, '.') !== false) {
+                array_unshift($exe_suffixes, '');
+            }
+            // is_executable() is not available on windows for PHP4
+            $pear_is_executable = (function_exists('is_executable')) ? 'is_executable' : 'is_file';
+        } else {
+            $exe_suffixes = array('');
+            $pear_is_executable = 'is_executable';
+        }
+
+        foreach ($exe_suffixes as $suff) {
+            foreach ($path_elements as $dir) {
+                $file = $dir . DIRECTORY_SEPARATOR . $program . $suff;
+                if (@$pear_is_executable($file)) {
+                    return $file;
+                }
+            }
+        }
+        return $fallback;
+    }
+
+    /**
+     * The "find" command
+     *
+     * Usage:
+     *
+     * System::find($dir);
+     * System::find("$dir -type d");
+     * System::find("$dir -type f");
+     * System::find("$dir -name *.php");
+     * System::find("$dir -name *.php -name *.htm*");
+     * System::find("$dir -maxdepth 1");
+     *
+     * Params implmented:
+     * $dir            -> Start the search at this directory
+     * -type d         -> return only directories
+     * -type f         -> return only files
+     * -maxdepth <n>   -> max depth of recursion
+     * -name <pattern> -> search pattern (bash style). Multiple -name param allowed
+     *
+     * @param  mixed Either array or string with the command line
+     * @return array Array of found files
+     * @static
+     *
+     */
+    function find($args)
+    {
+        if (!is_array($args)) {
+            $args = preg_split('/\s+/', $args, -1, PREG_SPLIT_NO_EMPTY);
+        }
+        $dir = realpath(array_shift($args));
+        if (!$dir) {
+            return array();
+        }
+        $patterns = array();
+        $depth = 0;
+        $do_files = $do_dirs = true;
+        $args_count = count($args);
+        for ($i = 0; $i < $args_count; $i++) {
+            switch ($args[$i]) {
+                case '-type':
+                    if (in_array($args[$i+1], array('d', 'f'))) {
+                        if ($args[$i+1] == 'd') {
+                            $do_files = false;
+                        } else {
+                            $do_dirs = false;
+                        }
+                    }
+                    $i++;
+                    break;
+                case '-name':
+                    $name = preg_quote($args[$i+1], '#');
+                    // our magic characters ? and * have just been escaped,
+                    // so now we change the escaped versions to PCRE operators
+                    $name = strtr($name, array('\?' => '.', '\*' => '.*'));
+                    $patterns[] = '('.$name.')';
+                    $i++;
+                    break;
+                case '-maxdepth':
+                    $depth = $args[$i+1];
+                    break;
+            }
+        }
+        $path = System::_dirToStruct($dir, $depth, 0, true);
+        if ($do_files && $do_dirs) {
+            $files = array_merge($path['files'], $path['dirs']);
+        } elseif ($do_dirs) {
+            $files = $path['dirs'];
+        } else {
+            $files = $path['files'];
+        }
+        if (count($patterns)) {
+            $dsq = preg_quote(DIRECTORY_SEPARATOR, '#');
+            $pattern = '#(^|'.$dsq.')'.implode('|', $patterns).'($|'.$dsq.')#';
+            $ret = array();
+            $files_count = count($files);
+            for ($i = 0; $i < $files_count; $i++) {
+                // only search in the part of the file below the current directory
+                $filepart = basename($files[$i]);
+                if (preg_match($pattern, $filepart)) {
+                    $ret[] = $files[$i];
+                }
+            }
+            return $ret;
+        }
+        return $files;
+    }
+}

js/css/smoothness/jquery-ui.css

@@ -0,0 +1,573 @@
+/*
+ * jQuery UI CSS Framework 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+ * jQuery UI CSS Framework 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; }
+.ui-widget-content a { color: #222222; }
+.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; }
+.ui-widget-header a { color: #222222; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight  {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary,  .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-right {  -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/*
+ * jQuery UI Resizable 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizable#theming
+ */
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
+ * jQuery UI Selectable 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectable#theming
+ */
+.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
+/*
+ * jQuery UI Accordion 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion#theming
+ */
+/* IE/Win - Fix animation bug - #4615 */
+.ui-accordion { width: 100%; }
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }
+/*
+ * jQuery UI Autocomplete 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }	
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/*
+ * jQuery UI Menu 1.8.10
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+	list-style:none;
+	padding: 2px;
+	margin: 0;
+	display:block;
+	float: left;
+}
+.ui-menu .ui-menu {
+	margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+	margin:0;
+	padding: 0;
+	zoom: 1;
+	float: left;
+	clear: left;
+	width: 100%;
+}
+.ui-menu .ui-menu-item a {
+	text-decoration:none;
+	display:block;
+	padding:.2em .4em;
+	line-height:1.5;
+	zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+	font-weight: normal;
+	margin: -1px;
+}
+/*
+ * jQuery UI Button 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button#theming
+ */
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; } 
+button.ui-button-icons-only { width: 3.7em; } 
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4;  }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+/*
+ * jQuery UI Dialog 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog#theming
+ */
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative;  }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } 
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
+.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/*
+ * jQuery UI Slider 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider#theming
+ */
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/*
+ * jQuery UI Tabs 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs#theming
+ */
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
+/*
+ * jQuery UI Datepicker 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker#theming
+ */
+.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px;  }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month, 
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0;  }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+    display: none; /*sorry for IE5*/
+    display/**/: block; /*sorry for IE5*/
+    position: absolute; /*must have*/
+    z-index: -1; /*must have*/
+    filter: mask(); /*must have*/
+    top: -4px; /*must have*/
+    left: -4px; /*must have*/
+    width: 200px; /*must have*/
+    height: 200px; /*must have*/
+}/*
+ * jQuery UI Progressbar 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar#theming
+ */
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }

js/jquery-ui.min.js

@@ -0,0 +1,782 @@
+/*!
+ * jQuery UI 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.10",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,
+NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,
+"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");
+if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f,
+"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,
+d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}});
+c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&
+b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery);
+;/*!
+ * jQuery UI Widget 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,
+a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h;
+e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options,
+this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},
+widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},
+enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
+;/*!
+ * jQuery UI Mouse 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ *	jquery.ui.widget.js
+ */
+(function(c){c.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(b){return a._mouseDown(b)}).bind("click."+this.widgetName,function(b){if(true===c.data(b.target,a.widgetName+".preventClickEvent")){c.removeData(b.target,a.widgetName+".preventClickEvent");b.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(a){a.originalEvent=
+a.originalEvent||{};if(!a.originalEvent.mouseHandled){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var b=this,e=a.which==1,f=typeof this.options.cancel=="string"?c(a.target).parents().add(a.target).filter(this.options.cancel).length:false;if(!e||f||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){b.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=
+this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();return true}}this._mouseMoveDelegate=function(d){return b._mouseMove(d)};this._mouseUpDelegate=function(d){return b._mouseUp(d)};c(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return a.originalEvent.mouseHandled=true}},_mouseMove:function(a){if(c.browser.msie&&!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);
+return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;a.target==this._mouseDownEvent.target&&c.data(a.target,this.widgetName+".preventClickEvent",
+true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
+;/*
+ * jQuery UI Position 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
+left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
+k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
+m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
+d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
+a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
+g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
+;/*
+ * jQuery UI Draggable 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
+"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
+this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-
+this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();
+d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||
+this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&
+this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
+a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||
+0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-
+(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment==
+"parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?
+0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),
+10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}}else if(a.containment.constructor==
+Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():
+f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;
+if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])e=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/
+b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;e=this.originalPageX+Math.round((e-this.originalPageX)/b.grid[0])*b.grid[0];e=this.containment?!(e-this.offset.click.left<this.containment[0]||e-this.offset.click.left>this.containment[2])?e:!(e-this.offset.click.left<this.containment[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:g-this.offset.click.top-
+this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=
+this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.10"});
+d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var g=d.data(this,"sortable");if(g&&!g.options.disabled){c.sortables.push({instance:g,shouldRevert:g.options.revert});g._refreshItems();g._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=
+0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=
+c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,
+true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=
+0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=
+a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","iframeFix",{start:function(){var a=d(this).data("draggable").options;d(a.iframeFix===true?"iframe":a.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})},
+stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=
+document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-
+c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-
+(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable",
+"snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,g=b.offset.left,n=g+c.helperProportions.width,m=b.offset.top,o=m+c.helperProportions.height,h=
+c.snapElements.length-1;h>=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e<g&&g<k+e&&j-e<m&&m<l+e||i-e<g&&g<k+e&&j-e<o&&o<l+e||i-e<n&&n<k+e&&j-e<m&&m<l+e||i-e<n&&n<k+e&&j-e<o&&o<l+e){if(f.snapMode!="inner"){var p=Math.abs(j-o)<=e,q=Math.abs(l-m)<=e,r=Math.abs(i-n)<=e,s=Math.abs(k-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",
+{top:l,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k}).left-c.margins.left}var t=p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(j-m)<=e;q=Math.abs(l-o)<=e;r=Math.abs(i-g)<=e;s=Math.abs(k-n)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l-c.helperProportions.height,
+left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[h].snapping&&(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=p||q||r||s||t}else{c.snapElements[h].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,
+a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,
+b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery);
+;/*
+ * jQuery UI Droppable 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.draggable.js
+ */
+(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this);
+a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&
+this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
+this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=
+d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
+a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.10"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height;
+switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>=
+i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!=
+"none";if(c[f].visible){c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight};e=="mousedown"&&c[f]._activate.call(c[f],b)}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem||
+a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=
+d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})}}})(jQuery);
+;/*
+ * jQuery UI Resizable 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element,
+_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
+top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
+this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
+nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
+String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
+this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){e(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};
+if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),
+d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=
+this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:
+this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",
+b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;
+f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");
+this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=
+null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=l(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=l(b.width)&&a.minWidth&&a.minWidth>b.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+
+this.size.height,k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=
+[c.css("borderTopWidth"),c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)||0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=
+this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,
+a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,
+c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,
+originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.10"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=
+b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width",
+"height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};
+if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-
+g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,
+height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=
+e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,
+d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?
+d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=
+a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&
+/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");
+b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/
+(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
+;/*
+ * jQuery UI Selectable 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),
+selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX,
+c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",
+c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d=
+this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting");
+a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&&
+!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d=
+e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.10"})})(jQuery);
+;/*
+ * jQuery UI Sortable 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable");
+this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,
+arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=
+c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,
+{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();
+if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",
+a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");
+if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+
+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()-b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+
+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+
+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,
+c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==
+document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var b=this.containers.length-
+1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});
+this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},toArray:function(a){var b=this._getItemsAsjQuery(a&&
+a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||this.options.tolerance!="pointer"&&this.helperProportions[this.floating?
+"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection();var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?
+c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)},_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;
+return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=
+d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});
+return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element),this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=
+d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&&this.helper)this.offset.parent=
+this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b],e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=
+e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];
+if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);
+c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===
+1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=
+this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):
+b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width==""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==
+""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=
+this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),
+10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions=
+{width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||
+document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,
+b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=
+document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():
+e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-
+this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<
+this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&
+this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=
+this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();
+this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove",f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],
+this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",
+g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||
+this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,
+originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.10"})})(jQuery);
+;/*
+ * jQuery UI Accordion 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");
+a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion",
+function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a=this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+
+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex");
+this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons();
+b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target);
+a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+
+c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options;
+if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);
+if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(),
+e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight||
+e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false",
+tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.10",animations:{slide:function(a,b){a=
+c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/);f[i]={value:j[1],
+unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide",paddingTop:"hide",
+paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery);
+;/*
+ * jQuery UI Autocomplete 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.position.js
+ */
+(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g=false;var f=d.ui.keyCode;
+switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=a.element.val()){a.selectedItem=
+null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||
+"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&&a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),
+i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");
+this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&&b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source===
+"string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},
+_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==
+this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label||b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position))},
+_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this;d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);
+else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery);
+(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
+-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.attr("scrollTop"),c=this.element.height();if(b<0)this.element.attr("scrollTop",g+b);else b>=c&&this.element.attr("scrollTop",g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},
+deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);
+e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,
+g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));
+this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery);
+;/*
+ * jQuery UI Button 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function(a){var g,i=function(b){a(":ui-button",b.target.form).each(function(){var c=a(this).data("button");setTimeout(function(){c.refresh()},1)})},h=function(b){var c=b.name,d=b.form,f=a([]);if(c)f=d?a(d).find("[name='"+c+"']"):a("[name='"+c+"']",b.ownerDocument).filter(function(){return!this.form});return f};a.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",
+i);if(typeof this.options.disabled!=="boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var b=this,c=this.options,d=this.type==="checkbox"||this.type==="radio",f="ui-state-hover"+(!d?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",
+function(){if(!c.disabled){a(this).addClass("ui-state-hover");this===g&&a(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||a(this).removeClass(f)}).bind("focus.button",function(){a(this).addClass("ui-state-focus")}).bind("blur.button",function(){a(this).removeClass("ui-state-focus")});d&&this.element.bind("change.button",function(){b.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).toggleClass("ui-state-active");
+b.buttonElement.attr("aria-pressed",b.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");b.buttonElement.attr("aria-pressed",true);var e=b.element[0];h(e).not(e).map(function(){return a(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");
+g=this;a(document).one("mouseup",function(){g=null})}).bind("mouseup.button",function(){if(c.disabled)return false;a(this).removeClass("ui-state-active")}).bind("keydown.button",function(e){if(c.disabled)return false;if(e.keyCode==a.ui.keyCode.SPACE||e.keyCode==a.ui.keyCode.ENTER)a(this).addClass("ui-state-active")}).bind("keyup.button",function(){a(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(e){e.keyCode===a.ui.keyCode.SPACE&&a(this).click()})}this._setOption("disabled",
+c.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type==="radio"){this.buttonElement=this.element.parents().last().find("label[for="+this.element.attr("id")+"]");this.element.addClass("ui-helper-hidden-accessible");var b=this.element.is(":checked");b&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",b)}else this.buttonElement=
+this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active  ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle||
+this.buttonElement.removeAttr("title");a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments);if(b==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var b=this.element.is(":disabled");b!==this.options.disabled&&this._setOption("disabled",b);if(this.type==="radio")h(this.element[0]).each(function(){a(this).is(":checked")?a(this).button("widget").addClass("ui-state-active").attr("aria-pressed",
+true):a(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var b=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"),
+c=a("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,f=d.primary&&d.secondary,e=[];if(d.primary||d.secondary){e.push("ui-button-text-icon"+(f?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>");d.secondary&&b.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>");if(!this.options.text){e.push(f?"ui-button-icons-only":"ui-button-icon-only");
+b.removeClass("ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary");this.hasTitle||b.attr("title",c)}}else e.push("ui-button-text-only");b.addClass(e.join(" "))}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,
+arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");
+a.Widget.prototype.destroy.call(this)}})})(jQuery);
+;/*
+ * jQuery UI Dialog 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *  jquery.ui.button.js
+ *	jquery.ui.draggable.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.position.js
+ *	jquery.ui.resizable.js
+ */
+(function(c,j){var k={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},l={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&
+c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||"&#160;",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",
+-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role",
+"button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=
+b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");a.uiDialog.remove();a.originalTitle&&
+a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==b.uiDialog[0]){e=c(this).css("z-index");
+isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);
+d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===f[0]&&e.shiftKey){g.focus(1);return false}}});
+c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,function(f,
+h){h=c.isFunction(h)?{click:h,text:f}:h;f=c('<button type="button"></button>').attr(h,true).unbind("click").click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.fn.button&&f.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=
+d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,originalSize:f.originalSize,
+position:f.position,size:f.size}}a=a===j?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",f,b(h))},stop:function(f,
+h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):[a[0],a[1]];if(b.length===
+1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);if(g in k)e=true;if(g in
+l)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):e.removeClass("ui-dialog-disabled");
+break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||"&#160;"));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=this.options,b,d,e=
+this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-b,0));this.uiDialog.is(":data(resizable)")&&
+this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.10",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(a){if(this.instances.length===
+0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),
+height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);
+b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,
+function(){a=a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);
+;/*
+ * jQuery UI Slider 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var b=this,a=this.options;this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");a.disabled&&this.element.addClass("ui-slider-disabled ui-disabled");
+this.range=d([]);if(a.range){if(a.range===true){this.range=d("<div></div>");if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}else this.range=d("<div></div>");this.range.appendTo(this.element).addClass("ui-slider-range");if(a.range==="min"||a.range==="max")this.range.addClass("ui-slider-range-"+a.range);this.range.addClass("ui-widget-header")}d(".ui-slider-handle",this.element).length===0&&d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");
+if(a.values&&a.values.length)for(;d(".ui-slider-handle",this.element).length<a.values.length;)d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");this.handles=d(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(c){c.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();
+else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(c){d(this).data("index.ui-slider-handle",c)});this.handles.keydown(function(c){var e=true,f=d(this).data("index.ui-slider-handle"),h,g,i;if(!b.options.disabled){switch(c.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:e=
+false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");h=b._start(c,f);if(h===false)return}break}i=b.options.step;h=b.options.values&&b.options.values.length?(g=b.values(f)):(g=b.value());switch(c.keyCode){case d.ui.keyCode.HOME:g=b._valueMin();break;case d.ui.keyCode.END:g=b._valueMax();break;case d.ui.keyCode.PAGE_UP:g=b._trimAlignValue(h+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:g=b._trimAlignValue(h-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(h===
+b._valueMax())return;g=b._trimAlignValue(h+i);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(h===b._valueMin())return;g=b._trimAlignValue(h-i);break}b._slide(c,f,g);return e}}).keyup(function(c){var e=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(c,e);b._change(c,e);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");
+this._mouseDestroy();return this},_mouseCapture:function(b){var a=this.options,c,e,f,h,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});e=this._valueMax()-this._valueMin()+1;h=this;this.handles.each(function(i){var j=Math.abs(c-h.values(i));if(e>j){e=j;f=d(this);g=i}});if(a.range===true&&this.values(1)===a.min){g+=1;f=d(this.handles[g])}if(this._start(b,
+g)===false)return false;this._mouseSliding=true;h._handleIndex=g;f.addClass("ui-state-active").focus();a=f.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-f.width()/2,top:b.pageY-a.top-f.height()/2-(parseInt(f.css("borderTopWidth"),10)||0)-(parseInt(f.css("borderBottomWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true},
+_mouseDrag:function(b){var a=this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;
+if(this.orientation==="horizontal"){a=this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=
+this.values(a);c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var e;if(this.options.values&&this.options.values.length){e=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>e||a===1&&c<e))c=e;if(c!==this.values(a)){e=this.values();e[a]=c;b=this._trigger("slide",b,{handle:this.handles[a],value:c,values:e});this.values(a?0:1);b!==false&&this.values(a,c,true)}}else if(c!==this.value()){b=this._trigger("slide",b,{handle:this.handles[a],
+value:c});b!==false&&this.value(c)}},_stop:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("stop",b,c)},_change:function(b,a){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("change",b,c)}},value:function(b){if(arguments.length){this.options.value=
+this._trimAlignValue(b);this._refreshValue();this._change(null,0)}return this._value()},values:function(b,a){var c,e,f;if(arguments.length>1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;e=arguments[0];for(f=0;f<c.length;f+=1){c[f]=this._trimAlignValue(e[f]);this._change(null,f)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(b):this.value();
+else return this._values()},_setOption:function(b,a){var c,e=0;if(d.isArray(this.options.values))e=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(b){case "disabled":if(a){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation();
+this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<e;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var b=this.options.value;return b=this._trimAlignValue(b)},_values:function(b){var a,c;if(arguments.length){a=this.options.values[b];
+return a=this._trimAlignValue(a)}else{a=this.options.values.slice();for(c=0;c<a.length;c+=1)a[c]=this._trimAlignValue(a[c]);return a}},_trimAlignValue:function(b){if(b<=this._valueMin())return this._valueMin();if(b>=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},
+_refreshValue:function(){var b=this.options.range,a=this.options,c=this,e=!this._animateOff?a.animate:false,f,h={},g,i,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(k){f=(c.values(k)-c._valueMin())/(c._valueMax()-c._valueMin())*100;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";d(this).stop(1,1)[e?"animate":"css"](h,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(k===0)c.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},a.animate);
+if(k===1)c.range[e?"animate":"css"]({width:f-g+"%"},{queue:false,duration:a.animate})}else{if(k===0)c.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},a.animate);if(k===1)c.range[e?"animate":"css"]({height:f-g+"%"},{queue:false,duration:a.animate})}g=f});else{i=this.value();j=this._valueMin();l=this._valueMax();f=l!==j?(i-j)/(l-j)*100:0;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";this.handle.stop(1,1)[e?"animate":"css"](h,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1,
+1)[e?"animate":"css"]({width:f+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[e?"animate":"css"]({width:100-f+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-f+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.10"})})(jQuery);
+;/*
+ * jQuery UI Tabs 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading&#8230;</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&&
+e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=
+d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]||
+(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");
+this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected=
+this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");
+if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"));
+this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+
+g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal",
+function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")};
+this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected=
+-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier.";
+d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e=
+d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b,
+e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]);
+j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove();
+if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null,
+this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this},
+load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c,
+"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},
+url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.10"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&&
+a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery);
+;/*
+ * jQuery UI Datepicker 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ */
+(function(d,G){function K(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass=
+"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su",
+"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",
+minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}function E(a,b){d.extend(a,b);for(var c in b)if(b[c]==
+null||b[c]==G)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.10"}});var y=(new Date).getTime();d.extend(K.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){E(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();
+f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}},
+_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&
+b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==
+""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,
+c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),
+true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}E(a.settings,e||{});
+b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);
+this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",
+this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,
+function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:
+f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false},_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?d.extend({},
+e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&this._hideDatepicker();var h=this._getDateDatepicker(a,true);E(e.settings,f);this._attachments(d(a),e);this._autoSize(e);this._setDateDatepicker(a,h);this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a,b);
+this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl");b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass+":not(."+d.datepicker._currentClass+")",b.dpDiv);c[0]?
+d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]):d.datepicker._hideDatepicker();return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target);c=a.ctrlKey||
+a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,
+e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b=d.datepicker._getInst(a.target);if(d.datepicker._get(b,
+"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));var c=String.fromCharCode(a.charCode==G?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},
+_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");E(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=
+d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,
+c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){d.datepicker._datepickerShowing=true;var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.effects&&
+d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){var b=this,c=d.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a));var e=a.dpDiv.find("iframe.ui-datepicker-cover");e.length&&e.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",
+function(){d(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!b._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=
+-1&&d(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();c=this._getNumberOfMonths(a);e=c[1];e>1?a.dpDiv.addClass("ui-datepicker-multi-"+e).css("width",17*e+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(c[0]!=1||c[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,
+"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var f=a.yearshtml;setTimeout(function(){f===a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);f=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),
+parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,
+b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);
+this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},
+_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):
+0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=
+false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=
+d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);
+else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=
+a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,
+g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=z+1<a.length&&a.charAt(z+1)==p)&&z++;return p},m=function(p){var v=o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"&&v?4:p=="o"?3:2)+"}");p=b.substring(s).match(p);if(!p)throw"Missing number at position "+s;s+=p[0].length;return parseInt(p[0],10)},n=function(p,v,H){p=o(p)?H:v;for(v=0;v<p.length;v++)if(b.substr(s,p[v].length).toLowerCase()==p[v].toLowerCase()){s+=p[v].length;return v+1}throw"Unknown name at position "+
+s;},r=function(){if(b.charAt(s)!=a.charAt(z))throw"Unexpected literal at position "+s;s++},s=0,z=0;z<a.length;z++)if(k)if(a.charAt(z)=="'"&&!o("'"))k=false;else r();else switch(a.charAt(z)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":j=m("m");break;case "M":j=n("M",i,g);break;case "y":c=m("y");break;case "@":var w=new Date(m("@"));c=w.getFullYear();j=w.getMonth()+1;l=w.getDate();break;case "!":w=new Date((m("!")-this._ticksTo1970)/1E4);c=w.getFullYear();j=w.getMonth()+
+1;l=w.getDate();break;case "'":if(o("'"))r();else k=true;break;default:r()}if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}w=this._daylightSavingAdjust(new Date(c,j-1,l));if(w.getFullYear()!=c||w.getMonth()+1!=j||w.getDate()!=l)throw"Invalid date";return w},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",
+RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+1<a.length&&
+a.charAt(k+1)==o)&&k++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length<n;)m="0"+m;return m},j=function(o,m,n,r){return i(o)?r[m]:n[m]},l="",u=false;if(b)for(var k=0;k<a.length;k++)if(u)if(a.charAt(k)=="'"&&!i("'"))u=false;else l+=a.charAt(k);else switch(a.charAt(k)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=j("D",b.getDay(),e,f);break;case "o":l+=g("o",(b.getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864E5,3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=j("M",
+b.getMonth(),h,c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(k)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+=
+"0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==G?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth=
+f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date;i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g=
+(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,j=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,k=u.exec(h);k;){switch(k[2]||"d"){case "d":case "D":g+=parseInt(k[1],10);break;case "w":case "W":g+=parseInt(k[1],10)*7;break;case "m":case "M":l+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break;case "y":case "Y":j+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break}k=u.exec(h)}return new Date(j,
+l,g)};if(b=(b=b==null||b===""?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):new Date(b.getTime()))&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=
+a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),
+b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=
+this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&n<k?k:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', -"+j+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+
+(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var r=this._get(a,"nextText");r=!h?r:this.formatDate(r,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', +"+j+", 'M');\" title=\""+r+'"><span class="ui-icon ui-icon-circle-triangle-'+
+(c?"w":"e")+'">'+r+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+r+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+r+"</span></a>";j=this._get(a,"currentText");r=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,r,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+y+'.datepicker._hideDatepicker();">'+this._get(a,
+"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,r)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._gotoToday('#"+a.id+"');\">"+j+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),z=
+this._get(a,"monthNames"),w=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),v=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var L=this._getDefaultDate(a),I="",C=0;C<i[0];C++){for(var M="",D=0;D<i[1];D++){var N=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",x="";if(l){x+='<div class="ui-datepicker-group';if(i[1]>1)switch(D){case 0:x+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-
+1:x+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:x+=" ui-datepicker-group-middle";t="";break}x+='">'}x+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&&C==0?c?f:n:"")+(/all|right/.test(t)&&C==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,C>0||D>0,z,w)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var A=j?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(t=0;t<7;t++){var q=
+(t+h)%7;A+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+r[q]+'">'+s[q]+"</span></th>"}x+=A+"</tr></thead><tbody>";A=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,A);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;A=l?6:Math.ceil((t+A)/7);q=this._daylightSavingAdjust(new Date(m,g,1-t));for(var O=0;O<A;O++){x+="<tr>";var P=!j?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(q)+"</td>";for(t=0;t<7;t++){var F=
+p?p.apply(a.input?a.input[0]:null,[q]):[true,""],B=q.getMonth()!=g,J=B&&!H||!F[0]||k&&q<k||o&&q>o;P+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(B?" ui-datepicker-other-month":"")+(q.getTime()==N.getTime()&&g==a.selectedMonth&&a._keyEvent||L.getTime()==q.getTime()&&L.getTime()==N.getTime()?" "+this._dayOverClass:"")+(J?" "+this._unselectableClass+" ui-state-disabled":"")+(B&&!v?"":" "+F[1]+(q.getTime()==u.getTime()?" "+this._currentClass:"")+(q.getTime()==b.getTime()?" ui-datepicker-today":
+""))+'"'+((!B||v)&&F[2]?' title="'+F[2]+'"':"")+(J?"":' onclick="DP_jQuery_'+y+".datepicker._selectDay('#"+a.id+"',"+q.getMonth()+","+q.getFullYear()+', this);return false;"')+">"+(B&&!v?"&#xa0;":J?'<span class="ui-state-default">'+q.getDate()+"</span>":'<a class="ui-state-default'+(q.getTime()==b.getTime()?" ui-state-highlight":"")+(q.getTime()==u.getTime()?" ui-state-active":"")+(B?" ui-priority-secondary":"")+'" href="#">'+q.getDate()+"</a>")+"</td>";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}x+=
+P+"</tr>"}g++;if(g>11){g=0;m++}x+="</tbody></table>"+(l?"</div>"+(i[0]>0&&D==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");M+=x}I+=M}I+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");a._keyEvent=false;return I},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='<div class="ui-datepicker-title">',
+o="";if(h||!j)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&(!m||n<=f.getMonth()))o+='<option value="'+n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(k+=o+(h||!(j&&
+l)?"&#xa0;":""));a.yearshtml="";if(h||!l)k+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?r:s};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+
+a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";b<=g;b++)a.yearshtml+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";a.yearshtml+="</select>";if(d.browser.mozilla)k+='<select class="ui-datepicker-year"><option value="'+c+'" selected="selected">'+c+"</option></select>";else{k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?"&#xa0;":"")+o;k+="</div>";return k},_adjustInstDate:function(a,b,c){var e=
+a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,
+"onChangeMonthYear");if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);
+c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,
+"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=
+function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,
+[this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new K;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.10";window["DP_jQuery_"+y]=d})(jQuery);
+;/*
+ * jQuery UI Progressbar 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ *   jquery.ui.core.js
+ *   jquery.ui.widget.js
+ */
+(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");
+this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*
+this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.10"})})(jQuery);
+;/*
+ * jQuery UI Effects 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+jQuery.effects||function(f,j){function n(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1],
+16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return o.transparent;return o[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return n(b)}function p(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,
+a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function q(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d=
+a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function m(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor",
+"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=n(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var o={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,
+0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,
+211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},r=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b,
+d){if(f.isFunction(b)){d=b;b=null}return this.queue("fx",function(){var e=f(this),g=e.attr("style")||" ",h=q(p.call(this)),l,v=e.attr("className");f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});l=q(p.call(this));e.attr("className",v);e.animate(u(h,l),a,b,function(){f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments)});h=f.queue(this);l=h.splice(h.length-1,1)[0];
+h.splice(1,0,l);f.dequeue(this)})};f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,
+a):f.effects.animateClass.apply(this,[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.10",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c,
+a){var b;switch(c[0]){case "top":b=0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",
+border:"none",margin:0,padding:0});c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);
+return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(m(c))return this._show.apply(this,arguments);
+else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(m(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(m(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),
+b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,
+a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,
+a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==
+e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=
+g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/
+h);if(a<1)return-0.5*h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c,
+a,b,d,e){return d-f.easing.easeOutBounce(c,e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,d,e)*0.5+b;return f.easing.easeOutBounce(c,a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery);
+;/*
+ * jQuery UI Effects Blind 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","bottom","left","right"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a,
+g);b.effects.removeWrapper(a);c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery);
+;/*
+ * jQuery UI Effects Bounce 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","bottom","left","right"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/
+3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a);
+b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery);
+;/*
+ * jQuery UI Effects Clip 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","bottom","left","right","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position,
+c/2)}var h={};h[g.size]=f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Drop 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e==
+"show"?1:0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Explode 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f=
+0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+
+e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery);
+;/*
+ * jQuery UI Effects Fade 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Fade
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Fold 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1],
+10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery);
+;/*
+ * jQuery UI Effects Highlight 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&&
+this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Pulsate 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration,
+a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery);
+;/*
+ * jQuery UI Effects Scale 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a,
+b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity=
+1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","bottom","left","right","width","height","overflow","opacity"],g=["position","top","bottom","left","right","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],
+p=c.effects.setMode(a,b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}};
+if(m=="box"||m=="both"){if(d.from.y!=d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a);
+a.css("overflow","hidden").css(a.from);if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from);
+child.to=c.effects.setTransition(child,f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a,
+n?e:g);c.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Shake 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","bottom","left","right"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]=
+(h=="pos"?"-=":"+=")+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery);
+;/*
+ * jQuery UI Effects Slide 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right"],f=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var g=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var e=d.options.distance||(g=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(f=="show")a.css(g,b=="pos"?isNaN(e)?"-"+e:-e:e);
+var i={};i[g]=(f=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+e;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){f=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Transfer 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments);
+b.dequeue()})})}})(jQuery);
+;

js/ui/i18n/jquery.ui.datepicker-af.js

@@ -0,0 +1,23 @@
+/* Afrikaans initialisation for the jQuery UI date picker plugin. */
+/* Written by Renier Pretorius. */
+jQuery(function($){
+	$.datepicker.regional['af'] = {
+		closeText: 'Selekteer',
+		prevText: 'Vorige',
+		nextText: 'Volgende',
+		currentText: 'Vandag',
+		monthNames: ['Januarie','Februarie','Maart','April','Mei','Junie',
+		'Julie','Augustus','September','Oktober','November','Desember'],
+		monthNamesShort: ['Jan', 'Feb', 'Mrt', 'Apr', 'Mei', 'Jun',
+		'Jul', 'Aug', 'Sep', 'Okt', 'Nov', 'Des'],
+		dayNames: ['Sondag', 'Maandag', 'Dinsdag', 'Woensdag', 'Donderdag', 'Vrydag', 'Saterdag'],
+		dayNamesShort: ['Son', 'Maa', 'Din', 'Woe', 'Don', 'Vry', 'Sat'],
+		dayNamesMin: ['So','Ma','Di','Wo','Do','Vr','Sa'],
+		weekHeader: 'Wk',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['af']);
+});

js/ui/i18n/jquery.ui.datepicker-ar-DZ.js

@@ -0,0 +1,23 @@
+/* Algerian Arabic Translation for jQuery UI date picker plugin. (can be used for Tunisia)*/
+/* Mohamed Cherif BOUCHELAGHEM -- cherifbouchelaghem@yahoo.fr */
+
+jQuery(function($){
+	$.datepicker.regional['ar-DZ'] = {
+		closeText: 'إغلاق',
+		prevText: '<السابق',
+		nextText: 'التالي>',
+		currentText: 'اليوم',
+		monthNames: ['جانفي', 'فيفري', 'مارس', 'أفريل', 'ماي', 'جوان',
+		'جويلية', 'أوت', 'سبتمبر','أكتوبر', 'نوفمبر', 'ديسمبر'],
+		monthNamesShort: ['1', '2', '3', '4', '5', '6', '7', '8', '9', '10', '11', '12'],
+		dayNames: ['الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة', 'السبت'],
+		dayNamesShort: ['الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة', 'السبت'],
+		dayNamesMin: ['الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة', 'السبت'],
+		weekHeader: 'أسبوع',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 6,
+  		isRTL: true,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['ar-DZ']);
+});

js/ui/i18n/jquery.ui.datepicker-ar.js

@@ -0,0 +1,23 @@
+/* Arabic Translation for jQuery UI date picker plugin. */
+/* Khaled Alhourani -- me@khaledalhourani.com */
+/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */
+jQuery(function($){
+	$.datepicker.regional['ar'] = {
+		closeText: 'إغلاق',
+		prevText: '<السابق',
+		nextText: 'التالي>',
+		currentText: 'اليوم',
+		monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران',
+		'تموز', 'آب', 'أيلول',	'تشرين الأول', 'تشرين الثاني', 'كانون الأول'],
+		monthNamesShort: ['1', '2', '3', '4', '5', '6', '7', '8', '9', '10', '11', '12'],
+		dayNames: ['الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة', 'السبت'],
+		dayNamesShort: ['الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة', 'السبت'],
+		dayNamesMin: ['الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة', 'السبت'],
+		weekHeader: 'أسبوع',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 6,
+  		isRTL: true,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['ar']);
+});

js/ui/i18n/jquery.ui.datepicker-az.js

@@ -0,0 +1,23 @@
+/* Azerbaijani (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Jamil Najafov (necefov33@gmail.com). */
+jQuery(function($) {
+	$.datepicker.regional['az'] = {
+		closeText: 'Bağla',
+		prevText: '<Geri',
+		nextText: 'İrəli>',
+		currentText: 'Bugün',
+		monthNames: ['Yanvar','Fevral','Mart','Aprel','May','İyun',
+		'İyul','Avqust','Sentyabr','Oktyabr','Noyabr','Dekabr'],
+		monthNamesShort: ['Yan','Fev','Mar','Apr','May','İyun',
+		'İyul','Avq','Sen','Okt','Noy','Dek'],
+		dayNames: ['Bazar','Bazar ertəsi','Çərşənbə axşamı','Çərşənbə','Cümə axşamı','Cümə','Şənbə'],
+		dayNamesShort: ['B','Be','Ça','Ç','Ca','C','Ş'],
+		dayNamesMin: ['B','B','Ç','С','Ç','C','Ş'],
+		weekHeader: 'Hf',
+		dateFormat: 'dd.mm.yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['az']);
+});